From 7b48f4d5f77b65f979b859616dbc3998f713537a Mon Sep 17 00:00:00 2001 From: Francois Perrad Date: Sat, 19 Dec 2015 17:30:38 +0100 Subject: [PATCH 1/7] fix indentation --- src/ciphers/aes/aes.c | 22 ++++---- src/ciphers/anubis.c | 10 ++-- src/ciphers/camellia.c | 4 +- src/ciphers/des.c | 12 ++-- src/ciphers/kseed.c | 52 ++++++++--------- src/ciphers/noekeon.c | 10 ++-- src/ciphers/rc2.c | 42 +++++++------- src/ciphers/safer/safer.c | 23 ++++---- src/ciphers/twofish/twofish.c | 26 ++++----- src/encauth/ccm/ccm_memory.c | 4 +- src/encauth/ccm/ccm_test.c | 6 +- src/encauth/eax/eax_test.c | 4 +- src/encauth/gcm/gcm_add_aad.c | 4 +- src/encauth/gcm/gcm_add_iv.c | 2 +- src/encauth/gcm/gcm_init.c | 4 +- src/encauth/gcm/gcm_process.c | 2 +- src/encauth/ocb/ocb_init.c | 40 ++++++------- src/encauth/ocb3/ocb3_init.c | 56 +++++++++---------- src/hashes/sha2/sha512.c | 20 +++---- src/mac/f9/f9_process.c | 14 ++--- src/mac/pmac/pmac_init.c | 46 +++++++-------- src/mac/pmac/pmac_test.c | 4 +- src/mac/xcbc/xcbc_process.c | 14 ++--- src/modes/cbc/cbc_decrypt.c | 18 +++--- src/modes/cbc/cbc_encrypt.c | 30 +++++----- src/modes/lrw/lrw_start.c | 12 ++-- src/modes/lrw/lrw_test.c | 4 +- src/pk/asn1/der/bit/der_decode_bit_string.c | 4 +- .../asn1/der/bit/der_decode_raw_bit_string.c | 4 +- .../der_decode_object_identifier.c | 44 +++++++-------- .../der_encode_object_identifier.c | 52 ++++++++--------- .../der/sequence/der_decode_sequence_ex.c | 16 +++--- src/pk/asn1/der/set/der_encode_setof.c | 16 +++--- src/pk/dsa/dsa_import.c | 6 +- src/pk/ecc/ltc_ecc_mul2add.c | 14 ++--- src/pk/ecc/ltc_ecc_mulmod_timing.c | 6 +- src/prngs/sober128.c | 20 +++---- 37 files changed, 334 insertions(+), 333 deletions(-) diff --git a/src/ciphers/aes/aes.c b/src/ciphers/aes/aes.c index cc9d99f..2bf7a00 100644 --- a/src/ciphers/aes/aes.c +++ b/src/ciphers/aes/aes.c @@ -675,11 +675,11 @@ int ECB_TEST(void) } }; - symmetric_key key; - unsigned char tmp[2][16]; - int i, y; + symmetric_key key; + unsigned char tmp[2][16]; + int i, y; - for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { + for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { zeromem(&key, sizeof(key)); if ((err = rijndael_setup(tests[i].key, tests[i].keylen, 0, &key)) != CRYPT_OK) { return err; @@ -707,13 +707,13 @@ int ECB_TEST(void) return CRYPT_FAIL_TESTVECTOR; } - /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ - for (y = 0; y < 16; y++) tmp[0][y] = 0; - for (y = 0; y < 1000; y++) rijndael_ecb_encrypt(tmp[0], tmp[0], &key); - for (y = 0; y < 1000; y++) rijndael_ecb_decrypt(tmp[0], tmp[0], &key); - for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; - } - return CRYPT_OK; + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 16; y++) tmp[0][y] = 0; + for (y = 0; y < 1000; y++) rijndael_ecb_encrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 1000; y++) rijndael_ecb_decrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + } + return CRYPT_OK; #endif } diff --git a/src/ciphers/anubis.c b/src/ciphers/anubis.c index c3b3c2f..f819421 100644 --- a/src/ciphers/anubis.c +++ b/src/ciphers/anubis.c @@ -926,16 +926,16 @@ int anubis_setup(const unsigned char *key, int keylen, int num_rounds, symmetri return CRYPT_INVALID_ROUNDS; } - /* - * map cipher key to initial key state (mu): - */ - for (i = 0, pos = 0; i < N; i++, pos += 4) { + /* + * map cipher key to initial key state (mu): + */ + for (i = 0, pos = 0; i < N; i++, pos += 4) { kappa[i] = (((ulong32)key[pos ]) << 24) ^ (((ulong32)key[pos + 1]) << 16) ^ (((ulong32)key[pos + 2]) << 8) ^ (((ulong32)key[pos + 3]) ); - } + } /* * generate R + 1 round keys: diff --git a/src/ciphers/camellia.c b/src/ciphers/camellia.c index 558a585..e791051 100644 --- a/src/ciphers/camellia.c +++ b/src/ciphers/camellia.c @@ -686,8 +686,8 @@ int camellia_test(void) unsigned int x; for (x = 0; x < sizeof(tests)/sizeof(tests[0]); x++) { - zeromem(&skey, sizeof(skey)); - if ((err = camellia_setup(tests[x].key, tests[x].keylen, 0, &skey)) != CRYPT_OK) { + zeromem(&skey, sizeof(skey)); + if ((err = camellia_setup(tests[x].key, tests[x].keylen, 0, &skey)) != CRYPT_OK) { return err; } if ((err = camellia_ecb_encrypt(tests[x].pt, buf[0], &skey)) != CRYPT_OK) { diff --git a/src/ciphers/des.c b/src/ciphers/des.c index fbacf5c..712c1ae 100644 --- a/src/ciphers/des.c +++ b/src/ciphers/des.c @@ -1983,12 +1983,12 @@ int des_test(void) return CRYPT_FAIL_TESTVECTOR; } - /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ - for (y = 0; y < 8; y++) tmp[y] = 0; - for (y = 0; y < 1000; y++) des_ecb_encrypt(tmp, tmp, &des); - for (y = 0; y < 1000; y++) des_ecb_decrypt(tmp, tmp, &des); - for (y = 0; y < 8; y++) if (tmp[y] != 0) return CRYPT_FAIL_TESTVECTOR; -} + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 8; y++) tmp[y] = 0; + for (y = 0; y < 1000; y++) des_ecb_encrypt(tmp, tmp, &des); + for (y = 0; y < 1000; y++) des_ecb_decrypt(tmp, tmp, &des); + for (y = 0; y < 8; y++) if (tmp[y] != 0) return CRYPT_FAIL_TESTVECTOR; + } return CRYPT_OK; #endif diff --git a/src/ciphers/kseed.c b/src/ciphers/kseed.c index 003074c..85b4f8a 100644 --- a/src/ciphers/kseed.c +++ b/src/ciphers/kseed.c @@ -201,41 +201,41 @@ static const ulong32 KCi[16] = { */ int kseed_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) { - int i; - ulong32 tmp, k1, k2, k3, k4; + int i; + ulong32 tmp, k1, k2, k3, k4; - if (keylen != 16) { - return CRYPT_INVALID_KEYSIZE; - } + if (keylen != 16) { + return CRYPT_INVALID_KEYSIZE; + } - if (num_rounds != 16 && num_rounds != 0) { - return CRYPT_INVALID_ROUNDS; - } + if (num_rounds != 16 && num_rounds != 0) { + return CRYPT_INVALID_ROUNDS; + } - /* load key */ - LOAD32H(k1, key); - LOAD32H(k2, key+4); - LOAD32H(k3, key+8); - LOAD32H(k4, key+12); + /* load key */ + LOAD32H(k1, key); + LOAD32H(k2, key+4); + LOAD32H(k3, key+8); + LOAD32H(k4, key+12); - for (i = 0; i < 16; i++) { - skey->kseed.K[2*i+0] = G(k1 + k3 - KCi[i]); - skey->kseed.K[2*i+1] = G(k2 - k4 + KCi[i]); - if (i&1) { - tmp = k3; - k3 = ((k3 << 8) | (k4 >> 24)) & 0xFFFFFFFF; - k4 = ((k4 << 8) | (tmp >> 24)) & 0xFFFFFFFF; - } else { - tmp = k1; - k1 = ((k1 >> 8) | (k2 << 24)) & 0xFFFFFFFF; - k2 = ((k2 >> 8) | (tmp << 24)) & 0xFFFFFFFF; + for (i = 0; i < 16; i++) { + skey->kseed.K[2*i+0] = G(k1 + k3 - KCi[i]); + skey->kseed.K[2*i+1] = G(k2 - k4 + KCi[i]); + if (i&1) { + tmp = k3; + k3 = ((k3 << 8) | (k4 >> 24)) & 0xFFFFFFFF; + k4 = ((k4 << 8) | (tmp >> 24)) & 0xFFFFFFFF; + } else { + tmp = k1; + k1 = ((k1 >> 8) | (k2 << 24)) & 0xFFFFFFFF; + k2 = ((k2 >> 8) | (tmp << 24)) & 0xFFFFFFFF; } /* reverse keys for decrypt */ skey->kseed.dK[2*(15-i)+0] = skey->kseed.K[2*i+0]; skey->kseed.dK[2*(15-i)+1] = skey->kseed.K[2*i+1]; - } + } - return CRYPT_OK; + return CRYPT_OK; } static void rounds(ulong32 *P, ulong32 *K) diff --git a/src/ciphers/noekeon.c b/src/ciphers/noekeon.c index f748d3e..5b8d1c8 100644 --- a/src/ciphers/noekeon.c +++ b/src/ciphers/noekeon.c @@ -303,11 +303,11 @@ int noekeon_test(void) return CRYPT_FAIL_TESTVECTOR; } - /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ - for (y = 0; y < 16; y++) tmp[0][y] = 0; - for (y = 0; y < 1000; y++) noekeon_ecb_encrypt(tmp[0], tmp[0], &key); - for (y = 0; y < 1000; y++) noekeon_ecb_decrypt(tmp[0], tmp[0], &key); - for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 16; y++) tmp[0][y] = 0; + for (y = 0; y < 1000; y++) noekeon_ecb_encrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 1000; y++) noekeon_ecb_decrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; } return CRYPT_OK; #endif diff --git a/src/ciphers/rc2.c b/src/ciphers/rc2.c index dbe5696..a778535 100644 --- a/src/ciphers/rc2.c +++ b/src/ciphers/rc2.c @@ -86,35 +86,35 @@ int rc2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke } for (i = 0; i < keylen; i++) { - tmp[i] = key[i] & 255; + tmp[i] = key[i] & 255; } - /* Phase 1: Expand input key to 128 bytes */ - if (keylen < 128) { - for (i = keylen; i < 128; i++) { - tmp[i] = permute[(tmp[i - 1] + tmp[i - keylen]) & 255]; - } - } + /* Phase 1: Expand input key to 128 bytes */ + if (keylen < 128) { + for (i = keylen; i < 128; i++) { + tmp[i] = permute[(tmp[i - 1] + tmp[i - keylen]) & 255]; + } + } - /* Phase 2 - reduce effective key size to "bits" */ - bits = keylen<<3; - T8 = (unsigned)(bits+7)>>3; - TM = (255 >> (unsigned)(7 & -bits)); - tmp[128 - T8] = permute[tmp[128 - T8] & TM]; - for (i = 127 - T8; i >= 0; i--) { - tmp[i] = permute[tmp[i + 1] ^ tmp[i + T8]]; - } + /* Phase 2 - reduce effective key size to "bits" */ + bits = keylen<<3; + T8 = (unsigned)(bits+7)>>3; + TM = (255 >> (unsigned)(7 & -bits)); + tmp[128 - T8] = permute[tmp[128 - T8] & TM]; + for (i = 127 - T8; i >= 0; i--) { + tmp[i] = permute[tmp[i + 1] ^ tmp[i + T8]]; + } - /* Phase 3 - copy to xkey in little-endian order */ - for (i = 0; i < 64; i++) { - xkey[i] = (unsigned)tmp[2*i] + ((unsigned)tmp[2*i+1] << 8); - } + /* Phase 3 - copy to xkey in little-endian order */ + for (i = 0; i < 64; i++) { + xkey[i] = (unsigned)tmp[2*i] + ((unsigned)tmp[2*i+1] << 8); + } #ifdef LTC_CLEAN_STACK - zeromem(tmp, sizeof(tmp)); + zeromem(tmp, sizeof(tmp)); #endif - return CRYPT_OK; + return CRYPT_OK; } /**********************************************************************\ diff --git a/src/ciphers/safer/safer.c b/src/ciphers/safer/safer.c index 865eee3..85af1f2 100644 --- a/src/ciphers/safer/safer.c +++ b/src/ciphers/safer/safer.c @@ -432,11 +432,11 @@ int safer_sk64_test(void) return CRYPT_FAIL_TESTVECTOR; } - /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ - for (y = 0; y < 8; y++) buf[0][y] = 0; - for (y = 0; y < 1000; y++) safer_ecb_encrypt(buf[0], buf[0], &skey); - for (y = 0; y < 1000; y++) safer_ecb_decrypt(buf[0], buf[0], &skey); - for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 8; y++) buf[0][y] = 0; + for (y = 0; y < 1000; y++) safer_ecb_encrypt(buf[0], buf[0], &skey); + for (y = 0; y < 1000; y++) safer_ecb_decrypt(buf[0], buf[0], &skey); + for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; return CRYPT_OK; #endif @@ -475,12 +475,13 @@ int safer_sk128_test(void) return CRYPT_FAIL_TESTVECTOR; } - /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ - for (y = 0; y < 8; y++) buf[0][y] = 0; - for (y = 0; y < 1000; y++) safer_ecb_encrypt(buf[0], buf[0], &skey); - for (y = 0; y < 1000; y++) safer_ecb_decrypt(buf[0], buf[0], &skey); - for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; - return CRYPT_OK; + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 8; y++) buf[0][y] = 0; + for (y = 0; y < 1000; y++) safer_ecb_encrypt(buf[0], buf[0], &skey); + for (y = 0; y < 1000; y++) safer_ecb_decrypt(buf[0], buf[0], &skey); + for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + + return CRYPT_OK; #endif } diff --git a/src/ciphers/twofish/twofish.c b/src/ciphers/twofish/twofish.c index b443a7c..8db396c 100644 --- a/src/ciphers/twofish/twofish.c +++ b/src/ciphers/twofish/twofish.c @@ -245,7 +245,7 @@ static void h_func(const unsigned char *in, unsigned char *out, unsigned char *M unsigned char y[4]; for (x = 0; x < 4; x++) { y[x] = in[x]; - } + } switch (k) { case 4: y[0] = (unsigned char)(sbox(1, (ulong32)y[0]) ^ M[4 * (6 + offset) + 0]); @@ -504,7 +504,7 @@ int twofish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_ke a = RORc(a ^ (t1 + k[2]), 1); b = ROLc(b, 1) ^ (t2 + t1 + k[3]); k += 4; - } + } /* output with "undo last swap" */ ta = c ^ skey->twofish.K[4]; @@ -646,11 +646,11 @@ int twofish_test(void) }; - symmetric_key key; - unsigned char tmp[2][16]; - int err, i, y; + symmetric_key key; + unsigned char tmp[2][16]; + int err, i, y; - for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { + for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { if ((err = twofish_setup(tests[i].key, tests[i].keylen, 0, &key)) != CRYPT_OK) { return err; } @@ -662,13 +662,13 @@ int twofish_test(void) #endif return CRYPT_FAIL_TESTVECTOR; } - /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ - for (y = 0; y < 16; y++) tmp[0][y] = 0; - for (y = 0; y < 1000; y++) twofish_ecb_encrypt(tmp[0], tmp[0], &key); - for (y = 0; y < 1000; y++) twofish_ecb_decrypt(tmp[0], tmp[0], &key); - for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; - } - return CRYPT_OK; + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 16; y++) tmp[0][y] = 0; + for (y = 0; y < 1000; y++) twofish_ecb_encrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 1000; y++) twofish_ecb_decrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + } + return CRYPT_OK; #endif } diff --git a/src/encauth/ccm/ccm_memory.c b/src/encauth/ccm/ccm_memory.c index f12d212..cac7f46 100644 --- a/src/encauth/ccm/ccm_memory.c +++ b/src/encauth/ccm/ccm_memory.c @@ -283,8 +283,8 @@ int ccm_memory(int cipher, goto error; } } - } - } + } + } #endif for (; y < ptlen; y++) { diff --git a/src/encauth/ccm/ccm_test.c b/src/encauth/ccm/ccm_test.c index 7384151..7d1353a 100644 --- a/src/encauth/ccm/ccm_test.c +++ b/src/encauth/ccm/ccm_test.c @@ -190,9 +190,9 @@ int ccm_test(void) } if (y == 0) { - XMEMCPY(tag3, tests[x].tag, tests[x].taglen); - taglen = tests[x].taglen; - if ((err = ccm_memory(idx, + XMEMCPY(tag3, tests[x].tag, tests[x].taglen); + taglen = tests[x].taglen; + if ((err = ccm_memory(idx, tests[x].key, 16, NULL, tests[x].nonce, tests[x].noncelen, diff --git a/src/encauth/eax/eax_test.c b/src/encauth/eax/eax_test.c index 5babef2..087755e 100644 --- a/src/encauth/eax/eax_test.c +++ b/src/encauth/eax/eax_test.c @@ -270,8 +270,8 @@ int eax_test(void) return CRYPT_FAIL_TESTVECTOR; } - } - return CRYPT_OK; + } + return CRYPT_OK; #endif /* LTC_TEST */ } diff --git a/src/encauth/gcm/gcm_add_aad.c b/src/encauth/gcm/gcm_add_aad.c index f538009..e09981b 100644 --- a/src/encauth/gcm/gcm_add_aad.c +++ b/src/encauth/gcm/gcm_add_aad.c @@ -104,9 +104,9 @@ int gcm_add_aad(gcm_state *gcm, /* start adding AAD data to the state */ for (; x < adatalen; x++) { - gcm->X[gcm->buflen++] ^= *adata++; + gcm->X[gcm->buflen++] ^= *adata++; - if (gcm->buflen == 16) { + if (gcm->buflen == 16) { /* GF mult it */ gcm_mult_h(gcm, gcm->X); gcm->buflen = 0; diff --git a/src/encauth/gcm/gcm_add_iv.c b/src/encauth/gcm/gcm_add_iv.c index 7464f9a..af2b1b8 100644 --- a/src/encauth/gcm/gcm_add_iv.c +++ b/src/encauth/gcm/gcm_add_iv.c @@ -72,7 +72,7 @@ int gcm_add_iv(gcm_state *gcm, for (; x < IVlen; x++) { gcm->buf[gcm->buflen++] = *IV++; - if (gcm->buflen == 16) { + if (gcm->buflen == 16) { /* GF mult it */ for (y = 0; y < 16; y++) { gcm->X[y] ^= gcm->buf[y]; diff --git a/src/encauth/gcm/gcm_init.c b/src/encauth/gcm/gcm_init.c index 8e1c496..2c6a5eb 100644 --- a/src/encauth/gcm/gcm_init.c +++ b/src/encauth/gcm/gcm_init.c @@ -92,8 +92,8 @@ int gcm_init(gcm_state *gcm, int cipher, } gcm->PC[x][y][0] = gcm_shift_table[t<<1]; gcm->PC[x][y][1] ^= gcm_shift_table[(t<<1)+1]; - } - } + } + } #endif diff --git a/src/encauth/gcm/gcm_process.c b/src/encauth/gcm/gcm_process.c index d1f3fd1..54fa1d1 100644 --- a/src/encauth/gcm/gcm_process.c +++ b/src/encauth/gcm/gcm_process.c @@ -118,7 +118,7 @@ int gcm_process(gcm_state *gcm, return err; } } - } + } } #endif diff --git a/src/encauth/ocb/ocb_init.c b/src/encauth/ocb/ocb_init.c index 22b2f46..393f282 100644 --- a/src/encauth/ocb/ocb_init.c +++ b/src/encauth/ocb/ocb_init.c @@ -106,32 +106,32 @@ int ocb_init(ocb_state *ocb, int cipher, ocb->Ls[x][y] ^= polys[poly].poly_mul[y]; } } - } + } - /* find Lr = L / x */ - m = ocb->L[ocb->block_len-1] & 1; + /* find Lr = L / x */ + m = ocb->L[ocb->block_len-1] & 1; - /* shift right */ - for (x = ocb->block_len - 1; x > 0; x--) { - ocb->Lr[x] = ((ocb->L[x] >> 1) | (ocb->L[x-1] << 7)) & 255; - } - ocb->Lr[0] = ocb->L[0] >> 1; + /* shift right */ + for (x = ocb->block_len - 1; x > 0; x--) { + ocb->Lr[x] = ((ocb->L[x] >> 1) | (ocb->L[x-1] << 7)) & 255; + } + ocb->Lr[0] = ocb->L[0] >> 1; - if (m == 1) { - for (x = 0; x < ocb->block_len; x++) { - ocb->Lr[x] ^= polys[poly].poly_div[x]; - } - } + if (m == 1) { + for (x = 0; x < ocb->block_len; x++) { + ocb->Lr[x] ^= polys[poly].poly_div[x]; + } + } - /* set Li, checksum */ - zeromem(ocb->Li, ocb->block_len); - zeromem(ocb->checksum, ocb->block_len); + /* set Li, checksum */ + zeromem(ocb->Li, ocb->block_len); + zeromem(ocb->checksum, ocb->block_len); - /* set other params */ - ocb->block_index = 1; - ocb->cipher = cipher; + /* set other params */ + ocb->block_index = 1; + ocb->cipher = cipher; - return CRYPT_OK; + return CRYPT_OK; } #endif diff --git a/src/encauth/ocb3/ocb3_init.c b/src/encauth/ocb3/ocb3_init.c index 926288b..c73cb96 100644 --- a/src/encauth/ocb3/ocb3_init.c +++ b/src/encauth/ocb3/ocb3_init.c @@ -90,45 +90,45 @@ int ocb3_init(ocb3_state *ocb, int cipher, /* compute L_$, L_0, L_1, ... */ for (x = -1; x < 32; x++) { - if (x == -1) { /* gonna compute: L_$ = double(L_*) */ + if (x == -1) { /* gonna compute: L_$ = double(L_*) */ current = ocb->L_dollar; previous = ocb->L_star; - } - else if (x == 0) { /* gonna compute: L_0 = double(L_$) */ + } + else if (x == 0) { /* gonna compute: L_0 = double(L_$) */ current = ocb->L_[0]; previous = ocb->L_dollar; - } - else { /* gonna compute: L_i = double(L_{i-1}) for every integer i > 0 */ + } + else { /* gonna compute: L_i = double(L_{i-1}) for every integer i > 0 */ current = ocb->L_[x]; previous = ocb->L_[x-1]; - } - m = previous[0] >> 7; - for (y = 0; y < ocb->block_len-1; y++) { - current[y] = ((previous[y] << 1) | (previous[y+1] >> 7)) & 255; - } - current[ocb->block_len-1] = (previous[ocb->block_len-1] << 1) & 255; - if (m == 1) { - /* current[] = current[] XOR polys[poly].poly_mul[]*/ - ocb3_int_xor_blocks(current, current, polys[poly].poly_mul, ocb->block_len); - } - } + } + m = previous[0] >> 7; + for (y = 0; y < ocb->block_len-1; y++) { + current[y] = ((previous[y] << 1) | (previous[y+1] >> 7)) & 255; + } + current[ocb->block_len-1] = (previous[ocb->block_len-1] << 1) & 255; + if (m == 1) { + /* current[] = current[] XOR polys[poly].poly_mul[]*/ + ocb3_int_xor_blocks(current, current, polys[poly].poly_mul, ocb->block_len); + } + } - /* initialize ocb->Offset_current = Offset_0 */ - ocb3_int_calc_offset_zero(ocb, nonce, noncelen); + /* initialize ocb->Offset_current = Offset_0 */ + ocb3_int_calc_offset_zero(ocb, nonce, noncelen); - /* initialize checksum to all zeros */ - zeromem(ocb->checksum, ocb->block_len); + /* initialize checksum to all zeros */ + zeromem(ocb->checksum, ocb->block_len); - /* set block index */ - ocb->block_index = 1; + /* set block index */ + ocb->block_index = 1; - /* initialize AAD related stuff */ - ocb->ablock_index = 1; - ocb->adata_buffer_bytes = 0; - zeromem(ocb->aOffset_current, ocb->block_len); - zeromem(ocb->aSum_current, ocb->block_len); + /* initialize AAD related stuff */ + ocb->ablock_index = 1; + ocb->adata_buffer_bytes = 0; + zeromem(ocb->aOffset_current, ocb->block_len); + zeromem(ocb->aSum_current, ocb->block_len); - return CRYPT_OK; + return CRYPT_OK; } #endif diff --git a/src/hashes/sha2/sha512.c b/src/hashes/sha2/sha512.c index 2d68416..44dd3e0 100644 --- a/src/hashes/sha2/sha512.c +++ b/src/hashes/sha2/sha512.c @@ -135,16 +135,16 @@ static int sha512_compress(hash_state * md, unsigned char *buf) d += t0; \ h = t0 + t1; - for (i = 0; i < 80; i += 8) { - RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0); - RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1); - RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2); - RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3); - RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4); - RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5); - RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6); - RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7); - } + for (i = 0; i < 80; i += 8) { + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7); + } #endif diff --git a/src/mac/f9/f9_process.c b/src/mac/f9/f9_process.c index b7a99f9..420bc4f 100644 --- a/src/mac/f9/f9_process.c +++ b/src/mac/f9/f9_process.c @@ -53,21 +53,21 @@ int f9_process(f9_state *f9, const unsigned char *in, unsigned long inlen) in += f9->blocksize; inlen -= f9->blocksize; } - } + } #endif while (inlen) { - if (f9->buflen == f9->blocksize) { + if (f9->buflen == f9->blocksize) { cipher_descriptor[f9->cipher].ecb_encrypt(f9->IV, f9->IV, &f9->key); for (x = 0; x < f9->blocksize; x++) { f9->ACC[x] ^= f9->IV[x]; } f9->buflen = 0; - } - f9->IV[f9->buflen++] ^= *in++; - --inlen; - } - return CRYPT_OK; + } + f9->IV[f9->buflen++] ^= *in++; + --inlen; + } + return CRYPT_OK; } #endif diff --git a/src/mac/pmac/pmac_init.c b/src/mac/pmac/pmac_init.c index 81b7e85..9a7192c 100644 --- a/src/mac/pmac/pmac_init.c +++ b/src/mac/pmac/pmac_init.c @@ -110,37 +110,37 @@ int pmac_init(pmac_state *pmac, int cipher, const unsigned char *key, unsigned l } } - /* find Lr = L / x */ - m = L[pmac->block_len-1] & 1; + /* find Lr = L / x */ + m = L[pmac->block_len-1] & 1; - /* shift right */ - for (x = pmac->block_len - 1; x > 0; x--) { - pmac->Lr[x] = ((L[x] >> 1) | (L[x-1] << 7)) & 255; - } - pmac->Lr[0] = L[0] >> 1; + /* shift right */ + for (x = pmac->block_len - 1; x > 0; x--) { + pmac->Lr[x] = ((L[x] >> 1) | (L[x-1] << 7)) & 255; + } + pmac->Lr[0] = L[0] >> 1; - if (m == 1) { - for (x = 0; x < pmac->block_len; x++) { - pmac->Lr[x] ^= polys[poly].poly_div[x]; - } - } + if (m == 1) { + for (x = 0; x < pmac->block_len; x++) { + pmac->Lr[x] ^= polys[poly].poly_div[x]; + } + } - /* zero buffer, counters, etc... */ - pmac->block_index = 1; - pmac->cipher_idx = cipher; - pmac->buflen = 0; - zeromem(pmac->block, sizeof(pmac->block)); - zeromem(pmac->Li, sizeof(pmac->Li)); - zeromem(pmac->checksum, sizeof(pmac->checksum)); - err = CRYPT_OK; + /* zero buffer, counters, etc... */ + pmac->block_index = 1; + pmac->cipher_idx = cipher; + pmac->buflen = 0; + zeromem(pmac->block, sizeof(pmac->block)); + zeromem(pmac->Li, sizeof(pmac->Li)); + zeromem(pmac->checksum, sizeof(pmac->checksum)); + err = CRYPT_OK; error: #ifdef LTC_CLEAN_STACK - zeromem(L, pmac->block_len); + zeromem(L, pmac->block_len); #endif - XFREE(L); + XFREE(L); - return err; + return err; } #endif diff --git a/src/mac/pmac/pmac_test.c b/src/mac/pmac/pmac_test.c index 5d2e42a..fe91c64 100644 --- a/src/mac/pmac/pmac_test.c +++ b/src/mac/pmac/pmac_test.c @@ -150,8 +150,8 @@ int pmac_test(void) #endif return CRYPT_FAIL_TESTVECTOR; } - } - return CRYPT_OK; + } + return CRYPT_OK; #endif /* LTC_TEST */ } diff --git a/src/mac/xcbc/xcbc_process.c b/src/mac/xcbc/xcbc_process.c index df5b741..c0798b3 100644 --- a/src/mac/xcbc/xcbc_process.c +++ b/src/mac/xcbc/xcbc_process.c @@ -53,18 +53,18 @@ int xcbc_process(xcbc_state *xcbc, const unsigned char *in, unsigned long inlen) in += xcbc->blocksize; inlen -= xcbc->blocksize; } - } + } #endif while (inlen) { - if (xcbc->buflen == xcbc->blocksize) { + if (xcbc->buflen == xcbc->blocksize) { cipher_descriptor[xcbc->cipher].ecb_encrypt(xcbc->IV, xcbc->IV, &xcbc->key); xcbc->buflen = 0; - } - xcbc->IV[xcbc->buflen++] ^= *in++; - --inlen; - } - return CRYPT_OK; + } + xcbc->IV[xcbc->buflen++] ^= *in++; + --inlen; + } + return CRYPT_OK; } #endif diff --git a/src/modes/cbc/cbc_decrypt.c b/src/modes/cbc/cbc_decrypt.c index d0766ed..fb67cb8 100644 --- a/src/modes/cbc/cbc_decrypt.c +++ b/src/modes/cbc/cbc_decrypt.c @@ -69,17 +69,17 @@ int cbc_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s /* xor IV against plaintext */ #if defined(LTC_FAST) - for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { + for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { tmpy = *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) ^ *((LTC_FAST_TYPE*)((unsigned char *)tmp + x)); - *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) = *((LTC_FAST_TYPE*)((unsigned char *)ct + x)); - *((LTC_FAST_TYPE*)((unsigned char *)pt + x)) = tmpy; - } + *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) = *((LTC_FAST_TYPE*)((unsigned char *)ct + x)); + *((LTC_FAST_TYPE*)((unsigned char *)pt + x)) = tmpy; + } #else - for (x = 0; x < cbc->blocklen; x++) { - tmpy = tmp[x] ^ cbc->IV[x]; - cbc->IV[x] = ct[x]; - pt[x] = tmpy; - } + for (x = 0; x < cbc->blocklen; x++) { + tmpy = tmp[x] ^ cbc->IV[x]; + cbc->IV[x] = ct[x]; + pt[x] = tmpy; + } #endif ct += cbc->blocklen; diff --git a/src/modes/cbc/cbc_encrypt.c b/src/modes/cbc/cbc_encrypt.c index f9c3941..380eb56 100644 --- a/src/modes/cbc/cbc_encrypt.c +++ b/src/modes/cbc/cbc_encrypt.c @@ -58,13 +58,13 @@ int cbc_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s while (len) { /* xor IV against plaintext */ #if defined(LTC_FAST) - for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { + for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) ^= *((LTC_FAST_TYPE*)((unsigned char *)pt + x)); - } + } #else - for (x = 0; x < cbc->blocklen; x++) { - cbc->IV[x] ^= pt[x]; - } + for (x = 0; x < cbc->blocklen; x++) { + cbc->IV[x] ^= pt[x]; + } #endif /* encrypt */ @@ -72,21 +72,21 @@ int cbc_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s return err; } - /* store IV [ciphertext] for a future block */ + /* store IV [ciphertext] for a future block */ #if defined(LTC_FAST) - for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { + for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) = *((LTC_FAST_TYPE*)((unsigned char *)ct + x)); - } + } #else - for (x = 0; x < cbc->blocklen; x++) { - cbc->IV[x] = ct[x]; - } + for (x = 0; x < cbc->blocklen; x++) { + cbc->IV[x] = ct[x]; + } #endif - ct += cbc->blocklen; - pt += cbc->blocklen; - len -= cbc->blocklen; - } + ct += cbc->blocklen; + pt += cbc->blocklen; + len -= cbc->blocklen; + } } return CRYPT_OK; } diff --git a/src/modes/lrw/lrw_start.c b/src/modes/lrw/lrw_start.c index bf9b275..64014d2 100644 --- a/src/modes/lrw/lrw_start.c +++ b/src/modes/lrw/lrw_start.c @@ -41,10 +41,10 @@ int lrw_start( int cipher, int x, y, z, t; #endif - LTC_ARGCHK(IV != NULL); - LTC_ARGCHK(key != NULL); - LTC_ARGCHK(tweak != NULL); - LTC_ARGCHK(lrw != NULL); + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(tweak != NULL); + LTC_ARGCHK(lrw != NULL); #ifdef LTC_FAST if (16 % sizeof(LTC_FAST_TYPE)) { @@ -88,8 +88,8 @@ int lrw_start( int cipher, } lrw->PC[x][y][0] = gcm_shift_table[t<<1]; lrw->PC[x][y][1] ^= gcm_shift_table[(t<<1)+1]; - } - } + } + } #endif /* generate first pad */ diff --git a/src/modes/lrw/lrw_test.c b/src/modes/lrw/lrw_test.c index 63e014a..2c9e076 100644 --- a/src/modes/lrw/lrw_test.c +++ b/src/modes/lrw/lrw_test.c @@ -122,8 +122,8 @@ int lrw_test(void) if ((err = lrw_done(&lrw)) != CRYPT_OK) { return err; } - } - return CRYPT_OK; + } + return CRYPT_OK; #endif } diff --git a/src/pk/asn1/der/bit/der_decode_bit_string.c b/src/pk/asn1/der/bit/der_decode_bit_string.c index bace8c8..d27af9f 100644 --- a/src/pk/asn1/der/bit/der_decode_bit_string.c +++ b/src/pk/asn1/der/bit/der_decode_bit_string.c @@ -45,8 +45,8 @@ int der_decode_bit_string(const unsigned char *in, unsigned long inlen, return CRYPT_INVALID_PACKET; } - /* offset in the data */ - x = 1; + /* offset in the data */ + x = 1; /* get the length of the data */ if (in[x] & 0x80) { diff --git a/src/pk/asn1/der/bit/der_decode_raw_bit_string.c b/src/pk/asn1/der/bit/der_decode_raw_bit_string.c index ee8e9a4..a4a3cb3 100644 --- a/src/pk/asn1/der/bit/der_decode_raw_bit_string.c +++ b/src/pk/asn1/der/bit/der_decode_raw_bit_string.c @@ -47,8 +47,8 @@ int der_decode_raw_bit_string(const unsigned char *in, unsigned long inlen, return CRYPT_INVALID_PACKET; } - /* offset in the data */ - x = 1; + /* offset in the data */ + x = 1; /* get the length of the data */ if (in[x] & 0x80) { diff --git a/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c b/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c index 406acdc..b110908 100644 --- a/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c +++ b/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c @@ -53,14 +53,14 @@ int der_decode_object_identifier(const unsigned char *in, unsigned long inle if (in[x] < 128) { len = in[x++]; } else { - if (in[x] < 0x81 || in[x] > 0x82) { - return CRYPT_INVALID_PACKET; - } - y = in[x++] & 0x7F; - len = 0; - while (y--) { - len = (len << 8) | (unsigned long)in[x++]; - } + if (in[x] < 0x81 || in[x] > 0x82) { + return CRYPT_INVALID_PACKET; + } + y = in[x++] & 0x7F; + len = 0; + while (y--) { + len = (len << 8) | (unsigned long)in[x++]; + } } if (len < 1 || (len + x) > inlen) { @@ -71,21 +71,21 @@ int der_decode_object_identifier(const unsigned char *in, unsigned long inle y = 0; t = 0; while (len--) { - t = (t << 7) | (in[x] & 0x7F); - if (!(in[x++] & 0x80)) { - /* store t */ - if (y >= *outlen) { - return CRYPT_BUFFER_OVERFLOW; - } - if (y == 0) { - words[0] = t / 40; - words[1] = t % 40; - y = 2; - } else { - words[y++] = t; + t = (t << 7) | (in[x] & 0x7F); + if (!(in[x++] & 0x80)) { + /* store t */ + if (y >= *outlen) { + return CRYPT_BUFFER_OVERFLOW; + } + if (y == 0) { + words[0] = t / 40; + words[1] = t % 40; + y = 2; + } else { + words[y++] = t; + } + t = 0; } - t = 0; - } } *outlen = y; diff --git a/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c b/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c index f018ba9..d9ebf8e 100644 --- a/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c +++ b/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c @@ -71,33 +71,33 @@ int der_encode_object_identifier(unsigned long *words, unsigned long nwords, } /* store first byte */ - wordbuf = words[0] * 40 + words[1]; - for (i = 1; i < nwords; i++) { - /* store 7 bit words in little endian */ - t = wordbuf & 0xFFFFFFFF; - if (t) { - y = x; - mask = 0; - while (t) { - out[x++] = (unsigned char)((t & 0x7F) | mask); - t >>= 7; - mask |= 0x80; /* upper bit is set on all but the last byte */ - } - /* now swap bytes y...x-1 */ - z = x - 1; - while (y < z) { - t = out[y]; out[y] = out[z]; out[z] = (unsigned char)t; - ++y; - --z; - } - } else { - /* zero word */ - out[x++] = 0x00; - } + wordbuf = words[0] * 40 + words[1]; + for (i = 1; i < nwords; i++) { + /* store 7 bit words in little endian */ + t = wordbuf & 0xFFFFFFFF; + if (t) { + y = x; + mask = 0; + while (t) { + out[x++] = (unsigned char)((t & 0x7F) | mask); + t >>= 7; + mask |= 0x80; /* upper bit is set on all but the last byte */ + } + /* now swap bytes y...x-1 */ + z = x - 1; + while (y < z) { + t = out[y]; out[y] = out[z]; out[z] = (unsigned char)t; + ++y; + --z; + } + } else { + /* zero word */ + out[x++] = 0x00; + } - if (i < nwords - 1) { - wordbuf = words[i + 1]; - } + if (i < nwords - 1) { + wordbuf = words[i + 1]; + } } *outlen = x; diff --git a/src/pk/asn1/der/sequence/der_decode_sequence_ex.c b/src/pk/asn1/der/sequence/der_decode_sequence_ex.c index 02aec22..d566e22 100644 --- a/src/pk/asn1/der/sequence/der_decode_sequence_ex.c +++ b/src/pk/asn1/der/sequence/der_decode_sequence_ex.c @@ -72,19 +72,19 @@ int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, while (y--) { blksize = (blksize << 8) | (unsigned long)in[x++]; } - } + } - /* would this blksize overflow? */ - if (x + blksize > inlen) { - return CRYPT_INVALID_PACKET; - } + /* would this blksize overflow? */ + if (x + blksize > inlen) { + return CRYPT_INVALID_PACKET; + } /* mark all as unused */ for (i = 0; i < (int)outlen; i++) { list[i].used = 0; } - /* ok read data */ + /* ok read data */ inlen = blksize; for (i = 0; i < (int)outlen; i++) { z = 0; @@ -105,8 +105,8 @@ int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, } if ((err = der_length_boolean(&z)) != CRYPT_OK) { goto LBL_ERR; - } - break; + } + break; case LTC_ASN1_INTEGER: z = inlen; diff --git a/src/pk/asn1/der/set/der_encode_setof.c b/src/pk/asn1/der/set/der_encode_setof.c index 022aca3..8add22b 100644 --- a/src/pk/asn1/der/set/der_encode_setof.c +++ b/src/pk/asn1/der/set/der_encode_setof.c @@ -94,16 +94,16 @@ int der_encode_setof(ltc_asn1_list *list, unsigned long inlen, } /* skip header */ - ptr = buf + 1; + ptr = buf + 1; - /* now skip length data */ - x = *ptr++; - if (x >= 0x80) { - ptr += (x & 0x7F); - } + /* now skip length data */ + x = *ptr++; + if (x >= 0x80) { + ptr += (x & 0x7F); + } - /* get the size of the static header */ - hdrlen = ptr - buf; + /* get the size of the static header */ + hdrlen = ptr - buf; /* scan for edges */ diff --git a/src/pk/dsa/dsa_import.c b/src/pk/dsa/dsa_import.c index 6408303..1793176 100644 --- a/src/pk/dsa/dsa_import.c +++ b/src/pk/dsa/dsa_import.c @@ -95,8 +95,8 @@ int dsa_import(const unsigned char *in, unsigned long inlen, dsa_key *key) tmpbuf = XCALLOC(1, tmpbuf_len); if (tmpbuf == NULL) { - err = CRYPT_MEM; - goto LBL_ERR; + err = CRYPT_MEM; + goto LBL_ERR; } err = der_decode_subject_public_key_info(in, inlen, @@ -112,7 +112,7 @@ int dsa_import(const unsigned char *in, unsigned long inlen, dsa_key *key) XFREE(tmpbuf); key->type = PK_PUBLIC; - } + } LBL_OK: key->qord = mp_unsigned_bin_size(key->q); diff --git a/src/pk/ecc/ltc_ecc_mul2add.c b/src/pk/ecc/ltc_ecc_mul2add.c index de4aac3..8b59320 100644 --- a/src/pk/ecc/ltc_ecc_mul2add.c +++ b/src/pk/ecc/ltc_ecc_mul2add.c @@ -93,16 +93,16 @@ int ltc_ecc_mul2add(ecc_point *A, void *kA, } } - /* init montgomery reduction */ - if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { + /* init montgomery reduction */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto ERR_P; - } - if ((err = mp_init(&mu)) != CRYPT_OK) { + } + if ((err = mp_init(&mu)) != CRYPT_OK) { goto ERR_MP; - } - if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { + } + if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { goto ERR_MU; - } + } /* copy ones ... */ if ((err = mp_mulmod(A->x, mu, modulus, precomp[1]->x)) != CRYPT_OK) { goto ERR_MU; } diff --git a/src/pk/ecc/ltc_ecc_mulmod_timing.c b/src/pk/ecc/ltc_ecc_mulmod_timing.c index ce4d9a4..70182a3 100644 --- a/src/pk/ecc/ltc_ecc_mulmod_timing.c +++ b/src/pk/ecc/ltc_ecc_mulmod_timing.c @@ -61,8 +61,8 @@ int ltc_ecc_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map) return err; } - /* alloc ram for window temps */ - for (i = 0; i < 3; i++) { + /* alloc ram for window temps */ + for (i = 0; i < 3; i++) { M[i] = ltc_ecc_new_point(); if (M[i] == NULL) { for (j = 0; j < i; j++) { @@ -72,7 +72,7 @@ int ltc_ecc_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map) mp_montgomery_free(mp); return CRYPT_MEM; } - } + } /* make a copy of G incase R==G */ tG = ltc_ecc_new_point(); diff --git a/src/prngs/sober128.c b/src/prngs/sober128.c index 25a3b43..33d7f00 100644 --- a/src/prngs/sober128.c +++ b/src/prngs/sober128.c @@ -311,8 +311,8 @@ unsigned long sober128_read(unsigned char *out, unsigned long outlen, prng_state } #ifndef LTC_SMALL_CODE - /* do lots at a time, if there's enough to do */ - while (outlen >= N*4) { + /* do lots at a time, if there's enough to do */ + while (outlen >= N*4) { SROUND(0); SROUND(1); SROUND(2); @@ -332,20 +332,20 @@ unsigned long sober128_read(unsigned char *out, unsigned long outlen, prng_state SROUND(16); out += 4*N; outlen -= 4*N; - } + } #endif - /* do small or odd size buffers the slow way */ - while (4 <= outlen) { + /* do small or odd size buffers the slow way */ + while (4 <= outlen) { cycle(c->R); t = nltap(c); XORWORD(t, out); out += 4; outlen -= 4; - } + } - /* handle any trailing bytes */ - if (outlen != 0) { + /* handle any trailing bytes */ + if (outlen != 0) { cycle(c->R); c->sbuf = nltap(c); c->nbuf = 32; @@ -355,9 +355,9 @@ unsigned long sober128_read(unsigned char *out, unsigned long outlen, prng_state c->nbuf -= 8; --outlen; } - } + } - return tlen; + return tlen; } /** From c22acc2d07bd9258579fc73c08faad055dc089e3 Mon Sep 17 00:00:00 2001 From: Francois Perrad Date: Sat, 19 Dec 2015 17:34:25 +0100 Subject: [PATCH 2/7] remove useless include --- src/pk/asn1/der/sequence/der_decode_sequence_ex.c | 1 - src/pk/asn1/der/sequence/der_encode_sequence_ex.c | 1 - 2 files changed, 2 deletions(-) diff --git a/src/pk/asn1/der/sequence/der_decode_sequence_ex.c b/src/pk/asn1/der/sequence/der_decode_sequence_ex.c index d566e22..8a362b7 100644 --- a/src/pk/asn1/der/sequence/der_decode_sequence_ex.c +++ b/src/pk/asn1/der/sequence/der_decode_sequence_ex.c @@ -9,7 +9,6 @@ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -#include /** diff --git a/src/pk/asn1/der/sequence/der_encode_sequence_ex.c b/src/pk/asn1/der/sequence/der_encode_sequence_ex.c index 677ce53..0f17118 100644 --- a/src/pk/asn1/der/sequence/der_encode_sequence_ex.c +++ b/src/pk/asn1/der/sequence/der_encode_sequence_ex.c @@ -9,7 +9,6 @@ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -#include /** From 9749958fe59abb582e3ed32eea0fbaa9548e278d Mon Sep 17 00:00:00 2001 From: Francois Perrad Date: Sat, 19 Dec 2015 17:51:44 +0100 Subject: [PATCH 3/7] the comment FALLTHROUGH is common for several lint tool --- src/ciphers/multi2.c | 6 +++--- src/ciphers/twofish/twofish.c | 3 +++ src/misc/adler32.c | 8 ++++---- 3 files changed, 10 insertions(+), 7 deletions(-) diff --git a/src/ciphers/multi2.c b/src/ciphers/multi2.c index d1e4a6c..d77c9a6 100644 --- a/src/ciphers/multi2.c +++ b/src/ciphers/multi2.c @@ -96,9 +96,9 @@ static void decrypt(ulong32 *p, int N, ulong32 *uk) int n, t; for (t = 4*(((N-1)>>2)&1), n = N; ; ) { switch (n<=4 ? n : ((n-1)%4)+1) { - case 4: pi4(p, uk+t); --n; - case 3: pi3(p, uk+t); --n; - case 2: pi2(p, uk+t); --n; + case 4: pi4(p, uk+t); --n; /* FALLTHROUGH */ + case 3: pi3(p, uk+t); --n; /* FALLTHROUGH */ + case 2: pi2(p, uk+t); --n; /* FALLTHROUGH */ case 1: pi1(p); --n; break; case 0: return; } diff --git a/src/ciphers/twofish/twofish.c b/src/ciphers/twofish/twofish.c index 8db396c..b2b41bb 100644 --- a/src/ciphers/twofish/twofish.c +++ b/src/ciphers/twofish/twofish.c @@ -252,16 +252,19 @@ static void h_func(const unsigned char *in, unsigned char *out, unsigned char *M y[1] = (unsigned char)(sbox(0, (ulong32)y[1]) ^ M[4 * (6 + offset) + 1]); y[2] = (unsigned char)(sbox(0, (ulong32)y[2]) ^ M[4 * (6 + offset) + 2]); y[3] = (unsigned char)(sbox(1, (ulong32)y[3]) ^ M[4 * (6 + offset) + 3]); + /* FALLTHROUGH */ case 3: y[0] = (unsigned char)(sbox(1, (ulong32)y[0]) ^ M[4 * (4 + offset) + 0]); y[1] = (unsigned char)(sbox(1, (ulong32)y[1]) ^ M[4 * (4 + offset) + 1]); y[2] = (unsigned char)(sbox(0, (ulong32)y[2]) ^ M[4 * (4 + offset) + 2]); y[3] = (unsigned char)(sbox(0, (ulong32)y[3]) ^ M[4 * (4 + offset) + 3]); + /* FALLTHROUGH */ case 2: y[0] = (unsigned char)(sbox(1, sbox(0, sbox(0, (ulong32)y[0]) ^ M[4 * (2 + offset) + 0]) ^ M[4 * (0 + offset) + 0])); y[1] = (unsigned char)(sbox(0, sbox(0, sbox(1, (ulong32)y[1]) ^ M[4 * (2 + offset) + 1]) ^ M[4 * (0 + offset) + 1])); y[2] = (unsigned char)(sbox(1, sbox(1, sbox(0, (ulong32)y[2]) ^ M[4 * (2 + offset) + 2]) ^ M[4 * (0 + offset) + 2])); y[3] = (unsigned char)(sbox(0, sbox(1, sbox(1, (ulong32)y[3]) ^ M[4 * (2 + offset) + 3]) ^ M[4 * (0 + offset) + 3])); + /* FALLTHROUGH */ } mds_mult(y, out); } diff --git a/src/misc/adler32.c b/src/misc/adler32.c index 3e6f4e5..48f404c 100644 --- a/src/misc/adler32.c +++ b/src/misc/adler32.c @@ -89,16 +89,16 @@ void adler32_finish(adler32_state *ctx, void *hash, unsigned long size) switch (size) { default: h[3] = ctx->s[0] & 0x0ff; - /* no break */ + /* FALLTHROUGH */ case 3: h[2] = (ctx->s[0] >> 8) & 0x0ff; - /* no break */ + /* FALLTHROUGH */ case 2: h[1] = ctx->s[1] & 0x0ff; - /* no break */ + /* FALLTHROUGH */ case 1: h[0] = (ctx->s[1] >> 8) & 0x0ff; - /* no break */ + /* FALLTHROUGH */ case 0: ; } From cebf33cdcedde158d3977cc14d42017450ac6b7a Mon Sep 17 00:00:00 2001 From: Francois Perrad Date: Sat, 19 Dec 2015 17:52:30 +0100 Subject: [PATCH 4/7] add some const --- src/ciphers/camellia.c | 2 +- src/misc/base64/base64_encode.c | 4 ++-- src/misc/error_to_string.c | 2 +- src/pk/asn1/der/utctime/der_encode_utctime.c | 2 +- 4 files changed, 5 insertions(+), 5 deletions(-) diff --git a/src/ciphers/camellia.c b/src/ciphers/camellia.c index e791051..ad8f501 100644 --- a/src/ciphers/camellia.c +++ b/src/ciphers/camellia.c @@ -171,7 +171,7 @@ static const ulong32 SP4404[] = { 0x28280028, 0x7b7b007b, 0xc9c900c9, 0xc1c100c1, 0xe3e300e3, 0xf4f400f4, 0xc7c700c7, 0x9e9e009e, }; -static ulong64 key_sigma[] = { +static const ulong64 key_sigma[] = { CONST64(0xA09E667F3BCC908B), CONST64(0xB67AE8584CAA73B2), CONST64(0xC6EF372FE94F82BE), diff --git a/src/misc/base64/base64_encode.c b/src/misc/base64/base64_encode.c index 0e1a7c1..0ed0aa3 100644 --- a/src/misc/base64/base64_encode.c +++ b/src/misc/base64/base64_encode.c @@ -20,12 +20,12 @@ #if defined(LTC_BASE64) || defined (LTC_BASE64_URL) #if defined(LTC_BASE64) -static const char *codes_base64 = +static const char * const codes_base64 = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"; #endif /* LTC_BASE64 */ #if defined(LTC_BASE64_URL) -static const char *codes_base64url = +static const char * const codes_base64url = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789-_"; #endif /* LTC_BASE64_URL */ diff --git a/src/misc/error_to_string.c b/src/misc/error_to_string.c index 19f8781..7ebd898 100644 --- a/src/misc/error_to_string.c +++ b/src/misc/error_to_string.c @@ -16,7 +16,7 @@ Convert error codes to ASCII strings, Tom St Denis */ -static const char *err_2_str[] = +static const char * const err_2_str[] = { "CRYPT_OK", "CRYPT_ERROR", diff --git a/src/pk/asn1/der/utctime/der_encode_utctime.c b/src/pk/asn1/der/utctime/der_encode_utctime.c index f8d0c56..0dcac8a 100644 --- a/src/pk/asn1/der/utctime/der_encode_utctime.c +++ b/src/pk/asn1/der/utctime/der_encode_utctime.c @@ -17,7 +17,7 @@ #ifdef LTC_DER -static const char *baseten = "0123456789"; +static const char * const baseten = "0123456789"; #define STORE_V(y) \ out[x++] = der_ia5_char_encode(baseten[(y/10) % 10]); \ From 9f8df116bee3b8f2b64e5b131f3ec636fb14a5cc Mon Sep 17 00:00:00 2001 From: Francois Perrad Date: Sat, 19 Dec 2015 17:53:07 +0100 Subject: [PATCH 5/7] remove useless code --- src/prngs/rng_get_bytes.c | 1 - 1 file changed, 1 deletion(-) diff --git a/src/prngs/rng_get_bytes.c b/src/prngs/rng_get_bytes.c index 19c8a78..f0536f6 100644 --- a/src/prngs/rng_get_bytes.c +++ b/src/prngs/rng_get_bytes.c @@ -80,7 +80,6 @@ static unsigned long rng_ansic(unsigned char *buf, unsigned long len, acc = 0; bits = 8; } - acc = bits = a = b = 0; return l; } From 5d7036ebe2b458bbbcc2b3d1039e8021a9e1f253 Mon Sep 17 00:00:00 2001 From: Francois Perrad Date: Sun, 20 Dec 2015 17:01:18 +0100 Subject: [PATCH 6/7] remove hard tab --- src/encauth/ccm/ccm_add_nonce.c | 4 +- src/encauth/ocb3/ocb3_test.c | 256 ++++++++++++++++---------------- src/headers/tomcrypt_hash.h | 2 +- src/headers/tomcrypt_pk.h | 4 +- src/math/fp/ltc_ecc_fp_mulmod.c | 12 +- src/pk/dh/dh.c | 8 +- 6 files changed, 143 insertions(+), 143 deletions(-) diff --git a/src/encauth/ccm/ccm_add_nonce.c b/src/encauth/ccm/ccm_add_nonce.c index fc4eafc..0f67fc2 100644 --- a/src/encauth/ccm/ccm_add_nonce.c +++ b/src/encauth/ccm/ccm_add_nonce.c @@ -42,8 +42,8 @@ int ccm_add_nonce(ccm_state *ccm, /* form B_0 == flags | Nonce N | l(m) */ x = 0; ccm->PAD[x++] = (unsigned char)(((ccm->aadlen > 0) ? (1<<6) : 0) | - (((ccm->taglen - 2)>>1)<<3) | - (ccm->L-1)); + (((ccm->taglen - 2)>>1)<<3) | + (ccm->L-1)); /* nonce */ for (y = 0; y < (16 - (ccm->L + 1)); y++) { diff --git a/src/encauth/ocb3/ocb3_test.c b/src/encauth/ocb3/ocb3_test.c index ae0069c..d59d005 100644 --- a/src/encauth/ocb3/ocb3_test.c +++ b/src/encauth/ocb3/ocb3_test.c @@ -35,134 +35,134 @@ int ocb3_test(void) unsigned char pt[64], aad[64], ct[64], tag[16]; } tests[] = { - { /* index:0 */ - 0, /* PLAINTEXT length */ - 0, /* AAD length */ - { }, /* PLAINTEXT */ - { }, /* AAD */ - { }, /* CIPHERTEXT */ - { 0x19,0x7b,0x9c,0x3c,0x44,0x1d,0x3c,0x83,0xea,0xfb,0x2b,0xef,0x63,0x3b,0x91,0x82 }, /* TAG */ - }, - { /* index:1 */ - 8, /* PLAINTEXT length */ - 8, /* AAD length */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, /* PLAINTEXT */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, /* AAD */ - { 0x92,0xb6,0x57,0x13,0x0a,0x74,0xb8,0x5a }, /* CIPHERTEXT */ - { 0x16,0xdc,0x76,0xa4,0x6d,0x47,0xe1,0xea,0xd5,0x37,0x20,0x9e,0x8a,0x96,0xd1,0x4e }, /* TAG */ - }, - { /* index:2 */ - 0, /* PLAINTEXT length */ - 8, /* AAD length */ - { }, /* PLAINTEXT */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, /* AAD */ - { }, /* CIPHERTEXT */ - { 0x98,0xb9,0x15,0x52,0xc8,0xc0,0x09,0x18,0x50,0x44,0xe3,0x0a,0x6e,0xb2,0xfe,0x21 }, /* TAG */ - }, - { /* index:3 */ - 8, /* PLAINTEXT length */ - 0, /* AAD length */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, /* PLAINTEXT */ - { }, /* AAD */ - { 0x92,0xb6,0x57,0x13,0x0a,0x74,0xb8,0x5a }, /* CIPHERTEXT */ - { 0x97,0x1e,0xff,0xca,0xe1,0x9a,0xd4,0x71,0x6f,0x88,0xe8,0x7b,0x87,0x1f,0xbe,0xed }, /* TAG */ - }, - { /* index:4 */ - 16, /* PLAINTEXT length */ - 16, /* AAD length */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, /* PLAINTEXT */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, /* AAD */ - { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22 }, /* CIPHERTEXT */ - { 0x77,0x6c,0x99,0x24,0xd6,0x72,0x3a,0x1f,0xc4,0x52,0x45,0x32,0xac,0x3e,0x5b,0xeb }, /* TAG */ - }, - { /* index:5 */ - 0, /* PLAINTEXT length */ - 16, /* AAD length */ - { }, /* PLAINTEXT */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, /* AAD */ - { }, /* CIPHERTEXT */ - { 0x7d,0xdb,0x8e,0x6c,0xea,0x68,0x14,0x86,0x62,0x12,0x50,0x96,0x19,0xb1,0x9c,0xc6 }, /* TAG */ - }, - { /* index:6 */ - 16, /* PLAINTEXT length */ - 0, /* AAD length */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, /* PLAINTEXT */ - { }, /* AAD */ - { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22 }, /* CIPHERTEXT */ - { 0x13,0xcc,0x8b,0x74,0x78,0x07,0x12,0x1a,0x4c,0xbb,0x3e,0x4b,0xd6,0xb4,0x56,0xaf }, /* TAG */ - }, - { /* index:7 */ - 24, /* PLAINTEXT length */ - 24, /* AAD length */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17 }, /* PLAINTEXT */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17 }, /* AAD */ - { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xfc,0xfc,0xee,0x7a,0x2a,0x8d,0x4d,0x48 }, /* CIPHERTEXT */ - { 0x5f,0xa9,0x4f,0xc3,0xf3,0x88,0x20,0xf1,0xdc,0x3f,0x3d,0x1f,0xd4,0xe5,0x5e,0x1c }, /* TAG */ - }, - { /* index:8 */ - 0, /* PLAINTEXT length */ - 24, /* AAD length */ - { }, /* PLAINTEXT */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17 }, /* AAD */ - { }, /* CIPHERTEXT */ - { 0x28,0x20,0x26,0xda,0x30,0x68,0xbc,0x9f,0xa1,0x18,0x68,0x1d,0x55,0x9f,0x10,0xf6 }, /* TAG */ - }, - { /* index:9 */ - 24, /* PLAINTEXT length */ - 0, /* AAD length */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17 }, /* PLAINTEXT */ - { }, /* AAD */ - { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xfc,0xfc,0xee,0x7a,0x2a,0x8d,0x4d,0x48 }, /* CIPHERTEXT */ - { 0x6e,0xf2,0xf5,0x25,0x87,0xfd,0xa0,0xed,0x97,0xdc,0x7e,0xed,0xe2,0x41,0xdf,0x68 }, /* TAG */ - }, - { /* index:10 */ - 32, /* PLAINTEXT length */ - 32, /* AAD length */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f }, /* PLAINTEXT */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f }, /* AAD */ - { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xce,0xaa,0xb9,0xb0,0x5d,0xf7,0x71,0xa6,0x57,0x14,0x9d,0x53,0x77,0x34,0x63,0xcb }, /* CIPHERTEXT */ - { 0xb2,0xa0,0x40,0xdd,0x3b,0xd5,0x16,0x43,0x72,0xd7,0x6d,0x7b,0xb6,0x82,0x42,0x40 }, /* TAG */ - }, - { /* index:11 */ - 0, /* PLAINTEXT length */ - 32, /* AAD length */ - { }, /* PLAINTEXT */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f }, /* AAD */ - { }, /* CIPHERTEXT */ - { 0xe1,0xe0,0x72,0x63,0x3b,0xad,0xe5,0x1a,0x60,0xe8,0x59,0x51,0xd9,0xc4,0x2a,0x1b }, /* TAG */ - }, - { /* index:12 */ - 32, /* PLAINTEXT length */ - 0, /* AAD length */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f }, /* PLAINTEXT */ - { }, /* AAD */ - { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xce,0xaa,0xb9,0xb0,0x5d,0xf7,0x71,0xa6,0x57,0x14,0x9d,0x53,0x77,0x34,0x63,0xcb }, /* CIPHERTEXT */ - { 0x4a,0x3b,0xae,0x82,0x44,0x65,0xcf,0xda,0xf8,0xc4,0x1f,0xc5,0x0c,0x7d,0xf9,0xd9 }, /* TAG */ - }, - { /* index:13 */ - 40, /* PLAINTEXT length */ - 40, /* AAD length */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }, /* PLAINTEXT */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }, /* AAD */ - { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xce,0xaa,0xb9,0xb0,0x5d,0xf7,0x71,0xa6,0x57,0x14,0x9d,0x53,0x77,0x34,0x63,0xcb,0x68,0xc6,0x57,0x78,0xb0,0x58,0xa6,0x35 }, /* CIPHERTEXT */ - { 0x65,0x9c,0x62,0x32,0x11,0xde,0xea,0x0d,0xe3,0x0d,0x2c,0x38,0x18,0x79,0xf4,0xc8 }, /* TAG */ - }, - { /* index:14 */ - 0, /* PLAINTEXT length */ - 40, /* AAD length */ - { }, /* PLAINTEXT */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }, /* AAD */ - { }, /* CIPHERTEXT */ - { 0x7a,0xeb,0x7a,0x69,0xa1,0x68,0x7d,0xd0,0x82,0xca,0x27,0xb0,0xd9,0xa3,0x70,0x96 }, /* TAG */ - }, - { /* index:15 */ - 40, /* PLAINTEXT length */ - 0, /* AAD length */ - { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }, /* PLAINTEXT */ - { }, /* AAD */ - { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xce,0xaa,0xb9,0xb0,0x5d,0xf7,0x71,0xa6,0x57,0x14,0x9d,0x53,0x77,0x34,0x63,0xcb,0x68,0xc6,0x57,0x78,0xb0,0x58,0xa6,0x35 }, /* CIPHERTEXT */ - { 0x06,0x0c,0x84,0x67,0xf4,0xab,0xab,0x5e,0x8b,0x3c,0x20,0x67,0xa2,0xe1,0x15,0xdc }, /* TAG */ - }, + { /* index:0 */ + 0, /* PLAINTEXT length */ + 0, /* AAD length */ + { }, /* PLAINTEXT */ + { }, /* AAD */ + { }, /* CIPHERTEXT */ + { 0x19,0x7b,0x9c,0x3c,0x44,0x1d,0x3c,0x83,0xea,0xfb,0x2b,0xef,0x63,0x3b,0x91,0x82 }, /* TAG */ + }, + { /* index:1 */ + 8, /* PLAINTEXT length */ + 8, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, /* AAD */ + { 0x92,0xb6,0x57,0x13,0x0a,0x74,0xb8,0x5a }, /* CIPHERTEXT */ + { 0x16,0xdc,0x76,0xa4,0x6d,0x47,0xe1,0xea,0xd5,0x37,0x20,0x9e,0x8a,0x96,0xd1,0x4e }, /* TAG */ + }, + { /* index:2 */ + 0, /* PLAINTEXT length */ + 8, /* AAD length */ + { }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, /* AAD */ + { }, /* CIPHERTEXT */ + { 0x98,0xb9,0x15,0x52,0xc8,0xc0,0x09,0x18,0x50,0x44,0xe3,0x0a,0x6e,0xb2,0xfe,0x21 }, /* TAG */ + }, + { /* index:3 */ + 8, /* PLAINTEXT length */ + 0, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, /* PLAINTEXT */ + { }, /* AAD */ + { 0x92,0xb6,0x57,0x13,0x0a,0x74,0xb8,0x5a }, /* CIPHERTEXT */ + { 0x97,0x1e,0xff,0xca,0xe1,0x9a,0xd4,0x71,0x6f,0x88,0xe8,0x7b,0x87,0x1f,0xbe,0xed }, /* TAG */ + }, + { /* index:4 */ + 16, /* PLAINTEXT length */ + 16, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, /* AAD */ + { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22 }, /* CIPHERTEXT */ + { 0x77,0x6c,0x99,0x24,0xd6,0x72,0x3a,0x1f,0xc4,0x52,0x45,0x32,0xac,0x3e,0x5b,0xeb }, /* TAG */ + }, + { /* index:5 */ + 0, /* PLAINTEXT length */ + 16, /* AAD length */ + { }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, /* AAD */ + { }, /* CIPHERTEXT */ + { 0x7d,0xdb,0x8e,0x6c,0xea,0x68,0x14,0x86,0x62,0x12,0x50,0x96,0x19,0xb1,0x9c,0xc6 }, /* TAG */ + }, + { /* index:6 */ + 16, /* PLAINTEXT length */ + 0, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, /* PLAINTEXT */ + { }, /* AAD */ + { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22 }, /* CIPHERTEXT */ + { 0x13,0xcc,0x8b,0x74,0x78,0x07,0x12,0x1a,0x4c,0xbb,0x3e,0x4b,0xd6,0xb4,0x56,0xaf }, /* TAG */ + }, + { /* index:7 */ + 24, /* PLAINTEXT length */ + 24, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17 }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17 }, /* AAD */ + { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xfc,0xfc,0xee,0x7a,0x2a,0x8d,0x4d,0x48 }, /* CIPHERTEXT */ + { 0x5f,0xa9,0x4f,0xc3,0xf3,0x88,0x20,0xf1,0xdc,0x3f,0x3d,0x1f,0xd4,0xe5,0x5e,0x1c }, /* TAG */ + }, + { /* index:8 */ + 0, /* PLAINTEXT length */ + 24, /* AAD length */ + { }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17 }, /* AAD */ + { }, /* CIPHERTEXT */ + { 0x28,0x20,0x26,0xda,0x30,0x68,0xbc,0x9f,0xa1,0x18,0x68,0x1d,0x55,0x9f,0x10,0xf6 }, /* TAG */ + }, + { /* index:9 */ + 24, /* PLAINTEXT length */ + 0, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17 }, /* PLAINTEXT */ + { }, /* AAD */ + { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xfc,0xfc,0xee,0x7a,0x2a,0x8d,0x4d,0x48 }, /* CIPHERTEXT */ + { 0x6e,0xf2,0xf5,0x25,0x87,0xfd,0xa0,0xed,0x97,0xdc,0x7e,0xed,0xe2,0x41,0xdf,0x68 }, /* TAG */ + }, + { /* index:10 */ + 32, /* PLAINTEXT length */ + 32, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f }, /* AAD */ + { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xce,0xaa,0xb9,0xb0,0x5d,0xf7,0x71,0xa6,0x57,0x14,0x9d,0x53,0x77,0x34,0x63,0xcb }, /* CIPHERTEXT */ + { 0xb2,0xa0,0x40,0xdd,0x3b,0xd5,0x16,0x43,0x72,0xd7,0x6d,0x7b,0xb6,0x82,0x42,0x40 }, /* TAG */ + }, + { /* index:11 */ + 0, /* PLAINTEXT length */ + 32, /* AAD length */ + { }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f }, /* AAD */ + { }, /* CIPHERTEXT */ + { 0xe1,0xe0,0x72,0x63,0x3b,0xad,0xe5,0x1a,0x60,0xe8,0x59,0x51,0xd9,0xc4,0x2a,0x1b }, /* TAG */ + }, + { /* index:12 */ + 32, /* PLAINTEXT length */ + 0, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f }, /* PLAINTEXT */ + { }, /* AAD */ + { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xce,0xaa,0xb9,0xb0,0x5d,0xf7,0x71,0xa6,0x57,0x14,0x9d,0x53,0x77,0x34,0x63,0xcb }, /* CIPHERTEXT */ + { 0x4a,0x3b,0xae,0x82,0x44,0x65,0xcf,0xda,0xf8,0xc4,0x1f,0xc5,0x0c,0x7d,0xf9,0xd9 }, /* TAG */ + }, + { /* index:13 */ + 40, /* PLAINTEXT length */ + 40, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }, /* AAD */ + { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xce,0xaa,0xb9,0xb0,0x5d,0xf7,0x71,0xa6,0x57,0x14,0x9d,0x53,0x77,0x34,0x63,0xcb,0x68,0xc6,0x57,0x78,0xb0,0x58,0xa6,0x35 }, /* CIPHERTEXT */ + { 0x65,0x9c,0x62,0x32,0x11,0xde,0xea,0x0d,0xe3,0x0d,0x2c,0x38,0x18,0x79,0xf4,0xc8 }, /* TAG */ + }, + { /* index:14 */ + 0, /* PLAINTEXT length */ + 40, /* AAD length */ + { }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }, /* AAD */ + { }, /* CIPHERTEXT */ + { 0x7a,0xeb,0x7a,0x69,0xa1,0x68,0x7d,0xd0,0x82,0xca,0x27,0xb0,0xd9,0xa3,0x70,0x96 }, /* TAG */ + }, + { /* index:15 */ + 40, /* PLAINTEXT length */ + 0, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }, /* PLAINTEXT */ + { }, /* AAD */ + { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xce,0xaa,0xb9,0xb0,0x5d,0xf7,0x71,0xa6,0x57,0x14,0x9d,0x53,0x77,0x34,0x63,0xcb,0x68,0xc6,0x57,0x78,0xb0,0x58,0xa6,0x35 }, /* CIPHERTEXT */ + { 0x06,0x0c,0x84,0x67,0xf4,0xab,0xab,0x5e,0x8b,0x3c,0x20,0x67,0xa2,0xe1,0x15,0xdc }, /* TAG */ + }, }; diff --git a/src/headers/tomcrypt_hash.h b/src/headers/tomcrypt_hash.h index c5a4d81..22b922e 100644 --- a/src/headers/tomcrypt_hash.h +++ b/src/headers/tomcrypt_hash.h @@ -373,7 +373,7 @@ int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) if (md-> state_var .curlen > sizeof(md-> state_var .buf)) { \ return CRYPT_INVALID_ARG; \ } \ - if ((md-> state_var .length + inlen) < md-> state_var .length) { \ + if ((md-> state_var .length + inlen) < md-> state_var .length) { \ return CRYPT_HASH_OVERFLOW; \ } \ while (inlen > 0) { \ diff --git a/src/headers/tomcrypt_pk.h b/src/headers/tomcrypt_pk.h index 1366931..c457ce8 100644 --- a/src/headers/tomcrypt_pk.h +++ b/src/headers/tomcrypt_pk.h @@ -261,8 +261,8 @@ typedef struct { /** Index into the ltc_ecc_sets[] for the parameters of this curve; if -1, then this key is using user supplied curve in dp */ int idx; - /** pointer to domain parameters; either points to NIST curves (identified by idx >= 0) or user supplied curve */ - const ltc_ecc_set_type *dp; + /** pointer to domain parameters; either points to NIST curves (identified by idx >= 0) or user supplied curve */ + const ltc_ecc_set_type *dp; /** The public key */ ecc_point pubkey; diff --git a/src/math/fp/ltc_ecc_fp_mulmod.c b/src/math/fp/ltc_ecc_fp_mulmod.c index b9819e3..87c128f 100644 --- a/src/math/fp/ltc_ecc_fp_mulmod.c +++ b/src/math/fp/ltc_ecc_fp_mulmod.c @@ -1363,7 +1363,7 @@ ltc_ecc_fp_add_point(ecc_point *g, void *modulus, int lock) if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { goto LBL_ERR; } - + /* build the LUT */ if ((err = build_lut(idx, modulus, mp, mu)) != CRYPT_OK) { goto LBL_ERR; @@ -1429,9 +1429,9 @@ int ltc_ecc_fp_save_state(unsigned char **out, unsigned long *outlen) * */ /* - * The cache itself is a point (3 INTEGERS), - * the LUT as pairs of INTEGERS (2 * 1<x ) { - mp_clear( key->x ); - key->x = NULL; + mp_clear( key->x ); + key->x = NULL; } if ( key->y ) { - mp_clear( key->y ); - key->y = NULL; + mp_clear( key->y ); + key->y = NULL; } } From 58353f51e2949d9c7009f8231cc55357cc42ac9c Mon Sep 17 00:00:00 2001 From: Francois Perrad Date: Sun, 20 Dec 2015 17:05:58 +0100 Subject: [PATCH 7/7] remove trailing spaces --- src/encauth/ccm/ccm_test.c | 2 +- src/encauth/eax/eax_addheader.c | 10 +- src/encauth/eax/eax_decrypt.c | 8 +- src/encauth/eax/eax_decrypt_verify_memory.c | 4 +- src/encauth/eax/eax_done.c | 4 +- src/encauth/eax/eax_encrypt.c | 6 +- .../eax/eax_encrypt_authenticate_memory.c | 10 +- src/encauth/eax/eax_init.c | 32 +- src/encauth/eax/eax_test.c | 26 +- src/encauth/gcm/gcm_done.c | 2 +- src/encauth/gcm/gcm_gf_mult.c | 18 +- src/encauth/gcm/gcm_init.c | 2 +- src/encauth/gcm/gcm_memory.c | 8 +- src/encauth/gcm/gcm_reset.c | 2 +- src/encauth/gcm/gcm_test.c | 196 +-- src/encauth/ocb/ocb_decrypt.c | 4 +- src/encauth/ocb/ocb_decrypt_verify_memory.c | 12 +- src/encauth/ocb/ocb_done_decrypt.c | 6 +- src/encauth/ocb/ocb_done_encrypt.c | 4 +- src/encauth/ocb/ocb_encrypt.c | 2 +- .../ocb/ocb_encrypt_authenticate_memory.c | 4 +- src/encauth/ocb/ocb_init.c | 12 +- src/encauth/ocb/ocb_shift_xor.c | 4 +- src/encauth/ocb/ocb_test.c | 26 +- src/encauth/ocb/s_ocb_done.c | 16 +- src/hashes/helper/hash_file.c | 4 +- src/hashes/helper/hash_filehandle.c | 6 +- src/hashes/md2.c | 18 +- src/hashes/md4.c | 136 +- src/hashes/md5.c | 30 +- src/hashes/rmd128.c | 22 +- src/hashes/rmd160.c | 18 +- src/hashes/sha1.c | 18 +- src/hashes/sha2/sha256.c | 30 +- src/hashes/sha2/sha512.c | 52 +- src/hashes/tiger.c | 68 +- src/mac/f9/f9_done.c | 2 +- src/mac/f9/f9_file.c | 4 +- src/mac/f9/f9_init.c | 4 +- src/mac/f9/f9_memory.c | 4 +- src/mac/f9/f9_memory_multi.c | 10 +- src/mac/f9/f9_test.c | 4 +- src/mac/pelican/pelican_memory.c | 10 +- src/mac/pelican/pelican_test.c | 18 +- src/mac/pmac/pmac_done.c | 4 +- src/mac/pmac/pmac_file.c | 10 +- src/mac/pmac/pmac_memory.c | 10 +- src/mac/pmac/pmac_memory_multi.c | 12 +- src/mac/pmac/pmac_ntz.c | 4 +- src/mac/pmac/pmac_shift_xor.c | 4 +- src/mac/pmac/pmac_test.c | 14 +- src/mac/xcbc/xcbc_done.c | 2 +- src/mac/xcbc/xcbc_file.c | 6 +- src/mac/xcbc/xcbc_init.c | 8 +- src/mac/xcbc/xcbc_memory.c | 4 +- src/mac/xcbc/xcbc_memory_multi.c | 10 +- src/mac/xcbc/xcbc_test.c | 32 +- src/math/fp/ltc_ecc_fp_mulmod.c | 1258 ++++++++--------- src/math/rand_prime.c | 12 +- src/misc/crypt/crypt_find_cipher_any.c | 2 +- src/misc/crypt/crypt_find_hash_any.c | 2 +- src/misc/crypt/crypt_fsa.c | 6 +- src/misc/crypt/crypt_hash_descriptor.c | 2 +- src/misc/crypt/crypt_hash_is_valid.c | 2 +- src/misc/crypt/crypt_prng_descriptor.c | 2 +- src/misc/crypt/crypt_register_prng.c | 2 +- src/misc/error_to_string.c | 2 +- src/modes/cbc/cbc_done.c | 2 +- src/modes/cbc/cbc_setiv.c | 2 +- src/modes/cbc/cbc_start.c | 6 +- src/modes/cfb/cfb_decrypt.c | 2 +- src/modes/cfb/cfb_done.c | 2 +- src/modes/cfb/cfb_encrypt.c | 2 +- src/modes/cfb/cfb_setiv.c | 10 +- src/modes/cfb/cfb_start.c | 6 +- src/modes/ctr/ctr_done.c | 2 +- src/modes/ctr/ctr_setiv.c | 10 +- src/modes/ctr/ctr_start.c | 10 +- src/modes/ctr/ctr_test.c | 2 +- src/modes/ecb/ecb_done.c | 2 +- src/modes/ecb/ecb_start.c | 2 +- src/modes/f8/f8_decrypt.c | 2 +- src/modes/f8/f8_done.c | 2 +- src/modes/f8/f8_setiv.c | 2 +- src/modes/f8/f8_start.c | 18 +- src/modes/f8/f8_test_mode.c | 28 +- src/modes/lrw/lrw_done.c | 4 +- src/modes/lrw/lrw_encrypt.c | 2 +- src/modes/lrw/lrw_start.c | 6 +- src/modes/lrw/lrw_test.c | 2 +- src/modes/ofb/ofb_decrypt.c | 2 +- src/modes/ofb/ofb_done.c | 2 +- src/modes/ofb/ofb_encrypt.c | 4 +- src/modes/ofb/ofb_setiv.c | 2 +- src/modes/ofb/ofb_start.c | 4 +- src/pk/asn1/der/bit/der_decode_bit_string.c | 2 +- src/pk/asn1/der/bit/der_length_bit_string.c | 4 +- src/pk/asn1/der/boolean/der_decode_boolean.c | 6 +- src/pk/asn1/der/boolean/der_encode_boolean.c | 8 +- src/pk/asn1/der/boolean/der_length_boolean.c | 2 +- src/pk/asn1/der/ia5/der_decode_ia5_string.c | 2 +- src/pk/asn1/der/ia5/der_encode_ia5_string.c | 2 +- src/pk/asn1/der/ia5/der_length_ia5_string.c | 206 +-- src/pk/asn1/der/integer/der_decode_integer.c | 6 +- src/pk/asn1/der/integer/der_encode_integer.c | 6 +- .../der_decode_object_identifier.c | 6 +- .../der_encode_object_identifier.c | 8 +- .../der_length_object_identifier.c | 4 +- .../asn1/der/octet/der_decode_octet_string.c | 2 +- .../asn1/der/octet/der_encode_octet_string.c | 2 +- .../asn1/der/octet/der_length_octet_string.c | 2 +- .../der_decode_printable_string.c | 2 +- .../der_encode_printable_string.c | 2 +- .../der_length_printable_string.c | 154 +- src/pk/asn1/der/sequence/der_sequence_free.c | 14 +- .../short_integer/der_encode_short_integer.c | 6 +- .../short_integer/der_length_short_integer.c | 10 +- .../der_length_teletex_string.c | 226 +-- src/pk/asn1/der/utctime/der_decode_utctime.c | 4 +- src/pk/asn1/der/utctime/der_encode_utctime.c | 8 +- src/pk/asn1/der/utf8/der_decode_utf8_string.c | 6 +- src/pk/asn1/der/utf8/der_length_utf8_string.c | 2 +- src/pk/dsa/dsa_decrypt_key.c | 16 +- src/pk/dsa/dsa_encrypt_key.c | 20 +- src/pk/dsa/dsa_shared_secret.c | 6 +- src/pk/dsa/dsa_sign_hash.c | 8 +- src/pk/dsa/dsa_verify_hash.c | 12 +- src/pk/dsa/dsa_verify_key.c | 2 +- src/pk/ecc/ecc_ansi_x963_import.c | 8 +- src/pk/ecc/ecc_decrypt_key.c | 10 +- src/pk/ecc/ecc_encrypt_key.c | 16 +- src/pk/ecc/ecc_export.c | 4 +- src/pk/ecc/ecc_free.c | 2 +- src/pk/ecc/ecc_get_size.c | 4 +- src/pk/ecc/ecc_import.c | 20 +- src/pk/ecc/ecc_make_key.c | 4 +- src/pk/ecc/ecc_shared_secret.c | 2 +- src/pk/ecc/ecc_sign_hash.c | 10 +- src/pk/ecc/ecc_sizes.c | 2 +- src/pk/ecc/ecc_verify_hash.c | 12 +- src/pk/ecc/ltc_ecc_is_valid_idx.c | 4 +- src/pk/ecc/ltc_ecc_map.c | 4 +- src/pk/ecc/ltc_ecc_mul2add.c | 14 +- src/pk/ecc/ltc_ecc_points.c | 4 +- src/pk/katja/katja_free.c | 2 +- src/pk/katja/katja_make_key.c | 8 +- src/pk/pkcs1/pkcs_1_os2ip.c | 4 +- src/pk/rsa/rsa_free.c | 2 +- src/pk/rsa/rsa_sign_hash.c | 4 +- src/prngs/fortuna.c | 58 +- src/prngs/rc4.c | 36 +- 151 files changed, 1714 insertions(+), 1714 deletions(-) diff --git a/src/encauth/ccm/ccm_test.c b/src/encauth/ccm/ccm_test.c index 7d1353a..51bc4af 100644 --- a/src/encauth/ccm/ccm_test.c +++ b/src/encauth/ccm/ccm_test.c @@ -118,7 +118,7 @@ int ccm_test(void) int err, idx; symmetric_key skey; ccm_state ccm; - + zeromem(zero, 64); idx = find_cipher("aes"); diff --git a/src/encauth/eax/eax_addheader.c b/src/encauth/eax/eax_addheader.c index d06e921..3c1d79b 100644 --- a/src/encauth/eax/eax_addheader.c +++ b/src/encauth/eax/eax_addheader.c @@ -8,22 +8,22 @@ * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file eax_addheader.c - EAX implementation, add meta-data, by Tom St Denis + EAX implementation, add meta-data, by Tom St Denis */ #include "tomcrypt.h" #ifdef LTC_EAX_MODE -/** - add header (metadata) to the stream +/** + add header (metadata) to the stream @param eax The current EAX state @param header The header (meta-data) data you wish to add to the state @param length The length of the header data @return CRYPT_OK if successful */ -int eax_addheader(eax_state *eax, const unsigned char *header, +int eax_addheader(eax_state *eax, const unsigned char *header, unsigned long length) { LTC_ARGCHK(eax != NULL); diff --git a/src/encauth/eax/eax_decrypt.c b/src/encauth/eax/eax_decrypt.c index 185330f..512b5b7 100644 --- a/src/encauth/eax/eax_decrypt.c +++ b/src/encauth/eax/eax_decrypt.c @@ -9,7 +9,7 @@ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file eax_decrypt.c EAX implementation, decrypt block, by Tom St Denis */ @@ -17,7 +17,7 @@ #ifdef LTC_EAX_MODE -/** +/** Decrypt data with the EAX protocol @param eax The EAX state @param ct The ciphertext @@ -25,11 +25,11 @@ @param length The length (octets) of the ciphertext @return CRYPT_OK if successful */ -int eax_decrypt(eax_state *eax, const unsigned char *ct, unsigned char *pt, +int eax_decrypt(eax_state *eax, const unsigned char *ct, unsigned char *pt, unsigned long length) { int err; - + LTC_ARGCHK(eax != NULL); LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); diff --git a/src/encauth/eax/eax_decrypt_verify_memory.c b/src/encauth/eax/eax_decrypt_verify_memory.c index 7956142..be07cf5 100644 --- a/src/encauth/eax/eax_decrypt_verify_memory.c +++ b/src/encauth/eax/eax_decrypt_verify_memory.c @@ -77,7 +77,7 @@ int eax_decrypt_verify_memory(int cipher, if ((err = eax_decrypt(eax, ct, pt, ctlen)) != CRYPT_OK) { goto LBL_ERR; } - + buflen = taglen; if ((err = eax_done(eax, buf, &buflen)) != CRYPT_OK) { goto LBL_ERR; @@ -87,7 +87,7 @@ int eax_decrypt_verify_memory(int cipher, if (buflen >= taglen && XMEMCMP(buf, tag, taglen) == 0) { *stat = 1; } - + err = CRYPT_OK; LBL_ERR: #ifdef LTC_CLEAN_STACK diff --git a/src/encauth/eax/eax_done.c b/src/encauth/eax/eax_done.c index 0bb0b33..cac6093 100644 --- a/src/encauth/eax/eax_done.c +++ b/src/encauth/eax/eax_done.c @@ -51,7 +51,7 @@ int eax_done(eax_state *eax, unsigned char *tag, unsigned long *taglen) /* finish ctomac */ len = MAXBLOCKSIZE; if ((err = omac_done(&eax->ctomac, ctmac, &len)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* finish headeromac */ @@ -59,7 +59,7 @@ int eax_done(eax_state *eax, unsigned char *tag, unsigned long *taglen) /* note we specifically don't reset len so the two lens are minimal */ if ((err = omac_done(&eax->headeromac, headermac, &len)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* terminate the CTR chain */ diff --git a/src/encauth/eax/eax_encrypt.c b/src/encauth/eax/eax_encrypt.c index 79f9dc5..29eb6ee 100644 --- a/src/encauth/eax/eax_encrypt.c +++ b/src/encauth/eax/eax_encrypt.c @@ -11,7 +11,7 @@ /** @file eax_encrypt.c - EAX implementation, encrypt block by Tom St Denis + EAX implementation, encrypt block by Tom St Denis */ #include "tomcrypt.h" @@ -25,11 +25,11 @@ @param length The length of the plaintext (octets) @return CRYPT_OK if successful */ -int eax_encrypt(eax_state *eax, const unsigned char *pt, unsigned char *ct, +int eax_encrypt(eax_state *eax, const unsigned char *pt, unsigned char *ct, unsigned long length) { int err; - + LTC_ARGCHK(eax != NULL); LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); diff --git a/src/encauth/eax/eax_encrypt_authenticate_memory.c b/src/encauth/eax/eax_encrypt_authenticate_memory.c index fc58ce6..4b4815f 100644 --- a/src/encauth/eax/eax_encrypt_authenticate_memory.c +++ b/src/encauth/eax/eax_encrypt_authenticate_memory.c @@ -53,15 +53,15 @@ int eax_encrypt_authenticate_memory(int cipher, eax = XMALLOC(sizeof(*eax)); if ((err = eax_init(eax, cipher, key, keylen, nonce, noncelen, header, headerlen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } if ((err = eax_encrypt(eax, pt, ct, ptlen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } - + if ((err = eax_done(eax, tag, taglen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } err = CRYPT_OK; @@ -72,7 +72,7 @@ LBL_ERR: XFREE(eax); - return err; + return err; } #endif diff --git a/src/encauth/eax/eax_init.c b/src/encauth/eax/eax_init.c index 563eabf..55d8df1 100644 --- a/src/encauth/eax/eax_init.c +++ b/src/encauth/eax/eax_init.c @@ -9,15 +9,15 @@ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file eax_init.c - EAX implementation, initialized EAX state, by Tom St Denis + EAX implementation, initialized EAX state, by Tom St Denis */ #include "tomcrypt.h" #ifdef LTC_EAX_MODE -/** +/** Initialized an EAX state @param eax [out] The EAX state to initialize @param cipher The index of the desired cipher @@ -29,7 +29,7 @@ @param headerlen The header length (octets) @return CRYPT_OK if successful */ -int eax_init(eax_state *eax, int cipher, +int eax_init(eax_state *eax, int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *nonce, unsigned long noncelen, const unsigned char *header, unsigned long headerlen) @@ -69,21 +69,21 @@ int eax_init(eax_state *eax, int cipher, /* N = LTC_OMAC_0K(nonce) */ zeromem(buf, MAXBLOCKSIZE); if ((err = omac_init(omac, cipher, key, keylen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* omac the [0]_n */ if ((err = omac_process(omac, buf, blklen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* omac the nonce */ if ((err = omac_process(omac, nonce, noncelen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* store result */ len = sizeof(eax->N); if ((err = omac_done(omac, eax->N, &len)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* H = LTC_OMAC_1K(header) */ @@ -91,17 +91,17 @@ int eax_init(eax_state *eax, int cipher, buf[blklen - 1] = 1; if ((err = omac_init(&eax->headeromac, cipher, key, keylen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* omac the [1]_n */ if ((err = omac_process(&eax->headeromac, buf, blklen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* omac the header */ if (headerlen != 0) { if ((err = omac_process(&eax->headeromac, header, headerlen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } } @@ -109,19 +109,19 @@ int eax_init(eax_state *eax, int cipher, /* setup the CTR mode */ if ((err = ctr_start(cipher, eax->N, key, keylen, 0, CTR_COUNTER_BIG_ENDIAN, &eax->ctr)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* setup the LTC_OMAC for the ciphertext */ - if ((err = omac_init(&eax->ctomac, cipher, key, keylen)) != CRYPT_OK) { - goto LBL_ERR; + if ((err = omac_init(&eax->ctomac, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; } /* omac [2]_n */ zeromem(buf, MAXBLOCKSIZE); buf[blklen-1] = 2; if ((err = omac_process(&eax->ctomac, buf, blklen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } err = CRYPT_OK; @@ -137,7 +137,7 @@ LBL_ERR: return err; } -#endif +#endif /* $Source$ */ /* $Revision$ */ diff --git a/src/encauth/eax/eax_test.c b/src/encauth/eax/eax_test.c index 087755e..f5558cc 100644 --- a/src/encauth/eax/eax_test.c +++ b/src/encauth/eax/eax_test.c @@ -9,7 +9,7 @@ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file eax_test.c EAX implementation, self-test, by Tom St Denis */ @@ -27,16 +27,16 @@ int eax_test(void) return CRYPT_NOP; #else static const struct { - int keylen, - noncelen, - headerlen, + int keylen, + noncelen, + headerlen, msglen; - unsigned char key[MAXBLOCKSIZE], - nonce[MAXBLOCKSIZE], - header[MAXBLOCKSIZE], + unsigned char key[MAXBLOCKSIZE], + nonce[MAXBLOCKSIZE], + header[MAXBLOCKSIZE], plaintext[MAXBLOCKSIZE], - ciphertext[MAXBLOCKSIZE], + ciphertext[MAXBLOCKSIZE], tag[MAXBLOCKSIZE]; } tests[] = { @@ -107,7 +107,7 @@ int eax_test(void) 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, /* nonce */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, - 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, /* header */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, @@ -134,7 +134,7 @@ int eax_test(void) 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, /* nonce */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, - 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e }, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e }, /* header */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d }, @@ -176,7 +176,7 @@ int eax_test(void) { 16, 16, 8, 2, - /* key */ + /* key */ { 0x91, 0x94, 0x5d, 0x3f, 0x4d, 0xcb, 0xee, 0x0b, 0xf4, 0x5e, 0xf5, 0x22, 0x55, 0xf0, 0x95, 0xa4 }, /* nonce */ @@ -210,14 +210,14 @@ int eax_test(void) /* Tag */ { 0x3a, 0x59, 0xf2, 0x38, 0xa2, 0x3e, 0x39, 0x19, 0x9d, 0xc9, 0x26, 0x66, 0x26, 0xc4, 0x0f, 0x80 } -} +} }; int err, x, idx, res; unsigned long len; unsigned char outct[MAXBLOCKSIZE], outtag[MAXBLOCKSIZE]; - /* AES can be under rijndael or aes... try to find it */ + /* AES can be under rijndael or aes... try to find it */ if ((idx = find_cipher("aes")) == -1) { if ((idx = find_cipher("rijndael")) == -1) { return CRYPT_NOP; diff --git a/src/encauth/gcm/gcm_done.c b/src/encauth/gcm/gcm_done.c index bbc9bbe..db950a5 100644 --- a/src/encauth/gcm/gcm_done.c +++ b/src/encauth/gcm/gcm_done.c @@ -24,7 +24,7 @@ @param taglen [in/out] The length of the MAC tag @return CRYPT_OK on success */ -int gcm_done(gcm_state *gcm, +int gcm_done(gcm_state *gcm, unsigned char *tag, unsigned long *taglen) { unsigned long x; diff --git a/src/encauth/gcm/gcm_gf_mult.c b/src/encauth/gcm/gcm_gf_mult.c index e8d8c2d..1b3387f 100644 --- a/src/encauth/gcm/gcm_gf_mult.c +++ b/src/encauth/gcm/gcm_gf_mult.c @@ -17,7 +17,7 @@ #if defined(LTC_GCM_TABLES) || defined(LTC_LRW_TABLES) || ((defined(LTC_GCM_MODE) || defined(LTC_GCM_MODE)) && defined(LTC_FAST)) -/* this is x*2^128 mod p(x) ... the results are 16 bytes each stored in a packed format. Since only the +/* this is x*2^128 mod p(x) ... the results are 16 bytes each stored in a packed format. Since only the * lower 16 bits are not zero'ed I removed the upper 14 bytes */ const unsigned char gcm_shift_table[256*2] = { 0x00, 0x00, 0x01, 0xc2, 0x03, 0x84, 0x02, 0x46, 0x07, 0x08, 0x06, 0xca, 0x04, 0x8c, 0x05, 0x4e, @@ -73,13 +73,13 @@ static void gcm_rightshift(unsigned char *a) static const unsigned char mask[] = { 0x80, 0x40, 0x20, 0x10, 0x08, 0x04, 0x02, 0x01 }; static const unsigned char poly[] = { 0x00, 0xE1 }; - + /** GCM GF multiplier (internal use only) bitserial @param a First value @param b Second value @param c Destination for a * b - */ + */ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c) { unsigned char Z[16], V[16]; @@ -90,7 +90,7 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char * for (x = 0; x < 128; x++) { if (b[x>>3] & mask[x&7]) { for (y = 0; y < 16; y++) { - Z[y] ^= V[y]; + Z[y] ^= V[y]; } } z = V[15] & 0x01; @@ -113,7 +113,7 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char * @param a First value @param b Second value @param c Destination for a * b - */ + */ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c) { int i, j, k, u; @@ -129,7 +129,7 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char * LOAD32H(B[M(1)][i], a + (i<<2)); LOAD32L(pB[i], b + (i<<2)); } -#else +#else for (i = 0; i < 2; i++) { LOAD64H(B[M(1)][i], a + (i<<3)); LOAD64L(pB[i], b + (i<<3)); @@ -154,7 +154,7 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char * B[M(9)][i] = B[M(1)][i] ^ B[M(8)][i]; B[M(10)][i] = B[M(2)][i] ^ B[M(8)][i]; B[M(12)][i] = B[M(8)][i] ^ B[M(4)][i]; - + /* now all 3 bit values and the only 4 bit value: 7, 11, 13, 14, 15 */ B[M(7)][i] = B[M(3)][i] ^ B[M(4)][i]; B[M(11)][i] = B[M(3)][i] ^ B[M(8)][i]; @@ -193,7 +193,7 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char * for (i = 0; i < 8; i++) { STORE32H(tmp[i], pTmp + (i<<2)); } -#else +#else for (i = 0; i < 4; i++) { STORE64H(tmp[i], pTmp + (i<<3)); } @@ -218,4 +218,4 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char * /* $Source$ */ /* $Revision$ */ /* $Date$ */ - + diff --git a/src/encauth/gcm/gcm_init.c b/src/encauth/gcm/gcm_init.c index 2c6a5eb..65282c1 100644 --- a/src/encauth/gcm/gcm_init.c +++ b/src/encauth/gcm/gcm_init.c @@ -25,7 +25,7 @@ @param keylen The length of the secret key @return CRYPT_OK on success */ -int gcm_init(gcm_state *gcm, int cipher, +int gcm_init(gcm_state *gcm, int cipher, const unsigned char *key, int keylen) { int err; diff --git a/src/encauth/gcm/gcm_memory.c b/src/encauth/gcm/gcm_memory.c index 451e3fa..f858992 100644 --- a/src/encauth/gcm/gcm_memory.c +++ b/src/encauth/gcm/gcm_memory.c @@ -22,7 +22,7 @@ @param cipher Index of cipher to use @param key The secret key @param keylen The length of the secret key - @param IV The initial vector + @param IV The initial vector @param IVlen The length of the initial vector @param adata The additional authentication data (header) @param adatalen The length of the adata @@ -39,7 +39,7 @@ int gcm_memory( int cipher, const unsigned char *IV, unsigned long IVlen, const unsigned char *adata, unsigned long adatalen, unsigned char *pt, unsigned long ptlen, - unsigned char *ct, + unsigned char *ct, unsigned char *tag, unsigned long *taglen, int direction) { @@ -50,9 +50,9 @@ int gcm_memory( int cipher, if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { return err; } - + if (cipher_descriptor[cipher].accel_gcm_memory != NULL) { - return + return cipher_descriptor[cipher].accel_gcm_memory (key, keylen, IV, IVlen, diff --git a/src/encauth/gcm/gcm_reset.c b/src/encauth/gcm/gcm_reset.c index c9e13d9..f9596b4 100644 --- a/src/encauth/gcm/gcm_reset.c +++ b/src/encauth/gcm/gcm_reset.c @@ -33,7 +33,7 @@ int gcm_reset(gcm_state *gcm) gcm->buflen = 0; gcm->totlen = 0; gcm->pttotlen = 0; - + return CRYPT_OK; } diff --git a/src/encauth/gcm/gcm_test.c b/src/encauth/gcm/gcm_test.c index 7380c81..fb37796 100644 --- a/src/encauth/gcm/gcm_test.c +++ b/src/encauth/gcm/gcm_test.c @@ -17,7 +17,7 @@ #ifdef LTC_GCM_MODE -/** +/** Test the GCM code @return CRYPT_OK on success */ @@ -100,18 +100,18 @@ int gcm_test(void) /* test case #3 */ { /* key */ - { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, + { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, 0x6d, 0x6a, 0x8f, 0x94, 0x67, 0x30, 0x83, 0x08, }, 16, /* PT */ - { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, - 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, - 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, - 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, - 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, - 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, - 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, + { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, + 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, + 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, + 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, + 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, + 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, + 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, 0xba, 0x63, 0x7b, 0x39, 0x1a, 0xaf, 0xd2, 0x55, }, 64, @@ -120,66 +120,66 @@ int gcm_test(void) 0, /* IV */ - { 0xca, 0xfe, 0xba, 0xbe, 0xfa, 0xce, 0xdb, 0xad, + { 0xca, 0xfe, 0xba, 0xbe, 0xfa, 0xce, 0xdb, 0xad, 0xde, 0xca, 0xf8, 0x88, }, 12, - + /* CT */ - { 0x42, 0x83, 0x1e, 0xc2, 0x21, 0x77, 0x74, 0x24, - 0x4b, 0x72, 0x21, 0xb7, 0x84, 0xd0, 0xd4, 0x9c, - 0xe3, 0xaa, 0x21, 0x2f, 0x2c, 0x02, 0xa4, 0xe0, - 0x35, 0xc1, 0x7e, 0x23, 0x29, 0xac, 0xa1, 0x2e, - 0x21, 0xd5, 0x14, 0xb2, 0x54, 0x66, 0x93, 0x1c, - 0x7d, 0x8f, 0x6a, 0x5a, 0xac, 0x84, 0xaa, 0x05, - 0x1b, 0xa3, 0x0b, 0x39, 0x6a, 0x0a, 0xac, 0x97, + { 0x42, 0x83, 0x1e, 0xc2, 0x21, 0x77, 0x74, 0x24, + 0x4b, 0x72, 0x21, 0xb7, 0x84, 0xd0, 0xd4, 0x9c, + 0xe3, 0xaa, 0x21, 0x2f, 0x2c, 0x02, 0xa4, 0xe0, + 0x35, 0xc1, 0x7e, 0x23, 0x29, 0xac, 0xa1, 0x2e, + 0x21, 0xd5, 0x14, 0xb2, 0x54, 0x66, 0x93, 0x1c, + 0x7d, 0x8f, 0x6a, 0x5a, 0xac, 0x84, 0xaa, 0x05, + 0x1b, 0xa3, 0x0b, 0x39, 0x6a, 0x0a, 0xac, 0x97, 0x3d, 0x58, 0xe0, 0x91, 0x47, 0x3f, 0x59, 0x85, }, /* TAG */ - { 0x4d, 0x5c, 0x2a, 0xf3, 0x27, 0xcd, 0x64, 0xa6, + { 0x4d, 0x5c, 0x2a, 0xf3, 0x27, 0xcd, 0x64, 0xa6, 0x2c, 0xf3, 0x5a, 0xbd, 0x2b, 0xa6, 0xfa, 0xb4, } }, /* test case #4 */ { /* key */ - { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, + { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, 0x6d, 0x6a, 0x8f, 0x94, 0x67, 0x30, 0x83, 0x08, }, 16, /* PT */ - { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, - 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, - 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, - 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, - 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, - 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, - 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, + { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, + 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, + 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, + 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, + 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, + 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, + 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, 0xba, 0x63, 0x7b, 0x39, }, 60, /* ADATA */ - { 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, - 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + { 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, 0xab, 0xad, 0xda, 0xd2, }, 20, /* IV */ - { 0xca, 0xfe, 0xba, 0xbe, 0xfa, 0xce, 0xdb, 0xad, + { 0xca, 0xfe, 0xba, 0xbe, 0xfa, 0xce, 0xdb, 0xad, 0xde, 0xca, 0xf8, 0x88, }, 12, /* CT */ - { 0x42, 0x83, 0x1e, 0xc2, 0x21, 0x77, 0x74, 0x24, - 0x4b, 0x72, 0x21, 0xb7, 0x84, 0xd0, 0xd4, 0x9c, - 0xe3, 0xaa, 0x21, 0x2f, 0x2c, 0x02, 0xa4, 0xe0, - 0x35, 0xc1, 0x7e, 0x23, 0x29, 0xac, 0xa1, 0x2e, - 0x21, 0xd5, 0x14, 0xb2, 0x54, 0x66, 0x93, 0x1c, - 0x7d, 0x8f, 0x6a, 0x5a, 0xac, 0x84, 0xaa, 0x05, - 0x1b, 0xa3, 0x0b, 0x39, 0x6a, 0x0a, 0xac, 0x97, + { 0x42, 0x83, 0x1e, 0xc2, 0x21, 0x77, 0x74, 0x24, + 0x4b, 0x72, 0x21, 0xb7, 0x84, 0xd0, 0xd4, 0x9c, + 0xe3, 0xaa, 0x21, 0x2f, 0x2c, 0x02, 0xa4, 0xe0, + 0x35, 0xc1, 0x7e, 0x23, 0x29, 0xac, 0xa1, 0x2e, + 0x21, 0xd5, 0x14, 0xb2, 0x54, 0x66, 0x93, 0x1c, + 0x7d, 0x8f, 0x6a, 0x5a, 0xac, 0x84, 0xaa, 0x05, + 0x1b, 0xa3, 0x0b, 0x39, 0x6a, 0x0a, 0xac, 0x97, 0x3d, 0x58, 0xe0, 0x91, }, /* TAG */ - { 0x5b, 0xc9, 0x4f, 0xbc, 0x32, 0x21, 0xa5, 0xdb, + { 0x5b, 0xc9, 0x4f, 0xbc, 0x32, 0x21, 0xa5, 0xdb, 0x94, 0xfa, 0xe9, 0x5a, 0xe7, 0x12, 0x1a, 0x47, } }, @@ -187,24 +187,24 @@ int gcm_test(void) /* test case #5 */ { /* key */ - { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, + { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, 0x6d, 0x6a, 0x8f, 0x94, 0x67, 0x30, 0x83, 0x08, }, 16, /* PT */ - { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, - 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, - 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, - 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, - 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, - 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, - 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, + { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, + 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, + 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, + 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, + 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, + 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, + 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, 0xba, 0x63, 0x7b, 0x39, }, 60, /* ADATA */ - { 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, - 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + { 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, 0xab, 0xad, 0xda, 0xd2, }, 20, @@ -213,112 +213,112 @@ int gcm_test(void) 8, /* CT */ - { 0x61, 0x35, 0x3b, 0x4c, 0x28, 0x06, 0x93, 0x4a, - 0x77, 0x7f, 0xf5, 0x1f, 0xa2, 0x2a, 0x47, 0x55, - 0x69, 0x9b, 0x2a, 0x71, 0x4f, 0xcd, 0xc6, 0xf8, - 0x37, 0x66, 0xe5, 0xf9, 0x7b, 0x6c, 0x74, 0x23, - 0x73, 0x80, 0x69, 0x00, 0xe4, 0x9f, 0x24, 0xb2, - 0x2b, 0x09, 0x75, 0x44, 0xd4, 0x89, 0x6b, 0x42, - 0x49, 0x89, 0xb5, 0xe1, 0xeb, 0xac, 0x0f, 0x07, + { 0x61, 0x35, 0x3b, 0x4c, 0x28, 0x06, 0x93, 0x4a, + 0x77, 0x7f, 0xf5, 0x1f, 0xa2, 0x2a, 0x47, 0x55, + 0x69, 0x9b, 0x2a, 0x71, 0x4f, 0xcd, 0xc6, 0xf8, + 0x37, 0x66, 0xe5, 0xf9, 0x7b, 0x6c, 0x74, 0x23, + 0x73, 0x80, 0x69, 0x00, 0xe4, 0x9f, 0x24, 0xb2, + 0x2b, 0x09, 0x75, 0x44, 0xd4, 0x89, 0x6b, 0x42, + 0x49, 0x89, 0xb5, 0xe1, 0xeb, 0xac, 0x0f, 0x07, 0xc2, 0x3f, 0x45, 0x98, }, /* TAG */ - { 0x36, 0x12, 0xd2, 0xe7, 0x9e, 0x3b, 0x07, 0x85, + { 0x36, 0x12, 0xd2, 0xe7, 0x9e, 0x3b, 0x07, 0x85, 0x56, 0x1b, 0xe1, 0x4a, 0xac, 0xa2, 0xfc, 0xcb, } }, /* test case #6 */ { /* key */ - { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, + { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, 0x6d, 0x6a, 0x8f, 0x94, 0x67, 0x30, 0x83, 0x08, }, 16, /* PT */ - { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, - 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, - 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, - 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, - 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, - 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, - 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, + { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, + 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, + 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, + 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, + 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, + 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, + 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, 0xba, 0x63, 0x7b, 0x39, }, 60, /* ADATA */ - { 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, - 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + { 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, 0xab, 0xad, 0xda, 0xd2, }, 20, /* IV */ - { 0x93, 0x13, 0x22, 0x5d, 0xf8, 0x84, 0x06, 0xe5, - 0x55, 0x90, 0x9c, 0x5a, 0xff, 0x52, 0x69, 0xaa, - 0x6a, 0x7a, 0x95, 0x38, 0x53, 0x4f, 0x7d, 0xa1, - 0xe4, 0xc3, 0x03, 0xd2, 0xa3, 0x18, 0xa7, 0x28, - 0xc3, 0xc0, 0xc9, 0x51, 0x56, 0x80, 0x95, 0x39, - 0xfc, 0xf0, 0xe2, 0x42, 0x9a, 0x6b, 0x52, 0x54, - 0x16, 0xae, 0xdb, 0xf5, 0xa0, 0xde, 0x6a, 0x57, + { 0x93, 0x13, 0x22, 0x5d, 0xf8, 0x84, 0x06, 0xe5, + 0x55, 0x90, 0x9c, 0x5a, 0xff, 0x52, 0x69, 0xaa, + 0x6a, 0x7a, 0x95, 0x38, 0x53, 0x4f, 0x7d, 0xa1, + 0xe4, 0xc3, 0x03, 0xd2, 0xa3, 0x18, 0xa7, 0x28, + 0xc3, 0xc0, 0xc9, 0x51, 0x56, 0x80, 0x95, 0x39, + 0xfc, 0xf0, 0xe2, 0x42, 0x9a, 0x6b, 0x52, 0x54, + 0x16, 0xae, 0xdb, 0xf5, 0xa0, 0xde, 0x6a, 0x57, 0xa6, 0x37, 0xb3, 0x9b, }, 60, /* CT */ - { 0x8c, 0xe2, 0x49, 0x98, 0x62, 0x56, 0x15, 0xb6, - 0x03, 0xa0, 0x33, 0xac, 0xa1, 0x3f, 0xb8, 0x94, - 0xbe, 0x91, 0x12, 0xa5, 0xc3, 0xa2, 0x11, 0xa8, - 0xba, 0x26, 0x2a, 0x3c, 0xca, 0x7e, 0x2c, 0xa7, - 0x01, 0xe4, 0xa9, 0xa4, 0xfb, 0xa4, 0x3c, 0x90, - 0xcc, 0xdc, 0xb2, 0x81, 0xd4, 0x8c, 0x7c, 0x6f, - 0xd6, 0x28, 0x75, 0xd2, 0xac, 0xa4, 0x17, 0x03, + { 0x8c, 0xe2, 0x49, 0x98, 0x62, 0x56, 0x15, 0xb6, + 0x03, 0xa0, 0x33, 0xac, 0xa1, 0x3f, 0xb8, 0x94, + 0xbe, 0x91, 0x12, 0xa5, 0xc3, 0xa2, 0x11, 0xa8, + 0xba, 0x26, 0x2a, 0x3c, 0xca, 0x7e, 0x2c, 0xa7, + 0x01, 0xe4, 0xa9, 0xa4, 0xfb, 0xa4, 0x3c, 0x90, + 0xcc, 0xdc, 0xb2, 0x81, 0xd4, 0x8c, 0x7c, 0x6f, + 0xd6, 0x28, 0x75, 0xd2, 0xac, 0xa4, 0x17, 0x03, 0x4c, 0x34, 0xae, 0xe5, }, /* TAG */ - { 0x61, 0x9c, 0xc5, 0xae, 0xff, 0xfe, 0x0b, 0xfa, + { 0x61, 0x9c, 0xc5, 0xae, 0xff, 0xfe, 0x0b, 0xfa, 0x46, 0x2a, 0xf4, 0x3c, 0x16, 0x99, 0xd0, 0x50, } }, /* test case #46 from BG (catches the LTC bug of v1.15) */ { /* key */ - { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, 16, /* PT */ - { 0xa2, 0xaa, 0xb3, 0xad, 0x8b, 0x17, 0xac, 0xdd, - 0xa2, 0x88, 0x42, 0x6c, 0xd7, 0xc4, 0x29, 0xb7, - 0xca, 0x86, 0xb7, 0xac, 0xa0, 0x58, 0x09, 0xc7, + { 0xa2, 0xaa, 0xb3, 0xad, 0x8b, 0x17, 0xac, 0xdd, + 0xa2, 0x88, 0x42, 0x6c, 0xd7, 0xc4, 0x29, 0xb7, + 0xca, 0x86, 0xb7, 0xac, 0xa0, 0x58, 0x09, 0xc7, 0x0c, 0xe8, 0x2d, 0xb2, 0x57, 0x11, 0xcb, 0x53, - 0x02, 0xeb, 0x27, 0x43, 0xb0, 0x36, 0xf3, 0xd7, - 0x50, 0xd6, 0xcf, 0x0d, 0xc0, 0xac, 0xb9, 0x29, - 0x50, 0xd5, 0x46, 0xdb, 0x30, 0x8f, 0x93, 0xb4, + 0x02, 0xeb, 0x27, 0x43, 0xb0, 0x36, 0xf3, 0xd7, + 0x50, 0xd6, 0xcf, 0x0d, 0xc0, 0xac, 0xb9, 0x29, + 0x50, 0xd5, 0x46, 0xdb, 0x30, 0x8f, 0x93, 0xb4, 0xff, 0x24, 0x4a, 0xfa, 0x9d, 0xc7, 0x2b, 0xcd, 0x75, 0x8d, 0x2c }, 67, /* ADATA */ - { 0x68, 0x8e, 0x1a, 0xa9, 0x84, 0xde, 0x92, 0x6d, + { 0x68, 0x8e, 0x1a, 0xa9, 0x84, 0xde, 0x92, 0x6d, 0xc7, 0xb4, 0xc4, 0x7f, 0x44 }, - 13, + 13, /* IV */ - { 0xb7, 0x21, 0x38, 0xb5, 0xa0, 0x5f, 0xf5, 0x07, + { 0xb7, 0x21, 0x38, 0xb5, 0xa0, 0x5f, 0xf5, 0x07, 0x0e, 0x8c, 0xd9, 0x41, 0x83, 0xf7, 0x61, 0xd8 }, 16, /* CT */ - { 0xcb, 0xc8, 0xd2, 0xf1, 0x54, 0x81, 0xa4, 0xcc, - 0x7d, 0xd1, 0xe1, 0x9a, 0xaa, 0x83, 0xde, 0x56, - 0x78, 0x48, 0x3e, 0xc3, 0x59, 0xae, 0x7d, 0xec, + { 0xcb, 0xc8, 0xd2, 0xf1, 0x54, 0x81, 0xa4, 0xcc, + 0x7d, 0xd1, 0xe1, 0x9a, 0xaa, 0x83, 0xde, 0x56, + 0x78, 0x48, 0x3e, 0xc3, 0x59, 0xae, 0x7d, 0xec, 0x2a, 0xb8, 0xd5, 0x34, 0xe0, 0x90, 0x6f, 0x4b, - 0x46, 0x63, 0xfa, 0xff, 0x58, 0xa8, 0xb2, 0xd7, - 0x33, 0xb8, 0x45, 0xee, 0xf7, 0xc9, 0xb3, 0x31, - 0xe9, 0xe1, 0x0e, 0xb2, 0x61, 0x2c, 0x99, 0x5f, + 0x46, 0x63, 0xfa, 0xff, 0x58, 0xa8, 0xb2, 0xd7, + 0x33, 0xb8, 0x45, 0xee, 0xf7, 0xc9, 0xb3, 0x31, + 0xe9, 0xe1, 0x0e, 0xb2, 0x61, 0x2c, 0x99, 0x5f, 0xeb, 0x1a, 0xc1, 0x5a, 0x62, 0x86, 0xcc, 0xe8, 0xb2, 0x97, 0xa8 }, /* TAG */ - { 0x8d, 0x2d, 0x2a, 0x93, 0x72, 0x62, 0x6f, 0x6b, + { 0x8d, 0x2d, 0x2a, 0x93, 0x72, 0x62, 0x6f, 0x6b, 0xee, 0x85, 0x80, 0x27, 0x6a, 0x63, 0x66, 0xbf } } diff --git a/src/encauth/ocb/ocb_decrypt.c b/src/encauth/ocb/ocb_decrypt.c index 61003db..33c425a 100644 --- a/src/encauth/ocb/ocb_decrypt.c +++ b/src/encauth/ocb/ocb_decrypt.c @@ -11,7 +11,7 @@ /** @file ocb_decrypt.c - OCB implementation, decrypt data, by Tom St Denis + OCB implementation, decrypt data, by Tom St Denis */ #include "tomcrypt.h" @@ -38,7 +38,7 @@ int ocb_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned char *pt) return err; } LTC_ARGCHK(cipher_descriptor[ocb->cipher].ecb_decrypt != NULL); - + /* check length */ if (ocb->block_len != cipher_descriptor[ocb->cipher].block_length) { return CRYPT_INVALID_ARG; diff --git a/src/encauth/ocb/ocb_decrypt_verify_memory.c b/src/encauth/ocb/ocb_decrypt_verify_memory.c index 6644618..70c579a 100644 --- a/src/encauth/ocb/ocb_decrypt_verify_memory.c +++ b/src/encauth/ocb/ocb_decrypt_verify_memory.c @@ -9,9 +9,9 @@ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file ocb_decrypt_verify_memory.c - OCB implementation, helper to decrypt block of memory, by Tom St Denis + OCB implementation, helper to decrypt block of memory, by Tom St Denis */ #include "tomcrypt.h" @@ -33,7 +33,7 @@ */ int ocb_decrypt_verify_memory(int cipher, const unsigned char *key, unsigned long keylen, - const unsigned char *nonce, + const unsigned char *nonce, const unsigned char *ct, unsigned long ctlen, unsigned char *pt, const unsigned char *tag, unsigned long taglen, @@ -56,12 +56,12 @@ int ocb_decrypt_verify_memory(int cipher, } if ((err = ocb_init(ocb, cipher, key, keylen, nonce)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } while (ctlen > (unsigned long)ocb->block_len) { if ((err = ocb_decrypt(ocb, ct, pt)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } ctlen -= ocb->block_len; pt += ocb->block_len; @@ -73,7 +73,7 @@ LBL_ERR: #ifdef LTC_CLEAN_STACK zeromem(ocb, sizeof(ocb_state)); #endif - + XFREE(ocb); return err; diff --git a/src/encauth/ocb/ocb_done_decrypt.c b/src/encauth/ocb/ocb_done_decrypt.c index d604b36..8a119b6 100644 --- a/src/encauth/ocb/ocb_done_decrypt.c +++ b/src/encauth/ocb/ocb_done_decrypt.c @@ -9,7 +9,7 @@ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file ocb_done_decrypt.c OCB implementation, terminate decryption, by Tom St Denis */ @@ -28,9 +28,9 @@ @param stat [out] The result of the tag comparison @return CRYPT_OK if the process was successful regardless if the tag is valid */ -int ocb_done_decrypt(ocb_state *ocb, +int ocb_done_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned long ctlen, - unsigned char *pt, + unsigned char *pt, const unsigned char *tag, unsigned long taglen, int *stat) { int err; diff --git a/src/encauth/ocb/ocb_done_encrypt.c b/src/encauth/ocb/ocb_done_encrypt.c index 276d50e..3c3054f 100644 --- a/src/encauth/ocb/ocb_done_encrypt.c +++ b/src/encauth/ocb/ocb_done_encrypt.c @@ -9,7 +9,7 @@ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file ocb_done_encrypt.c OCB implementation, terminate encryption, by Tom St Denis */ @@ -17,7 +17,7 @@ #ifdef LTC_OCB_MODE -/** +/** Terminate an encryption OCB state @param ocb The OCB state @param pt Remaining plaintext (if any) diff --git a/src/encauth/ocb/ocb_encrypt.c b/src/encauth/ocb/ocb_encrypt.c index 84afa66..24d22db 100644 --- a/src/encauth/ocb/ocb_encrypt.c +++ b/src/encauth/ocb/ocb_encrypt.c @@ -9,7 +9,7 @@ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file ocb_encrypt.c OCB implementation, encrypt data, by Tom St Denis */ diff --git a/src/encauth/ocb/ocb_encrypt_authenticate_memory.c b/src/encauth/ocb/ocb_encrypt_authenticate_memory.c index f81cc4b..3c23171 100644 --- a/src/encauth/ocb/ocb_encrypt_authenticate_memory.c +++ b/src/encauth/ocb/ocb_encrypt_authenticate_memory.c @@ -9,7 +9,7 @@ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file ocb_encrypt_authenticate_memory.c OCB implementation, encrypt block of memory, by Tom St Denis */ @@ -32,7 +32,7 @@ */ int ocb_encrypt_authenticate_memory(int cipher, const unsigned char *key, unsigned long keylen, - const unsigned char *nonce, + const unsigned char *nonce, const unsigned char *pt, unsigned long ptlen, unsigned char *ct, unsigned char *tag, unsigned long *taglen) diff --git a/src/encauth/ocb/ocb_init.c b/src/encauth/ocb/ocb_init.c index 393f282..2b2d09e 100644 --- a/src/encauth/ocb/ocb_init.c +++ b/src/encauth/ocb/ocb_init.c @@ -19,7 +19,7 @@ static const struct { int len; - unsigned char poly_div[MAXBLOCKSIZE], + unsigned char poly_div[MAXBLOCKSIZE], poly_mul[MAXBLOCKSIZE]; } polys[] = { { @@ -27,7 +27,7 @@ static const struct { { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0D }, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1B } }, { - 16, + 16, { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x43 }, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, @@ -44,7 +44,7 @@ static const struct { @param nonce The session nonce (length of the block size of the cipher) @return CRYPT_OK if successful */ -int ocb_init(ocb_state *ocb, int cipher, +int ocb_init(ocb_state *ocb, int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *nonce) { int poly, x, y, m, err; @@ -62,7 +62,7 @@ int ocb_init(ocb_state *ocb, int cipher, ocb->block_len = cipher_descriptor[cipher].block_length; x = (int)(sizeof(polys)/sizeof(polys[0])); for (poly = 0; poly < x; poly++) { - if (polys[poly].len == ocb->block_len) { + if (polys[poly].len == ocb->block_len) { break; } } @@ -71,13 +71,13 @@ int ocb_init(ocb_state *ocb, int cipher, } if (polys[poly].len != ocb->block_len) { return CRYPT_INVALID_ARG; - } + } /* schedule the key */ if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &ocb->key)) != CRYPT_OK) { return err; } - + /* find L = E[0] */ zeromem(ocb->L, ocb->block_len); if ((err = cipher_descriptor[cipher].ecb_encrypt(ocb->L, ocb->L, &ocb->key)) != CRYPT_OK) { diff --git a/src/encauth/ocb/ocb_shift_xor.c b/src/encauth/ocb/ocb_shift_xor.c index 145f4c4..48b76b6 100644 --- a/src/encauth/ocb/ocb_shift_xor.c +++ b/src/encauth/ocb/ocb_shift_xor.c @@ -9,7 +9,7 @@ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file ocb_shift_xor.c OCB implementation, internal function, by Tom St Denis */ @@ -19,7 +19,7 @@ /** Compute the shift/xor for OCB (internal function) - @param ocb The OCB state + @param ocb The OCB state @param Z The destination of the shift */ void ocb_shift_xor(ocb_state *ocb, unsigned char *Z) diff --git a/src/encauth/ocb/ocb_test.c b/src/encauth/ocb/ocb_test.c index 8de1a57..ca0653f 100644 --- a/src/encauth/ocb/ocb_test.c +++ b/src/encauth/ocb/ocb_test.c @@ -9,7 +9,7 @@ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file ocb_test.c OCB implementation, self-test by Tom St Denis */ @@ -17,7 +17,7 @@ #ifdef LTC_OCB_MODE -/** +/** Test the OCB protocol @return CRYPT_OK if successful */ @@ -52,7 +52,7 @@ int ocb_test(void) /* OCB-AES-128-3B */ { - 3, + 3, /* key */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, @@ -70,7 +70,7 @@ int ocb_test(void) /* OCB-AES-128-16B */ { - 16, + 16, /* key */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, @@ -90,7 +90,7 @@ int ocb_test(void) /* OCB-AES-128-20B */ { - 20, + 20, /* key */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, @@ -99,7 +99,7 @@ int ocb_test(void) 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, /* pt */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, - 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13 }, /* ct */ { 0x01, 0xa0, 0x75, 0xf0, 0xd8, 0x15, 0xb1, 0xa4, @@ -112,7 +112,7 @@ int ocb_test(void) /* OCB-AES-128-32B */ { - 32, + 32, /* key */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, @@ -121,7 +121,7 @@ int ocb_test(void) 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, /* pt */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, - 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f }, /* ct */ @@ -137,7 +137,7 @@ int ocb_test(void) /* OCB-AES-128-34B */ { - 34, + 34, /* key */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, @@ -146,7 +146,7 @@ int ocb_test(void) 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, /* pt */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, - 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f, 0x20, 0x21 }, @@ -168,7 +168,7 @@ int ocb_test(void) unsigned long len; unsigned char outct[MAXBLOCKSIZE], outtag[MAXBLOCKSIZE]; - /* AES can be under rijndael or aes... try to find it */ + /* AES can be under rijndael or aes... try to find it */ if ((idx = find_cipher("aes")) == -1) { if ((idx = find_cipher("rijndael")) == -1) { return CRYPT_NOP; @@ -181,7 +181,7 @@ int ocb_test(void) tests[x].nonce, tests[x].pt, tests[x].ptlen, outct, outtag, &len)) != CRYPT_OK) { return err; } - + if (XMEMCMP(outtag, tests[x].tag, len) || XMEMCMP(outct, tests[x].ct, tests[x].ptlen)) { #if 0 unsigned long y; @@ -200,7 +200,7 @@ int ocb_test(void) #endif return CRYPT_FAIL_TESTVECTOR; } - + if ((err = ocb_decrypt_verify_memory(idx, tests[x].key, 16, tests[x].nonce, outct, tests[x].ptlen, outct, tests[x].tag, len, &res)) != CRYPT_OK) { return err; diff --git a/src/encauth/ocb/s_ocb_done.c b/src/encauth/ocb/s_ocb_done.c index 37a7cb7..5cf9c73 100644 --- a/src/encauth/ocb/s_ocb_done.c +++ b/src/encauth/ocb/s_ocb_done.c @@ -9,7 +9,7 @@ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file s_ocb_done.c OCB implementation, internal helper, by Tom St Denis */ @@ -22,7 +22,7 @@ * is we XOR the final ciphertext into the checksum so we have to xor it * before we CTR [decrypt] or after [encrypt] * - * the names pt/ptlen/ct really just mean in/inlen/out but this is the way I wrote it... + * the names pt/ptlen/ct really just mean in/inlen/out but this is the way I wrote it... */ /** @@ -74,13 +74,13 @@ int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, } /* compute X[m] = len(pt[m]) XOR Lr XOR Z[m] */ - ocb_shift_xor(ocb, X); + ocb_shift_xor(ocb, X); XMEMCPY(Z, X, ocb->block_len); X[ocb->block_len-1] ^= (ptlen*8)&255; X[ocb->block_len-2] ^= ((ptlen*8)>>8)&255; for (x = 0; x < ocb->block_len; x++) { - X[x] ^= ocb->Lr[x]; + X[x] ^= ocb->Lr[x]; } /* Y[m] = E(X[m])) */ @@ -93,7 +93,7 @@ int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, /* xor C[m] into checksum */ for (x = 0; x < (int)ptlen; x++) { ocb->checksum[x] ^= ct[x]; - } + } } /* C[m] = P[m] xor Y[m] */ @@ -102,7 +102,7 @@ int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, } if (mode == 0) { - /* encrypt mode */ + /* encrypt mode */ /* xor C[m] into checksum */ for (x = 0; x < (int)ptlen; x++) { ocb->checksum[x] ^= ct[x]; @@ -113,7 +113,7 @@ int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, for (x = 0; x < ocb->block_len; x++) { ocb->checksum[x] ^= Y[x] ^ Z[x]; } - + /* encrypt checksum, er... tag!! */ if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(ocb->checksum, X, &ocb->key)) != CRYPT_OK) { goto error; @@ -132,7 +132,7 @@ int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, zeromem(Z, MAXBLOCKSIZE); zeromem(ocb, sizeof(*ocb)); #endif -error: +error: XFREE(X); XFREE(Y); XFREE(Z); diff --git a/src/hashes/helper/hash_file.c b/src/hashes/helper/hash_file.c index 4c184d8..bb899a1 100644 --- a/src/hashes/helper/hash_file.c +++ b/src/hashes/helper/hash_file.c @@ -11,7 +11,7 @@ #include "tomcrypt.h" #ifndef LTC_NO_FILE -/** +/** @file hash_file.c Hash a file, Tom St Denis */ @@ -36,7 +36,7 @@ int hash_file(int hash, const char *fname, unsigned char *out, unsigned long *ou } in = fopen(fname, "rb"); - if (in == NULL) { + if (in == NULL) { return CRYPT_FILE_NOTFOUND; } diff --git a/src/hashes/helper/hash_filehandle.c b/src/hashes/helper/hash_filehandle.c index 6a6052f..1305539 100644 --- a/src/hashes/helper/hash_filehandle.c +++ b/src/hashes/helper/hash_filehandle.c @@ -16,13 +16,13 @@ Hash open files, Tom St Denis */ -/** - Hash data from an open file handle. +/** + Hash data from an open file handle. @param hash The index of the hash you want to use @param in The FILE* handle of the file you want to hash @param out [out] The destination of the digest @param outlen [in/out] The max size and resulting size of the digest - @result CRYPT_OK if successful + @result CRYPT_OK if successful */ int hash_filehandle(int hash, FILE *in, unsigned char *out, unsigned long *outlen) { diff --git a/src/hashes/md2.c b/src/hashes/md2.c index 5a65d7e..0410923 100644 --- a/src/hashes/md2.c +++ b/src/hashes/md2.c @@ -12,7 +12,7 @@ /** @param md2.c - LTC_MD2 (RFC 1319) hash function implementation by Tom St Denis + LTC_MD2 (RFC 1319) hash function implementation by Tom St Denis */ #ifdef LTC_MD2 @@ -64,7 +64,7 @@ static void md2_update_chksum(hash_state *md) L = md->md2.chksum[15]; for (j = 0; j < 16; j++) { -/* caution, the RFC says its "C[j] = S[M[i*16+j] xor L]" but the reference source code [and test vectors] say +/* caution, the RFC says its "C[j] = S[M[i*16+j] xor L]" but the reference source code [and test vectors] say otherwise. */ L = (md->md2.chksum[j] ^= PI_SUBST[(int)(md->md2.buf[j] ^ L)] & 255); @@ -75,7 +75,7 @@ static void md2_compress(hash_state *md) { int j, k; unsigned char t; - + /* copy block */ for (j = 0; j < 16; j++) { md->md2.X[16+j] = md->md2.buf[j]; @@ -122,9 +122,9 @@ int md2_process(hash_state *md, const unsigned char *in, unsigned long inlen) unsigned long n; LTC_ARGCHK(md != NULL); LTC_ARGCHK(in != NULL); - if (md-> md2 .curlen > sizeof(md-> md2 .buf)) { - return CRYPT_INVALID_ARG; - } + if (md-> md2 .curlen > sizeof(md-> md2 .buf)) { + return CRYPT_INVALID_ARG; + } while (inlen > 0) { n = MIN(inlen, (16 - md->md2.curlen)); XMEMCPY(md->md2.buf + md->md2.curlen, in, (size_t)n); @@ -186,12 +186,12 @@ int md2_done(hash_state * md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int md2_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { char *msg; unsigned char md[16]; @@ -239,7 +239,7 @@ int md2_test(void) return CRYPT_FAIL_TESTVECTOR; } } - return CRYPT_OK; + return CRYPT_OK; #endif } diff --git a/src/hashes/md4.c b/src/hashes/md4.c index adf916b..b2527b5 100644 --- a/src/hashes/md4.c +++ b/src/hashes/md4.c @@ -12,7 +12,7 @@ /** @param md4.c - Submitted by Dobes Vandermeer (dobes@smartt.com) + Submitted by Dobes Vandermeer (dobes@smartt.com) */ #ifdef LTC_MD4 @@ -23,7 +23,7 @@ const struct ltc_hash_descriptor md4_desc = 6, 16, 64, - + /* OID */ { 1, 2, 840, 113549, 2, 4, }, 6, @@ -56,8 +56,8 @@ const struct ltc_hash_descriptor md4_desc = /* ROTATE_LEFT rotates x left n bits. */ #define ROTATE_LEFT(x, n) ROLc(x, n) -/* FF, GG and HH are transformations for rounds 1, 2 and 3 */ -/* Rotation is separate from addition to prevent recomputation */ +/* FF, GG and HH are transformations for rounds 1, 2 and 3 */ +/* Rotation is separate from addition to prevent recomputation */ #define FF(a, b, c, d, x, s) { \ (a) += F ((b), (c), (d)) + (x); \ @@ -91,61 +91,61 @@ static int md4_compress(hash_state *md, unsigned char *buf) for (i = 0; i < 16; i++) { LOAD32L(x[i], buf + (4*i)); } - - /* Round 1 */ - FF (a, b, c, d, x[ 0], S11); /* 1 */ - FF (d, a, b, c, x[ 1], S12); /* 2 */ - FF (c, d, a, b, x[ 2], S13); /* 3 */ - FF (b, c, d, a, x[ 3], S14); /* 4 */ - FF (a, b, c, d, x[ 4], S11); /* 5 */ - FF (d, a, b, c, x[ 5], S12); /* 6 */ - FF (c, d, a, b, x[ 6], S13); /* 7 */ - FF (b, c, d, a, x[ 7], S14); /* 8 */ - FF (a, b, c, d, x[ 8], S11); /* 9 */ + + /* Round 1 */ + FF (a, b, c, d, x[ 0], S11); /* 1 */ + FF (d, a, b, c, x[ 1], S12); /* 2 */ + FF (c, d, a, b, x[ 2], S13); /* 3 */ + FF (b, c, d, a, x[ 3], S14); /* 4 */ + FF (a, b, c, d, x[ 4], S11); /* 5 */ + FF (d, a, b, c, x[ 5], S12); /* 6 */ + FF (c, d, a, b, x[ 6], S13); /* 7 */ + FF (b, c, d, a, x[ 7], S14); /* 8 */ + FF (a, b, c, d, x[ 8], S11); /* 9 */ FF (d, a, b, c, x[ 9], S12); /* 10 */ - FF (c, d, a, b, x[10], S13); /* 11 */ + FF (c, d, a, b, x[10], S13); /* 11 */ FF (b, c, d, a, x[11], S14); /* 12 */ FF (a, b, c, d, x[12], S11); /* 13 */ - FF (d, a, b, c, x[13], S12); /* 14 */ - FF (c, d, a, b, x[14], S13); /* 15 */ - FF (b, c, d, a, x[15], S14); /* 16 */ - - /* Round 2 */ - GG (a, b, c, d, x[ 0], S21); /* 17 */ - GG (d, a, b, c, x[ 4], S22); /* 18 */ - GG (c, d, a, b, x[ 8], S23); /* 19 */ - GG (b, c, d, a, x[12], S24); /* 20 */ - GG (a, b, c, d, x[ 1], S21); /* 21 */ - GG (d, a, b, c, x[ 5], S22); /* 22 */ - GG (c, d, a, b, x[ 9], S23); /* 23 */ - GG (b, c, d, a, x[13], S24); /* 24 */ - GG (a, b, c, d, x[ 2], S21); /* 25 */ - GG (d, a, b, c, x[ 6], S22); /* 26 */ - GG (c, d, a, b, x[10], S23); /* 27 */ - GG (b, c, d, a, x[14], S24); /* 28 */ - GG (a, b, c, d, x[ 3], S21); /* 29 */ - GG (d, a, b, c, x[ 7], S22); /* 30 */ - GG (c, d, a, b, x[11], S23); /* 31 */ - GG (b, c, d, a, x[15], S24); /* 32 */ - + FF (d, a, b, c, x[13], S12); /* 14 */ + FF (c, d, a, b, x[14], S13); /* 15 */ + FF (b, c, d, a, x[15], S14); /* 16 */ + + /* Round 2 */ + GG (a, b, c, d, x[ 0], S21); /* 17 */ + GG (d, a, b, c, x[ 4], S22); /* 18 */ + GG (c, d, a, b, x[ 8], S23); /* 19 */ + GG (b, c, d, a, x[12], S24); /* 20 */ + GG (a, b, c, d, x[ 1], S21); /* 21 */ + GG (d, a, b, c, x[ 5], S22); /* 22 */ + GG (c, d, a, b, x[ 9], S23); /* 23 */ + GG (b, c, d, a, x[13], S24); /* 24 */ + GG (a, b, c, d, x[ 2], S21); /* 25 */ + GG (d, a, b, c, x[ 6], S22); /* 26 */ + GG (c, d, a, b, x[10], S23); /* 27 */ + GG (b, c, d, a, x[14], S24); /* 28 */ + GG (a, b, c, d, x[ 3], S21); /* 29 */ + GG (d, a, b, c, x[ 7], S22); /* 30 */ + GG (c, d, a, b, x[11], S23); /* 31 */ + GG (b, c, d, a, x[15], S24); /* 32 */ + /* Round 3 */ - HH (a, b, c, d, x[ 0], S31); /* 33 */ - HH (d, a, b, c, x[ 8], S32); /* 34 */ - HH (c, d, a, b, x[ 4], S33); /* 35 */ - HH (b, c, d, a, x[12], S34); /* 36 */ - HH (a, b, c, d, x[ 2], S31); /* 37 */ - HH (d, a, b, c, x[10], S32); /* 38 */ - HH (c, d, a, b, x[ 6], S33); /* 39 */ - HH (b, c, d, a, x[14], S34); /* 40 */ - HH (a, b, c, d, x[ 1], S31); /* 41 */ - HH (d, a, b, c, x[ 9], S32); /* 42 */ - HH (c, d, a, b, x[ 5], S33); /* 43 */ - HH (b, c, d, a, x[13], S34); /* 44 */ - HH (a, b, c, d, x[ 3], S31); /* 45 */ - HH (d, a, b, c, x[11], S32); /* 46 */ - HH (c, d, a, b, x[ 7], S33); /* 47 */ - HH (b, c, d, a, x[15], S34); /* 48 */ - + HH (a, b, c, d, x[ 0], S31); /* 33 */ + HH (d, a, b, c, x[ 8], S32); /* 34 */ + HH (c, d, a, b, x[ 4], S33); /* 35 */ + HH (b, c, d, a, x[12], S34); /* 36 */ + HH (a, b, c, d, x[ 2], S31); /* 37 */ + HH (d, a, b, c, x[10], S32); /* 38 */ + HH (c, d, a, b, x[ 6], S33); /* 39 */ + HH (b, c, d, a, x[14], S34); /* 40 */ + HH (a, b, c, d, x[ 1], S31); /* 41 */ + HH (d, a, b, c, x[ 9], S32); /* 42 */ + HH (c, d, a, b, x[ 5], S33); /* 43 */ + HH (b, c, d, a, x[13], S34); /* 44 */ + HH (a, b, c, d, x[ 3], S31); /* 45 */ + HH (d, a, b, c, x[11], S32); /* 46 */ + HH (c, d, a, b, x[ 7], S33); /* 47 */ + HH (b, c, d, a, x[15], S34); /* 48 */ + /* Update our state */ md->md4.state[0] = md->md4.state[0] + a; @@ -242,43 +242,43 @@ int md4_done(hash_state * md, unsigned char *out) } #ifdef LTC_CLEAN_STACK zeromem(md, sizeof(hash_state)); -#endif +#endif return CRYPT_OK; } /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int md4_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct md4_test_case { char *input; unsigned char digest[16]; } cases[] = { - { "", + { "", {0x31, 0xd6, 0xcf, 0xe0, 0xd1, 0x6a, 0xe9, 0x31, 0xb7, 0x3c, 0x59, 0xd7, 0xe0, 0xc0, 0x89, 0xc0} }, { "a", {0xbd, 0xe5, 0x2c, 0xb3, 0x1d, 0xe3, 0x3e, 0x46, 0x24, 0x5e, 0x05, 0xfb, 0xdb, 0xd6, 0xfb, 0x24} }, { "abc", - {0xa4, 0x48, 0x01, 0x7a, 0xaf, 0x21, 0xd8, 0x52, + {0xa4, 0x48, 0x01, 0x7a, 0xaf, 0x21, 0xd8, 0x52, 0x5f, 0xc1, 0x0a, 0xe8, 0x7a, 0xa6, 0x72, 0x9d} }, - { "message digest", - {0xd9, 0x13, 0x0a, 0x81, 0x64, 0x54, 0x9f, 0xe8, + { "message digest", + {0xd9, 0x13, 0x0a, 0x81, 0x64, 0x54, 0x9f, 0xe8, 0x18, 0x87, 0x48, 0x06, 0xe1, 0xc7, 0x01, 0x4b} }, - { "abcdefghijklmnopqrstuvwxyz", - {0xd7, 0x9e, 0x1c, 0x30, 0x8a, 0xa5, 0xbb, 0xcd, + { "abcdefghijklmnopqrstuvwxyz", + {0xd7, 0x9e, 0x1c, 0x30, 0x8a, 0xa5, 0xbb, 0xcd, 0xee, 0xa8, 0xed, 0x63, 0xdf, 0x41, 0x2d, 0xa9} }, - { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789", - {0x04, 0x3f, 0x85, 0x82, 0xf2, 0x41, 0xdb, 0x35, + { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789", + {0x04, 0x3f, 0x85, 0x82, 0xf2, 0x41, 0xdb, 0x35, 0x1c, 0xe6, 0x27, 0xe1, 0x53, 0xe7, 0xf0, 0xe4} }, - { "12345678901234567890123456789012345678901234567890123456789012345678901234567890", - {0xe3, 0x3b, 0x4d, 0xdc, 0x9c, 0x38, 0xf2, 0x19, + { "12345678901234567890123456789012345678901234567890123456789012345678901234567890", + {0xe3, 0x3b, 0x4d, 0xdc, 0x9c, 0x38, 0xf2, 0x19, 0x9c, 0x3e, 0x7b, 0x16, 0x4f, 0xcc, 0x05, 0x36} }, }; int i; diff --git a/src/hashes/md5.c b/src/hashes/md5.c index 4fa1e9e..1d0ec92 100644 --- a/src/hashes/md5.c +++ b/src/hashes/md5.c @@ -13,7 +13,7 @@ /** @file md5.c - LTC_MD5 hash function by Tom St Denis + LTC_MD5 hash function by Tom St Denis */ #ifdef LTC_MD5 @@ -95,7 +95,7 @@ static const ulong32 Korder[64] = { a = (a + I(b,c,d) + M + t); a = ROLc(a, s) + b; -#endif +#endif #ifdef LTC_CLEAN_STACK static int _md5_compress(hash_state *md, unsigned char *buf) @@ -112,7 +112,7 @@ static int md5_compress(hash_state *md, unsigned char *buf) for (i = 0; i < 16; i++) { LOAD32L(W[i], buf + (4*i)); } - + /* copy state */ a = md->md5.state[0]; b = md->md5.state[1]; @@ -309,37 +309,37 @@ int md5_done(hash_state * md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int md5_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { char *msg; unsigned char hash[16]; } tests[] = { { "", - { 0xd4, 0x1d, 0x8c, 0xd9, 0x8f, 0x00, 0xb2, 0x04, + { 0xd4, 0x1d, 0x8c, 0xd9, 0x8f, 0x00, 0xb2, 0x04, 0xe9, 0x80, 0x09, 0x98, 0xec, 0xf8, 0x42, 0x7e } }, { "a", - {0x0c, 0xc1, 0x75, 0xb9, 0xc0, 0xf1, 0xb6, 0xa8, + {0x0c, 0xc1, 0x75, 0xb9, 0xc0, 0xf1, 0xb6, 0xa8, 0x31, 0xc3, 0x99, 0xe2, 0x69, 0x77, 0x26, 0x61 } }, { "abc", - { 0x90, 0x01, 0x50, 0x98, 0x3c, 0xd2, 0x4f, 0xb0, + { 0x90, 0x01, 0x50, 0x98, 0x3c, 0xd2, 0x4f, 0xb0, 0xd6, 0x96, 0x3f, 0x7d, 0x28, 0xe1, 0x7f, 0x72 } }, - { "message digest", - { 0xf9, 0x6b, 0x69, 0x7d, 0x7c, 0xb7, 0x93, 0x8d, - 0x52, 0x5a, 0x2f, 0x31, 0xaa, 0xf1, 0x61, 0xd0 } }, + { "message digest", + { 0xf9, 0x6b, 0x69, 0x7d, 0x7c, 0xb7, 0x93, 0x8d, + 0x52, 0x5a, 0x2f, 0x31, 0xaa, 0xf1, 0x61, 0xd0 } }, { "abcdefghijklmnopqrstuvwxyz", - { 0xc3, 0xfc, 0xd3, 0xd7, 0x61, 0x92, 0xe4, 0x00, + { 0xc3, 0xfc, 0xd3, 0xd7, 0x61, 0x92, 0xe4, 0x00, 0x7d, 0xfb, 0x49, 0x6c, 0xca, 0x67, 0xe1, 0x3b } }, { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789", - { 0xd1, 0x74, 0xab, 0x98, 0xd2, 0x77, 0xd9, 0xf5, + { 0xd1, 0x74, 0xab, 0x98, 0xd2, 0x77, 0xd9, 0xf5, 0xa5, 0x61, 0x1c, 0x2c, 0x9f, 0x41, 0x9d, 0x9f } }, { "12345678901234567890123456789012345678901234567890123456789012345678901234567890", - { 0x57, 0xed, 0xf4, 0xa2, 0x2b, 0xe3, 0xc9, 0x55, - 0xac, 0x49, 0xda, 0x2e, 0x21, 0x07, 0xb6, 0x7a } }, + { 0x57, 0xed, 0xf4, 0xa2, 0x2b, 0xe3, 0xc9, 0x55, + 0xac, 0x49, 0xda, 0x2e, 0x21, 0x07, 0xb6, 0x7a } }, { NULL, { 0 } } }; diff --git a/src/hashes/rmd128.c b/src/hashes/rmd128.c index 58ae927..af16f1f 100644 --- a/src/hashes/rmd128.c +++ b/src/hashes/rmd128.c @@ -13,7 +13,7 @@ /** @param rmd128.c RMD128 Hash function -*/ +*/ /* Implementation of LTC_RIPEMD-128 based on the source by Antoon Bosselaers, ESAT-COSIC * @@ -42,11 +42,11 @@ const struct ltc_hash_descriptor rmd128_desc = }; /* the four basic functions F(), G() and H() */ -#define F(x, y, z) ((x) ^ (y) ^ (z)) -#define G(x, y, z) (((x) & (y)) | (~(x) & (z))) +#define F(x, y, z) ((x) ^ (y) ^ (z)) +#define G(x, y, z) (((x) & (y)) | (~(x) & (z))) #define H(x, y, z) (((x) | ~(y)) ^ (z)) -#define I(x, y, z) (((x) & (z)) | ((y) & ~(z))) - +#define I(x, y, z) (((x) & (z)) | ((y) & ~(z))) + /* the eight basic operations FF() through III() */ #define FF(a, b, c, d, x, s) \ (a) += F((b), (c), (d)) + (x);\ @@ -88,7 +88,7 @@ static int rmd128_compress(hash_state *md, unsigned char *buf) { ulong32 aa,bb,cc,dd,aaa,bbb,ccc,ddd,X[16]; int i; - + /* load words X */ for (i = 0; i < 16; i++){ LOAD32L(X[i], buf + (4 * i)); @@ -117,7 +117,7 @@ static int rmd128_compress(hash_state *md, unsigned char *buf) FF(dd, aa, bb, cc, X[13], 7); FF(cc, dd, aa, bb, X[14], 9); FF(bb, cc, dd, aa, X[15], 8); - + /* round 2 */ GG(aa, bb, cc, dd, X[ 7], 7); GG(dd, aa, bb, cc, X[ 4], 6); @@ -173,7 +173,7 @@ static int rmd128_compress(hash_state *md, unsigned char *buf) II(bb, cc, dd, aa, X[ 2], 12); /* parallel round 1 */ - III(aaa, bbb, ccc, ddd, X[ 5], 8); + III(aaa, bbb, ccc, ddd, X[ 5], 8); III(ddd, aaa, bbb, ccc, X[14], 9); III(ccc, ddd, aaa, bbb, X[ 7], 9); III(bbb, ccc, ddd, aaa, X[ 0], 11); @@ -208,7 +208,7 @@ static int rmd128_compress(hash_state *md, unsigned char *buf) HHH(ccc, ddd, aaa, bbb, X[ 1], 13); HHH(bbb, ccc, ddd, aaa, X[ 2], 11); - /* parallel round 3 */ + /* parallel round 3 */ GGG(aaa, bbb, ccc, ddd, X[15], 9); GGG(ddd, aaa, bbb, ccc, X[ 5], 7); GGG(ccc, ddd, aaa, bbb, X[ 1], 15); @@ -342,13 +342,13 @@ int rmd128_done(hash_state * md, unsigned char *out) #ifdef LTC_CLEAN_STACK zeromem(md, sizeof(hash_state)); #endif - return CRYPT_OK; + return CRYPT_OK; } /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int rmd128_test(void) { #ifndef LTC_TEST diff --git a/src/hashes/rmd160.c b/src/hashes/rmd160.c index 1313e41..ac41e5b 100644 --- a/src/hashes/rmd160.c +++ b/src/hashes/rmd160.c @@ -13,7 +13,7 @@ /** @file rmd160.c RMD160 hash function -*/ +*/ /* Implementation of LTC_RIPEMD-160 based on the source by Antoon Bosselaers, ESAT-COSIC * @@ -42,12 +42,12 @@ const struct ltc_hash_descriptor rmd160_desc = }; /* the five basic functions F(), G() and H() */ -#define F(x, y, z) ((x) ^ (y) ^ (z)) -#define G(x, y, z) (((x) & (y)) | (~(x) & (z))) +#define F(x, y, z) ((x) ^ (y) ^ (z)) +#define G(x, y, z) (((x) & (y)) | (~(x) & (z))) #define H(x, y, z) (((x) | ~(y)) ^ (z)) -#define I(x, y, z) (((x) & (z)) | ((y) & ~(z))) +#define I(x, y, z) (((x) & (z)) | ((y) & ~(z))) #define J(x, y, z) ((x) ^ ((y) | ~(z))) - + /* the ten basic operations FF() through III() */ #define FF(a, b, c, d, e, x, s) \ (a) += F((b), (c), (d)) + (x);\ @@ -138,7 +138,7 @@ static int rmd160_compress(hash_state *md, unsigned char *buf) FF(cc, dd, ee, aa, bb, X[13], 7); FF(bb, cc, dd, ee, aa, X[14], 9); FF(aa, bb, cc, dd, ee, X[15], 8); - + /* round 2 */ GG(ee, aa, bb, cc, dd, X[ 7], 7); GG(dd, ee, aa, bb, cc, X[ 4], 6); @@ -230,7 +230,7 @@ static int rmd160_compress(hash_state *md, unsigned char *buf) JJJ(aaa, bbb, ccc, ddd, eee, X[12], 6); /* parallel round 2 */ - III(eee, aaa, bbb, ccc, ddd, X[ 6], 9); + III(eee, aaa, bbb, ccc, ddd, X[ 6], 9); III(ddd, eee, aaa, bbb, ccc, X[11], 13); III(ccc, ddd, eee, aaa, bbb, X[ 3], 15); III(bbb, ccc, ddd, eee, aaa, X[ 7], 7); @@ -265,7 +265,7 @@ static int rmd160_compress(hash_state *md, unsigned char *buf) HHH(eee, aaa, bbb, ccc, ddd, X[ 4], 7); HHH(ddd, eee, aaa, bbb, ccc, X[13], 5); - /* parallel round 4 */ + /* parallel round 4 */ GGG(ccc, ddd, eee, aaa, bbb, X[ 8], 15); GGG(bbb, ccc, ddd, eee, aaa, X[ 6], 5); GGG(aaa, bbb, ccc, ddd, eee, X[ 4], 8); @@ -407,7 +407,7 @@ int rmd160_done(hash_state * md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int rmd160_test(void) { #ifndef LTC_TEST diff --git a/src/hashes/sha1.c b/src/hashes/sha1.c index 8c846b0..96c3b93 100644 --- a/src/hashes/sha1.c +++ b/src/hashes/sha1.c @@ -12,7 +12,7 @@ /** @file sha1.c - LTC_SHA1 code by Tom St Denis + LTC_SHA1 code by Tom St Denis */ @@ -66,7 +66,7 @@ static int sha1_compress(hash_state *md, unsigned char *buf) /* expand it */ for (i = 16; i < 80; i++) { - W[i] = ROL(W[i-3] ^ W[i-8] ^ W[i-14] ^ W[i-16], 1); + W[i] = ROL(W[i-3] ^ W[i-8] ^ W[i-14] ^ W[i-16], 1); } /* compress */ @@ -75,9 +75,9 @@ static int sha1_compress(hash_state *md, unsigned char *buf) #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); - + #ifdef LTC_SMALL_CODE - + for (i = 0; i < 20; ) { FF0(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; } @@ -105,7 +105,7 @@ static int sha1_compress(hash_state *md, unsigned char *buf) } /* round two */ - for (; i < 40; ) { + for (; i < 40; ) { FF1(a,b,c,d,e,i++); FF1(e,a,b,c,d,i++); FF1(d,e,a,b,c,i++); @@ -114,7 +114,7 @@ static int sha1_compress(hash_state *md, unsigned char *buf) } /* round three */ - for (; i < 60; ) { + for (; i < 60; ) { FF2(a,b,c,d,e,i++); FF2(e,a,b,c,d,i++); FF2(d,e,a,b,c,i++); @@ -123,7 +123,7 @@ static int sha1_compress(hash_state *md, unsigned char *buf) } /* round four */ - for (; i < 80; ) { + for (; i < 80; ) { FF3(a,b,c,d,e,i++); FF3(e,a,b,c,d,i++); FF3(d,e,a,b,c,i++); @@ -241,12 +241,12 @@ int sha1_done(hash_state * md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int sha1_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { char *msg; unsigned char hash[20]; diff --git a/src/hashes/sha2/sha256.c b/src/hashes/sha2/sha256.c index 251ee6d..255c7ec 100644 --- a/src/hashes/sha2/sha256.c +++ b/src/hashes/sha2/sha256.c @@ -12,10 +12,10 @@ /** @file sha256.c - LTC_SHA256 by Tom St Denis + LTC_SHA256 by Tom St Denis */ -#ifdef LTC_SHA256 +#ifdef LTC_SHA256 const struct ltc_hash_descriptor sha256_desc = { @@ -56,7 +56,7 @@ static const ulong32 K[64] = { /* Various logical functions */ #define Ch(x,y,z) (z ^ (x & (y ^ z))) -#define Maj(x,y,z) (((x | y) & z) | (x & y)) +#define Maj(x,y,z) (((x | y) & z) | (x & y)) #define S(x, n) RORc((x),(n)) #define R(x, n) (((x)&0xFFFFFFFFUL)>>(n)) #define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) @@ -90,10 +90,10 @@ static int sha256_compress(hash_state * md, unsigned char *buf) /* fill W[16..63] */ for (i = 16; i < 64; i++) { W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; - } + } /* Compress */ -#ifdef LTC_SMALL_CODE +#ifdef LTC_SMALL_CODE #define RND(a,b,c,d,e,f,g,h,i) \ t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ t1 = Sigma0(a) + Maj(a, b, c); \ @@ -102,10 +102,10 @@ static int sha256_compress(hash_state * md, unsigned char *buf) for (i = 0; i < 64; ++i) { RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i); - t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4]; + t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4]; S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t; - } -#else + } +#else #define RND(a,b,c,d,e,f,g,h,i,ki) \ t0 = h + Sigma1(e) + Ch(e, f, g) + ki + W[i]; \ t1 = Sigma0(a) + Maj(a, b, c); \ @@ -177,9 +177,9 @@ static int sha256_compress(hash_state * md, unsigned char *buf) RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],62,0xbef9a3f7); RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],63,0xc67178f2); -#undef RND - -#endif +#undef RND + +#endif /* feedback */ for (i = 0; i < 8; i++) { @@ -287,12 +287,12 @@ int sha256_done(hash_state * md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int sha256_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { char *msg; unsigned char hash[32]; @@ -304,9 +304,9 @@ int sha256_test(void) 0xb4, 0x10, 0xff, 0x61, 0xf2, 0x00, 0x15, 0xad } }, { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", - { 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8, + { 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8, 0xe5, 0xc0, 0x26, 0x93, 0x0c, 0x3e, 0x60, 0x39, - 0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67, + 0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67, 0xf6, 0xec, 0xed, 0xd4, 0x19, 0xdb, 0x06, 0xc1 } }, }; diff --git a/src/hashes/sha2/sha512.c b/src/hashes/sha2/sha512.c index 44dd3e0..fbf14de 100644 --- a/src/hashes/sha2/sha512.c +++ b/src/hashes/sha2/sha512.c @@ -12,7 +12,7 @@ /** @param sha512.c - LTC_SHA512 by Tom St Denis + LTC_SHA512 by Tom St Denis */ #ifdef LTC_SHA512 @@ -37,51 +37,51 @@ const struct ltc_hash_descriptor sha512_desc = /* the K array */ static const ulong64 K[80] = { -CONST64(0x428a2f98d728ae22), CONST64(0x7137449123ef65cd), +CONST64(0x428a2f98d728ae22), CONST64(0x7137449123ef65cd), CONST64(0xb5c0fbcfec4d3b2f), CONST64(0xe9b5dba58189dbbc), -CONST64(0x3956c25bf348b538), CONST64(0x59f111f1b605d019), +CONST64(0x3956c25bf348b538), CONST64(0x59f111f1b605d019), CONST64(0x923f82a4af194f9b), CONST64(0xab1c5ed5da6d8118), -CONST64(0xd807aa98a3030242), CONST64(0x12835b0145706fbe), +CONST64(0xd807aa98a3030242), CONST64(0x12835b0145706fbe), CONST64(0x243185be4ee4b28c), CONST64(0x550c7dc3d5ffb4e2), -CONST64(0x72be5d74f27b896f), CONST64(0x80deb1fe3b1696b1), +CONST64(0x72be5d74f27b896f), CONST64(0x80deb1fe3b1696b1), CONST64(0x9bdc06a725c71235), CONST64(0xc19bf174cf692694), -CONST64(0xe49b69c19ef14ad2), CONST64(0xefbe4786384f25e3), +CONST64(0xe49b69c19ef14ad2), CONST64(0xefbe4786384f25e3), CONST64(0x0fc19dc68b8cd5b5), CONST64(0x240ca1cc77ac9c65), -CONST64(0x2de92c6f592b0275), CONST64(0x4a7484aa6ea6e483), +CONST64(0x2de92c6f592b0275), CONST64(0x4a7484aa6ea6e483), CONST64(0x5cb0a9dcbd41fbd4), CONST64(0x76f988da831153b5), -CONST64(0x983e5152ee66dfab), CONST64(0xa831c66d2db43210), +CONST64(0x983e5152ee66dfab), CONST64(0xa831c66d2db43210), CONST64(0xb00327c898fb213f), CONST64(0xbf597fc7beef0ee4), -CONST64(0xc6e00bf33da88fc2), CONST64(0xd5a79147930aa725), +CONST64(0xc6e00bf33da88fc2), CONST64(0xd5a79147930aa725), CONST64(0x06ca6351e003826f), CONST64(0x142929670a0e6e70), -CONST64(0x27b70a8546d22ffc), CONST64(0x2e1b21385c26c926), +CONST64(0x27b70a8546d22ffc), CONST64(0x2e1b21385c26c926), CONST64(0x4d2c6dfc5ac42aed), CONST64(0x53380d139d95b3df), -CONST64(0x650a73548baf63de), CONST64(0x766a0abb3c77b2a8), +CONST64(0x650a73548baf63de), CONST64(0x766a0abb3c77b2a8), CONST64(0x81c2c92e47edaee6), CONST64(0x92722c851482353b), CONST64(0xa2bfe8a14cf10364), CONST64(0xa81a664bbc423001), CONST64(0xc24b8b70d0f89791), CONST64(0xc76c51a30654be30), -CONST64(0xd192e819d6ef5218), CONST64(0xd69906245565a910), +CONST64(0xd192e819d6ef5218), CONST64(0xd69906245565a910), CONST64(0xf40e35855771202a), CONST64(0x106aa07032bbd1b8), -CONST64(0x19a4c116b8d2d0c8), CONST64(0x1e376c085141ab53), +CONST64(0x19a4c116b8d2d0c8), CONST64(0x1e376c085141ab53), CONST64(0x2748774cdf8eeb99), CONST64(0x34b0bcb5e19b48a8), -CONST64(0x391c0cb3c5c95a63), CONST64(0x4ed8aa4ae3418acb), +CONST64(0x391c0cb3c5c95a63), CONST64(0x4ed8aa4ae3418acb), CONST64(0x5b9cca4f7763e373), CONST64(0x682e6ff3d6b2b8a3), -CONST64(0x748f82ee5defb2fc), CONST64(0x78a5636f43172f60), +CONST64(0x748f82ee5defb2fc), CONST64(0x78a5636f43172f60), CONST64(0x84c87814a1f0ab72), CONST64(0x8cc702081a6439ec), -CONST64(0x90befffa23631e28), CONST64(0xa4506cebde82bde9), +CONST64(0x90befffa23631e28), CONST64(0xa4506cebde82bde9), CONST64(0xbef9a3f7b2c67915), CONST64(0xc67178f2e372532b), -CONST64(0xca273eceea26619c), CONST64(0xd186b8c721c0c207), +CONST64(0xca273eceea26619c), CONST64(0xd186b8c721c0c207), CONST64(0xeada7dd6cde0eb1e), CONST64(0xf57d4f7fee6ed178), -CONST64(0x06f067aa72176fba), CONST64(0x0a637dc5a2c898a6), +CONST64(0x06f067aa72176fba), CONST64(0x0a637dc5a2c898a6), CONST64(0x113f9804bef90dae), CONST64(0x1b710b35131c471b), -CONST64(0x28db77f523047d84), CONST64(0x32caab7b40c72493), +CONST64(0x28db77f523047d84), CONST64(0x32caab7b40c72493), CONST64(0x3c9ebe0a15c9bebc), CONST64(0x431d67c49c100d4c), -CONST64(0x4cc5d4becb3e42b6), CONST64(0x597f299cfc657e2a), +CONST64(0x4cc5d4becb3e42b6), CONST64(0x597f299cfc657e2a), CONST64(0x5fcb6fab3ad6faec), CONST64(0x6c44198c4a475817) }; /* Various logical functions */ #define Ch(x,y,z) (z ^ (x & (y ^ z))) -#define Maj(x,y,z) (((x | y) & z) | (x & y)) +#define Maj(x,y,z) (((x | y) & z) | (x & y)) #define S(x, n) ROR64c(x, n) #define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n)) #define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) @@ -112,7 +112,7 @@ static int sha512_compress(hash_state * md, unsigned char *buf) /* fill W[16..79] */ for (i = 16; i < 80; i++) { W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; - } + } /* Compress */ #ifdef LTC_SMALL_CODE @@ -145,7 +145,7 @@ static int sha512_compress(hash_state * md, unsigned char *buf) RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6); RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7); } -#endif +#endif /* feedback */ @@ -232,7 +232,7 @@ int sha512_done(hash_state * md, unsigned char *out) md->sha512.curlen = 0; } - /* pad upto 120 bytes of zeroes + /* pad upto 120 bytes of zeroes * note: that from 112 to 120 is the 64 MSB of the length. We assume that you won't hash * > 2^64 bits of data... :-) */ @@ -257,12 +257,12 @@ int sha512_done(hash_state * md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int sha512_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { char *msg; unsigned char hash[64]; diff --git a/src/hashes/tiger.c b/src/hashes/tiger.c index 4d8c659..dcacb64 100644 --- a/src/hashes/tiger.c +++ b/src/hashes/tiger.c @@ -558,16 +558,16 @@ static const ulong64 table[4*256] = { #ifdef _MSC_VER #define INLINE __inline #else - #define INLINE -#endif + #define INLINE +#endif /* one round of the hash function */ INLINE static void tiger_round(ulong64 *a, ulong64 *b, ulong64 *c, ulong64 x, int mul) { ulong64 tmp; - tmp = (*c ^= x); - *a -= t1[byte(tmp, 0)] ^ t2[byte(tmp, 2)] ^ t3[byte(tmp, 4)] ^ t4[byte(tmp, 6)]; - tmp = (*b += t4[byte(tmp, 1)] ^ t3[byte(tmp, 3)] ^ t2[byte(tmp,5)] ^ t1[byte(tmp,7)]); + tmp = (*c ^= x); + *a -= t1[byte(tmp, 0)] ^ t2[byte(tmp, 2)] ^ t3[byte(tmp, 4)] ^ t4[byte(tmp, 6)]; + tmp = (*b += t4[byte(tmp, 1)] ^ t3[byte(tmp, 3)] ^ t2[byte(tmp,5)] ^ t1[byte(tmp,7)]); switch (mul) { case 5: *b = (tmp << 2) + tmp; break; case 7: *b = (tmp << 3) - tmp; break; @@ -578,36 +578,36 @@ INLINE static void tiger_round(ulong64 *a, ulong64 *b, ulong64 *c, ulong64 x, in /* one complete pass */ static void pass(ulong64 *a, ulong64 *b, ulong64 *c, ulong64 *x, int mul) { - tiger_round(a,b,c,x[0],mul); - tiger_round(b,c,a,x[1],mul); - tiger_round(c,a,b,x[2],mul); - tiger_round(a,b,c,x[3],mul); - tiger_round(b,c,a,x[4],mul); - tiger_round(c,a,b,x[5],mul); - tiger_round(a,b,c,x[6],mul); - tiger_round(b,c,a,x[7],mul); -} + tiger_round(a,b,c,x[0],mul); + tiger_round(b,c,a,x[1],mul); + tiger_round(c,a,b,x[2],mul); + tiger_round(a,b,c,x[3],mul); + tiger_round(b,c,a,x[4],mul); + tiger_round(c,a,b,x[5],mul); + tiger_round(a,b,c,x[6],mul); + tiger_round(b,c,a,x[7],mul); +} /* The key mixing schedule */ -static void key_schedule(ulong64 *x) +static void key_schedule(ulong64 *x) { - x[0] -= x[7] ^ CONST64(0xA5A5A5A5A5A5A5A5); - x[1] ^= x[0]; - x[2] += x[1]; - x[3] -= x[2] ^ ((~x[1])<<19); - x[4] ^= x[3]; - x[5] += x[4]; - x[6] -= x[5] ^ ((~x[4])>>23); - x[7] ^= x[6]; - x[0] += x[7]; - x[1] -= x[0] ^ ((~x[7])<<19); - x[2] ^= x[1]; - x[3] += x[2]; - x[4] -= x[3] ^ ((~x[2])>>23); - x[5] ^= x[4]; - x[6] += x[5]; + x[0] -= x[7] ^ CONST64(0xA5A5A5A5A5A5A5A5); + x[1] ^= x[0]; + x[2] += x[1]; + x[3] -= x[2] ^ ((~x[1])<<19); + x[4] ^= x[3]; + x[5] += x[4]; + x[6] -= x[5] ^ ((~x[4])>>23); + x[7] ^= x[6]; + x[0] += x[7]; + x[1] -= x[0] ^ ((~x[7])<<19); + x[2] ^= x[1]; + x[3] += x[2]; + x[4] -= x[3] ^ ((~x[2])>>23); + x[5] ^= x[4]; + x[6] += x[5]; x[7] -= x[6] ^ CONST64(0x0123456789ABCDEF); -} +} #ifdef LTC_CLEAN_STACK static int _tiger_compress(hash_state *md, unsigned char *buf) @@ -709,7 +709,7 @@ int tiger_done(hash_state * md, unsigned char *out) /* pad upto 56 bytes of zeroes */ while (md->tiger.curlen < 56) { - md->tiger.buf[md->tiger.curlen++] = (unsigned char)0; + md->tiger.buf[md->tiger.curlen++] = (unsigned char)0; } /* store length */ @@ -730,12 +730,12 @@ int tiger_done(hash_state * md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int tiger_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { char *msg; unsigned char hash[24]; diff --git a/src/mac/f9/f9_done.c b/src/mac/f9/f9_done.c index 8da4c73..9bcf1b5 100644 --- a/src/mac/f9/f9_done.c +++ b/src/mac/f9/f9_done.c @@ -62,7 +62,7 @@ int f9_done(f9_state *f9, unsigned char *out, unsigned long *outlen) out[x] = f9->ACC[x]; } *outlen = x; - + #ifdef LTC_CLEAN_STACK zeromem(f9, sizeof(*f9)); #endif diff --git a/src/mac/f9/f9_file.c b/src/mac/f9/f9_file.c index 88216a9..49d732b 100644 --- a/src/mac/f9/f9_file.c +++ b/src/mac/f9/f9_file.c @@ -10,7 +10,7 @@ */ #include "tomcrypt.h" -/** +/** @file f9_file.c f9 support, process a file, Tom St Denis */ @@ -29,7 +29,7 @@ */ int f9_file(int cipher, const unsigned char *key, unsigned long keylen, - const char *filename, + const char *filename, unsigned char *out, unsigned long *outlen) { #ifdef LTC_NO_FILE diff --git a/src/mac/f9/f9_init.c b/src/mac/f9/f9_init.c index b6b878f..ec026b9 100644 --- a/src/mac/f9/f9_init.c +++ b/src/mac/f9/f9_init.c @@ -45,12 +45,12 @@ int f9_init(f9_state *f9, int cipher, const unsigned char *key, unsigned long ke if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &f9->key)) != CRYPT_OK) { goto done; } - + /* make the second key */ for (x = 0; (unsigned)x < keylen; x++) { f9->akey[x] = key[x] ^ 0xAA; } - + /* setup struct */ zeromem(f9->IV, cipher_descriptor[cipher].block_length); zeromem(f9->ACC, cipher_descriptor[cipher].block_length); diff --git a/src/mac/f9/f9_memory.c b/src/mac/f9/f9_memory.c index 0850dc3..e07a05c 100644 --- a/src/mac/f9/f9_memory.c +++ b/src/mac/f9/f9_memory.c @@ -17,7 +17,7 @@ #ifdef LTC_F9_MODE -/** f9-MAC a block of memory +/** f9-MAC a block of memory @param cipher Index of cipher to use @param key [in] Secret key @param keylen Length of key in octets @@ -27,7 +27,7 @@ @param outlen [in/out] Output size and final tag size Return CRYPT_OK on success. */ -int f9_memory(int cipher, +int f9_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) diff --git a/src/mac/f9/f9_memory_multi.c b/src/mac/f9/f9_memory_multi.c index 7a13ff9..6c8f2dc 100644 --- a/src/mac/f9/f9_memory_multi.c +++ b/src/mac/f9/f9_memory_multi.c @@ -11,7 +11,7 @@ #include "tomcrypt.h" #include -/** +/** @file f9_memory_multi.c f9 support, process multiple blocks of memory, Tom St Denis */ @@ -19,7 +19,7 @@ #ifdef LTC_F9_MODE /** - f9 multiple blocks of memory + f9 multiple blocks of memory @param cipher The index of the desired cipher @param key The secret key @param keylen The length of the secret key (octets) @@ -30,7 +30,7 @@ @param ... tuples of (data,len) pairs to f9, terminated with a (NULL,x) (x=don't care) @return CRYPT_OK if successful */ -int f9_memory_multi(int cipher, +int f9_memory_multi(int cipher, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...) @@ -57,7 +57,7 @@ int f9_memory_multi(int cipher, goto LBL_ERR; } va_start(args, inlen); - curptr = in; + curptr = in; curlen = inlen; for (;;) { /* process buf */ @@ -80,7 +80,7 @@ LBL_ERR: #endif XFREE(f9); va_end(args); - return err; + return err; } #endif diff --git a/src/mac/f9/f9_test.c b/src/mac/f9/f9_test.c index b92c630..d08f6d2 100644 --- a/src/mac/f9/f9_test.c +++ b/src/mac/f9/f9_test.c @@ -12,7 +12,7 @@ /** @file f9_test.c - f9 Support, Test F9 mode + f9 Support, Test F9 mode */ #ifdef LTC_F9_MODE @@ -39,7 +39,7 @@ int f9_test(void) { 105, { 0x83, 0xFD, 0x23, 0xA2, 0x44, 0xA7, 0x4C, 0xF3, 0x58, 0xDA, 0x30, 0x19, 0xF1, 0x72, 0x26, 0x35 }, - { 0x36, 0xAF, 0x61, 0x44, 0x4F, 0x30, 0x2A, 0xD2, + { 0x36, 0xAF, 0x61, 0x44, 0x4F, 0x30, 0x2A, 0xD2, 0x35, 0xC6, 0x87, 0x16, 0x63, 0x3C, 0x66, 0xFB, 0x75, 0x0C, 0x26, 0x68, 0x65, 0xD5, 0x3C, 0x11, 0xEA, 0x05, 0xB1, 0xE9, 0xFA, 0x49, 0xC8, 0x39, 0x8D, 0x48, 0xE1, 0xEF, 0xA5, 0x90, 0x9D, 0x39, 0x47, 0x90, 0x28, 0x37, 0xF5, 0xAE, 0x96, 0xD5, 0xA0, 0x5B, 0xC8, 0xD6, 0x1C, 0xA8, 0xDB, 0xEF, 0x1B, 0x13, 0xA4, 0xB4, 0xAB, 0xFE, 0x4F, 0xB1, 0x00, 0x60, 0x45, 0xB6, 0x74, 0xBB, 0x54, 0x72, 0x93, 0x04, 0xC3, 0x82, 0xBE, 0x53, 0xA5, 0xAF, 0x05, 0x55, 0x61, 0x76, 0xF6, 0xEA, 0xA2, 0xEF, 0x1D, 0x05, 0xE4, 0xB0, 0x83, 0x18, 0x1E, 0xE6, 0x74, 0xCD, 0xA5, 0xA4, 0x85, 0xF7, 0x4D, 0x7A, diff --git a/src/mac/pelican/pelican_memory.c b/src/mac/pelican/pelican_memory.c index 6eabaa1..f5e7b4a 100644 --- a/src/mac/pelican/pelican_memory.c +++ b/src/mac/pelican/pelican_memory.c @@ -10,9 +10,9 @@ */ #include "tomcrypt.h" -/** +/** @file pelican_memory.c - Pelican MAC, MAC a block of memory, by Tom St Denis + Pelican MAC, MAC a block of memory, by Tom St Denis */ #ifdef LTC_PELICAN @@ -23,7 +23,7 @@ @param keylen The length of the key (octets) @param in The input to MAC @param inlen The length of the input (octets) - @param out [out] The output TAG + @param out [out] The output TAG @return CRYPT_OK on success */ int pelican_memory(const unsigned char *key, unsigned long keylen, @@ -34,7 +34,7 @@ int pelican_memory(const unsigned char *key, unsigned long keylen, int err; pel = XMALLOC(sizeof(*pel)); - if (pel == NULL) { + if (pel == NULL) { return CRYPT_MEM; } @@ -47,7 +47,7 @@ int pelican_memory(const unsigned char *key, unsigned long keylen, return err; } err = pelican_done(pel, out); - XFREE(pel); + XFREE(pel); return err; } diff --git a/src/mac/pelican/pelican_test.c b/src/mac/pelican/pelican_test.c index e743faa..230026b 100644 --- a/src/mac/pelican/pelican_test.c +++ b/src/mac/pelican/pelican_test.c @@ -10,9 +10,9 @@ */ #include "tomcrypt.h" -/** +/** @file pelican_test.c - Pelican MAC, test, by Tom St Denis + Pelican MAC, test, by Tom St Denis */ #ifdef LTC_PELICAN @@ -31,7 +31,7 @@ int pelican_test(void) { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F }, { 0 }, - { 0xeb, 0x58, 0x37, 0x15, 0xf8, 0x34, 0xde, 0xe5, + { 0xeb, 0x58, 0x37, 0x15, 0xf8, 0x34, 0xde, 0xe5, 0xa4, 0xd1, 0x6e, 0xe4, 0xb9, 0xd7, 0x76, 0x0e, }, 16, 0 }, @@ -41,7 +41,7 @@ int pelican_test(void) { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F }, { 0x00, 0x01, 0x02 }, - { 0x1c, 0x97, 0x40, 0x60, 0x6c, 0x58, 0x17, 0x2d, + { 0x1c, 0x97, 0x40, 0x60, 0x6c, 0x58, 0x17, 0x2d, 0x03, 0x94, 0x19, 0x70, 0x81, 0xc4, 0x38, 0x54, }, 16, 3 }, @@ -52,7 +52,7 @@ int pelican_test(void) 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F }, { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F }, - { 0x03, 0xcc, 0x46, 0xb8, 0xac, 0xa7, 0x9c, 0x36, + { 0x03, 0xcc, 0x46, 0xb8, 0xac, 0xa7, 0x9c, 0x36, 0x1e, 0x8c, 0x6e, 0xa6, 0x7b, 0x89, 0x32, 0x49, }, 16, 16 }, @@ -65,7 +65,7 @@ int pelican_test(void) 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F, 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1A, 0x1B, 0x1C, 0x1D, 0x1E, 0x1F }, - { 0x89, 0xcc, 0x36, 0x58, 0x1b, 0xdd, 0x4d, 0xb5, + { 0x89, 0xcc, 0x36, 0x58, 0x1b, 0xdd, 0x4d, 0xb5, 0x78, 0xbb, 0xac, 0xf0, 0xff, 0x8b, 0x08, 0x15, }, 16, 32 }, @@ -79,7 +79,7 @@ int pelican_test(void) 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1A, 0x1B, 0x1C, 0x1D, 0x1E, 0x1F, 0x20, 0x21, 0x23 }, - { 0x4a, 0x7d, 0x45, 0x4d, 0xcd, 0xb5, 0xda, 0x8d, + { 0x4a, 0x7d, 0x45, 0x4d, 0xcd, 0xb5, 0xda, 0x8d, 0x48, 0x78, 0x16, 0x48, 0x5d, 0x45, 0x95, 0x99, }, 16, 35 }, @@ -87,8 +87,8 @@ int pelican_test(void) int x, err; unsigned char out[16]; pelican_state pel; - - for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { if ((err = pelican_init(&pel, tests[x].K, tests[x].keylen)) != CRYPT_OK) { return err; } diff --git a/src/mac/pmac/pmac_done.c b/src/mac/pmac/pmac_done.c index 88076c6..6ad5646 100644 --- a/src/mac/pmac/pmac_done.c +++ b/src/mac/pmac/pmac_done.c @@ -10,9 +10,9 @@ */ #include "tomcrypt.h" -/** +/** @file pmac_done.c - PMAC implementation, terminate a session, by Tom St Denis + PMAC implementation, terminate a session, by Tom St Denis */ #ifdef LTC_PMAC diff --git a/src/mac/pmac/pmac_file.c b/src/mac/pmac/pmac_file.c index c7a9f74..c6849d7 100644 --- a/src/mac/pmac/pmac_file.c +++ b/src/mac/pmac/pmac_file.c @@ -10,15 +10,15 @@ */ #include "tomcrypt.h" -/** +/** @file pmac_file.c - PMAC implementation, process a file, by Tom St Denis + PMAC implementation, process a file, by Tom St Denis */ #ifdef LTC_PMAC /** - PMAC a file + PMAC a file @param cipher The index of the cipher desired @param key The secret key @param keylen The length of the secret key (octets) @@ -27,9 +27,9 @@ @param outlen [in/out] Max size and resulting size of the authentication tag @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled */ -int pmac_file(int cipher, +int pmac_file(int cipher, const unsigned char *key, unsigned long keylen, - const char *filename, + const char *filename, unsigned char *out, unsigned long *outlen) { #ifdef LTC_NO_FILE diff --git a/src/mac/pmac/pmac_memory.c b/src/mac/pmac/pmac_memory.c index 70b9616..f73244a 100644 --- a/src/mac/pmac/pmac_memory.c +++ b/src/mac/pmac/pmac_memory.c @@ -10,9 +10,9 @@ */ #include "tomcrypt.h" -/** +/** @file pmac_memory.c - PMAC implementation, process a block of memory, by Tom St Denis + PMAC implementation, process a block of memory, by Tom St Denis */ #ifdef LTC_PMAC @@ -28,7 +28,7 @@ @param outlen [in/out] The max size and resulting size of the authentication tag @return CRYPT_OK if successful */ -int pmac_memory(int cipher, +int pmac_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) @@ -46,7 +46,7 @@ int pmac_memory(int cipher, if (pmac == NULL) { return CRYPT_MEM; } - + if ((err = pmac_init(pmac, cipher, key, keylen)) != CRYPT_OK) { goto LBL_ERR; } @@ -64,7 +64,7 @@ LBL_ERR: #endif XFREE(pmac); - return err; + return err; } #endif diff --git a/src/mac/pmac/pmac_memory_multi.c b/src/mac/pmac/pmac_memory_multi.c index 36783d3..913840a 100644 --- a/src/mac/pmac/pmac_memory_multi.c +++ b/src/mac/pmac/pmac_memory_multi.c @@ -11,9 +11,9 @@ #include "tomcrypt.h" #include -/** +/** @file pmac_memory_multi.c - PMAC implementation, process multiple blocks of memory, by Tom St Denis + PMAC implementation, process multiple blocks of memory, by Tom St Denis */ #ifdef LTC_PMAC @@ -30,7 +30,7 @@ @param ... tuples of (data,len) pairs to PMAC, terminated with a (NULL,x) (x=don't care) @return CRYPT_OK if successful */ -int pmac_memory_multi(int cipher, +int pmac_memory_multi(int cipher, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...) @@ -51,12 +51,12 @@ int pmac_memory_multi(int cipher, if (pmac == NULL) { return CRYPT_MEM; } - + if ((err = pmac_init(pmac, cipher, key, keylen)) != CRYPT_OK) { goto LBL_ERR; } va_start(args, inlen); - curptr = in; + curptr = in; curlen = inlen; for (;;) { /* process buf */ @@ -79,7 +79,7 @@ LBL_ERR: #endif XFREE(pmac); va_end(args); - return err; + return err; } #endif diff --git a/src/mac/pmac/pmac_ntz.c b/src/mac/pmac/pmac_ntz.c index b5137da..2e649f9 100644 --- a/src/mac/pmac/pmac_ntz.c +++ b/src/mac/pmac/pmac_ntz.c @@ -10,9 +10,9 @@ */ #include "tomcrypt.h" -/** +/** @file pmac_ntz.c - PMAC implementation, internal function, by Tom St Denis + PMAC implementation, internal function, by Tom St Denis */ #ifdef LTC_PMAC diff --git a/src/mac/pmac/pmac_shift_xor.c b/src/mac/pmac/pmac_shift_xor.c index 122cadb..27aa6cc 100644 --- a/src/mac/pmac/pmac_shift_xor.c +++ b/src/mac/pmac/pmac_shift_xor.c @@ -10,9 +10,9 @@ */ #include "tomcrypt.h" -/** +/** @file pmac_shift_xor.c - PMAC implementation, internal function, by Tom St Denis + PMAC implementation, internal function, by Tom St Denis */ #ifdef LTC_PMAC diff --git a/src/mac/pmac/pmac_test.c b/src/mac/pmac/pmac_test.c index fe91c64..253cb5f 100644 --- a/src/mac/pmac/pmac_test.c +++ b/src/mac/pmac/pmac_test.c @@ -10,15 +10,15 @@ */ #include "tomcrypt.h" -/** +/** @file pmac_test.c - PMAC implementation, self-test, by Tom St Denis + PMAC implementation, self-test, by Tom St Denis */ #ifdef LTC_PMAC -/** +/** Test the LTC_OMAC implementation @return CRYPT_OK if successful, CRYPT_NOP if testing has been disabled */ @@ -27,7 +27,7 @@ int pmac_test(void) #if !defined(LTC_TEST) return CRYPT_NOP; #else - static const struct { + static const struct { int msglen; unsigned char key[16], msg[34], tag[16]; } tests[] = { @@ -125,7 +125,7 @@ int pmac_test(void) unsigned long len; unsigned char outtag[MAXBLOCKSIZE]; - /* AES can be under rijndael or aes... try to find it */ + /* AES can be under rijndael or aes... try to find it */ if ((idx = find_cipher("aes")) == -1) { if ((idx = find_cipher("rijndael")) == -1) { return CRYPT_NOP; @@ -137,7 +137,7 @@ int pmac_test(void) if ((err = pmac_memory(idx, tests[x].key, 16, tests[x].msg, tests[x].msglen, outtag, &len)) != CRYPT_OK) { return err; } - + if (XMEMCMP(outtag, tests[x].tag, len)) { #if 0 unsigned long y; @@ -158,7 +158,7 @@ int pmac_test(void) #endif /* PMAC_MODE */ - + /* $Source$ */ /* $Revision$ */ diff --git a/src/mac/xcbc/xcbc_done.c b/src/mac/xcbc/xcbc_done.c index 6640eeb..1573263 100644 --- a/src/mac/xcbc/xcbc_done.c +++ b/src/mac/xcbc/xcbc_done.c @@ -62,7 +62,7 @@ int xcbc_done(xcbc_state *xcbc, unsigned char *out, unsigned long *outlen) out[x] = xcbc->IV[x]; } *outlen = x; - + #ifdef LTC_CLEAN_STACK zeromem(xcbc, sizeof(*xcbc)); #endif diff --git a/src/mac/xcbc/xcbc_file.c b/src/mac/xcbc/xcbc_file.c index 3d75b4e..dd7767f 100644 --- a/src/mac/xcbc/xcbc_file.c +++ b/src/mac/xcbc/xcbc_file.c @@ -10,7 +10,7 @@ */ #include "tomcrypt.h" -/** +/** @file xcbc_file.c XCBC support, process a file, Tom St Denis */ @@ -27,9 +27,9 @@ @param outlen [in/out] The max size and resulting size of the authentication tag @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled */ -int xcbc_file(int cipher, +int xcbc_file(int cipher, const unsigned char *key, unsigned long keylen, - const char *filename, + const char *filename, unsigned char *out, unsigned long *outlen) { #ifdef LTC_NO_FILE diff --git a/src/mac/xcbc/xcbc_init.c b/src/mac/xcbc/xcbc_init.c index 94c9d79..b4ad2e9 100644 --- a/src/mac/xcbc/xcbc_init.c +++ b/src/mac/xcbc/xcbc_init.c @@ -71,7 +71,7 @@ int xcbc_init(xcbc_state *xcbc, int cipher, const unsigned char *key, unsigned l if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, skey)) != CRYPT_OK) { goto done; } - + /* make the three keys */ for (y = 0; y < 3; y++) { for (x = 0; x < cipher_descriptor[cipher].block_length; x++) { @@ -80,10 +80,10 @@ int xcbc_init(xcbc_state *xcbc, int cipher, const unsigned char *key, unsigned l cipher_descriptor[cipher].ecb_encrypt(xcbc->K[y], xcbc->K[y], skey); } } - + /* setup K1 */ err = cipher_descriptor[cipher].setup(xcbc->K[0], k1, 0, &xcbc->key); - + /* setup struct */ zeromem(xcbc->IV, cipher_descriptor[cipher].block_length); xcbc->blocksize = cipher_descriptor[cipher].block_length; @@ -91,7 +91,7 @@ int xcbc_init(xcbc_state *xcbc, int cipher, const unsigned char *key, unsigned l xcbc->buflen = 0; done: cipher_descriptor[cipher].done(skey); - if (skey != NULL) { + if (skey != NULL) { #ifdef LTC_CLEAN_STACK zeromem(skey, sizeof(*skey)); #endif diff --git a/src/mac/xcbc/xcbc_memory.c b/src/mac/xcbc/xcbc_memory.c index 124817a..aac9298 100644 --- a/src/mac/xcbc/xcbc_memory.c +++ b/src/mac/xcbc/xcbc_memory.c @@ -17,7 +17,7 @@ #ifdef LTC_XCBC -/** XCBC-MAC a block of memory +/** XCBC-MAC a block of memory @param cipher Index of cipher to use @param key [in] Secret key @param keylen Length of key in octets @@ -27,7 +27,7 @@ @param outlen [in/out] Output size and final tag size Return CRYPT_OK on success. */ -int xcbc_memory(int cipher, +int xcbc_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) diff --git a/src/mac/xcbc/xcbc_memory_multi.c b/src/mac/xcbc/xcbc_memory_multi.c index a237907..994bdce 100644 --- a/src/mac/xcbc/xcbc_memory_multi.c +++ b/src/mac/xcbc/xcbc_memory_multi.c @@ -11,7 +11,7 @@ #include "tomcrypt.h" #include -/** +/** @file xcbc_memory_multi.c XCBC support, process multiple blocks of memory, Tom St Denis */ @@ -19,7 +19,7 @@ #ifdef LTC_XCBC /** - XCBC multiple blocks of memory + XCBC multiple blocks of memory @param cipher The index of the desired cipher @param key The secret key @param keylen The length of the secret key (octets) @@ -30,7 +30,7 @@ @param ... tuples of (data,len) pairs to XCBC, terminated with a (NULL,x) (x=don't care) @return CRYPT_OK if successful */ -int xcbc_memory_multi(int cipher, +int xcbc_memory_multi(int cipher, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...) @@ -57,7 +57,7 @@ int xcbc_memory_multi(int cipher, goto LBL_ERR; } va_start(args, inlen); - curptr = in; + curptr = in; curlen = inlen; for (;;) { /* process buf */ @@ -80,7 +80,7 @@ LBL_ERR: #endif XFREE(xcbc); va_end(args); - return err; + return err; } #endif diff --git a/src/mac/xcbc/xcbc_test.c b/src/mac/xcbc/xcbc_test.c index 1bd5840..f7610b2 100644 --- a/src/mac/xcbc/xcbc_test.c +++ b/src/mac/xcbc/xcbc_test.c @@ -31,64 +31,64 @@ int xcbc_test(void) } tests[] = { { 0, - { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, { 0 }, - { 0x75, 0xf0, 0x25, 0x1d, 0x52, 0x8a, 0xc0, 0x1c, + { 0x75, 0xf0, 0x25, 0x1d, 0x52, 0x8a, 0xc0, 0x1c, 0x45, 0x73, 0xdf, 0xd5, 0x84, 0xd7, 0x9f, 0x29 } }, { 3, - { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, { 0x00, 0x01, 0x02 }, - { 0x5b, 0x37, 0x65, 0x80, 0xae, 0x2f, 0x19, 0xaf, + { 0x5b, 0x37, 0x65, 0x80, 0xae, 0x2f, 0x19, 0xaf, 0xe7, 0x21, 0x9c, 0xee, 0xf1, 0x72, 0x75, 0x6f } }, { 16, - { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, - { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, - { 0xd2, 0xa2, 0x46, 0xfa, 0x34, 0x9b, 0x68, 0xa7, + { 0xd2, 0xa2, 0x46, 0xfa, 0x34, 0x9b, 0x68, 0xa7, 0x99, 0x98, 0xa4, 0x39, 0x4f, 0xf7, 0xa2, 0x63 } }, { 32, - { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, - { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, - 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f }, - { 0xf5, 0x4f, 0x0e, 0xc8, 0xd2, 0xb9, 0xf3, 0xd3, + { 0xf5, 0x4f, 0x0e, 0xc8, 0xd2, 0xb9, 0xf3, 0xd3, 0x68, 0x07, 0x73, 0x4b, 0xd5, 0x28, 0x3f, 0xd4 } }, { 34, - { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, - { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, - 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f, 0x20, 0x21 }, - { 0xbe, 0xcb, 0xb3, 0xbc, 0xcd, 0xb5, 0x18, 0xa3, + { 0xbe, 0xcb, 0xb3, 0xbc, 0xcd, 0xb5, 0x18, 0xa3, 0x06, 0x77, 0xd5, 0x48, 0x1f, 0xb6, 0xb4, 0xd8 }, }, @@ -99,7 +99,7 @@ int xcbc_test(void) unsigned long taglen; int err, x, idx; - /* AES can be under rijndael or aes... try to find it */ + /* AES can be under rijndael or aes... try to find it */ if ((idx = find_cipher("aes")) == -1) { if ((idx = find_cipher("rijndael")) == -1) { return CRYPT_NOP; diff --git a/src/math/fp/ltc_ecc_fp_mulmod.c b/src/math/fp/ltc_ecc_fp_mulmod.c index 87c128f..0e62375 100644 --- a/src/math/fp/ltc_ecc_fp_mulmod.c +++ b/src/math/fp/ltc_ecc_fp_mulmod.c @@ -13,7 +13,7 @@ /** @file ltc_ecc_fp_mulmod.c ECC Crypto, Tom St Denis -*/ +*/ #if defined(LTC_MECC) && defined(LTC_MECC_FP) #include @@ -30,12 +30,12 @@ #if (FP_LUT > 12) || (FP_LUT < 2) #error FP_LUT must be between 2 and 12 inclusively -#endif +#endif /** Our FP cache */ static struct { ecc_point *g, /* cached COPY of base point */ - *LUT[1U< 6 - { 1, 0, 0 }, { 2, 1, 64 }, { 2, 2, 64 }, { 3, 3, 64 }, { 2, 4, 64 }, { 3, 5, 64 }, { 3, 6, 64 }, { 4, 7, 64 }, - { 2, 8, 64 }, { 3, 9, 64 }, { 3, 10, 64 }, { 4, 11, 64 }, { 3, 12, 64 }, { 4, 13, 64 }, { 4, 14, 64 }, { 5, 15, 64 }, - { 2, 16, 64 }, { 3, 17, 64 }, { 3, 18, 64 }, { 4, 19, 64 }, { 3, 20, 64 }, { 4, 21, 64 }, { 4, 22, 64 }, { 5, 23, 64 }, - { 3, 24, 64 }, { 4, 25, 64 }, { 4, 26, 64 }, { 5, 27, 64 }, { 4, 28, 64 }, { 5, 29, 64 }, { 5, 30, 64 }, { 6, 31, 64 }, - { 2, 32, 64 }, { 3, 33, 64 }, { 3, 34, 64 }, { 4, 35, 64 }, { 3, 36, 64 }, { 4, 37, 64 }, { 4, 38, 64 }, { 5, 39, 64 }, - { 3, 40, 64 }, { 4, 41, 64 }, { 4, 42, 64 }, { 5, 43, 64 }, { 4, 44, 64 }, { 5, 45, 64 }, { 5, 46, 64 }, { 6, 47, 64 }, - { 3, 48, 64 }, { 4, 49, 64 }, { 4, 50, 64 }, { 5, 51, 64 }, { 4, 52, 64 }, { 5, 53, 64 }, { 5, 54, 64 }, { 6, 55, 64 }, - { 4, 56, 64 }, { 5, 57, 64 }, { 5, 58, 64 }, { 6, 59, 64 }, { 5, 60, 64 }, { 6, 61, 64 }, { 6, 62, 64 }, { 7, 63, 64 }, + { 1, 0, 0 }, { 2, 1, 64 }, { 2, 2, 64 }, { 3, 3, 64 }, { 2, 4, 64 }, { 3, 5, 64 }, { 3, 6, 64 }, { 4, 7, 64 }, + { 2, 8, 64 }, { 3, 9, 64 }, { 3, 10, 64 }, { 4, 11, 64 }, { 3, 12, 64 }, { 4, 13, 64 }, { 4, 14, 64 }, { 5, 15, 64 }, + { 2, 16, 64 }, { 3, 17, 64 }, { 3, 18, 64 }, { 4, 19, 64 }, { 3, 20, 64 }, { 4, 21, 64 }, { 4, 22, 64 }, { 5, 23, 64 }, + { 3, 24, 64 }, { 4, 25, 64 }, { 4, 26, 64 }, { 5, 27, 64 }, { 4, 28, 64 }, { 5, 29, 64 }, { 5, 30, 64 }, { 6, 31, 64 }, + { 2, 32, 64 }, { 3, 33, 64 }, { 3, 34, 64 }, { 4, 35, 64 }, { 3, 36, 64 }, { 4, 37, 64 }, { 4, 38, 64 }, { 5, 39, 64 }, + { 3, 40, 64 }, { 4, 41, 64 }, { 4, 42, 64 }, { 5, 43, 64 }, { 4, 44, 64 }, { 5, 45, 64 }, { 5, 46, 64 }, { 6, 47, 64 }, + { 3, 48, 64 }, { 4, 49, 64 }, { 4, 50, 64 }, { 5, 51, 64 }, { 4, 52, 64 }, { 5, 53, 64 }, { 5, 54, 64 }, { 6, 55, 64 }, + { 4, 56, 64 }, { 5, 57, 64 }, { 5, 58, 64 }, { 6, 59, 64 }, { 5, 60, 64 }, { 6, 61, 64 }, { 6, 62, 64 }, { 7, 63, 64 }, #if FP_LUT > 7 - { 1, 0, 0 }, { 2, 1, 128 }, { 2, 2, 128 }, { 3, 3, 128 }, { 2, 4, 128 }, { 3, 5, 128 }, { 3, 6, 128 }, { 4, 7, 128 }, - { 2, 8, 128 }, { 3, 9, 128 }, { 3, 10, 128 }, { 4, 11, 128 }, { 3, 12, 128 }, { 4, 13, 128 }, { 4, 14, 128 }, { 5, 15, 128 }, - { 2, 16, 128 }, { 3, 17, 128 }, { 3, 18, 128 }, { 4, 19, 128 }, { 3, 20, 128 }, { 4, 21, 128 }, { 4, 22, 128 }, { 5, 23, 128 }, - { 3, 24, 128 }, { 4, 25, 128 }, { 4, 26, 128 }, { 5, 27, 128 }, { 4, 28, 128 }, { 5, 29, 128 }, { 5, 30, 128 }, { 6, 31, 128 }, - { 2, 32, 128 }, { 3, 33, 128 }, { 3, 34, 128 }, { 4, 35, 128 }, { 3, 36, 128 }, { 4, 37, 128 }, { 4, 38, 128 }, { 5, 39, 128 }, - { 3, 40, 128 }, { 4, 41, 128 }, { 4, 42, 128 }, { 5, 43, 128 }, { 4, 44, 128 }, { 5, 45, 128 }, { 5, 46, 128 }, { 6, 47, 128 }, - { 3, 48, 128 }, { 4, 49, 128 }, { 4, 50, 128 }, { 5, 51, 128 }, { 4, 52, 128 }, { 5, 53, 128 }, { 5, 54, 128 }, { 6, 55, 128 }, - { 4, 56, 128 }, { 5, 57, 128 }, { 5, 58, 128 }, { 6, 59, 128 }, { 5, 60, 128 }, { 6, 61, 128 }, { 6, 62, 128 }, { 7, 63, 128 }, - { 2, 64, 128 }, { 3, 65, 128 }, { 3, 66, 128 }, { 4, 67, 128 }, { 3, 68, 128 }, { 4, 69, 128 }, { 4, 70, 128 }, { 5, 71, 128 }, - { 3, 72, 128 }, { 4, 73, 128 }, { 4, 74, 128 }, { 5, 75, 128 }, { 4, 76, 128 }, { 5, 77, 128 }, { 5, 78, 128 }, { 6, 79, 128 }, - { 3, 80, 128 }, { 4, 81, 128 }, { 4, 82, 128 }, { 5, 83, 128 }, { 4, 84, 128 }, { 5, 85, 128 }, { 5, 86, 128 }, { 6, 87, 128 }, - { 4, 88, 128 }, { 5, 89, 128 }, { 5, 90, 128 }, { 6, 91, 128 }, { 5, 92, 128 }, { 6, 93, 128 }, { 6, 94, 128 }, { 7, 95, 128 }, - { 3, 96, 128 }, { 4, 97, 128 }, { 4, 98, 128 }, { 5, 99, 128 }, { 4, 100, 128 }, { 5, 101, 128 }, { 5, 102, 128 }, { 6, 103, 128 }, - { 4, 104, 128 }, { 5, 105, 128 }, { 5, 106, 128 }, { 6, 107, 128 }, { 5, 108, 128 }, { 6, 109, 128 }, { 6, 110, 128 }, { 7, 111, 128 }, - { 4, 112, 128 }, { 5, 113, 128 }, { 5, 114, 128 }, { 6, 115, 128 }, { 5, 116, 128 }, { 6, 117, 128 }, { 6, 118, 128 }, { 7, 119, 128 }, - { 5, 120, 128 }, { 6, 121, 128 }, { 6, 122, 128 }, { 7, 123, 128 }, { 6, 124, 128 }, { 7, 125, 128 }, { 7, 126, 128 }, { 8, 127, 128 }, + { 1, 0, 0 }, { 2, 1, 128 }, { 2, 2, 128 }, { 3, 3, 128 }, { 2, 4, 128 }, { 3, 5, 128 }, { 3, 6, 128 }, { 4, 7, 128 }, + { 2, 8, 128 }, { 3, 9, 128 }, { 3, 10, 128 }, { 4, 11, 128 }, { 3, 12, 128 }, { 4, 13, 128 }, { 4, 14, 128 }, { 5, 15, 128 }, + { 2, 16, 128 }, { 3, 17, 128 }, { 3, 18, 128 }, { 4, 19, 128 }, { 3, 20, 128 }, { 4, 21, 128 }, { 4, 22, 128 }, { 5, 23, 128 }, + { 3, 24, 128 }, { 4, 25, 128 }, { 4, 26, 128 }, { 5, 27, 128 }, { 4, 28, 128 }, { 5, 29, 128 }, { 5, 30, 128 }, { 6, 31, 128 }, + { 2, 32, 128 }, { 3, 33, 128 }, { 3, 34, 128 }, { 4, 35, 128 }, { 3, 36, 128 }, { 4, 37, 128 }, { 4, 38, 128 }, { 5, 39, 128 }, + { 3, 40, 128 }, { 4, 41, 128 }, { 4, 42, 128 }, { 5, 43, 128 }, { 4, 44, 128 }, { 5, 45, 128 }, { 5, 46, 128 }, { 6, 47, 128 }, + { 3, 48, 128 }, { 4, 49, 128 }, { 4, 50, 128 }, { 5, 51, 128 }, { 4, 52, 128 }, { 5, 53, 128 }, { 5, 54, 128 }, { 6, 55, 128 }, + { 4, 56, 128 }, { 5, 57, 128 }, { 5, 58, 128 }, { 6, 59, 128 }, { 5, 60, 128 }, { 6, 61, 128 }, { 6, 62, 128 }, { 7, 63, 128 }, + { 2, 64, 128 }, { 3, 65, 128 }, { 3, 66, 128 }, { 4, 67, 128 }, { 3, 68, 128 }, { 4, 69, 128 }, { 4, 70, 128 }, { 5, 71, 128 }, + { 3, 72, 128 }, { 4, 73, 128 }, { 4, 74, 128 }, { 5, 75, 128 }, { 4, 76, 128 }, { 5, 77, 128 }, { 5, 78, 128 }, { 6, 79, 128 }, + { 3, 80, 128 }, { 4, 81, 128 }, { 4, 82, 128 }, { 5, 83, 128 }, { 4, 84, 128 }, { 5, 85, 128 }, { 5, 86, 128 }, { 6, 87, 128 }, + { 4, 88, 128 }, { 5, 89, 128 }, { 5, 90, 128 }, { 6, 91, 128 }, { 5, 92, 128 }, { 6, 93, 128 }, { 6, 94, 128 }, { 7, 95, 128 }, + { 3, 96, 128 }, { 4, 97, 128 }, { 4, 98, 128 }, { 5, 99, 128 }, { 4, 100, 128 }, { 5, 101, 128 }, { 5, 102, 128 }, { 6, 103, 128 }, + { 4, 104, 128 }, { 5, 105, 128 }, { 5, 106, 128 }, { 6, 107, 128 }, { 5, 108, 128 }, { 6, 109, 128 }, { 6, 110, 128 }, { 7, 111, 128 }, + { 4, 112, 128 }, { 5, 113, 128 }, { 5, 114, 128 }, { 6, 115, 128 }, { 5, 116, 128 }, { 6, 117, 128 }, { 6, 118, 128 }, { 7, 119, 128 }, + { 5, 120, 128 }, { 6, 121, 128 }, { 6, 122, 128 }, { 7, 123, 128 }, { 6, 124, 128 }, { 7, 125, 128 }, { 7, 126, 128 }, { 8, 127, 128 }, #if FP_LUT > 8 - { 1, 0, 0 }, { 2, 1, 256 }, { 2, 2, 256 }, { 3, 3, 256 }, { 2, 4, 256 }, { 3, 5, 256 }, { 3, 6, 256 }, { 4, 7, 256 }, - { 2, 8, 256 }, { 3, 9, 256 }, { 3, 10, 256 }, { 4, 11, 256 }, { 3, 12, 256 }, { 4, 13, 256 }, { 4, 14, 256 }, { 5, 15, 256 }, - { 2, 16, 256 }, { 3, 17, 256 }, { 3, 18, 256 }, { 4, 19, 256 }, { 3, 20, 256 }, { 4, 21, 256 }, { 4, 22, 256 }, { 5, 23, 256 }, - { 3, 24, 256 }, { 4, 25, 256 }, { 4, 26, 256 }, { 5, 27, 256 }, { 4, 28, 256 }, { 5, 29, 256 }, { 5, 30, 256 }, { 6, 31, 256 }, - { 2, 32, 256 }, { 3, 33, 256 }, { 3, 34, 256 }, { 4, 35, 256 }, { 3, 36, 256 }, { 4, 37, 256 }, { 4, 38, 256 }, { 5, 39, 256 }, - { 3, 40, 256 }, { 4, 41, 256 }, { 4, 42, 256 }, { 5, 43, 256 }, { 4, 44, 256 }, { 5, 45, 256 }, { 5, 46, 256 }, { 6, 47, 256 }, - { 3, 48, 256 }, { 4, 49, 256 }, { 4, 50, 256 }, { 5, 51, 256 }, { 4, 52, 256 }, { 5, 53, 256 }, { 5, 54, 256 }, { 6, 55, 256 }, - { 4, 56, 256 }, { 5, 57, 256 }, { 5, 58, 256 }, { 6, 59, 256 }, { 5, 60, 256 }, { 6, 61, 256 }, { 6, 62, 256 }, { 7, 63, 256 }, - { 2, 64, 256 }, { 3, 65, 256 }, { 3, 66, 256 }, { 4, 67, 256 }, { 3, 68, 256 }, { 4, 69, 256 }, { 4, 70, 256 }, { 5, 71, 256 }, - { 3, 72, 256 }, { 4, 73, 256 }, { 4, 74, 256 }, { 5, 75, 256 }, { 4, 76, 256 }, { 5, 77, 256 }, { 5, 78, 256 }, { 6, 79, 256 }, - { 3, 80, 256 }, { 4, 81, 256 }, { 4, 82, 256 }, { 5, 83, 256 }, { 4, 84, 256 }, { 5, 85, 256 }, { 5, 86, 256 }, { 6, 87, 256 }, - { 4, 88, 256 }, { 5, 89, 256 }, { 5, 90, 256 }, { 6, 91, 256 }, { 5, 92, 256 }, { 6, 93, 256 }, { 6, 94, 256 }, { 7, 95, 256 }, - { 3, 96, 256 }, { 4, 97, 256 }, { 4, 98, 256 }, { 5, 99, 256 }, { 4, 100, 256 }, { 5, 101, 256 }, { 5, 102, 256 }, { 6, 103, 256 }, - { 4, 104, 256 }, { 5, 105, 256 }, { 5, 106, 256 }, { 6, 107, 256 }, { 5, 108, 256 }, { 6, 109, 256 }, { 6, 110, 256 }, { 7, 111, 256 }, - { 4, 112, 256 }, { 5, 113, 256 }, { 5, 114, 256 }, { 6, 115, 256 }, { 5, 116, 256 }, { 6, 117, 256 }, { 6, 118, 256 }, { 7, 119, 256 }, - { 5, 120, 256 }, { 6, 121, 256 }, { 6, 122, 256 }, { 7, 123, 256 }, { 6, 124, 256 }, { 7, 125, 256 }, { 7, 126, 256 }, { 8, 127, 256 }, - { 2, 128, 256 }, { 3, 129, 256 }, { 3, 130, 256 }, { 4, 131, 256 }, { 3, 132, 256 }, { 4, 133, 256 }, { 4, 134, 256 }, { 5, 135, 256 }, - { 3, 136, 256 }, { 4, 137, 256 }, { 4, 138, 256 }, { 5, 139, 256 }, { 4, 140, 256 }, { 5, 141, 256 }, { 5, 142, 256 }, { 6, 143, 256 }, - { 3, 144, 256 }, { 4, 145, 256 }, { 4, 146, 256 }, { 5, 147, 256 }, { 4, 148, 256 }, { 5, 149, 256 }, { 5, 150, 256 }, { 6, 151, 256 }, - { 4, 152, 256 }, { 5, 153, 256 }, { 5, 154, 256 }, { 6, 155, 256 }, { 5, 156, 256 }, { 6, 157, 256 }, { 6, 158, 256 }, { 7, 159, 256 }, - { 3, 160, 256 }, { 4, 161, 256 }, { 4, 162, 256 }, { 5, 163, 256 }, { 4, 164, 256 }, { 5, 165, 256 }, { 5, 166, 256 }, { 6, 167, 256 }, - { 4, 168, 256 }, { 5, 169, 256 }, { 5, 170, 256 }, { 6, 171, 256 }, { 5, 172, 256 }, { 6, 173, 256 }, { 6, 174, 256 }, { 7, 175, 256 }, - { 4, 176, 256 }, { 5, 177, 256 }, { 5, 178, 256 }, { 6, 179, 256 }, { 5, 180, 256 }, { 6, 181, 256 }, { 6, 182, 256 }, { 7, 183, 256 }, - { 5, 184, 256 }, { 6, 185, 256 }, { 6, 186, 256 }, { 7, 187, 256 }, { 6, 188, 256 }, { 7, 189, 256 }, { 7, 190, 256 }, { 8, 191, 256 }, - { 3, 192, 256 }, { 4, 193, 256 }, { 4, 194, 256 }, { 5, 195, 256 }, { 4, 196, 256 }, { 5, 197, 256 }, { 5, 198, 256 }, { 6, 199, 256 }, - { 4, 200, 256 }, { 5, 201, 256 }, { 5, 202, 256 }, { 6, 203, 256 }, { 5, 204, 256 }, { 6, 205, 256 }, { 6, 206, 256 }, { 7, 207, 256 }, - { 4, 208, 256 }, { 5, 209, 256 }, { 5, 210, 256 }, { 6, 211, 256 }, { 5, 212, 256 }, { 6, 213, 256 }, { 6, 214, 256 }, { 7, 215, 256 }, - { 5, 216, 256 }, { 6, 217, 256 }, { 6, 218, 256 }, { 7, 219, 256 }, { 6, 220, 256 }, { 7, 221, 256 }, { 7, 222, 256 }, { 8, 223, 256 }, - { 4, 224, 256 }, { 5, 225, 256 }, { 5, 226, 256 }, { 6, 227, 256 }, { 5, 228, 256 }, { 6, 229, 256 }, { 6, 230, 256 }, { 7, 231, 256 }, - { 5, 232, 256 }, { 6, 233, 256 }, { 6, 234, 256 }, { 7, 235, 256 }, { 6, 236, 256 }, { 7, 237, 256 }, { 7, 238, 256 }, { 8, 239, 256 }, - { 5, 240, 256 }, { 6, 241, 256 }, { 6, 242, 256 }, { 7, 243, 256 }, { 6, 244, 256 }, { 7, 245, 256 }, { 7, 246, 256 }, { 8, 247, 256 }, - { 6, 248, 256 }, { 7, 249, 256 }, { 7, 250, 256 }, { 8, 251, 256 }, { 7, 252, 256 }, { 8, 253, 256 }, { 8, 254, 256 }, { 9, 255, 256 }, + { 1, 0, 0 }, { 2, 1, 256 }, { 2, 2, 256 }, { 3, 3, 256 }, { 2, 4, 256 }, { 3, 5, 256 }, { 3, 6, 256 }, { 4, 7, 256 }, + { 2, 8, 256 }, { 3, 9, 256 }, { 3, 10, 256 }, { 4, 11, 256 }, { 3, 12, 256 }, { 4, 13, 256 }, { 4, 14, 256 }, { 5, 15, 256 }, + { 2, 16, 256 }, { 3, 17, 256 }, { 3, 18, 256 }, { 4, 19, 256 }, { 3, 20, 256 }, { 4, 21, 256 }, { 4, 22, 256 }, { 5, 23, 256 }, + { 3, 24, 256 }, { 4, 25, 256 }, { 4, 26, 256 }, { 5, 27, 256 }, { 4, 28, 256 }, { 5, 29, 256 }, { 5, 30, 256 }, { 6, 31, 256 }, + { 2, 32, 256 }, { 3, 33, 256 }, { 3, 34, 256 }, { 4, 35, 256 }, { 3, 36, 256 }, { 4, 37, 256 }, { 4, 38, 256 }, { 5, 39, 256 }, + { 3, 40, 256 }, { 4, 41, 256 }, { 4, 42, 256 }, { 5, 43, 256 }, { 4, 44, 256 }, { 5, 45, 256 }, { 5, 46, 256 }, { 6, 47, 256 }, + { 3, 48, 256 }, { 4, 49, 256 }, { 4, 50, 256 }, { 5, 51, 256 }, { 4, 52, 256 }, { 5, 53, 256 }, { 5, 54, 256 }, { 6, 55, 256 }, + { 4, 56, 256 }, { 5, 57, 256 }, { 5, 58, 256 }, { 6, 59, 256 }, { 5, 60, 256 }, { 6, 61, 256 }, { 6, 62, 256 }, { 7, 63, 256 }, + { 2, 64, 256 }, { 3, 65, 256 }, { 3, 66, 256 }, { 4, 67, 256 }, { 3, 68, 256 }, { 4, 69, 256 }, { 4, 70, 256 }, { 5, 71, 256 }, + { 3, 72, 256 }, { 4, 73, 256 }, { 4, 74, 256 }, { 5, 75, 256 }, { 4, 76, 256 }, { 5, 77, 256 }, { 5, 78, 256 }, { 6, 79, 256 }, + { 3, 80, 256 }, { 4, 81, 256 }, { 4, 82, 256 }, { 5, 83, 256 }, { 4, 84, 256 }, { 5, 85, 256 }, { 5, 86, 256 }, { 6, 87, 256 }, + { 4, 88, 256 }, { 5, 89, 256 }, { 5, 90, 256 }, { 6, 91, 256 }, { 5, 92, 256 }, { 6, 93, 256 }, { 6, 94, 256 }, { 7, 95, 256 }, + { 3, 96, 256 }, { 4, 97, 256 }, { 4, 98, 256 }, { 5, 99, 256 }, { 4, 100, 256 }, { 5, 101, 256 }, { 5, 102, 256 }, { 6, 103, 256 }, + { 4, 104, 256 }, { 5, 105, 256 }, { 5, 106, 256 }, { 6, 107, 256 }, { 5, 108, 256 }, { 6, 109, 256 }, { 6, 110, 256 }, { 7, 111, 256 }, + { 4, 112, 256 }, { 5, 113, 256 }, { 5, 114, 256 }, { 6, 115, 256 }, { 5, 116, 256 }, { 6, 117, 256 }, { 6, 118, 256 }, { 7, 119, 256 }, + { 5, 120, 256 }, { 6, 121, 256 }, { 6, 122, 256 }, { 7, 123, 256 }, { 6, 124, 256 }, { 7, 125, 256 }, { 7, 126, 256 }, { 8, 127, 256 }, + { 2, 128, 256 }, { 3, 129, 256 }, { 3, 130, 256 }, { 4, 131, 256 }, { 3, 132, 256 }, { 4, 133, 256 }, { 4, 134, 256 }, { 5, 135, 256 }, + { 3, 136, 256 }, { 4, 137, 256 }, { 4, 138, 256 }, { 5, 139, 256 }, { 4, 140, 256 }, { 5, 141, 256 }, { 5, 142, 256 }, { 6, 143, 256 }, + { 3, 144, 256 }, { 4, 145, 256 }, { 4, 146, 256 }, { 5, 147, 256 }, { 4, 148, 256 }, { 5, 149, 256 }, { 5, 150, 256 }, { 6, 151, 256 }, + { 4, 152, 256 }, { 5, 153, 256 }, { 5, 154, 256 }, { 6, 155, 256 }, { 5, 156, 256 }, { 6, 157, 256 }, { 6, 158, 256 }, { 7, 159, 256 }, + { 3, 160, 256 }, { 4, 161, 256 }, { 4, 162, 256 }, { 5, 163, 256 }, { 4, 164, 256 }, { 5, 165, 256 }, { 5, 166, 256 }, { 6, 167, 256 }, + { 4, 168, 256 }, { 5, 169, 256 }, { 5, 170, 256 }, { 6, 171, 256 }, { 5, 172, 256 }, { 6, 173, 256 }, { 6, 174, 256 }, { 7, 175, 256 }, + { 4, 176, 256 }, { 5, 177, 256 }, { 5, 178, 256 }, { 6, 179, 256 }, { 5, 180, 256 }, { 6, 181, 256 }, { 6, 182, 256 }, { 7, 183, 256 }, + { 5, 184, 256 }, { 6, 185, 256 }, { 6, 186, 256 }, { 7, 187, 256 }, { 6, 188, 256 }, { 7, 189, 256 }, { 7, 190, 256 }, { 8, 191, 256 }, + { 3, 192, 256 }, { 4, 193, 256 }, { 4, 194, 256 }, { 5, 195, 256 }, { 4, 196, 256 }, { 5, 197, 256 }, { 5, 198, 256 }, { 6, 199, 256 }, + { 4, 200, 256 }, { 5, 201, 256 }, { 5, 202, 256 }, { 6, 203, 256 }, { 5, 204, 256 }, { 6, 205, 256 }, { 6, 206, 256 }, { 7, 207, 256 }, + { 4, 208, 256 }, { 5, 209, 256 }, { 5, 210, 256 }, { 6, 211, 256 }, { 5, 212, 256 }, { 6, 213, 256 }, { 6, 214, 256 }, { 7, 215, 256 }, + { 5, 216, 256 }, { 6, 217, 256 }, { 6, 218, 256 }, { 7, 219, 256 }, { 6, 220, 256 }, { 7, 221, 256 }, { 7, 222, 256 }, { 8, 223, 256 }, + { 4, 224, 256 }, { 5, 225, 256 }, { 5, 226, 256 }, { 6, 227, 256 }, { 5, 228, 256 }, { 6, 229, 256 }, { 6, 230, 256 }, { 7, 231, 256 }, + { 5, 232, 256 }, { 6, 233, 256 }, { 6, 234, 256 }, { 7, 235, 256 }, { 6, 236, 256 }, { 7, 237, 256 }, { 7, 238, 256 }, { 8, 239, 256 }, + { 5, 240, 256 }, { 6, 241, 256 }, { 6, 242, 256 }, { 7, 243, 256 }, { 6, 244, 256 }, { 7, 245, 256 }, { 7, 246, 256 }, { 8, 247, 256 }, + { 6, 248, 256 }, { 7, 249, 256 }, { 7, 250, 256 }, { 8, 251, 256 }, { 7, 252, 256 }, { 8, 253, 256 }, { 8, 254, 256 }, { 9, 255, 256 }, #if FP_LUT > 9 - { 1, 0, 0 }, { 2, 1, 512 }, { 2, 2, 512 }, { 3, 3, 512 }, { 2, 4, 512 }, { 3, 5, 512 }, { 3, 6, 512 }, { 4, 7, 512 }, - { 2, 8, 512 }, { 3, 9, 512 }, { 3, 10, 512 }, { 4, 11, 512 }, { 3, 12, 512 }, { 4, 13, 512 }, { 4, 14, 512 }, { 5, 15, 512 }, - { 2, 16, 512 }, { 3, 17, 512 }, { 3, 18, 512 }, { 4, 19, 512 }, { 3, 20, 512 }, { 4, 21, 512 }, { 4, 22, 512 }, { 5, 23, 512 }, - { 3, 24, 512 }, { 4, 25, 512 }, { 4, 26, 512 }, { 5, 27, 512 }, { 4, 28, 512 }, { 5, 29, 512 }, { 5, 30, 512 }, { 6, 31, 512 }, - { 2, 32, 512 }, { 3, 33, 512 }, { 3, 34, 512 }, { 4, 35, 512 }, { 3, 36, 512 }, { 4, 37, 512 }, { 4, 38, 512 }, { 5, 39, 512 }, - { 3, 40, 512 }, { 4, 41, 512 }, { 4, 42, 512 }, { 5, 43, 512 }, { 4, 44, 512 }, { 5, 45, 512 }, { 5, 46, 512 }, { 6, 47, 512 }, - { 3, 48, 512 }, { 4, 49, 512 }, { 4, 50, 512 }, { 5, 51, 512 }, { 4, 52, 512 }, { 5, 53, 512 }, { 5, 54, 512 }, { 6, 55, 512 }, - { 4, 56, 512 }, { 5, 57, 512 }, { 5, 58, 512 }, { 6, 59, 512 }, { 5, 60, 512 }, { 6, 61, 512 }, { 6, 62, 512 }, { 7, 63, 512 }, - { 2, 64, 512 }, { 3, 65, 512 }, { 3, 66, 512 }, { 4, 67, 512 }, { 3, 68, 512 }, { 4, 69, 512 }, { 4, 70, 512 }, { 5, 71, 512 }, - { 3, 72, 512 }, { 4, 73, 512 }, { 4, 74, 512 }, { 5, 75, 512 }, { 4, 76, 512 }, { 5, 77, 512 }, { 5, 78, 512 }, { 6, 79, 512 }, - { 3, 80, 512 }, { 4, 81, 512 }, { 4, 82, 512 }, { 5, 83, 512 }, { 4, 84, 512 }, { 5, 85, 512 }, { 5, 86, 512 }, { 6, 87, 512 }, - { 4, 88, 512 }, { 5, 89, 512 }, { 5, 90, 512 }, { 6, 91, 512 }, { 5, 92, 512 }, { 6, 93, 512 }, { 6, 94, 512 }, { 7, 95, 512 }, - { 3, 96, 512 }, { 4, 97, 512 }, { 4, 98, 512 }, { 5, 99, 512 }, { 4, 100, 512 }, { 5, 101, 512 }, { 5, 102, 512 }, { 6, 103, 512 }, - { 4, 104, 512 }, { 5, 105, 512 }, { 5, 106, 512 }, { 6, 107, 512 }, { 5, 108, 512 }, { 6, 109, 512 }, { 6, 110, 512 }, { 7, 111, 512 }, - { 4, 112, 512 }, { 5, 113, 512 }, { 5, 114, 512 }, { 6, 115, 512 }, { 5, 116, 512 }, { 6, 117, 512 }, { 6, 118, 512 }, { 7, 119, 512 }, - { 5, 120, 512 }, { 6, 121, 512 }, { 6, 122, 512 }, { 7, 123, 512 }, { 6, 124, 512 }, { 7, 125, 512 }, { 7, 126, 512 }, { 8, 127, 512 }, - { 2, 128, 512 }, { 3, 129, 512 }, { 3, 130, 512 }, { 4, 131, 512 }, { 3, 132, 512 }, { 4, 133, 512 }, { 4, 134, 512 }, { 5, 135, 512 }, - { 3, 136, 512 }, { 4, 137, 512 }, { 4, 138, 512 }, { 5, 139, 512 }, { 4, 140, 512 }, { 5, 141, 512 }, { 5, 142, 512 }, { 6, 143, 512 }, - { 3, 144, 512 }, { 4, 145, 512 }, { 4, 146, 512 }, { 5, 147, 512 }, { 4, 148, 512 }, { 5, 149, 512 }, { 5, 150, 512 }, { 6, 151, 512 }, - { 4, 152, 512 }, { 5, 153, 512 }, { 5, 154, 512 }, { 6, 155, 512 }, { 5, 156, 512 }, { 6, 157, 512 }, { 6, 158, 512 }, { 7, 159, 512 }, - { 3, 160, 512 }, { 4, 161, 512 }, { 4, 162, 512 }, { 5, 163, 512 }, { 4, 164, 512 }, { 5, 165, 512 }, { 5, 166, 512 }, { 6, 167, 512 }, - { 4, 168, 512 }, { 5, 169, 512 }, { 5, 170, 512 }, { 6, 171, 512 }, { 5, 172, 512 }, { 6, 173, 512 }, { 6, 174, 512 }, { 7, 175, 512 }, - { 4, 176, 512 }, { 5, 177, 512 }, { 5, 178, 512 }, { 6, 179, 512 }, { 5, 180, 512 }, { 6, 181, 512 }, { 6, 182, 512 }, { 7, 183, 512 }, - { 5, 184, 512 }, { 6, 185, 512 }, { 6, 186, 512 }, { 7, 187, 512 }, { 6, 188, 512 }, { 7, 189, 512 }, { 7, 190, 512 }, { 8, 191, 512 }, - { 3, 192, 512 }, { 4, 193, 512 }, { 4, 194, 512 }, { 5, 195, 512 }, { 4, 196, 512 }, { 5, 197, 512 }, { 5, 198, 512 }, { 6, 199, 512 }, - { 4, 200, 512 }, { 5, 201, 512 }, { 5, 202, 512 }, { 6, 203, 512 }, { 5, 204, 512 }, { 6, 205, 512 }, { 6, 206, 512 }, { 7, 207, 512 }, - { 4, 208, 512 }, { 5, 209, 512 }, { 5, 210, 512 }, { 6, 211, 512 }, { 5, 212, 512 }, { 6, 213, 512 }, { 6, 214, 512 }, { 7, 215, 512 }, - { 5, 216, 512 }, { 6, 217, 512 }, { 6, 218, 512 }, { 7, 219, 512 }, { 6, 220, 512 }, { 7, 221, 512 }, { 7, 222, 512 }, { 8, 223, 512 }, - { 4, 224, 512 }, { 5, 225, 512 }, { 5, 226, 512 }, { 6, 227, 512 }, { 5, 228, 512 }, { 6, 229, 512 }, { 6, 230, 512 }, { 7, 231, 512 }, - { 5, 232, 512 }, { 6, 233, 512 }, { 6, 234, 512 }, { 7, 235, 512 }, { 6, 236, 512 }, { 7, 237, 512 }, { 7, 238, 512 }, { 8, 239, 512 }, - { 5, 240, 512 }, { 6, 241, 512 }, { 6, 242, 512 }, { 7, 243, 512 }, { 6, 244, 512 }, { 7, 245, 512 }, { 7, 246, 512 }, { 8, 247, 512 }, - { 6, 248, 512 }, { 7, 249, 512 }, { 7, 250, 512 }, { 8, 251, 512 }, { 7, 252, 512 }, { 8, 253, 512 }, { 8, 254, 512 }, { 9, 255, 512 }, - { 2, 256, 512 }, { 3, 257, 512 }, { 3, 258, 512 }, { 4, 259, 512 }, { 3, 260, 512 }, { 4, 261, 512 }, { 4, 262, 512 }, { 5, 263, 512 }, - { 3, 264, 512 }, { 4, 265, 512 }, { 4, 266, 512 }, { 5, 267, 512 }, { 4, 268, 512 }, { 5, 269, 512 }, { 5, 270, 512 }, { 6, 271, 512 }, - { 3, 272, 512 }, { 4, 273, 512 }, { 4, 274, 512 }, { 5, 275, 512 }, { 4, 276, 512 }, { 5, 277, 512 }, { 5, 278, 512 }, { 6, 279, 512 }, - { 4, 280, 512 }, { 5, 281, 512 }, { 5, 282, 512 }, { 6, 283, 512 }, { 5, 284, 512 }, { 6, 285, 512 }, { 6, 286, 512 }, { 7, 287, 512 }, - { 3, 288, 512 }, { 4, 289, 512 }, { 4, 290, 512 }, { 5, 291, 512 }, { 4, 292, 512 }, { 5, 293, 512 }, { 5, 294, 512 }, { 6, 295, 512 }, - { 4, 296, 512 }, { 5, 297, 512 }, { 5, 298, 512 }, { 6, 299, 512 }, { 5, 300, 512 }, { 6, 301, 512 }, { 6, 302, 512 }, { 7, 303, 512 }, - { 4, 304, 512 }, { 5, 305, 512 }, { 5, 306, 512 }, { 6, 307, 512 }, { 5, 308, 512 }, { 6, 309, 512 }, { 6, 310, 512 }, { 7, 311, 512 }, - { 5, 312, 512 }, { 6, 313, 512 }, { 6, 314, 512 }, { 7, 315, 512 }, { 6, 316, 512 }, { 7, 317, 512 }, { 7, 318, 512 }, { 8, 319, 512 }, - { 3, 320, 512 }, { 4, 321, 512 }, { 4, 322, 512 }, { 5, 323, 512 }, { 4, 324, 512 }, { 5, 325, 512 }, { 5, 326, 512 }, { 6, 327, 512 }, - { 4, 328, 512 }, { 5, 329, 512 }, { 5, 330, 512 }, { 6, 331, 512 }, { 5, 332, 512 }, { 6, 333, 512 }, { 6, 334, 512 }, { 7, 335, 512 }, - { 4, 336, 512 }, { 5, 337, 512 }, { 5, 338, 512 }, { 6, 339, 512 }, { 5, 340, 512 }, { 6, 341, 512 }, { 6, 342, 512 }, { 7, 343, 512 }, - { 5, 344, 512 }, { 6, 345, 512 }, { 6, 346, 512 }, { 7, 347, 512 }, { 6, 348, 512 }, { 7, 349, 512 }, { 7, 350, 512 }, { 8, 351, 512 }, - { 4, 352, 512 }, { 5, 353, 512 }, { 5, 354, 512 }, { 6, 355, 512 }, { 5, 356, 512 }, { 6, 357, 512 }, { 6, 358, 512 }, { 7, 359, 512 }, - { 5, 360, 512 }, { 6, 361, 512 }, { 6, 362, 512 }, { 7, 363, 512 }, { 6, 364, 512 }, { 7, 365, 512 }, { 7, 366, 512 }, { 8, 367, 512 }, - { 5, 368, 512 }, { 6, 369, 512 }, { 6, 370, 512 }, { 7, 371, 512 }, { 6, 372, 512 }, { 7, 373, 512 }, { 7, 374, 512 }, { 8, 375, 512 }, - { 6, 376, 512 }, { 7, 377, 512 }, { 7, 378, 512 }, { 8, 379, 512 }, { 7, 380, 512 }, { 8, 381, 512 }, { 8, 382, 512 }, { 9, 383, 512 }, - { 3, 384, 512 }, { 4, 385, 512 }, { 4, 386, 512 }, { 5, 387, 512 }, { 4, 388, 512 }, { 5, 389, 512 }, { 5, 390, 512 }, { 6, 391, 512 }, - { 4, 392, 512 }, { 5, 393, 512 }, { 5, 394, 512 }, { 6, 395, 512 }, { 5, 396, 512 }, { 6, 397, 512 }, { 6, 398, 512 }, { 7, 399, 512 }, - { 4, 400, 512 }, { 5, 401, 512 }, { 5, 402, 512 }, { 6, 403, 512 }, { 5, 404, 512 }, { 6, 405, 512 }, { 6, 406, 512 }, { 7, 407, 512 }, - { 5, 408, 512 }, { 6, 409, 512 }, { 6, 410, 512 }, { 7, 411, 512 }, { 6, 412, 512 }, { 7, 413, 512 }, { 7, 414, 512 }, { 8, 415, 512 }, - { 4, 416, 512 }, { 5, 417, 512 }, { 5, 418, 512 }, { 6, 419, 512 }, { 5, 420, 512 }, { 6, 421, 512 }, { 6, 422, 512 }, { 7, 423, 512 }, - { 5, 424, 512 }, { 6, 425, 512 }, { 6, 426, 512 }, { 7, 427, 512 }, { 6, 428, 512 }, { 7, 429, 512 }, { 7, 430, 512 }, { 8, 431, 512 }, - { 5, 432, 512 }, { 6, 433, 512 }, { 6, 434, 512 }, { 7, 435, 512 }, { 6, 436, 512 }, { 7, 437, 512 }, { 7, 438, 512 }, { 8, 439, 512 }, - { 6, 440, 512 }, { 7, 441, 512 }, { 7, 442, 512 }, { 8, 443, 512 }, { 7, 444, 512 }, { 8, 445, 512 }, { 8, 446, 512 }, { 9, 447, 512 }, - { 4, 448, 512 }, { 5, 449, 512 }, { 5, 450, 512 }, { 6, 451, 512 }, { 5, 452, 512 }, { 6, 453, 512 }, { 6, 454, 512 }, { 7, 455, 512 }, - { 5, 456, 512 }, { 6, 457, 512 }, { 6, 458, 512 }, { 7, 459, 512 }, { 6, 460, 512 }, { 7, 461, 512 }, { 7, 462, 512 }, { 8, 463, 512 }, - { 5, 464, 512 }, { 6, 465, 512 }, { 6, 466, 512 }, { 7, 467, 512 }, { 6, 468, 512 }, { 7, 469, 512 }, { 7, 470, 512 }, { 8, 471, 512 }, - { 6, 472, 512 }, { 7, 473, 512 }, { 7, 474, 512 }, { 8, 475, 512 }, { 7, 476, 512 }, { 8, 477, 512 }, { 8, 478, 512 }, { 9, 479, 512 }, - { 5, 480, 512 }, { 6, 481, 512 }, { 6, 482, 512 }, { 7, 483, 512 }, { 6, 484, 512 }, { 7, 485, 512 }, { 7, 486, 512 }, { 8, 487, 512 }, - { 6, 488, 512 }, { 7, 489, 512 }, { 7, 490, 512 }, { 8, 491, 512 }, { 7, 492, 512 }, { 8, 493, 512 }, { 8, 494, 512 }, { 9, 495, 512 }, - { 6, 496, 512 }, { 7, 497, 512 }, { 7, 498, 512 }, { 8, 499, 512 }, { 7, 500, 512 }, { 8, 501, 512 }, { 8, 502, 512 }, { 9, 503, 512 }, - { 7, 504, 512 }, { 8, 505, 512 }, { 8, 506, 512 }, { 9, 507, 512 }, { 8, 508, 512 }, { 9, 509, 512 }, { 9, 510, 512 }, { 10, 511, 512 }, + { 1, 0, 0 }, { 2, 1, 512 }, { 2, 2, 512 }, { 3, 3, 512 }, { 2, 4, 512 }, { 3, 5, 512 }, { 3, 6, 512 }, { 4, 7, 512 }, + { 2, 8, 512 }, { 3, 9, 512 }, { 3, 10, 512 }, { 4, 11, 512 }, { 3, 12, 512 }, { 4, 13, 512 }, { 4, 14, 512 }, { 5, 15, 512 }, + { 2, 16, 512 }, { 3, 17, 512 }, { 3, 18, 512 }, { 4, 19, 512 }, { 3, 20, 512 }, { 4, 21, 512 }, { 4, 22, 512 }, { 5, 23, 512 }, + { 3, 24, 512 }, { 4, 25, 512 }, { 4, 26, 512 }, { 5, 27, 512 }, { 4, 28, 512 }, { 5, 29, 512 }, { 5, 30, 512 }, { 6, 31, 512 }, + { 2, 32, 512 }, { 3, 33, 512 }, { 3, 34, 512 }, { 4, 35, 512 }, { 3, 36, 512 }, { 4, 37, 512 }, { 4, 38, 512 }, { 5, 39, 512 }, + { 3, 40, 512 }, { 4, 41, 512 }, { 4, 42, 512 }, { 5, 43, 512 }, { 4, 44, 512 }, { 5, 45, 512 }, { 5, 46, 512 }, { 6, 47, 512 }, + { 3, 48, 512 }, { 4, 49, 512 }, { 4, 50, 512 }, { 5, 51, 512 }, { 4, 52, 512 }, { 5, 53, 512 }, { 5, 54, 512 }, { 6, 55, 512 }, + { 4, 56, 512 }, { 5, 57, 512 }, { 5, 58, 512 }, { 6, 59, 512 }, { 5, 60, 512 }, { 6, 61, 512 }, { 6, 62, 512 }, { 7, 63, 512 }, + { 2, 64, 512 }, { 3, 65, 512 }, { 3, 66, 512 }, { 4, 67, 512 }, { 3, 68, 512 }, { 4, 69, 512 }, { 4, 70, 512 }, { 5, 71, 512 }, + { 3, 72, 512 }, { 4, 73, 512 }, { 4, 74, 512 }, { 5, 75, 512 }, { 4, 76, 512 }, { 5, 77, 512 }, { 5, 78, 512 }, { 6, 79, 512 }, + { 3, 80, 512 }, { 4, 81, 512 }, { 4, 82, 512 }, { 5, 83, 512 }, { 4, 84, 512 }, { 5, 85, 512 }, { 5, 86, 512 }, { 6, 87, 512 }, + { 4, 88, 512 }, { 5, 89, 512 }, { 5, 90, 512 }, { 6, 91, 512 }, { 5, 92, 512 }, { 6, 93, 512 }, { 6, 94, 512 }, { 7, 95, 512 }, + { 3, 96, 512 }, { 4, 97, 512 }, { 4, 98, 512 }, { 5, 99, 512 }, { 4, 100, 512 }, { 5, 101, 512 }, { 5, 102, 512 }, { 6, 103, 512 }, + { 4, 104, 512 }, { 5, 105, 512 }, { 5, 106, 512 }, { 6, 107, 512 }, { 5, 108, 512 }, { 6, 109, 512 }, { 6, 110, 512 }, { 7, 111, 512 }, + { 4, 112, 512 }, { 5, 113, 512 }, { 5, 114, 512 }, { 6, 115, 512 }, { 5, 116, 512 }, { 6, 117, 512 }, { 6, 118, 512 }, { 7, 119, 512 }, + { 5, 120, 512 }, { 6, 121, 512 }, { 6, 122, 512 }, { 7, 123, 512 }, { 6, 124, 512 }, { 7, 125, 512 }, { 7, 126, 512 }, { 8, 127, 512 }, + { 2, 128, 512 }, { 3, 129, 512 }, { 3, 130, 512 }, { 4, 131, 512 }, { 3, 132, 512 }, { 4, 133, 512 }, { 4, 134, 512 }, { 5, 135, 512 }, + { 3, 136, 512 }, { 4, 137, 512 }, { 4, 138, 512 }, { 5, 139, 512 }, { 4, 140, 512 }, { 5, 141, 512 }, { 5, 142, 512 }, { 6, 143, 512 }, + { 3, 144, 512 }, { 4, 145, 512 }, { 4, 146, 512 }, { 5, 147, 512 }, { 4, 148, 512 }, { 5, 149, 512 }, { 5, 150, 512 }, { 6, 151, 512 }, + { 4, 152, 512 }, { 5, 153, 512 }, { 5, 154, 512 }, { 6, 155, 512 }, { 5, 156, 512 }, { 6, 157, 512 }, { 6, 158, 512 }, { 7, 159, 512 }, + { 3, 160, 512 }, { 4, 161, 512 }, { 4, 162, 512 }, { 5, 163, 512 }, { 4, 164, 512 }, { 5, 165, 512 }, { 5, 166, 512 }, { 6, 167, 512 }, + { 4, 168, 512 }, { 5, 169, 512 }, { 5, 170, 512 }, { 6, 171, 512 }, { 5, 172, 512 }, { 6, 173, 512 }, { 6, 174, 512 }, { 7, 175, 512 }, + { 4, 176, 512 }, { 5, 177, 512 }, { 5, 178, 512 }, { 6, 179, 512 }, { 5, 180, 512 }, { 6, 181, 512 }, { 6, 182, 512 }, { 7, 183, 512 }, + { 5, 184, 512 }, { 6, 185, 512 }, { 6, 186, 512 }, { 7, 187, 512 }, { 6, 188, 512 }, { 7, 189, 512 }, { 7, 190, 512 }, { 8, 191, 512 }, + { 3, 192, 512 }, { 4, 193, 512 }, { 4, 194, 512 }, { 5, 195, 512 }, { 4, 196, 512 }, { 5, 197, 512 }, { 5, 198, 512 }, { 6, 199, 512 }, + { 4, 200, 512 }, { 5, 201, 512 }, { 5, 202, 512 }, { 6, 203, 512 }, { 5, 204, 512 }, { 6, 205, 512 }, { 6, 206, 512 }, { 7, 207, 512 }, + { 4, 208, 512 }, { 5, 209, 512 }, { 5, 210, 512 }, { 6, 211, 512 }, { 5, 212, 512 }, { 6, 213, 512 }, { 6, 214, 512 }, { 7, 215, 512 }, + { 5, 216, 512 }, { 6, 217, 512 }, { 6, 218, 512 }, { 7, 219, 512 }, { 6, 220, 512 }, { 7, 221, 512 }, { 7, 222, 512 }, { 8, 223, 512 }, + { 4, 224, 512 }, { 5, 225, 512 }, { 5, 226, 512 }, { 6, 227, 512 }, { 5, 228, 512 }, { 6, 229, 512 }, { 6, 230, 512 }, { 7, 231, 512 }, + { 5, 232, 512 }, { 6, 233, 512 }, { 6, 234, 512 }, { 7, 235, 512 }, { 6, 236, 512 }, { 7, 237, 512 }, { 7, 238, 512 }, { 8, 239, 512 }, + { 5, 240, 512 }, { 6, 241, 512 }, { 6, 242, 512 }, { 7, 243, 512 }, { 6, 244, 512 }, { 7, 245, 512 }, { 7, 246, 512 }, { 8, 247, 512 }, + { 6, 248, 512 }, { 7, 249, 512 }, { 7, 250, 512 }, { 8, 251, 512 }, { 7, 252, 512 }, { 8, 253, 512 }, { 8, 254, 512 }, { 9, 255, 512 }, + { 2, 256, 512 }, { 3, 257, 512 }, { 3, 258, 512 }, { 4, 259, 512 }, { 3, 260, 512 }, { 4, 261, 512 }, { 4, 262, 512 }, { 5, 263, 512 }, + { 3, 264, 512 }, { 4, 265, 512 }, { 4, 266, 512 }, { 5, 267, 512 }, { 4, 268, 512 }, { 5, 269, 512 }, { 5, 270, 512 }, { 6, 271, 512 }, + { 3, 272, 512 }, { 4, 273, 512 }, { 4, 274, 512 }, { 5, 275, 512 }, { 4, 276, 512 }, { 5, 277, 512 }, { 5, 278, 512 }, { 6, 279, 512 }, + { 4, 280, 512 }, { 5, 281, 512 }, { 5, 282, 512 }, { 6, 283, 512 }, { 5, 284, 512 }, { 6, 285, 512 }, { 6, 286, 512 }, { 7, 287, 512 }, + { 3, 288, 512 }, { 4, 289, 512 }, { 4, 290, 512 }, { 5, 291, 512 }, { 4, 292, 512 }, { 5, 293, 512 }, { 5, 294, 512 }, { 6, 295, 512 }, + { 4, 296, 512 }, { 5, 297, 512 }, { 5, 298, 512 }, { 6, 299, 512 }, { 5, 300, 512 }, { 6, 301, 512 }, { 6, 302, 512 }, { 7, 303, 512 }, + { 4, 304, 512 }, { 5, 305, 512 }, { 5, 306, 512 }, { 6, 307, 512 }, { 5, 308, 512 }, { 6, 309, 512 }, { 6, 310, 512 }, { 7, 311, 512 }, + { 5, 312, 512 }, { 6, 313, 512 }, { 6, 314, 512 }, { 7, 315, 512 }, { 6, 316, 512 }, { 7, 317, 512 }, { 7, 318, 512 }, { 8, 319, 512 }, + { 3, 320, 512 }, { 4, 321, 512 }, { 4, 322, 512 }, { 5, 323, 512 }, { 4, 324, 512 }, { 5, 325, 512 }, { 5, 326, 512 }, { 6, 327, 512 }, + { 4, 328, 512 }, { 5, 329, 512 }, { 5, 330, 512 }, { 6, 331, 512 }, { 5, 332, 512 }, { 6, 333, 512 }, { 6, 334, 512 }, { 7, 335, 512 }, + { 4, 336, 512 }, { 5, 337, 512 }, { 5, 338, 512 }, { 6, 339, 512 }, { 5, 340, 512 }, { 6, 341, 512 }, { 6, 342, 512 }, { 7, 343, 512 }, + { 5, 344, 512 }, { 6, 345, 512 }, { 6, 346, 512 }, { 7, 347, 512 }, { 6, 348, 512 }, { 7, 349, 512 }, { 7, 350, 512 }, { 8, 351, 512 }, + { 4, 352, 512 }, { 5, 353, 512 }, { 5, 354, 512 }, { 6, 355, 512 }, { 5, 356, 512 }, { 6, 357, 512 }, { 6, 358, 512 }, { 7, 359, 512 }, + { 5, 360, 512 }, { 6, 361, 512 }, { 6, 362, 512 }, { 7, 363, 512 }, { 6, 364, 512 }, { 7, 365, 512 }, { 7, 366, 512 }, { 8, 367, 512 }, + { 5, 368, 512 }, { 6, 369, 512 }, { 6, 370, 512 }, { 7, 371, 512 }, { 6, 372, 512 }, { 7, 373, 512 }, { 7, 374, 512 }, { 8, 375, 512 }, + { 6, 376, 512 }, { 7, 377, 512 }, { 7, 378, 512 }, { 8, 379, 512 }, { 7, 380, 512 }, { 8, 381, 512 }, { 8, 382, 512 }, { 9, 383, 512 }, + { 3, 384, 512 }, { 4, 385, 512 }, { 4, 386, 512 }, { 5, 387, 512 }, { 4, 388, 512 }, { 5, 389, 512 }, { 5, 390, 512 }, { 6, 391, 512 }, + { 4, 392, 512 }, { 5, 393, 512 }, { 5, 394, 512 }, { 6, 395, 512 }, { 5, 396, 512 }, { 6, 397, 512 }, { 6, 398, 512 }, { 7, 399, 512 }, + { 4, 400, 512 }, { 5, 401, 512 }, { 5, 402, 512 }, { 6, 403, 512 }, { 5, 404, 512 }, { 6, 405, 512 }, { 6, 406, 512 }, { 7, 407, 512 }, + { 5, 408, 512 }, { 6, 409, 512 }, { 6, 410, 512 }, { 7, 411, 512 }, { 6, 412, 512 }, { 7, 413, 512 }, { 7, 414, 512 }, { 8, 415, 512 }, + { 4, 416, 512 }, { 5, 417, 512 }, { 5, 418, 512 }, { 6, 419, 512 }, { 5, 420, 512 }, { 6, 421, 512 }, { 6, 422, 512 }, { 7, 423, 512 }, + { 5, 424, 512 }, { 6, 425, 512 }, { 6, 426, 512 }, { 7, 427, 512 }, { 6, 428, 512 }, { 7, 429, 512 }, { 7, 430, 512 }, { 8, 431, 512 }, + { 5, 432, 512 }, { 6, 433, 512 }, { 6, 434, 512 }, { 7, 435, 512 }, { 6, 436, 512 }, { 7, 437, 512 }, { 7, 438, 512 }, { 8, 439, 512 }, + { 6, 440, 512 }, { 7, 441, 512 }, { 7, 442, 512 }, { 8, 443, 512 }, { 7, 444, 512 }, { 8, 445, 512 }, { 8, 446, 512 }, { 9, 447, 512 }, + { 4, 448, 512 }, { 5, 449, 512 }, { 5, 450, 512 }, { 6, 451, 512 }, { 5, 452, 512 }, { 6, 453, 512 }, { 6, 454, 512 }, { 7, 455, 512 }, + { 5, 456, 512 }, { 6, 457, 512 }, { 6, 458, 512 }, { 7, 459, 512 }, { 6, 460, 512 }, { 7, 461, 512 }, { 7, 462, 512 }, { 8, 463, 512 }, + { 5, 464, 512 }, { 6, 465, 512 }, { 6, 466, 512 }, { 7, 467, 512 }, { 6, 468, 512 }, { 7, 469, 512 }, { 7, 470, 512 }, { 8, 471, 512 }, + { 6, 472, 512 }, { 7, 473, 512 }, { 7, 474, 512 }, { 8, 475, 512 }, { 7, 476, 512 }, { 8, 477, 512 }, { 8, 478, 512 }, { 9, 479, 512 }, + { 5, 480, 512 }, { 6, 481, 512 }, { 6, 482, 512 }, { 7, 483, 512 }, { 6, 484, 512 }, { 7, 485, 512 }, { 7, 486, 512 }, { 8, 487, 512 }, + { 6, 488, 512 }, { 7, 489, 512 }, { 7, 490, 512 }, { 8, 491, 512 }, { 7, 492, 512 }, { 8, 493, 512 }, { 8, 494, 512 }, { 9, 495, 512 }, + { 6, 496, 512 }, { 7, 497, 512 }, { 7, 498, 512 }, { 8, 499, 512 }, { 7, 500, 512 }, { 8, 501, 512 }, { 8, 502, 512 }, { 9, 503, 512 }, + { 7, 504, 512 }, { 8, 505, 512 }, { 8, 506, 512 }, { 9, 507, 512 }, { 8, 508, 512 }, { 9, 509, 512 }, { 9, 510, 512 }, { 10, 511, 512 }, #if FP_LUT > 10 - { 1, 0, 0 }, { 2, 1, 1024 }, { 2, 2, 1024 }, { 3, 3, 1024 }, { 2, 4, 1024 }, { 3, 5, 1024 }, { 3, 6, 1024 }, { 4, 7, 1024 }, - { 2, 8, 1024 }, { 3, 9, 1024 }, { 3, 10, 1024 }, { 4, 11, 1024 }, { 3, 12, 1024 }, { 4, 13, 1024 }, { 4, 14, 1024 }, { 5, 15, 1024 }, - { 2, 16, 1024 }, { 3, 17, 1024 }, { 3, 18, 1024 }, { 4, 19, 1024 }, { 3, 20, 1024 }, { 4, 21, 1024 }, { 4, 22, 1024 }, { 5, 23, 1024 }, - { 3, 24, 1024 }, { 4, 25, 1024 }, { 4, 26, 1024 }, { 5, 27, 1024 }, { 4, 28, 1024 }, { 5, 29, 1024 }, { 5, 30, 1024 }, { 6, 31, 1024 }, - { 2, 32, 1024 }, { 3, 33, 1024 }, { 3, 34, 1024 }, { 4, 35, 1024 }, { 3, 36, 1024 }, { 4, 37, 1024 }, { 4, 38, 1024 }, { 5, 39, 1024 }, - { 3, 40, 1024 }, { 4, 41, 1024 }, { 4, 42, 1024 }, { 5, 43, 1024 }, { 4, 44, 1024 }, { 5, 45, 1024 }, { 5, 46, 1024 }, { 6, 47, 1024 }, - { 3, 48, 1024 }, { 4, 49, 1024 }, { 4, 50, 1024 }, { 5, 51, 1024 }, { 4, 52, 1024 }, { 5, 53, 1024 }, { 5, 54, 1024 }, { 6, 55, 1024 }, - { 4, 56, 1024 }, { 5, 57, 1024 }, { 5, 58, 1024 }, { 6, 59, 1024 }, { 5, 60, 1024 }, { 6, 61, 1024 }, { 6, 62, 1024 }, { 7, 63, 1024 }, - { 2, 64, 1024 }, { 3, 65, 1024 }, { 3, 66, 1024 }, { 4, 67, 1024 }, { 3, 68, 1024 }, { 4, 69, 1024 }, { 4, 70, 1024 }, { 5, 71, 1024 }, - { 3, 72, 1024 }, { 4, 73, 1024 }, { 4, 74, 1024 }, { 5, 75, 1024 }, { 4, 76, 1024 }, { 5, 77, 1024 }, { 5, 78, 1024 }, { 6, 79, 1024 }, - { 3, 80, 1024 }, { 4, 81, 1024 }, { 4, 82, 1024 }, { 5, 83, 1024 }, { 4, 84, 1024 }, { 5, 85, 1024 }, { 5, 86, 1024 }, { 6, 87, 1024 }, - { 4, 88, 1024 }, { 5, 89, 1024 }, { 5, 90, 1024 }, { 6, 91, 1024 }, { 5, 92, 1024 }, { 6, 93, 1024 }, { 6, 94, 1024 }, { 7, 95, 1024 }, - { 3, 96, 1024 }, { 4, 97, 1024 }, { 4, 98, 1024 }, { 5, 99, 1024 }, { 4, 100, 1024 }, { 5, 101, 1024 }, { 5, 102, 1024 }, { 6, 103, 1024 }, - { 4, 104, 1024 }, { 5, 105, 1024 }, { 5, 106, 1024 }, { 6, 107, 1024 }, { 5, 108, 1024 }, { 6, 109, 1024 }, { 6, 110, 1024 }, { 7, 111, 1024 }, - { 4, 112, 1024 }, { 5, 113, 1024 }, { 5, 114, 1024 }, { 6, 115, 1024 }, { 5, 116, 1024 }, { 6, 117, 1024 }, { 6, 118, 1024 }, { 7, 119, 1024 }, - { 5, 120, 1024 }, { 6, 121, 1024 }, { 6, 122, 1024 }, { 7, 123, 1024 }, { 6, 124, 1024 }, { 7, 125, 1024 }, { 7, 126, 1024 }, { 8, 127, 1024 }, - { 2, 128, 1024 }, { 3, 129, 1024 }, { 3, 130, 1024 }, { 4, 131, 1024 }, { 3, 132, 1024 }, { 4, 133, 1024 }, { 4, 134, 1024 }, { 5, 135, 1024 }, - { 3, 136, 1024 }, { 4, 137, 1024 }, { 4, 138, 1024 }, { 5, 139, 1024 }, { 4, 140, 1024 }, { 5, 141, 1024 }, { 5, 142, 1024 }, { 6, 143, 1024 }, - { 3, 144, 1024 }, { 4, 145, 1024 }, { 4, 146, 1024 }, { 5, 147, 1024 }, { 4, 148, 1024 }, { 5, 149, 1024 }, { 5, 150, 1024 }, { 6, 151, 1024 }, - { 4, 152, 1024 }, { 5, 153, 1024 }, { 5, 154, 1024 }, { 6, 155, 1024 }, { 5, 156, 1024 }, { 6, 157, 1024 }, { 6, 158, 1024 }, { 7, 159, 1024 }, - { 3, 160, 1024 }, { 4, 161, 1024 }, { 4, 162, 1024 }, { 5, 163, 1024 }, { 4, 164, 1024 }, { 5, 165, 1024 }, { 5, 166, 1024 }, { 6, 167, 1024 }, - { 4, 168, 1024 }, { 5, 169, 1024 }, { 5, 170, 1024 }, { 6, 171, 1024 }, { 5, 172, 1024 }, { 6, 173, 1024 }, { 6, 174, 1024 }, { 7, 175, 1024 }, - { 4, 176, 1024 }, { 5, 177, 1024 }, { 5, 178, 1024 }, { 6, 179, 1024 }, { 5, 180, 1024 }, { 6, 181, 1024 }, { 6, 182, 1024 }, { 7, 183, 1024 }, - { 5, 184, 1024 }, { 6, 185, 1024 }, { 6, 186, 1024 }, { 7, 187, 1024 }, { 6, 188, 1024 }, { 7, 189, 1024 }, { 7, 190, 1024 }, { 8, 191, 1024 }, - { 3, 192, 1024 }, { 4, 193, 1024 }, { 4, 194, 1024 }, { 5, 195, 1024 }, { 4, 196, 1024 }, { 5, 197, 1024 }, { 5, 198, 1024 }, { 6, 199, 1024 }, - { 4, 200, 1024 }, { 5, 201, 1024 }, { 5, 202, 1024 }, { 6, 203, 1024 }, { 5, 204, 1024 }, { 6, 205, 1024 }, { 6, 206, 1024 }, { 7, 207, 1024 }, - { 4, 208, 1024 }, { 5, 209, 1024 }, { 5, 210, 1024 }, { 6, 211, 1024 }, { 5, 212, 1024 }, { 6, 213, 1024 }, { 6, 214, 1024 }, { 7, 215, 1024 }, - { 5, 216, 1024 }, { 6, 217, 1024 }, { 6, 218, 1024 }, { 7, 219, 1024 }, { 6, 220, 1024 }, { 7, 221, 1024 }, { 7, 222, 1024 }, { 8, 223, 1024 }, - { 4, 224, 1024 }, { 5, 225, 1024 }, { 5, 226, 1024 }, { 6, 227, 1024 }, { 5, 228, 1024 }, { 6, 229, 1024 }, { 6, 230, 1024 }, { 7, 231, 1024 }, - { 5, 232, 1024 }, { 6, 233, 1024 }, { 6, 234, 1024 }, { 7, 235, 1024 }, { 6, 236, 1024 }, { 7, 237, 1024 }, { 7, 238, 1024 }, { 8, 239, 1024 }, - { 5, 240, 1024 }, { 6, 241, 1024 }, { 6, 242, 1024 }, { 7, 243, 1024 }, { 6, 244, 1024 }, { 7, 245, 1024 }, { 7, 246, 1024 }, { 8, 247, 1024 }, - { 6, 248, 1024 }, { 7, 249, 1024 }, { 7, 250, 1024 }, { 8, 251, 1024 }, { 7, 252, 1024 }, { 8, 253, 1024 }, { 8, 254, 1024 }, { 9, 255, 1024 }, - { 2, 256, 1024 }, { 3, 257, 1024 }, { 3, 258, 1024 }, { 4, 259, 1024 }, { 3, 260, 1024 }, { 4, 261, 1024 }, { 4, 262, 1024 }, { 5, 263, 1024 }, - { 3, 264, 1024 }, { 4, 265, 1024 }, { 4, 266, 1024 }, { 5, 267, 1024 }, { 4, 268, 1024 }, { 5, 269, 1024 }, { 5, 270, 1024 }, { 6, 271, 1024 }, - { 3, 272, 1024 }, { 4, 273, 1024 }, { 4, 274, 1024 }, { 5, 275, 1024 }, { 4, 276, 1024 }, { 5, 277, 1024 }, { 5, 278, 1024 }, { 6, 279, 1024 }, - { 4, 280, 1024 }, { 5, 281, 1024 }, { 5, 282, 1024 }, { 6, 283, 1024 }, { 5, 284, 1024 }, { 6, 285, 1024 }, { 6, 286, 1024 }, { 7, 287, 1024 }, - { 3, 288, 1024 }, { 4, 289, 1024 }, { 4, 290, 1024 }, { 5, 291, 1024 }, { 4, 292, 1024 }, { 5, 293, 1024 }, { 5, 294, 1024 }, { 6, 295, 1024 }, - { 4, 296, 1024 }, { 5, 297, 1024 }, { 5, 298, 1024 }, { 6, 299, 1024 }, { 5, 300, 1024 }, { 6, 301, 1024 }, { 6, 302, 1024 }, { 7, 303, 1024 }, - { 4, 304, 1024 }, { 5, 305, 1024 }, { 5, 306, 1024 }, { 6, 307, 1024 }, { 5, 308, 1024 }, { 6, 309, 1024 }, { 6, 310, 1024 }, { 7, 311, 1024 }, - { 5, 312, 1024 }, { 6, 313, 1024 }, { 6, 314, 1024 }, { 7, 315, 1024 }, { 6, 316, 1024 }, { 7, 317, 1024 }, { 7, 318, 1024 }, { 8, 319, 1024 }, - { 3, 320, 1024 }, { 4, 321, 1024 }, { 4, 322, 1024 }, { 5, 323, 1024 }, { 4, 324, 1024 }, { 5, 325, 1024 }, { 5, 326, 1024 }, { 6, 327, 1024 }, - { 4, 328, 1024 }, { 5, 329, 1024 }, { 5, 330, 1024 }, { 6, 331, 1024 }, { 5, 332, 1024 }, { 6, 333, 1024 }, { 6, 334, 1024 }, { 7, 335, 1024 }, - { 4, 336, 1024 }, { 5, 337, 1024 }, { 5, 338, 1024 }, { 6, 339, 1024 }, { 5, 340, 1024 }, { 6, 341, 1024 }, { 6, 342, 1024 }, { 7, 343, 1024 }, - { 5, 344, 1024 }, { 6, 345, 1024 }, { 6, 346, 1024 }, { 7, 347, 1024 }, { 6, 348, 1024 }, { 7, 349, 1024 }, { 7, 350, 1024 }, { 8, 351, 1024 }, - { 4, 352, 1024 }, { 5, 353, 1024 }, { 5, 354, 1024 }, { 6, 355, 1024 }, { 5, 356, 1024 }, { 6, 357, 1024 }, { 6, 358, 1024 }, { 7, 359, 1024 }, - { 5, 360, 1024 }, { 6, 361, 1024 }, { 6, 362, 1024 }, { 7, 363, 1024 }, { 6, 364, 1024 }, { 7, 365, 1024 }, { 7, 366, 1024 }, { 8, 367, 1024 }, - { 5, 368, 1024 }, { 6, 369, 1024 }, { 6, 370, 1024 }, { 7, 371, 1024 }, { 6, 372, 1024 }, { 7, 373, 1024 }, { 7, 374, 1024 }, { 8, 375, 1024 }, - { 6, 376, 1024 }, { 7, 377, 1024 }, { 7, 378, 1024 }, { 8, 379, 1024 }, { 7, 380, 1024 }, { 8, 381, 1024 }, { 8, 382, 1024 }, { 9, 383, 1024 }, - { 3, 384, 1024 }, { 4, 385, 1024 }, { 4, 386, 1024 }, { 5, 387, 1024 }, { 4, 388, 1024 }, { 5, 389, 1024 }, { 5, 390, 1024 }, { 6, 391, 1024 }, - { 4, 392, 1024 }, { 5, 393, 1024 }, { 5, 394, 1024 }, { 6, 395, 1024 }, { 5, 396, 1024 }, { 6, 397, 1024 }, { 6, 398, 1024 }, { 7, 399, 1024 }, - { 4, 400, 1024 }, { 5, 401, 1024 }, { 5, 402, 1024 }, { 6, 403, 1024 }, { 5, 404, 1024 }, { 6, 405, 1024 }, { 6, 406, 1024 }, { 7, 407, 1024 }, - { 5, 408, 1024 }, { 6, 409, 1024 }, { 6, 410, 1024 }, { 7, 411, 1024 }, { 6, 412, 1024 }, { 7, 413, 1024 }, { 7, 414, 1024 }, { 8, 415, 1024 }, - { 4, 416, 1024 }, { 5, 417, 1024 }, { 5, 418, 1024 }, { 6, 419, 1024 }, { 5, 420, 1024 }, { 6, 421, 1024 }, { 6, 422, 1024 }, { 7, 423, 1024 }, - { 5, 424, 1024 }, { 6, 425, 1024 }, { 6, 426, 1024 }, { 7, 427, 1024 }, { 6, 428, 1024 }, { 7, 429, 1024 }, { 7, 430, 1024 }, { 8, 431, 1024 }, - { 5, 432, 1024 }, { 6, 433, 1024 }, { 6, 434, 1024 }, { 7, 435, 1024 }, { 6, 436, 1024 }, { 7, 437, 1024 }, { 7, 438, 1024 }, { 8, 439, 1024 }, - { 6, 440, 1024 }, { 7, 441, 1024 }, { 7, 442, 1024 }, { 8, 443, 1024 }, { 7, 444, 1024 }, { 8, 445, 1024 }, { 8, 446, 1024 }, { 9, 447, 1024 }, - { 4, 448, 1024 }, { 5, 449, 1024 }, { 5, 450, 1024 }, { 6, 451, 1024 }, { 5, 452, 1024 }, { 6, 453, 1024 }, { 6, 454, 1024 }, { 7, 455, 1024 }, - { 5, 456, 1024 }, { 6, 457, 1024 }, { 6, 458, 1024 }, { 7, 459, 1024 }, { 6, 460, 1024 }, { 7, 461, 1024 }, { 7, 462, 1024 }, { 8, 463, 1024 }, - { 5, 464, 1024 }, { 6, 465, 1024 }, { 6, 466, 1024 }, { 7, 467, 1024 }, { 6, 468, 1024 }, { 7, 469, 1024 }, { 7, 470, 1024 }, { 8, 471, 1024 }, - { 6, 472, 1024 }, { 7, 473, 1024 }, { 7, 474, 1024 }, { 8, 475, 1024 }, { 7, 476, 1024 }, { 8, 477, 1024 }, { 8, 478, 1024 }, { 9, 479, 1024 }, - { 5, 480, 1024 }, { 6, 481, 1024 }, { 6, 482, 1024 }, { 7, 483, 1024 }, { 6, 484, 1024 }, { 7, 485, 1024 }, { 7, 486, 1024 }, { 8, 487, 1024 }, - { 6, 488, 1024 }, { 7, 489, 1024 }, { 7, 490, 1024 }, { 8, 491, 1024 }, { 7, 492, 1024 }, { 8, 493, 1024 }, { 8, 494, 1024 }, { 9, 495, 1024 }, - { 6, 496, 1024 }, { 7, 497, 1024 }, { 7, 498, 1024 }, { 8, 499, 1024 }, { 7, 500, 1024 }, { 8, 501, 1024 }, { 8, 502, 1024 }, { 9, 503, 1024 }, - { 7, 504, 1024 }, { 8, 505, 1024 }, { 8, 506, 1024 }, { 9, 507, 1024 }, { 8, 508, 1024 }, { 9, 509, 1024 }, { 9, 510, 1024 }, { 10, 511, 1024 }, - { 2, 512, 1024 }, { 3, 513, 1024 }, { 3, 514, 1024 }, { 4, 515, 1024 }, { 3, 516, 1024 }, { 4, 517, 1024 }, { 4, 518, 1024 }, { 5, 519, 1024 }, - { 3, 520, 1024 }, { 4, 521, 1024 }, { 4, 522, 1024 }, { 5, 523, 1024 }, { 4, 524, 1024 }, { 5, 525, 1024 }, { 5, 526, 1024 }, { 6, 527, 1024 }, - { 3, 528, 1024 }, { 4, 529, 1024 }, { 4, 530, 1024 }, { 5, 531, 1024 }, { 4, 532, 1024 }, { 5, 533, 1024 }, { 5, 534, 1024 }, { 6, 535, 1024 }, - { 4, 536, 1024 }, { 5, 537, 1024 }, { 5, 538, 1024 }, { 6, 539, 1024 }, { 5, 540, 1024 }, { 6, 541, 1024 }, { 6, 542, 1024 }, { 7, 543, 1024 }, - { 3, 544, 1024 }, { 4, 545, 1024 }, { 4, 546, 1024 }, { 5, 547, 1024 }, { 4, 548, 1024 }, { 5, 549, 1024 }, { 5, 550, 1024 }, { 6, 551, 1024 }, - { 4, 552, 1024 }, { 5, 553, 1024 }, { 5, 554, 1024 }, { 6, 555, 1024 }, { 5, 556, 1024 }, { 6, 557, 1024 }, { 6, 558, 1024 }, { 7, 559, 1024 }, - { 4, 560, 1024 }, { 5, 561, 1024 }, { 5, 562, 1024 }, { 6, 563, 1024 }, { 5, 564, 1024 }, { 6, 565, 1024 }, { 6, 566, 1024 }, { 7, 567, 1024 }, - { 5, 568, 1024 }, { 6, 569, 1024 }, { 6, 570, 1024 }, { 7, 571, 1024 }, { 6, 572, 1024 }, { 7, 573, 1024 }, { 7, 574, 1024 }, { 8, 575, 1024 }, - { 3, 576, 1024 }, { 4, 577, 1024 }, { 4, 578, 1024 }, { 5, 579, 1024 }, { 4, 580, 1024 }, { 5, 581, 1024 }, { 5, 582, 1024 }, { 6, 583, 1024 }, - { 4, 584, 1024 }, { 5, 585, 1024 }, { 5, 586, 1024 }, { 6, 587, 1024 }, { 5, 588, 1024 }, { 6, 589, 1024 }, { 6, 590, 1024 }, { 7, 591, 1024 }, - { 4, 592, 1024 }, { 5, 593, 1024 }, { 5, 594, 1024 }, { 6, 595, 1024 }, { 5, 596, 1024 }, { 6, 597, 1024 }, { 6, 598, 1024 }, { 7, 599, 1024 }, - { 5, 600, 1024 }, { 6, 601, 1024 }, { 6, 602, 1024 }, { 7, 603, 1024 }, { 6, 604, 1024 }, { 7, 605, 1024 }, { 7, 606, 1024 }, { 8, 607, 1024 }, - { 4, 608, 1024 }, { 5, 609, 1024 }, { 5, 610, 1024 }, { 6, 611, 1024 }, { 5, 612, 1024 }, { 6, 613, 1024 }, { 6, 614, 1024 }, { 7, 615, 1024 }, - { 5, 616, 1024 }, { 6, 617, 1024 }, { 6, 618, 1024 }, { 7, 619, 1024 }, { 6, 620, 1024 }, { 7, 621, 1024 }, { 7, 622, 1024 }, { 8, 623, 1024 }, - { 5, 624, 1024 }, { 6, 625, 1024 }, { 6, 626, 1024 }, { 7, 627, 1024 }, { 6, 628, 1024 }, { 7, 629, 1024 }, { 7, 630, 1024 }, { 8, 631, 1024 }, - { 6, 632, 1024 }, { 7, 633, 1024 }, { 7, 634, 1024 }, { 8, 635, 1024 }, { 7, 636, 1024 }, { 8, 637, 1024 }, { 8, 638, 1024 }, { 9, 639, 1024 }, - { 3, 640, 1024 }, { 4, 641, 1024 }, { 4, 642, 1024 }, { 5, 643, 1024 }, { 4, 644, 1024 }, { 5, 645, 1024 }, { 5, 646, 1024 }, { 6, 647, 1024 }, - { 4, 648, 1024 }, { 5, 649, 1024 }, { 5, 650, 1024 }, { 6, 651, 1024 }, { 5, 652, 1024 }, { 6, 653, 1024 }, { 6, 654, 1024 }, { 7, 655, 1024 }, - { 4, 656, 1024 }, { 5, 657, 1024 }, { 5, 658, 1024 }, { 6, 659, 1024 }, { 5, 660, 1024 }, { 6, 661, 1024 }, { 6, 662, 1024 }, { 7, 663, 1024 }, - { 5, 664, 1024 }, { 6, 665, 1024 }, { 6, 666, 1024 }, { 7, 667, 1024 }, { 6, 668, 1024 }, { 7, 669, 1024 }, { 7, 670, 1024 }, { 8, 671, 1024 }, - { 4, 672, 1024 }, { 5, 673, 1024 }, { 5, 674, 1024 }, { 6, 675, 1024 }, { 5, 676, 1024 }, { 6, 677, 1024 }, { 6, 678, 1024 }, { 7, 679, 1024 }, - { 5, 680, 1024 }, { 6, 681, 1024 }, { 6, 682, 1024 }, { 7, 683, 1024 }, { 6, 684, 1024 }, { 7, 685, 1024 }, { 7, 686, 1024 }, { 8, 687, 1024 }, - { 5, 688, 1024 }, { 6, 689, 1024 }, { 6, 690, 1024 }, { 7, 691, 1024 }, { 6, 692, 1024 }, { 7, 693, 1024 }, { 7, 694, 1024 }, { 8, 695, 1024 }, - { 6, 696, 1024 }, { 7, 697, 1024 }, { 7, 698, 1024 }, { 8, 699, 1024 }, { 7, 700, 1024 }, { 8, 701, 1024 }, { 8, 702, 1024 }, { 9, 703, 1024 }, - { 4, 704, 1024 }, { 5, 705, 1024 }, { 5, 706, 1024 }, { 6, 707, 1024 }, { 5, 708, 1024 }, { 6, 709, 1024 }, { 6, 710, 1024 }, { 7, 711, 1024 }, - { 5, 712, 1024 }, { 6, 713, 1024 }, { 6, 714, 1024 }, { 7, 715, 1024 }, { 6, 716, 1024 }, { 7, 717, 1024 }, { 7, 718, 1024 }, { 8, 719, 1024 }, - { 5, 720, 1024 }, { 6, 721, 1024 }, { 6, 722, 1024 }, { 7, 723, 1024 }, { 6, 724, 1024 }, { 7, 725, 1024 }, { 7, 726, 1024 }, { 8, 727, 1024 }, - { 6, 728, 1024 }, { 7, 729, 1024 }, { 7, 730, 1024 }, { 8, 731, 1024 }, { 7, 732, 1024 }, { 8, 733, 1024 }, { 8, 734, 1024 }, { 9, 735, 1024 }, - { 5, 736, 1024 }, { 6, 737, 1024 }, { 6, 738, 1024 }, { 7, 739, 1024 }, { 6, 740, 1024 }, { 7, 741, 1024 }, { 7, 742, 1024 }, { 8, 743, 1024 }, - { 6, 744, 1024 }, { 7, 745, 1024 }, { 7, 746, 1024 }, { 8, 747, 1024 }, { 7, 748, 1024 }, { 8, 749, 1024 }, { 8, 750, 1024 }, { 9, 751, 1024 }, - { 6, 752, 1024 }, { 7, 753, 1024 }, { 7, 754, 1024 }, { 8, 755, 1024 }, { 7, 756, 1024 }, { 8, 757, 1024 }, { 8, 758, 1024 }, { 9, 759, 1024 }, - { 7, 760, 1024 }, { 8, 761, 1024 }, { 8, 762, 1024 }, { 9, 763, 1024 }, { 8, 764, 1024 }, { 9, 765, 1024 }, { 9, 766, 1024 }, { 10, 767, 1024 }, - { 3, 768, 1024 }, { 4, 769, 1024 }, { 4, 770, 1024 }, { 5, 771, 1024 }, { 4, 772, 1024 }, { 5, 773, 1024 }, { 5, 774, 1024 }, { 6, 775, 1024 }, - { 4, 776, 1024 }, { 5, 777, 1024 }, { 5, 778, 1024 }, { 6, 779, 1024 }, { 5, 780, 1024 }, { 6, 781, 1024 }, { 6, 782, 1024 }, { 7, 783, 1024 }, - { 4, 784, 1024 }, { 5, 785, 1024 }, { 5, 786, 1024 }, { 6, 787, 1024 }, { 5, 788, 1024 }, { 6, 789, 1024 }, { 6, 790, 1024 }, { 7, 791, 1024 }, - { 5, 792, 1024 }, { 6, 793, 1024 }, { 6, 794, 1024 }, { 7, 795, 1024 }, { 6, 796, 1024 }, { 7, 797, 1024 }, { 7, 798, 1024 }, { 8, 799, 1024 }, - { 4, 800, 1024 }, { 5, 801, 1024 }, { 5, 802, 1024 }, { 6, 803, 1024 }, { 5, 804, 1024 }, { 6, 805, 1024 }, { 6, 806, 1024 }, { 7, 807, 1024 }, - { 5, 808, 1024 }, { 6, 809, 1024 }, { 6, 810, 1024 }, { 7, 811, 1024 }, { 6, 812, 1024 }, { 7, 813, 1024 }, { 7, 814, 1024 }, { 8, 815, 1024 }, - { 5, 816, 1024 }, { 6, 817, 1024 }, { 6, 818, 1024 }, { 7, 819, 1024 }, { 6, 820, 1024 }, { 7, 821, 1024 }, { 7, 822, 1024 }, { 8, 823, 1024 }, - { 6, 824, 1024 }, { 7, 825, 1024 }, { 7, 826, 1024 }, { 8, 827, 1024 }, { 7, 828, 1024 }, { 8, 829, 1024 }, { 8, 830, 1024 }, { 9, 831, 1024 }, - { 4, 832, 1024 }, { 5, 833, 1024 }, { 5, 834, 1024 }, { 6, 835, 1024 }, { 5, 836, 1024 }, { 6, 837, 1024 }, { 6, 838, 1024 }, { 7, 839, 1024 }, - { 5, 840, 1024 }, { 6, 841, 1024 }, { 6, 842, 1024 }, { 7, 843, 1024 }, { 6, 844, 1024 }, { 7, 845, 1024 }, { 7, 846, 1024 }, { 8, 847, 1024 }, - { 5, 848, 1024 }, { 6, 849, 1024 }, { 6, 850, 1024 }, { 7, 851, 1024 }, { 6, 852, 1024 }, { 7, 853, 1024 }, { 7, 854, 1024 }, { 8, 855, 1024 }, - { 6, 856, 1024 }, { 7, 857, 1024 }, { 7, 858, 1024 }, { 8, 859, 1024 }, { 7, 860, 1024 }, { 8, 861, 1024 }, { 8, 862, 1024 }, { 9, 863, 1024 }, - { 5, 864, 1024 }, { 6, 865, 1024 }, { 6, 866, 1024 }, { 7, 867, 1024 }, { 6, 868, 1024 }, { 7, 869, 1024 }, { 7, 870, 1024 }, { 8, 871, 1024 }, - { 6, 872, 1024 }, { 7, 873, 1024 }, { 7, 874, 1024 }, { 8, 875, 1024 }, { 7, 876, 1024 }, { 8, 877, 1024 }, { 8, 878, 1024 }, { 9, 879, 1024 }, - { 6, 880, 1024 }, { 7, 881, 1024 }, { 7, 882, 1024 }, { 8, 883, 1024 }, { 7, 884, 1024 }, { 8, 885, 1024 }, { 8, 886, 1024 }, { 9, 887, 1024 }, - { 7, 888, 1024 }, { 8, 889, 1024 }, { 8, 890, 1024 }, { 9, 891, 1024 }, { 8, 892, 1024 }, { 9, 893, 1024 }, { 9, 894, 1024 }, { 10, 895, 1024 }, - { 4, 896, 1024 }, { 5, 897, 1024 }, { 5, 898, 1024 }, { 6, 899, 1024 }, { 5, 900, 1024 }, { 6, 901, 1024 }, { 6, 902, 1024 }, { 7, 903, 1024 }, - { 5, 904, 1024 }, { 6, 905, 1024 }, { 6, 906, 1024 }, { 7, 907, 1024 }, { 6, 908, 1024 }, { 7, 909, 1024 }, { 7, 910, 1024 }, { 8, 911, 1024 }, - { 5, 912, 1024 }, { 6, 913, 1024 }, { 6, 914, 1024 }, { 7, 915, 1024 }, { 6, 916, 1024 }, { 7, 917, 1024 }, { 7, 918, 1024 }, { 8, 919, 1024 }, - { 6, 920, 1024 }, { 7, 921, 1024 }, { 7, 922, 1024 }, { 8, 923, 1024 }, { 7, 924, 1024 }, { 8, 925, 1024 }, { 8, 926, 1024 }, { 9, 927, 1024 }, - { 5, 928, 1024 }, { 6, 929, 1024 }, { 6, 930, 1024 }, { 7, 931, 1024 }, { 6, 932, 1024 }, { 7, 933, 1024 }, { 7, 934, 1024 }, { 8, 935, 1024 }, - { 6, 936, 1024 }, { 7, 937, 1024 }, { 7, 938, 1024 }, { 8, 939, 1024 }, { 7, 940, 1024 }, { 8, 941, 1024 }, { 8, 942, 1024 }, { 9, 943, 1024 }, - { 6, 944, 1024 }, { 7, 945, 1024 }, { 7, 946, 1024 }, { 8, 947, 1024 }, { 7, 948, 1024 }, { 8, 949, 1024 }, { 8, 950, 1024 }, { 9, 951, 1024 }, - { 7, 952, 1024 }, { 8, 953, 1024 }, { 8, 954, 1024 }, { 9, 955, 1024 }, { 8, 956, 1024 }, { 9, 957, 1024 }, { 9, 958, 1024 }, { 10, 959, 1024 }, - { 5, 960, 1024 }, { 6, 961, 1024 }, { 6, 962, 1024 }, { 7, 963, 1024 }, { 6, 964, 1024 }, { 7, 965, 1024 }, { 7, 966, 1024 }, { 8, 967, 1024 }, - { 6, 968, 1024 }, { 7, 969, 1024 }, { 7, 970, 1024 }, { 8, 971, 1024 }, { 7, 972, 1024 }, { 8, 973, 1024 }, { 8, 974, 1024 }, { 9, 975, 1024 }, - { 6, 976, 1024 }, { 7, 977, 1024 }, { 7, 978, 1024 }, { 8, 979, 1024 }, { 7, 980, 1024 }, { 8, 981, 1024 }, { 8, 982, 1024 }, { 9, 983, 1024 }, - { 7, 984, 1024 }, { 8, 985, 1024 }, { 8, 986, 1024 }, { 9, 987, 1024 }, { 8, 988, 1024 }, { 9, 989, 1024 }, { 9, 990, 1024 }, { 10, 991, 1024 }, - { 6, 992, 1024 }, { 7, 993, 1024 }, { 7, 994, 1024 }, { 8, 995, 1024 }, { 7, 996, 1024 }, { 8, 997, 1024 }, { 8, 998, 1024 }, { 9, 999, 1024 }, - { 7, 1000, 1024 }, { 8, 1001, 1024 }, { 8, 1002, 1024 }, { 9, 1003, 1024 }, { 8, 1004, 1024 }, { 9, 1005, 1024 }, { 9, 1006, 1024 }, { 10, 1007, 1024 }, - { 7, 1008, 1024 }, { 8, 1009, 1024 }, { 8, 1010, 1024 }, { 9, 1011, 1024 }, { 8, 1012, 1024 }, { 9, 1013, 1024 }, { 9, 1014, 1024 }, { 10, 1015, 1024 }, - { 8, 1016, 1024 }, { 9, 1017, 1024 }, { 9, 1018, 1024 }, { 10, 1019, 1024 }, { 9, 1020, 1024 }, { 10, 1021, 1024 }, { 10, 1022, 1024 }, { 11, 1023, 1024 }, + { 1, 0, 0 }, { 2, 1, 1024 }, { 2, 2, 1024 }, { 3, 3, 1024 }, { 2, 4, 1024 }, { 3, 5, 1024 }, { 3, 6, 1024 }, { 4, 7, 1024 }, + { 2, 8, 1024 }, { 3, 9, 1024 }, { 3, 10, 1024 }, { 4, 11, 1024 }, { 3, 12, 1024 }, { 4, 13, 1024 }, { 4, 14, 1024 }, { 5, 15, 1024 }, + { 2, 16, 1024 }, { 3, 17, 1024 }, { 3, 18, 1024 }, { 4, 19, 1024 }, { 3, 20, 1024 }, { 4, 21, 1024 }, { 4, 22, 1024 }, { 5, 23, 1024 }, + { 3, 24, 1024 }, { 4, 25, 1024 }, { 4, 26, 1024 }, { 5, 27, 1024 }, { 4, 28, 1024 }, { 5, 29, 1024 }, { 5, 30, 1024 }, { 6, 31, 1024 }, + { 2, 32, 1024 }, { 3, 33, 1024 }, { 3, 34, 1024 }, { 4, 35, 1024 }, { 3, 36, 1024 }, { 4, 37, 1024 }, { 4, 38, 1024 }, { 5, 39, 1024 }, + { 3, 40, 1024 }, { 4, 41, 1024 }, { 4, 42, 1024 }, { 5, 43, 1024 }, { 4, 44, 1024 }, { 5, 45, 1024 }, { 5, 46, 1024 }, { 6, 47, 1024 }, + { 3, 48, 1024 }, { 4, 49, 1024 }, { 4, 50, 1024 }, { 5, 51, 1024 }, { 4, 52, 1024 }, { 5, 53, 1024 }, { 5, 54, 1024 }, { 6, 55, 1024 }, + { 4, 56, 1024 }, { 5, 57, 1024 }, { 5, 58, 1024 }, { 6, 59, 1024 }, { 5, 60, 1024 }, { 6, 61, 1024 }, { 6, 62, 1024 }, { 7, 63, 1024 }, + { 2, 64, 1024 }, { 3, 65, 1024 }, { 3, 66, 1024 }, { 4, 67, 1024 }, { 3, 68, 1024 }, { 4, 69, 1024 }, { 4, 70, 1024 }, { 5, 71, 1024 }, + { 3, 72, 1024 }, { 4, 73, 1024 }, { 4, 74, 1024 }, { 5, 75, 1024 }, { 4, 76, 1024 }, { 5, 77, 1024 }, { 5, 78, 1024 }, { 6, 79, 1024 }, + { 3, 80, 1024 }, { 4, 81, 1024 }, { 4, 82, 1024 }, { 5, 83, 1024 }, { 4, 84, 1024 }, { 5, 85, 1024 }, { 5, 86, 1024 }, { 6, 87, 1024 }, + { 4, 88, 1024 }, { 5, 89, 1024 }, { 5, 90, 1024 }, { 6, 91, 1024 }, { 5, 92, 1024 }, { 6, 93, 1024 }, { 6, 94, 1024 }, { 7, 95, 1024 }, + { 3, 96, 1024 }, { 4, 97, 1024 }, { 4, 98, 1024 }, { 5, 99, 1024 }, { 4, 100, 1024 }, { 5, 101, 1024 }, { 5, 102, 1024 }, { 6, 103, 1024 }, + { 4, 104, 1024 }, { 5, 105, 1024 }, { 5, 106, 1024 }, { 6, 107, 1024 }, { 5, 108, 1024 }, { 6, 109, 1024 }, { 6, 110, 1024 }, { 7, 111, 1024 }, + { 4, 112, 1024 }, { 5, 113, 1024 }, { 5, 114, 1024 }, { 6, 115, 1024 }, { 5, 116, 1024 }, { 6, 117, 1024 }, { 6, 118, 1024 }, { 7, 119, 1024 }, + { 5, 120, 1024 }, { 6, 121, 1024 }, { 6, 122, 1024 }, { 7, 123, 1024 }, { 6, 124, 1024 }, { 7, 125, 1024 }, { 7, 126, 1024 }, { 8, 127, 1024 }, + { 2, 128, 1024 }, { 3, 129, 1024 }, { 3, 130, 1024 }, { 4, 131, 1024 }, { 3, 132, 1024 }, { 4, 133, 1024 }, { 4, 134, 1024 }, { 5, 135, 1024 }, + { 3, 136, 1024 }, { 4, 137, 1024 }, { 4, 138, 1024 }, { 5, 139, 1024 }, { 4, 140, 1024 }, { 5, 141, 1024 }, { 5, 142, 1024 }, { 6, 143, 1024 }, + { 3, 144, 1024 }, { 4, 145, 1024 }, { 4, 146, 1024 }, { 5, 147, 1024 }, { 4, 148, 1024 }, { 5, 149, 1024 }, { 5, 150, 1024 }, { 6, 151, 1024 }, + { 4, 152, 1024 }, { 5, 153, 1024 }, { 5, 154, 1024 }, { 6, 155, 1024 }, { 5, 156, 1024 }, { 6, 157, 1024 }, { 6, 158, 1024 }, { 7, 159, 1024 }, + { 3, 160, 1024 }, { 4, 161, 1024 }, { 4, 162, 1024 }, { 5, 163, 1024 }, { 4, 164, 1024 }, { 5, 165, 1024 }, { 5, 166, 1024 }, { 6, 167, 1024 }, + { 4, 168, 1024 }, { 5, 169, 1024 }, { 5, 170, 1024 }, { 6, 171, 1024 }, { 5, 172, 1024 }, { 6, 173, 1024 }, { 6, 174, 1024 }, { 7, 175, 1024 }, + { 4, 176, 1024 }, { 5, 177, 1024 }, { 5, 178, 1024 }, { 6, 179, 1024 }, { 5, 180, 1024 }, { 6, 181, 1024 }, { 6, 182, 1024 }, { 7, 183, 1024 }, + { 5, 184, 1024 }, { 6, 185, 1024 }, { 6, 186, 1024 }, { 7, 187, 1024 }, { 6, 188, 1024 }, { 7, 189, 1024 }, { 7, 190, 1024 }, { 8, 191, 1024 }, + { 3, 192, 1024 }, { 4, 193, 1024 }, { 4, 194, 1024 }, { 5, 195, 1024 }, { 4, 196, 1024 }, { 5, 197, 1024 }, { 5, 198, 1024 }, { 6, 199, 1024 }, + { 4, 200, 1024 }, { 5, 201, 1024 }, { 5, 202, 1024 }, { 6, 203, 1024 }, { 5, 204, 1024 }, { 6, 205, 1024 }, { 6, 206, 1024 }, { 7, 207, 1024 }, + { 4, 208, 1024 }, { 5, 209, 1024 }, { 5, 210, 1024 }, { 6, 211, 1024 }, { 5, 212, 1024 }, { 6, 213, 1024 }, { 6, 214, 1024 }, { 7, 215, 1024 }, + { 5, 216, 1024 }, { 6, 217, 1024 }, { 6, 218, 1024 }, { 7, 219, 1024 }, { 6, 220, 1024 }, { 7, 221, 1024 }, { 7, 222, 1024 }, { 8, 223, 1024 }, + { 4, 224, 1024 }, { 5, 225, 1024 }, { 5, 226, 1024 }, { 6, 227, 1024 }, { 5, 228, 1024 }, { 6, 229, 1024 }, { 6, 230, 1024 }, { 7, 231, 1024 }, + { 5, 232, 1024 }, { 6, 233, 1024 }, { 6, 234, 1024 }, { 7, 235, 1024 }, { 6, 236, 1024 }, { 7, 237, 1024 }, { 7, 238, 1024 }, { 8, 239, 1024 }, + { 5, 240, 1024 }, { 6, 241, 1024 }, { 6, 242, 1024 }, { 7, 243, 1024 }, { 6, 244, 1024 }, { 7, 245, 1024 }, { 7, 246, 1024 }, { 8, 247, 1024 }, + { 6, 248, 1024 }, { 7, 249, 1024 }, { 7, 250, 1024 }, { 8, 251, 1024 }, { 7, 252, 1024 }, { 8, 253, 1024 }, { 8, 254, 1024 }, { 9, 255, 1024 }, + { 2, 256, 1024 }, { 3, 257, 1024 }, { 3, 258, 1024 }, { 4, 259, 1024 }, { 3, 260, 1024 }, { 4, 261, 1024 }, { 4, 262, 1024 }, { 5, 263, 1024 }, + { 3, 264, 1024 }, { 4, 265, 1024 }, { 4, 266, 1024 }, { 5, 267, 1024 }, { 4, 268, 1024 }, { 5, 269, 1024 }, { 5, 270, 1024 }, { 6, 271, 1024 }, + { 3, 272, 1024 }, { 4, 273, 1024 }, { 4, 274, 1024 }, { 5, 275, 1024 }, { 4, 276, 1024 }, { 5, 277, 1024 }, { 5, 278, 1024 }, { 6, 279, 1024 }, + { 4, 280, 1024 }, { 5, 281, 1024 }, { 5, 282, 1024 }, { 6, 283, 1024 }, { 5, 284, 1024 }, { 6, 285, 1024 }, { 6, 286, 1024 }, { 7, 287, 1024 }, + { 3, 288, 1024 }, { 4, 289, 1024 }, { 4, 290, 1024 }, { 5, 291, 1024 }, { 4, 292, 1024 }, { 5, 293, 1024 }, { 5, 294, 1024 }, { 6, 295, 1024 }, + { 4, 296, 1024 }, { 5, 297, 1024 }, { 5, 298, 1024 }, { 6, 299, 1024 }, { 5, 300, 1024 }, { 6, 301, 1024 }, { 6, 302, 1024 }, { 7, 303, 1024 }, + { 4, 304, 1024 }, { 5, 305, 1024 }, { 5, 306, 1024 }, { 6, 307, 1024 }, { 5, 308, 1024 }, { 6, 309, 1024 }, { 6, 310, 1024 }, { 7, 311, 1024 }, + { 5, 312, 1024 }, { 6, 313, 1024 }, { 6, 314, 1024 }, { 7, 315, 1024 }, { 6, 316, 1024 }, { 7, 317, 1024 }, { 7, 318, 1024 }, { 8, 319, 1024 }, + { 3, 320, 1024 }, { 4, 321, 1024 }, { 4, 322, 1024 }, { 5, 323, 1024 }, { 4, 324, 1024 }, { 5, 325, 1024 }, { 5, 326, 1024 }, { 6, 327, 1024 }, + { 4, 328, 1024 }, { 5, 329, 1024 }, { 5, 330, 1024 }, { 6, 331, 1024 }, { 5, 332, 1024 }, { 6, 333, 1024 }, { 6, 334, 1024 }, { 7, 335, 1024 }, + { 4, 336, 1024 }, { 5, 337, 1024 }, { 5, 338, 1024 }, { 6, 339, 1024 }, { 5, 340, 1024 }, { 6, 341, 1024 }, { 6, 342, 1024 }, { 7, 343, 1024 }, + { 5, 344, 1024 }, { 6, 345, 1024 }, { 6, 346, 1024 }, { 7, 347, 1024 }, { 6, 348, 1024 }, { 7, 349, 1024 }, { 7, 350, 1024 }, { 8, 351, 1024 }, + { 4, 352, 1024 }, { 5, 353, 1024 }, { 5, 354, 1024 }, { 6, 355, 1024 }, { 5, 356, 1024 }, { 6, 357, 1024 }, { 6, 358, 1024 }, { 7, 359, 1024 }, + { 5, 360, 1024 }, { 6, 361, 1024 }, { 6, 362, 1024 }, { 7, 363, 1024 }, { 6, 364, 1024 }, { 7, 365, 1024 }, { 7, 366, 1024 }, { 8, 367, 1024 }, + { 5, 368, 1024 }, { 6, 369, 1024 }, { 6, 370, 1024 }, { 7, 371, 1024 }, { 6, 372, 1024 }, { 7, 373, 1024 }, { 7, 374, 1024 }, { 8, 375, 1024 }, + { 6, 376, 1024 }, { 7, 377, 1024 }, { 7, 378, 1024 }, { 8, 379, 1024 }, { 7, 380, 1024 }, { 8, 381, 1024 }, { 8, 382, 1024 }, { 9, 383, 1024 }, + { 3, 384, 1024 }, { 4, 385, 1024 }, { 4, 386, 1024 }, { 5, 387, 1024 }, { 4, 388, 1024 }, { 5, 389, 1024 }, { 5, 390, 1024 }, { 6, 391, 1024 }, + { 4, 392, 1024 }, { 5, 393, 1024 }, { 5, 394, 1024 }, { 6, 395, 1024 }, { 5, 396, 1024 }, { 6, 397, 1024 }, { 6, 398, 1024 }, { 7, 399, 1024 }, + { 4, 400, 1024 }, { 5, 401, 1024 }, { 5, 402, 1024 }, { 6, 403, 1024 }, { 5, 404, 1024 }, { 6, 405, 1024 }, { 6, 406, 1024 }, { 7, 407, 1024 }, + { 5, 408, 1024 }, { 6, 409, 1024 }, { 6, 410, 1024 }, { 7, 411, 1024 }, { 6, 412, 1024 }, { 7, 413, 1024 }, { 7, 414, 1024 }, { 8, 415, 1024 }, + { 4, 416, 1024 }, { 5, 417, 1024 }, { 5, 418, 1024 }, { 6, 419, 1024 }, { 5, 420, 1024 }, { 6, 421, 1024 }, { 6, 422, 1024 }, { 7, 423, 1024 }, + { 5, 424, 1024 }, { 6, 425, 1024 }, { 6, 426, 1024 }, { 7, 427, 1024 }, { 6, 428, 1024 }, { 7, 429, 1024 }, { 7, 430, 1024 }, { 8, 431, 1024 }, + { 5, 432, 1024 }, { 6, 433, 1024 }, { 6, 434, 1024 }, { 7, 435, 1024 }, { 6, 436, 1024 }, { 7, 437, 1024 }, { 7, 438, 1024 }, { 8, 439, 1024 }, + { 6, 440, 1024 }, { 7, 441, 1024 }, { 7, 442, 1024 }, { 8, 443, 1024 }, { 7, 444, 1024 }, { 8, 445, 1024 }, { 8, 446, 1024 }, { 9, 447, 1024 }, + { 4, 448, 1024 }, { 5, 449, 1024 }, { 5, 450, 1024 }, { 6, 451, 1024 }, { 5, 452, 1024 }, { 6, 453, 1024 }, { 6, 454, 1024 }, { 7, 455, 1024 }, + { 5, 456, 1024 }, { 6, 457, 1024 }, { 6, 458, 1024 }, { 7, 459, 1024 }, { 6, 460, 1024 }, { 7, 461, 1024 }, { 7, 462, 1024 }, { 8, 463, 1024 }, + { 5, 464, 1024 }, { 6, 465, 1024 }, { 6, 466, 1024 }, { 7, 467, 1024 }, { 6, 468, 1024 }, { 7, 469, 1024 }, { 7, 470, 1024 }, { 8, 471, 1024 }, + { 6, 472, 1024 }, { 7, 473, 1024 }, { 7, 474, 1024 }, { 8, 475, 1024 }, { 7, 476, 1024 }, { 8, 477, 1024 }, { 8, 478, 1024 }, { 9, 479, 1024 }, + { 5, 480, 1024 }, { 6, 481, 1024 }, { 6, 482, 1024 }, { 7, 483, 1024 }, { 6, 484, 1024 }, { 7, 485, 1024 }, { 7, 486, 1024 }, { 8, 487, 1024 }, + { 6, 488, 1024 }, { 7, 489, 1024 }, { 7, 490, 1024 }, { 8, 491, 1024 }, { 7, 492, 1024 }, { 8, 493, 1024 }, { 8, 494, 1024 }, { 9, 495, 1024 }, + { 6, 496, 1024 }, { 7, 497, 1024 }, { 7, 498, 1024 }, { 8, 499, 1024 }, { 7, 500, 1024 }, { 8, 501, 1024 }, { 8, 502, 1024 }, { 9, 503, 1024 }, + { 7, 504, 1024 }, { 8, 505, 1024 }, { 8, 506, 1024 }, { 9, 507, 1024 }, { 8, 508, 1024 }, { 9, 509, 1024 }, { 9, 510, 1024 }, { 10, 511, 1024 }, + { 2, 512, 1024 }, { 3, 513, 1024 }, { 3, 514, 1024 }, { 4, 515, 1024 }, { 3, 516, 1024 }, { 4, 517, 1024 }, { 4, 518, 1024 }, { 5, 519, 1024 }, + { 3, 520, 1024 }, { 4, 521, 1024 }, { 4, 522, 1024 }, { 5, 523, 1024 }, { 4, 524, 1024 }, { 5, 525, 1024 }, { 5, 526, 1024 }, { 6, 527, 1024 }, + { 3, 528, 1024 }, { 4, 529, 1024 }, { 4, 530, 1024 }, { 5, 531, 1024 }, { 4, 532, 1024 }, { 5, 533, 1024 }, { 5, 534, 1024 }, { 6, 535, 1024 }, + { 4, 536, 1024 }, { 5, 537, 1024 }, { 5, 538, 1024 }, { 6, 539, 1024 }, { 5, 540, 1024 }, { 6, 541, 1024 }, { 6, 542, 1024 }, { 7, 543, 1024 }, + { 3, 544, 1024 }, { 4, 545, 1024 }, { 4, 546, 1024 }, { 5, 547, 1024 }, { 4, 548, 1024 }, { 5, 549, 1024 }, { 5, 550, 1024 }, { 6, 551, 1024 }, + { 4, 552, 1024 }, { 5, 553, 1024 }, { 5, 554, 1024 }, { 6, 555, 1024 }, { 5, 556, 1024 }, { 6, 557, 1024 }, { 6, 558, 1024 }, { 7, 559, 1024 }, + { 4, 560, 1024 }, { 5, 561, 1024 }, { 5, 562, 1024 }, { 6, 563, 1024 }, { 5, 564, 1024 }, { 6, 565, 1024 }, { 6, 566, 1024 }, { 7, 567, 1024 }, + { 5, 568, 1024 }, { 6, 569, 1024 }, { 6, 570, 1024 }, { 7, 571, 1024 }, { 6, 572, 1024 }, { 7, 573, 1024 }, { 7, 574, 1024 }, { 8, 575, 1024 }, + { 3, 576, 1024 }, { 4, 577, 1024 }, { 4, 578, 1024 }, { 5, 579, 1024 }, { 4, 580, 1024 }, { 5, 581, 1024 }, { 5, 582, 1024 }, { 6, 583, 1024 }, + { 4, 584, 1024 }, { 5, 585, 1024 }, { 5, 586, 1024 }, { 6, 587, 1024 }, { 5, 588, 1024 }, { 6, 589, 1024 }, { 6, 590, 1024 }, { 7, 591, 1024 }, + { 4, 592, 1024 }, { 5, 593, 1024 }, { 5, 594, 1024 }, { 6, 595, 1024 }, { 5, 596, 1024 }, { 6, 597, 1024 }, { 6, 598, 1024 }, { 7, 599, 1024 }, + { 5, 600, 1024 }, { 6, 601, 1024 }, { 6, 602, 1024 }, { 7, 603, 1024 }, { 6, 604, 1024 }, { 7, 605, 1024 }, { 7, 606, 1024 }, { 8, 607, 1024 }, + { 4, 608, 1024 }, { 5, 609, 1024 }, { 5, 610, 1024 }, { 6, 611, 1024 }, { 5, 612, 1024 }, { 6, 613, 1024 }, { 6, 614, 1024 }, { 7, 615, 1024 }, + { 5, 616, 1024 }, { 6, 617, 1024 }, { 6, 618, 1024 }, { 7, 619, 1024 }, { 6, 620, 1024 }, { 7, 621, 1024 }, { 7, 622, 1024 }, { 8, 623, 1024 }, + { 5, 624, 1024 }, { 6, 625, 1024 }, { 6, 626, 1024 }, { 7, 627, 1024 }, { 6, 628, 1024 }, { 7, 629, 1024 }, { 7, 630, 1024 }, { 8, 631, 1024 }, + { 6, 632, 1024 }, { 7, 633, 1024 }, { 7, 634, 1024 }, { 8, 635, 1024 }, { 7, 636, 1024 }, { 8, 637, 1024 }, { 8, 638, 1024 }, { 9, 639, 1024 }, + { 3, 640, 1024 }, { 4, 641, 1024 }, { 4, 642, 1024 }, { 5, 643, 1024 }, { 4, 644, 1024 }, { 5, 645, 1024 }, { 5, 646, 1024 }, { 6, 647, 1024 }, + { 4, 648, 1024 }, { 5, 649, 1024 }, { 5, 650, 1024 }, { 6, 651, 1024 }, { 5, 652, 1024 }, { 6, 653, 1024 }, { 6, 654, 1024 }, { 7, 655, 1024 }, + { 4, 656, 1024 }, { 5, 657, 1024 }, { 5, 658, 1024 }, { 6, 659, 1024 }, { 5, 660, 1024 }, { 6, 661, 1024 }, { 6, 662, 1024 }, { 7, 663, 1024 }, + { 5, 664, 1024 }, { 6, 665, 1024 }, { 6, 666, 1024 }, { 7, 667, 1024 }, { 6, 668, 1024 }, { 7, 669, 1024 }, { 7, 670, 1024 }, { 8, 671, 1024 }, + { 4, 672, 1024 }, { 5, 673, 1024 }, { 5, 674, 1024 }, { 6, 675, 1024 }, { 5, 676, 1024 }, { 6, 677, 1024 }, { 6, 678, 1024 }, { 7, 679, 1024 }, + { 5, 680, 1024 }, { 6, 681, 1024 }, { 6, 682, 1024 }, { 7, 683, 1024 }, { 6, 684, 1024 }, { 7, 685, 1024 }, { 7, 686, 1024 }, { 8, 687, 1024 }, + { 5, 688, 1024 }, { 6, 689, 1024 }, { 6, 690, 1024 }, { 7, 691, 1024 }, { 6, 692, 1024 }, { 7, 693, 1024 }, { 7, 694, 1024 }, { 8, 695, 1024 }, + { 6, 696, 1024 }, { 7, 697, 1024 }, { 7, 698, 1024 }, { 8, 699, 1024 }, { 7, 700, 1024 }, { 8, 701, 1024 }, { 8, 702, 1024 }, { 9, 703, 1024 }, + { 4, 704, 1024 }, { 5, 705, 1024 }, { 5, 706, 1024 }, { 6, 707, 1024 }, { 5, 708, 1024 }, { 6, 709, 1024 }, { 6, 710, 1024 }, { 7, 711, 1024 }, + { 5, 712, 1024 }, { 6, 713, 1024 }, { 6, 714, 1024 }, { 7, 715, 1024 }, { 6, 716, 1024 }, { 7, 717, 1024 }, { 7, 718, 1024 }, { 8, 719, 1024 }, + { 5, 720, 1024 }, { 6, 721, 1024 }, { 6, 722, 1024 }, { 7, 723, 1024 }, { 6, 724, 1024 }, { 7, 725, 1024 }, { 7, 726, 1024 }, { 8, 727, 1024 }, + { 6, 728, 1024 }, { 7, 729, 1024 }, { 7, 730, 1024 }, { 8, 731, 1024 }, { 7, 732, 1024 }, { 8, 733, 1024 }, { 8, 734, 1024 }, { 9, 735, 1024 }, + { 5, 736, 1024 }, { 6, 737, 1024 }, { 6, 738, 1024 }, { 7, 739, 1024 }, { 6, 740, 1024 }, { 7, 741, 1024 }, { 7, 742, 1024 }, { 8, 743, 1024 }, + { 6, 744, 1024 }, { 7, 745, 1024 }, { 7, 746, 1024 }, { 8, 747, 1024 }, { 7, 748, 1024 }, { 8, 749, 1024 }, { 8, 750, 1024 }, { 9, 751, 1024 }, + { 6, 752, 1024 }, { 7, 753, 1024 }, { 7, 754, 1024 }, { 8, 755, 1024 }, { 7, 756, 1024 }, { 8, 757, 1024 }, { 8, 758, 1024 }, { 9, 759, 1024 }, + { 7, 760, 1024 }, { 8, 761, 1024 }, { 8, 762, 1024 }, { 9, 763, 1024 }, { 8, 764, 1024 }, { 9, 765, 1024 }, { 9, 766, 1024 }, { 10, 767, 1024 }, + { 3, 768, 1024 }, { 4, 769, 1024 }, { 4, 770, 1024 }, { 5, 771, 1024 }, { 4, 772, 1024 }, { 5, 773, 1024 }, { 5, 774, 1024 }, { 6, 775, 1024 }, + { 4, 776, 1024 }, { 5, 777, 1024 }, { 5, 778, 1024 }, { 6, 779, 1024 }, { 5, 780, 1024 }, { 6, 781, 1024 }, { 6, 782, 1024 }, { 7, 783, 1024 }, + { 4, 784, 1024 }, { 5, 785, 1024 }, { 5, 786, 1024 }, { 6, 787, 1024 }, { 5, 788, 1024 }, { 6, 789, 1024 }, { 6, 790, 1024 }, { 7, 791, 1024 }, + { 5, 792, 1024 }, { 6, 793, 1024 }, { 6, 794, 1024 }, { 7, 795, 1024 }, { 6, 796, 1024 }, { 7, 797, 1024 }, { 7, 798, 1024 }, { 8, 799, 1024 }, + { 4, 800, 1024 }, { 5, 801, 1024 }, { 5, 802, 1024 }, { 6, 803, 1024 }, { 5, 804, 1024 }, { 6, 805, 1024 }, { 6, 806, 1024 }, { 7, 807, 1024 }, + { 5, 808, 1024 }, { 6, 809, 1024 }, { 6, 810, 1024 }, { 7, 811, 1024 }, { 6, 812, 1024 }, { 7, 813, 1024 }, { 7, 814, 1024 }, { 8, 815, 1024 }, + { 5, 816, 1024 }, { 6, 817, 1024 }, { 6, 818, 1024 }, { 7, 819, 1024 }, { 6, 820, 1024 }, { 7, 821, 1024 }, { 7, 822, 1024 }, { 8, 823, 1024 }, + { 6, 824, 1024 }, { 7, 825, 1024 }, { 7, 826, 1024 }, { 8, 827, 1024 }, { 7, 828, 1024 }, { 8, 829, 1024 }, { 8, 830, 1024 }, { 9, 831, 1024 }, + { 4, 832, 1024 }, { 5, 833, 1024 }, { 5, 834, 1024 }, { 6, 835, 1024 }, { 5, 836, 1024 }, { 6, 837, 1024 }, { 6, 838, 1024 }, { 7, 839, 1024 }, + { 5, 840, 1024 }, { 6, 841, 1024 }, { 6, 842, 1024 }, { 7, 843, 1024 }, { 6, 844, 1024 }, { 7, 845, 1024 }, { 7, 846, 1024 }, { 8, 847, 1024 }, + { 5, 848, 1024 }, { 6, 849, 1024 }, { 6, 850, 1024 }, { 7, 851, 1024 }, { 6, 852, 1024 }, { 7, 853, 1024 }, { 7, 854, 1024 }, { 8, 855, 1024 }, + { 6, 856, 1024 }, { 7, 857, 1024 }, { 7, 858, 1024 }, { 8, 859, 1024 }, { 7, 860, 1024 }, { 8, 861, 1024 }, { 8, 862, 1024 }, { 9, 863, 1024 }, + { 5, 864, 1024 }, { 6, 865, 1024 }, { 6, 866, 1024 }, { 7, 867, 1024 }, { 6, 868, 1024 }, { 7, 869, 1024 }, { 7, 870, 1024 }, { 8, 871, 1024 }, + { 6, 872, 1024 }, { 7, 873, 1024 }, { 7, 874, 1024 }, { 8, 875, 1024 }, { 7, 876, 1024 }, { 8, 877, 1024 }, { 8, 878, 1024 }, { 9, 879, 1024 }, + { 6, 880, 1024 }, { 7, 881, 1024 }, { 7, 882, 1024 }, { 8, 883, 1024 }, { 7, 884, 1024 }, { 8, 885, 1024 }, { 8, 886, 1024 }, { 9, 887, 1024 }, + { 7, 888, 1024 }, { 8, 889, 1024 }, { 8, 890, 1024 }, { 9, 891, 1024 }, { 8, 892, 1024 }, { 9, 893, 1024 }, { 9, 894, 1024 }, { 10, 895, 1024 }, + { 4, 896, 1024 }, { 5, 897, 1024 }, { 5, 898, 1024 }, { 6, 899, 1024 }, { 5, 900, 1024 }, { 6, 901, 1024 }, { 6, 902, 1024 }, { 7, 903, 1024 }, + { 5, 904, 1024 }, { 6, 905, 1024 }, { 6, 906, 1024 }, { 7, 907, 1024 }, { 6, 908, 1024 }, { 7, 909, 1024 }, { 7, 910, 1024 }, { 8, 911, 1024 }, + { 5, 912, 1024 }, { 6, 913, 1024 }, { 6, 914, 1024 }, { 7, 915, 1024 }, { 6, 916, 1024 }, { 7, 917, 1024 }, { 7, 918, 1024 }, { 8, 919, 1024 }, + { 6, 920, 1024 }, { 7, 921, 1024 }, { 7, 922, 1024 }, { 8, 923, 1024 }, { 7, 924, 1024 }, { 8, 925, 1024 }, { 8, 926, 1024 }, { 9, 927, 1024 }, + { 5, 928, 1024 }, { 6, 929, 1024 }, { 6, 930, 1024 }, { 7, 931, 1024 }, { 6, 932, 1024 }, { 7, 933, 1024 }, { 7, 934, 1024 }, { 8, 935, 1024 }, + { 6, 936, 1024 }, { 7, 937, 1024 }, { 7, 938, 1024 }, { 8, 939, 1024 }, { 7, 940, 1024 }, { 8, 941, 1024 }, { 8, 942, 1024 }, { 9, 943, 1024 }, + { 6, 944, 1024 }, { 7, 945, 1024 }, { 7, 946, 1024 }, { 8, 947, 1024 }, { 7, 948, 1024 }, { 8, 949, 1024 }, { 8, 950, 1024 }, { 9, 951, 1024 }, + { 7, 952, 1024 }, { 8, 953, 1024 }, { 8, 954, 1024 }, { 9, 955, 1024 }, { 8, 956, 1024 }, { 9, 957, 1024 }, { 9, 958, 1024 }, { 10, 959, 1024 }, + { 5, 960, 1024 }, { 6, 961, 1024 }, { 6, 962, 1024 }, { 7, 963, 1024 }, { 6, 964, 1024 }, { 7, 965, 1024 }, { 7, 966, 1024 }, { 8, 967, 1024 }, + { 6, 968, 1024 }, { 7, 969, 1024 }, { 7, 970, 1024 }, { 8, 971, 1024 }, { 7, 972, 1024 }, { 8, 973, 1024 }, { 8, 974, 1024 }, { 9, 975, 1024 }, + { 6, 976, 1024 }, { 7, 977, 1024 }, { 7, 978, 1024 }, { 8, 979, 1024 }, { 7, 980, 1024 }, { 8, 981, 1024 }, { 8, 982, 1024 }, { 9, 983, 1024 }, + { 7, 984, 1024 }, { 8, 985, 1024 }, { 8, 986, 1024 }, { 9, 987, 1024 }, { 8, 988, 1024 }, { 9, 989, 1024 }, { 9, 990, 1024 }, { 10, 991, 1024 }, + { 6, 992, 1024 }, { 7, 993, 1024 }, { 7, 994, 1024 }, { 8, 995, 1024 }, { 7, 996, 1024 }, { 8, 997, 1024 }, { 8, 998, 1024 }, { 9, 999, 1024 }, + { 7, 1000, 1024 }, { 8, 1001, 1024 }, { 8, 1002, 1024 }, { 9, 1003, 1024 }, { 8, 1004, 1024 }, { 9, 1005, 1024 }, { 9, 1006, 1024 }, { 10, 1007, 1024 }, + { 7, 1008, 1024 }, { 8, 1009, 1024 }, { 8, 1010, 1024 }, { 9, 1011, 1024 }, { 8, 1012, 1024 }, { 9, 1013, 1024 }, { 9, 1014, 1024 }, { 10, 1015, 1024 }, + { 8, 1016, 1024 }, { 9, 1017, 1024 }, { 9, 1018, 1024 }, { 10, 1019, 1024 }, { 9, 1020, 1024 }, { 10, 1021, 1024 }, { 10, 1022, 1024 }, { 11, 1023, 1024 }, #if FP_LUT > 11 - { 1, 0, 0 }, { 2, 1, 2048 }, { 2, 2, 2048 }, { 3, 3, 2048 }, { 2, 4, 2048 }, { 3, 5, 2048 }, { 3, 6, 2048 }, { 4, 7, 2048 }, - { 2, 8, 2048 }, { 3, 9, 2048 }, { 3, 10, 2048 }, { 4, 11, 2048 }, { 3, 12, 2048 }, { 4, 13, 2048 }, { 4, 14, 2048 }, { 5, 15, 2048 }, - { 2, 16, 2048 }, { 3, 17, 2048 }, { 3, 18, 2048 }, { 4, 19, 2048 }, { 3, 20, 2048 }, { 4, 21, 2048 }, { 4, 22, 2048 }, { 5, 23, 2048 }, - { 3, 24, 2048 }, { 4, 25, 2048 }, { 4, 26, 2048 }, { 5, 27, 2048 }, { 4, 28, 2048 }, { 5, 29, 2048 }, { 5, 30, 2048 }, { 6, 31, 2048 }, - { 2, 32, 2048 }, { 3, 33, 2048 }, { 3, 34, 2048 }, { 4, 35, 2048 }, { 3, 36, 2048 }, { 4, 37, 2048 }, { 4, 38, 2048 }, { 5, 39, 2048 }, - { 3, 40, 2048 }, { 4, 41, 2048 }, { 4, 42, 2048 }, { 5, 43, 2048 }, { 4, 44, 2048 }, { 5, 45, 2048 }, { 5, 46, 2048 }, { 6, 47, 2048 }, - { 3, 48, 2048 }, { 4, 49, 2048 }, { 4, 50, 2048 }, { 5, 51, 2048 }, { 4, 52, 2048 }, { 5, 53, 2048 }, { 5, 54, 2048 }, { 6, 55, 2048 }, - { 4, 56, 2048 }, { 5, 57, 2048 }, { 5, 58, 2048 }, { 6, 59, 2048 }, { 5, 60, 2048 }, { 6, 61, 2048 }, { 6, 62, 2048 }, { 7, 63, 2048 }, - { 2, 64, 2048 }, { 3, 65, 2048 }, { 3, 66, 2048 }, { 4, 67, 2048 }, { 3, 68, 2048 }, { 4, 69, 2048 }, { 4, 70, 2048 }, { 5, 71, 2048 }, - { 3, 72, 2048 }, { 4, 73, 2048 }, { 4, 74, 2048 }, { 5, 75, 2048 }, { 4, 76, 2048 }, { 5, 77, 2048 }, { 5, 78, 2048 }, { 6, 79, 2048 }, - { 3, 80, 2048 }, { 4, 81, 2048 }, { 4, 82, 2048 }, { 5, 83, 2048 }, { 4, 84, 2048 }, { 5, 85, 2048 }, { 5, 86, 2048 }, { 6, 87, 2048 }, - { 4, 88, 2048 }, { 5, 89, 2048 }, { 5, 90, 2048 }, { 6, 91, 2048 }, { 5, 92, 2048 }, { 6, 93, 2048 }, { 6, 94, 2048 }, { 7, 95, 2048 }, - { 3, 96, 2048 }, { 4, 97, 2048 }, { 4, 98, 2048 }, { 5, 99, 2048 }, { 4, 100, 2048 }, { 5, 101, 2048 }, { 5, 102, 2048 }, { 6, 103, 2048 }, - { 4, 104, 2048 }, { 5, 105, 2048 }, { 5, 106, 2048 }, { 6, 107, 2048 }, { 5, 108, 2048 }, { 6, 109, 2048 }, { 6, 110, 2048 }, { 7, 111, 2048 }, - { 4, 112, 2048 }, { 5, 113, 2048 }, { 5, 114, 2048 }, { 6, 115, 2048 }, { 5, 116, 2048 }, { 6, 117, 2048 }, { 6, 118, 2048 }, { 7, 119, 2048 }, - { 5, 120, 2048 }, { 6, 121, 2048 }, { 6, 122, 2048 }, { 7, 123, 2048 }, { 6, 124, 2048 }, { 7, 125, 2048 }, { 7, 126, 2048 }, { 8, 127, 2048 }, - { 2, 128, 2048 }, { 3, 129, 2048 }, { 3, 130, 2048 }, { 4, 131, 2048 }, { 3, 132, 2048 }, { 4, 133, 2048 }, { 4, 134, 2048 }, { 5, 135, 2048 }, - { 3, 136, 2048 }, { 4, 137, 2048 }, { 4, 138, 2048 }, { 5, 139, 2048 }, { 4, 140, 2048 }, { 5, 141, 2048 }, { 5, 142, 2048 }, { 6, 143, 2048 }, - { 3, 144, 2048 }, { 4, 145, 2048 }, { 4, 146, 2048 }, { 5, 147, 2048 }, { 4, 148, 2048 }, { 5, 149, 2048 }, { 5, 150, 2048 }, { 6, 151, 2048 }, - { 4, 152, 2048 }, { 5, 153, 2048 }, { 5, 154, 2048 }, { 6, 155, 2048 }, { 5, 156, 2048 }, { 6, 157, 2048 }, { 6, 158, 2048 }, { 7, 159, 2048 }, - { 3, 160, 2048 }, { 4, 161, 2048 }, { 4, 162, 2048 }, { 5, 163, 2048 }, { 4, 164, 2048 }, { 5, 165, 2048 }, { 5, 166, 2048 }, { 6, 167, 2048 }, - { 4, 168, 2048 }, { 5, 169, 2048 }, { 5, 170, 2048 }, { 6, 171, 2048 }, { 5, 172, 2048 }, { 6, 173, 2048 }, { 6, 174, 2048 }, { 7, 175, 2048 }, - { 4, 176, 2048 }, { 5, 177, 2048 }, { 5, 178, 2048 }, { 6, 179, 2048 }, { 5, 180, 2048 }, { 6, 181, 2048 }, { 6, 182, 2048 }, { 7, 183, 2048 }, - { 5, 184, 2048 }, { 6, 185, 2048 }, { 6, 186, 2048 }, { 7, 187, 2048 }, { 6, 188, 2048 }, { 7, 189, 2048 }, { 7, 190, 2048 }, { 8, 191, 2048 }, - { 3, 192, 2048 }, { 4, 193, 2048 }, { 4, 194, 2048 }, { 5, 195, 2048 }, { 4, 196, 2048 }, { 5, 197, 2048 }, { 5, 198, 2048 }, { 6, 199, 2048 }, - { 4, 200, 2048 }, { 5, 201, 2048 }, { 5, 202, 2048 }, { 6, 203, 2048 }, { 5, 204, 2048 }, { 6, 205, 2048 }, { 6, 206, 2048 }, { 7, 207, 2048 }, - { 4, 208, 2048 }, { 5, 209, 2048 }, { 5, 210, 2048 }, { 6, 211, 2048 }, { 5, 212, 2048 }, { 6, 213, 2048 }, { 6, 214, 2048 }, { 7, 215, 2048 }, - { 5, 216, 2048 }, { 6, 217, 2048 }, { 6, 218, 2048 }, { 7, 219, 2048 }, { 6, 220, 2048 }, { 7, 221, 2048 }, { 7, 222, 2048 }, { 8, 223, 2048 }, - { 4, 224, 2048 }, { 5, 225, 2048 }, { 5, 226, 2048 }, { 6, 227, 2048 }, { 5, 228, 2048 }, { 6, 229, 2048 }, { 6, 230, 2048 }, { 7, 231, 2048 }, - { 5, 232, 2048 }, { 6, 233, 2048 }, { 6, 234, 2048 }, { 7, 235, 2048 }, { 6, 236, 2048 }, { 7, 237, 2048 }, { 7, 238, 2048 }, { 8, 239, 2048 }, - { 5, 240, 2048 }, { 6, 241, 2048 }, { 6, 242, 2048 }, { 7, 243, 2048 }, { 6, 244, 2048 }, { 7, 245, 2048 }, { 7, 246, 2048 }, { 8, 247, 2048 }, - { 6, 248, 2048 }, { 7, 249, 2048 }, { 7, 250, 2048 }, { 8, 251, 2048 }, { 7, 252, 2048 }, { 8, 253, 2048 }, { 8, 254, 2048 }, { 9, 255, 2048 }, - { 2, 256, 2048 }, { 3, 257, 2048 }, { 3, 258, 2048 }, { 4, 259, 2048 }, { 3, 260, 2048 }, { 4, 261, 2048 }, { 4, 262, 2048 }, { 5, 263, 2048 }, - { 3, 264, 2048 }, { 4, 265, 2048 }, { 4, 266, 2048 }, { 5, 267, 2048 }, { 4, 268, 2048 }, { 5, 269, 2048 }, { 5, 270, 2048 }, { 6, 271, 2048 }, - { 3, 272, 2048 }, { 4, 273, 2048 }, { 4, 274, 2048 }, { 5, 275, 2048 }, { 4, 276, 2048 }, { 5, 277, 2048 }, { 5, 278, 2048 }, { 6, 279, 2048 }, - { 4, 280, 2048 }, { 5, 281, 2048 }, { 5, 282, 2048 }, { 6, 283, 2048 }, { 5, 284, 2048 }, { 6, 285, 2048 }, { 6, 286, 2048 }, { 7, 287, 2048 }, - { 3, 288, 2048 }, { 4, 289, 2048 }, { 4, 290, 2048 }, { 5, 291, 2048 }, { 4, 292, 2048 }, { 5, 293, 2048 }, { 5, 294, 2048 }, { 6, 295, 2048 }, - { 4, 296, 2048 }, { 5, 297, 2048 }, { 5, 298, 2048 }, { 6, 299, 2048 }, { 5, 300, 2048 }, { 6, 301, 2048 }, { 6, 302, 2048 }, { 7, 303, 2048 }, - { 4, 304, 2048 }, { 5, 305, 2048 }, { 5, 306, 2048 }, { 6, 307, 2048 }, { 5, 308, 2048 }, { 6, 309, 2048 }, { 6, 310, 2048 }, { 7, 311, 2048 }, - { 5, 312, 2048 }, { 6, 313, 2048 }, { 6, 314, 2048 }, { 7, 315, 2048 }, { 6, 316, 2048 }, { 7, 317, 2048 }, { 7, 318, 2048 }, { 8, 319, 2048 }, - { 3, 320, 2048 }, { 4, 321, 2048 }, { 4, 322, 2048 }, { 5, 323, 2048 }, { 4, 324, 2048 }, { 5, 325, 2048 }, { 5, 326, 2048 }, { 6, 327, 2048 }, - { 4, 328, 2048 }, { 5, 329, 2048 }, { 5, 330, 2048 }, { 6, 331, 2048 }, { 5, 332, 2048 }, { 6, 333, 2048 }, { 6, 334, 2048 }, { 7, 335, 2048 }, - { 4, 336, 2048 }, { 5, 337, 2048 }, { 5, 338, 2048 }, { 6, 339, 2048 }, { 5, 340, 2048 }, { 6, 341, 2048 }, { 6, 342, 2048 }, { 7, 343, 2048 }, - { 5, 344, 2048 }, { 6, 345, 2048 }, { 6, 346, 2048 }, { 7, 347, 2048 }, { 6, 348, 2048 }, { 7, 349, 2048 }, { 7, 350, 2048 }, { 8, 351, 2048 }, - { 4, 352, 2048 }, { 5, 353, 2048 }, { 5, 354, 2048 }, { 6, 355, 2048 }, { 5, 356, 2048 }, { 6, 357, 2048 }, { 6, 358, 2048 }, { 7, 359, 2048 }, - { 5, 360, 2048 }, { 6, 361, 2048 }, { 6, 362, 2048 }, { 7, 363, 2048 }, { 6, 364, 2048 }, { 7, 365, 2048 }, { 7, 366, 2048 }, { 8, 367, 2048 }, - { 5, 368, 2048 }, { 6, 369, 2048 }, { 6, 370, 2048 }, { 7, 371, 2048 }, { 6, 372, 2048 }, { 7, 373, 2048 }, { 7, 374, 2048 }, { 8, 375, 2048 }, - { 6, 376, 2048 }, { 7, 377, 2048 }, { 7, 378, 2048 }, { 8, 379, 2048 }, { 7, 380, 2048 }, { 8, 381, 2048 }, { 8, 382, 2048 }, { 9, 383, 2048 }, - { 3, 384, 2048 }, { 4, 385, 2048 }, { 4, 386, 2048 }, { 5, 387, 2048 }, { 4, 388, 2048 }, { 5, 389, 2048 }, { 5, 390, 2048 }, { 6, 391, 2048 }, - { 4, 392, 2048 }, { 5, 393, 2048 }, { 5, 394, 2048 }, { 6, 395, 2048 }, { 5, 396, 2048 }, { 6, 397, 2048 }, { 6, 398, 2048 }, { 7, 399, 2048 }, - { 4, 400, 2048 }, { 5, 401, 2048 }, { 5, 402, 2048 }, { 6, 403, 2048 }, { 5, 404, 2048 }, { 6, 405, 2048 }, { 6, 406, 2048 }, { 7, 407, 2048 }, - { 5, 408, 2048 }, { 6, 409, 2048 }, { 6, 410, 2048 }, { 7, 411, 2048 }, { 6, 412, 2048 }, { 7, 413, 2048 }, { 7, 414, 2048 }, { 8, 415, 2048 }, - { 4, 416, 2048 }, { 5, 417, 2048 }, { 5, 418, 2048 }, { 6, 419, 2048 }, { 5, 420, 2048 }, { 6, 421, 2048 }, { 6, 422, 2048 }, { 7, 423, 2048 }, - { 5, 424, 2048 }, { 6, 425, 2048 }, { 6, 426, 2048 }, { 7, 427, 2048 }, { 6, 428, 2048 }, { 7, 429, 2048 }, { 7, 430, 2048 }, { 8, 431, 2048 }, - { 5, 432, 2048 }, { 6, 433, 2048 }, { 6, 434, 2048 }, { 7, 435, 2048 }, { 6, 436, 2048 }, { 7, 437, 2048 }, { 7, 438, 2048 }, { 8, 439, 2048 }, - { 6, 440, 2048 }, { 7, 441, 2048 }, { 7, 442, 2048 }, { 8, 443, 2048 }, { 7, 444, 2048 }, { 8, 445, 2048 }, { 8, 446, 2048 }, { 9, 447, 2048 }, - { 4, 448, 2048 }, { 5, 449, 2048 }, { 5, 450, 2048 }, { 6, 451, 2048 }, { 5, 452, 2048 }, { 6, 453, 2048 }, { 6, 454, 2048 }, { 7, 455, 2048 }, - { 5, 456, 2048 }, { 6, 457, 2048 }, { 6, 458, 2048 }, { 7, 459, 2048 }, { 6, 460, 2048 }, { 7, 461, 2048 }, { 7, 462, 2048 }, { 8, 463, 2048 }, - { 5, 464, 2048 }, { 6, 465, 2048 }, { 6, 466, 2048 }, { 7, 467, 2048 }, { 6, 468, 2048 }, { 7, 469, 2048 }, { 7, 470, 2048 }, { 8, 471, 2048 }, - { 6, 472, 2048 }, { 7, 473, 2048 }, { 7, 474, 2048 }, { 8, 475, 2048 }, { 7, 476, 2048 }, { 8, 477, 2048 }, { 8, 478, 2048 }, { 9, 479, 2048 }, - { 5, 480, 2048 }, { 6, 481, 2048 }, { 6, 482, 2048 }, { 7, 483, 2048 }, { 6, 484, 2048 }, { 7, 485, 2048 }, { 7, 486, 2048 }, { 8, 487, 2048 }, - { 6, 488, 2048 }, { 7, 489, 2048 }, { 7, 490, 2048 }, { 8, 491, 2048 }, { 7, 492, 2048 }, { 8, 493, 2048 }, { 8, 494, 2048 }, { 9, 495, 2048 }, - { 6, 496, 2048 }, { 7, 497, 2048 }, { 7, 498, 2048 }, { 8, 499, 2048 }, { 7, 500, 2048 }, { 8, 501, 2048 }, { 8, 502, 2048 }, { 9, 503, 2048 }, - { 7, 504, 2048 }, { 8, 505, 2048 }, { 8, 506, 2048 }, { 9, 507, 2048 }, { 8, 508, 2048 }, { 9, 509, 2048 }, { 9, 510, 2048 }, { 10, 511, 2048 }, - { 2, 512, 2048 }, { 3, 513, 2048 }, { 3, 514, 2048 }, { 4, 515, 2048 }, { 3, 516, 2048 }, { 4, 517, 2048 }, { 4, 518, 2048 }, { 5, 519, 2048 }, - { 3, 520, 2048 }, { 4, 521, 2048 }, { 4, 522, 2048 }, { 5, 523, 2048 }, { 4, 524, 2048 }, { 5, 525, 2048 }, { 5, 526, 2048 }, { 6, 527, 2048 }, - { 3, 528, 2048 }, { 4, 529, 2048 }, { 4, 530, 2048 }, { 5, 531, 2048 }, { 4, 532, 2048 }, { 5, 533, 2048 }, { 5, 534, 2048 }, { 6, 535, 2048 }, - { 4, 536, 2048 }, { 5, 537, 2048 }, { 5, 538, 2048 }, { 6, 539, 2048 }, { 5, 540, 2048 }, { 6, 541, 2048 }, { 6, 542, 2048 }, { 7, 543, 2048 }, - { 3, 544, 2048 }, { 4, 545, 2048 }, { 4, 546, 2048 }, { 5, 547, 2048 }, { 4, 548, 2048 }, { 5, 549, 2048 }, { 5, 550, 2048 }, { 6, 551, 2048 }, - { 4, 552, 2048 }, { 5, 553, 2048 }, { 5, 554, 2048 }, { 6, 555, 2048 }, { 5, 556, 2048 }, { 6, 557, 2048 }, { 6, 558, 2048 }, { 7, 559, 2048 }, - { 4, 560, 2048 }, { 5, 561, 2048 }, { 5, 562, 2048 }, { 6, 563, 2048 }, { 5, 564, 2048 }, { 6, 565, 2048 }, { 6, 566, 2048 }, { 7, 567, 2048 }, - { 5, 568, 2048 }, { 6, 569, 2048 }, { 6, 570, 2048 }, { 7, 571, 2048 }, { 6, 572, 2048 }, { 7, 573, 2048 }, { 7, 574, 2048 }, { 8, 575, 2048 }, - { 3, 576, 2048 }, { 4, 577, 2048 }, { 4, 578, 2048 }, { 5, 579, 2048 }, { 4, 580, 2048 }, { 5, 581, 2048 }, { 5, 582, 2048 }, { 6, 583, 2048 }, - { 4, 584, 2048 }, { 5, 585, 2048 }, { 5, 586, 2048 }, { 6, 587, 2048 }, { 5, 588, 2048 }, { 6, 589, 2048 }, { 6, 590, 2048 }, { 7, 591, 2048 }, - { 4, 592, 2048 }, { 5, 593, 2048 }, { 5, 594, 2048 }, { 6, 595, 2048 }, { 5, 596, 2048 }, { 6, 597, 2048 }, { 6, 598, 2048 }, { 7, 599, 2048 }, - { 5, 600, 2048 }, { 6, 601, 2048 }, { 6, 602, 2048 }, { 7, 603, 2048 }, { 6, 604, 2048 }, { 7, 605, 2048 }, { 7, 606, 2048 }, { 8, 607, 2048 }, - { 4, 608, 2048 }, { 5, 609, 2048 }, { 5, 610, 2048 }, { 6, 611, 2048 }, { 5, 612, 2048 }, { 6, 613, 2048 }, { 6, 614, 2048 }, { 7, 615, 2048 }, - { 5, 616, 2048 }, { 6, 617, 2048 }, { 6, 618, 2048 }, { 7, 619, 2048 }, { 6, 620, 2048 }, { 7, 621, 2048 }, { 7, 622, 2048 }, { 8, 623, 2048 }, - { 5, 624, 2048 }, { 6, 625, 2048 }, { 6, 626, 2048 }, { 7, 627, 2048 }, { 6, 628, 2048 }, { 7, 629, 2048 }, { 7, 630, 2048 }, { 8, 631, 2048 }, - { 6, 632, 2048 }, { 7, 633, 2048 }, { 7, 634, 2048 }, { 8, 635, 2048 }, { 7, 636, 2048 }, { 8, 637, 2048 }, { 8, 638, 2048 }, { 9, 639, 2048 }, - { 3, 640, 2048 }, { 4, 641, 2048 }, { 4, 642, 2048 }, { 5, 643, 2048 }, { 4, 644, 2048 }, { 5, 645, 2048 }, { 5, 646, 2048 }, { 6, 647, 2048 }, - { 4, 648, 2048 }, { 5, 649, 2048 }, { 5, 650, 2048 }, { 6, 651, 2048 }, { 5, 652, 2048 }, { 6, 653, 2048 }, { 6, 654, 2048 }, { 7, 655, 2048 }, - { 4, 656, 2048 }, { 5, 657, 2048 }, { 5, 658, 2048 }, { 6, 659, 2048 }, { 5, 660, 2048 }, { 6, 661, 2048 }, { 6, 662, 2048 }, { 7, 663, 2048 }, - { 5, 664, 2048 }, { 6, 665, 2048 }, { 6, 666, 2048 }, { 7, 667, 2048 }, { 6, 668, 2048 }, { 7, 669, 2048 }, { 7, 670, 2048 }, { 8, 671, 2048 }, - { 4, 672, 2048 }, { 5, 673, 2048 }, { 5, 674, 2048 }, { 6, 675, 2048 }, { 5, 676, 2048 }, { 6, 677, 2048 }, { 6, 678, 2048 }, { 7, 679, 2048 }, - { 5, 680, 2048 }, { 6, 681, 2048 }, { 6, 682, 2048 }, { 7, 683, 2048 }, { 6, 684, 2048 }, { 7, 685, 2048 }, { 7, 686, 2048 }, { 8, 687, 2048 }, - { 5, 688, 2048 }, { 6, 689, 2048 }, { 6, 690, 2048 }, { 7, 691, 2048 }, { 6, 692, 2048 }, { 7, 693, 2048 }, { 7, 694, 2048 }, { 8, 695, 2048 }, - { 6, 696, 2048 }, { 7, 697, 2048 }, { 7, 698, 2048 }, { 8, 699, 2048 }, { 7, 700, 2048 }, { 8, 701, 2048 }, { 8, 702, 2048 }, { 9, 703, 2048 }, - { 4, 704, 2048 }, { 5, 705, 2048 }, { 5, 706, 2048 }, { 6, 707, 2048 }, { 5, 708, 2048 }, { 6, 709, 2048 }, { 6, 710, 2048 }, { 7, 711, 2048 }, - { 5, 712, 2048 }, { 6, 713, 2048 }, { 6, 714, 2048 }, { 7, 715, 2048 }, { 6, 716, 2048 }, { 7, 717, 2048 }, { 7, 718, 2048 }, { 8, 719, 2048 }, - { 5, 720, 2048 }, { 6, 721, 2048 }, { 6, 722, 2048 }, { 7, 723, 2048 }, { 6, 724, 2048 }, { 7, 725, 2048 }, { 7, 726, 2048 }, { 8, 727, 2048 }, - { 6, 728, 2048 }, { 7, 729, 2048 }, { 7, 730, 2048 }, { 8, 731, 2048 }, { 7, 732, 2048 }, { 8, 733, 2048 }, { 8, 734, 2048 }, { 9, 735, 2048 }, - { 5, 736, 2048 }, { 6, 737, 2048 }, { 6, 738, 2048 }, { 7, 739, 2048 }, { 6, 740, 2048 }, { 7, 741, 2048 }, { 7, 742, 2048 }, { 8, 743, 2048 }, - { 6, 744, 2048 }, { 7, 745, 2048 }, { 7, 746, 2048 }, { 8, 747, 2048 }, { 7, 748, 2048 }, { 8, 749, 2048 }, { 8, 750, 2048 }, { 9, 751, 2048 }, - { 6, 752, 2048 }, { 7, 753, 2048 }, { 7, 754, 2048 }, { 8, 755, 2048 }, { 7, 756, 2048 }, { 8, 757, 2048 }, { 8, 758, 2048 }, { 9, 759, 2048 }, - { 7, 760, 2048 }, { 8, 761, 2048 }, { 8, 762, 2048 }, { 9, 763, 2048 }, { 8, 764, 2048 }, { 9, 765, 2048 }, { 9, 766, 2048 }, { 10, 767, 2048 }, - { 3, 768, 2048 }, { 4, 769, 2048 }, { 4, 770, 2048 }, { 5, 771, 2048 }, { 4, 772, 2048 }, { 5, 773, 2048 }, { 5, 774, 2048 }, { 6, 775, 2048 }, - { 4, 776, 2048 }, { 5, 777, 2048 }, { 5, 778, 2048 }, { 6, 779, 2048 }, { 5, 780, 2048 }, { 6, 781, 2048 }, { 6, 782, 2048 }, { 7, 783, 2048 }, - { 4, 784, 2048 }, { 5, 785, 2048 }, { 5, 786, 2048 }, { 6, 787, 2048 }, { 5, 788, 2048 }, { 6, 789, 2048 }, { 6, 790, 2048 }, { 7, 791, 2048 }, - { 5, 792, 2048 }, { 6, 793, 2048 }, { 6, 794, 2048 }, { 7, 795, 2048 }, { 6, 796, 2048 }, { 7, 797, 2048 }, { 7, 798, 2048 }, { 8, 799, 2048 }, - { 4, 800, 2048 }, { 5, 801, 2048 }, { 5, 802, 2048 }, { 6, 803, 2048 }, { 5, 804, 2048 }, { 6, 805, 2048 }, { 6, 806, 2048 }, { 7, 807, 2048 }, - { 5, 808, 2048 }, { 6, 809, 2048 }, { 6, 810, 2048 }, { 7, 811, 2048 }, { 6, 812, 2048 }, { 7, 813, 2048 }, { 7, 814, 2048 }, { 8, 815, 2048 }, - { 5, 816, 2048 }, { 6, 817, 2048 }, { 6, 818, 2048 }, { 7, 819, 2048 }, { 6, 820, 2048 }, { 7, 821, 2048 }, { 7, 822, 2048 }, { 8, 823, 2048 }, - { 6, 824, 2048 }, { 7, 825, 2048 }, { 7, 826, 2048 }, { 8, 827, 2048 }, { 7, 828, 2048 }, { 8, 829, 2048 }, { 8, 830, 2048 }, { 9, 831, 2048 }, - { 4, 832, 2048 }, { 5, 833, 2048 }, { 5, 834, 2048 }, { 6, 835, 2048 }, { 5, 836, 2048 }, { 6, 837, 2048 }, { 6, 838, 2048 }, { 7, 839, 2048 }, - { 5, 840, 2048 }, { 6, 841, 2048 }, { 6, 842, 2048 }, { 7, 843, 2048 }, { 6, 844, 2048 }, { 7, 845, 2048 }, { 7, 846, 2048 }, { 8, 847, 2048 }, - { 5, 848, 2048 }, { 6, 849, 2048 }, { 6, 850, 2048 }, { 7, 851, 2048 }, { 6, 852, 2048 }, { 7, 853, 2048 }, { 7, 854, 2048 }, { 8, 855, 2048 }, - { 6, 856, 2048 }, { 7, 857, 2048 }, { 7, 858, 2048 }, { 8, 859, 2048 }, { 7, 860, 2048 }, { 8, 861, 2048 }, { 8, 862, 2048 }, { 9, 863, 2048 }, - { 5, 864, 2048 }, { 6, 865, 2048 }, { 6, 866, 2048 }, { 7, 867, 2048 }, { 6, 868, 2048 }, { 7, 869, 2048 }, { 7, 870, 2048 }, { 8, 871, 2048 }, - { 6, 872, 2048 }, { 7, 873, 2048 }, { 7, 874, 2048 }, { 8, 875, 2048 }, { 7, 876, 2048 }, { 8, 877, 2048 }, { 8, 878, 2048 }, { 9, 879, 2048 }, - { 6, 880, 2048 }, { 7, 881, 2048 }, { 7, 882, 2048 }, { 8, 883, 2048 }, { 7, 884, 2048 }, { 8, 885, 2048 }, { 8, 886, 2048 }, { 9, 887, 2048 }, - { 7, 888, 2048 }, { 8, 889, 2048 }, { 8, 890, 2048 }, { 9, 891, 2048 }, { 8, 892, 2048 }, { 9, 893, 2048 }, { 9, 894, 2048 }, { 10, 895, 2048 }, - { 4, 896, 2048 }, { 5, 897, 2048 }, { 5, 898, 2048 }, { 6, 899, 2048 }, { 5, 900, 2048 }, { 6, 901, 2048 }, { 6, 902, 2048 }, { 7, 903, 2048 }, - { 5, 904, 2048 }, { 6, 905, 2048 }, { 6, 906, 2048 }, { 7, 907, 2048 }, { 6, 908, 2048 }, { 7, 909, 2048 }, { 7, 910, 2048 }, { 8, 911, 2048 }, - { 5, 912, 2048 }, { 6, 913, 2048 }, { 6, 914, 2048 }, { 7, 915, 2048 }, { 6, 916, 2048 }, { 7, 917, 2048 }, { 7, 918, 2048 }, { 8, 919, 2048 }, - { 6, 920, 2048 }, { 7, 921, 2048 }, { 7, 922, 2048 }, { 8, 923, 2048 }, { 7, 924, 2048 }, { 8, 925, 2048 }, { 8, 926, 2048 }, { 9, 927, 2048 }, - { 5, 928, 2048 }, { 6, 929, 2048 }, { 6, 930, 2048 }, { 7, 931, 2048 }, { 6, 932, 2048 }, { 7, 933, 2048 }, { 7, 934, 2048 }, { 8, 935, 2048 }, - { 6, 936, 2048 }, { 7, 937, 2048 }, { 7, 938, 2048 }, { 8, 939, 2048 }, { 7, 940, 2048 }, { 8, 941, 2048 }, { 8, 942, 2048 }, { 9, 943, 2048 }, - { 6, 944, 2048 }, { 7, 945, 2048 }, { 7, 946, 2048 }, { 8, 947, 2048 }, { 7, 948, 2048 }, { 8, 949, 2048 }, { 8, 950, 2048 }, { 9, 951, 2048 }, - { 7, 952, 2048 }, { 8, 953, 2048 }, { 8, 954, 2048 }, { 9, 955, 2048 }, { 8, 956, 2048 }, { 9, 957, 2048 }, { 9, 958, 2048 }, { 10, 959, 2048 }, - { 5, 960, 2048 }, { 6, 961, 2048 }, { 6, 962, 2048 }, { 7, 963, 2048 }, { 6, 964, 2048 }, { 7, 965, 2048 }, { 7, 966, 2048 }, { 8, 967, 2048 }, - { 6, 968, 2048 }, { 7, 969, 2048 }, { 7, 970, 2048 }, { 8, 971, 2048 }, { 7, 972, 2048 }, { 8, 973, 2048 }, { 8, 974, 2048 }, { 9, 975, 2048 }, - { 6, 976, 2048 }, { 7, 977, 2048 }, { 7, 978, 2048 }, { 8, 979, 2048 }, { 7, 980, 2048 }, { 8, 981, 2048 }, { 8, 982, 2048 }, { 9, 983, 2048 }, - { 7, 984, 2048 }, { 8, 985, 2048 }, { 8, 986, 2048 }, { 9, 987, 2048 }, { 8, 988, 2048 }, { 9, 989, 2048 }, { 9, 990, 2048 }, { 10, 991, 2048 }, - { 6, 992, 2048 }, { 7, 993, 2048 }, { 7, 994, 2048 }, { 8, 995, 2048 }, { 7, 996, 2048 }, { 8, 997, 2048 }, { 8, 998, 2048 }, { 9, 999, 2048 }, - { 7, 1000, 2048 }, { 8, 1001, 2048 }, { 8, 1002, 2048 }, { 9, 1003, 2048 }, { 8, 1004, 2048 }, { 9, 1005, 2048 }, { 9, 1006, 2048 }, { 10, 1007, 2048 }, - { 7, 1008, 2048 }, { 8, 1009, 2048 }, { 8, 1010, 2048 }, { 9, 1011, 2048 }, { 8, 1012, 2048 }, { 9, 1013, 2048 }, { 9, 1014, 2048 }, { 10, 1015, 2048 }, - { 8, 1016, 2048 }, { 9, 1017, 2048 }, { 9, 1018, 2048 }, { 10, 1019, 2048 }, { 9, 1020, 2048 }, { 10, 1021, 2048 }, { 10, 1022, 2048 }, { 11, 1023, 2048 }, - { 2, 1024, 2048 }, { 3, 1025, 2048 }, { 3, 1026, 2048 }, { 4, 1027, 2048 }, { 3, 1028, 2048 }, { 4, 1029, 2048 }, { 4, 1030, 2048 }, { 5, 1031, 2048 }, - { 3, 1032, 2048 }, { 4, 1033, 2048 }, { 4, 1034, 2048 }, { 5, 1035, 2048 }, { 4, 1036, 2048 }, { 5, 1037, 2048 }, { 5, 1038, 2048 }, { 6, 1039, 2048 }, - { 3, 1040, 2048 }, { 4, 1041, 2048 }, { 4, 1042, 2048 }, { 5, 1043, 2048 }, { 4, 1044, 2048 }, { 5, 1045, 2048 }, { 5, 1046, 2048 }, { 6, 1047, 2048 }, - { 4, 1048, 2048 }, { 5, 1049, 2048 }, { 5, 1050, 2048 }, { 6, 1051, 2048 }, { 5, 1052, 2048 }, { 6, 1053, 2048 }, { 6, 1054, 2048 }, { 7, 1055, 2048 }, - { 3, 1056, 2048 }, { 4, 1057, 2048 }, { 4, 1058, 2048 }, { 5, 1059, 2048 }, { 4, 1060, 2048 }, { 5, 1061, 2048 }, { 5, 1062, 2048 }, { 6, 1063, 2048 }, - { 4, 1064, 2048 }, { 5, 1065, 2048 }, { 5, 1066, 2048 }, { 6, 1067, 2048 }, { 5, 1068, 2048 }, { 6, 1069, 2048 }, { 6, 1070, 2048 }, { 7, 1071, 2048 }, - { 4, 1072, 2048 }, { 5, 1073, 2048 }, { 5, 1074, 2048 }, { 6, 1075, 2048 }, { 5, 1076, 2048 }, { 6, 1077, 2048 }, { 6, 1078, 2048 }, { 7, 1079, 2048 }, - { 5, 1080, 2048 }, { 6, 1081, 2048 }, { 6, 1082, 2048 }, { 7, 1083, 2048 }, { 6, 1084, 2048 }, { 7, 1085, 2048 }, { 7, 1086, 2048 }, { 8, 1087, 2048 }, - { 3, 1088, 2048 }, { 4, 1089, 2048 }, { 4, 1090, 2048 }, { 5, 1091, 2048 }, { 4, 1092, 2048 }, { 5, 1093, 2048 }, { 5, 1094, 2048 }, { 6, 1095, 2048 }, - { 4, 1096, 2048 }, { 5, 1097, 2048 }, { 5, 1098, 2048 }, { 6, 1099, 2048 }, { 5, 1100, 2048 }, { 6, 1101, 2048 }, { 6, 1102, 2048 }, { 7, 1103, 2048 }, - { 4, 1104, 2048 }, { 5, 1105, 2048 }, { 5, 1106, 2048 }, { 6, 1107, 2048 }, { 5, 1108, 2048 }, { 6, 1109, 2048 }, { 6, 1110, 2048 }, { 7, 1111, 2048 }, - { 5, 1112, 2048 }, { 6, 1113, 2048 }, { 6, 1114, 2048 }, { 7, 1115, 2048 }, { 6, 1116, 2048 }, { 7, 1117, 2048 }, { 7, 1118, 2048 }, { 8, 1119, 2048 }, - { 4, 1120, 2048 }, { 5, 1121, 2048 }, { 5, 1122, 2048 }, { 6, 1123, 2048 }, { 5, 1124, 2048 }, { 6, 1125, 2048 }, { 6, 1126, 2048 }, { 7, 1127, 2048 }, - { 5, 1128, 2048 }, { 6, 1129, 2048 }, { 6, 1130, 2048 }, { 7, 1131, 2048 }, { 6, 1132, 2048 }, { 7, 1133, 2048 }, { 7, 1134, 2048 }, { 8, 1135, 2048 }, - { 5, 1136, 2048 }, { 6, 1137, 2048 }, { 6, 1138, 2048 }, { 7, 1139, 2048 }, { 6, 1140, 2048 }, { 7, 1141, 2048 }, { 7, 1142, 2048 }, { 8, 1143, 2048 }, - { 6, 1144, 2048 }, { 7, 1145, 2048 }, { 7, 1146, 2048 }, { 8, 1147, 2048 }, { 7, 1148, 2048 }, { 8, 1149, 2048 }, { 8, 1150, 2048 }, { 9, 1151, 2048 }, - { 3, 1152, 2048 }, { 4, 1153, 2048 }, { 4, 1154, 2048 }, { 5, 1155, 2048 }, { 4, 1156, 2048 }, { 5, 1157, 2048 }, { 5, 1158, 2048 }, { 6, 1159, 2048 }, - { 4, 1160, 2048 }, { 5, 1161, 2048 }, { 5, 1162, 2048 }, { 6, 1163, 2048 }, { 5, 1164, 2048 }, { 6, 1165, 2048 }, { 6, 1166, 2048 }, { 7, 1167, 2048 }, - { 4, 1168, 2048 }, { 5, 1169, 2048 }, { 5, 1170, 2048 }, { 6, 1171, 2048 }, { 5, 1172, 2048 }, { 6, 1173, 2048 }, { 6, 1174, 2048 }, { 7, 1175, 2048 }, - { 5, 1176, 2048 }, { 6, 1177, 2048 }, { 6, 1178, 2048 }, { 7, 1179, 2048 }, { 6, 1180, 2048 }, { 7, 1181, 2048 }, { 7, 1182, 2048 }, { 8, 1183, 2048 }, - { 4, 1184, 2048 }, { 5, 1185, 2048 }, { 5, 1186, 2048 }, { 6, 1187, 2048 }, { 5, 1188, 2048 }, { 6, 1189, 2048 }, { 6, 1190, 2048 }, { 7, 1191, 2048 }, - { 5, 1192, 2048 }, { 6, 1193, 2048 }, { 6, 1194, 2048 }, { 7, 1195, 2048 }, { 6, 1196, 2048 }, { 7, 1197, 2048 }, { 7, 1198, 2048 }, { 8, 1199, 2048 }, - { 5, 1200, 2048 }, { 6, 1201, 2048 }, { 6, 1202, 2048 }, { 7, 1203, 2048 }, { 6, 1204, 2048 }, { 7, 1205, 2048 }, { 7, 1206, 2048 }, { 8, 1207, 2048 }, - { 6, 1208, 2048 }, { 7, 1209, 2048 }, { 7, 1210, 2048 }, { 8, 1211, 2048 }, { 7, 1212, 2048 }, { 8, 1213, 2048 }, { 8, 1214, 2048 }, { 9, 1215, 2048 }, - { 4, 1216, 2048 }, { 5, 1217, 2048 }, { 5, 1218, 2048 }, { 6, 1219, 2048 }, { 5, 1220, 2048 }, { 6, 1221, 2048 }, { 6, 1222, 2048 }, { 7, 1223, 2048 }, - { 5, 1224, 2048 }, { 6, 1225, 2048 }, { 6, 1226, 2048 }, { 7, 1227, 2048 }, { 6, 1228, 2048 }, { 7, 1229, 2048 }, { 7, 1230, 2048 }, { 8, 1231, 2048 }, - { 5, 1232, 2048 }, { 6, 1233, 2048 }, { 6, 1234, 2048 }, { 7, 1235, 2048 }, { 6, 1236, 2048 }, { 7, 1237, 2048 }, { 7, 1238, 2048 }, { 8, 1239, 2048 }, - { 6, 1240, 2048 }, { 7, 1241, 2048 }, { 7, 1242, 2048 }, { 8, 1243, 2048 }, { 7, 1244, 2048 }, { 8, 1245, 2048 }, { 8, 1246, 2048 }, { 9, 1247, 2048 }, - { 5, 1248, 2048 }, { 6, 1249, 2048 }, { 6, 1250, 2048 }, { 7, 1251, 2048 }, { 6, 1252, 2048 }, { 7, 1253, 2048 }, { 7, 1254, 2048 }, { 8, 1255, 2048 }, - { 6, 1256, 2048 }, { 7, 1257, 2048 }, { 7, 1258, 2048 }, { 8, 1259, 2048 }, { 7, 1260, 2048 }, { 8, 1261, 2048 }, { 8, 1262, 2048 }, { 9, 1263, 2048 }, - { 6, 1264, 2048 }, { 7, 1265, 2048 }, { 7, 1266, 2048 }, { 8, 1267, 2048 }, { 7, 1268, 2048 }, { 8, 1269, 2048 }, { 8, 1270, 2048 }, { 9, 1271, 2048 }, - { 7, 1272, 2048 }, { 8, 1273, 2048 }, { 8, 1274, 2048 }, { 9, 1275, 2048 }, { 8, 1276, 2048 }, { 9, 1277, 2048 }, { 9, 1278, 2048 }, { 10, 1279, 2048 }, - { 3, 1280, 2048 }, { 4, 1281, 2048 }, { 4, 1282, 2048 }, { 5, 1283, 2048 }, { 4, 1284, 2048 }, { 5, 1285, 2048 }, { 5, 1286, 2048 }, { 6, 1287, 2048 }, - { 4, 1288, 2048 }, { 5, 1289, 2048 }, { 5, 1290, 2048 }, { 6, 1291, 2048 }, { 5, 1292, 2048 }, { 6, 1293, 2048 }, { 6, 1294, 2048 }, { 7, 1295, 2048 }, - { 4, 1296, 2048 }, { 5, 1297, 2048 }, { 5, 1298, 2048 }, { 6, 1299, 2048 }, { 5, 1300, 2048 }, { 6, 1301, 2048 }, { 6, 1302, 2048 }, { 7, 1303, 2048 }, - { 5, 1304, 2048 }, { 6, 1305, 2048 }, { 6, 1306, 2048 }, { 7, 1307, 2048 }, { 6, 1308, 2048 }, { 7, 1309, 2048 }, { 7, 1310, 2048 }, { 8, 1311, 2048 }, - { 4, 1312, 2048 }, { 5, 1313, 2048 }, { 5, 1314, 2048 }, { 6, 1315, 2048 }, { 5, 1316, 2048 }, { 6, 1317, 2048 }, { 6, 1318, 2048 }, { 7, 1319, 2048 }, - { 5, 1320, 2048 }, { 6, 1321, 2048 }, { 6, 1322, 2048 }, { 7, 1323, 2048 }, { 6, 1324, 2048 }, { 7, 1325, 2048 }, { 7, 1326, 2048 }, { 8, 1327, 2048 }, - { 5, 1328, 2048 }, { 6, 1329, 2048 }, { 6, 1330, 2048 }, { 7, 1331, 2048 }, { 6, 1332, 2048 }, { 7, 1333, 2048 }, { 7, 1334, 2048 }, { 8, 1335, 2048 }, - { 6, 1336, 2048 }, { 7, 1337, 2048 }, { 7, 1338, 2048 }, { 8, 1339, 2048 }, { 7, 1340, 2048 }, { 8, 1341, 2048 }, { 8, 1342, 2048 }, { 9, 1343, 2048 }, - { 4, 1344, 2048 }, { 5, 1345, 2048 }, { 5, 1346, 2048 }, { 6, 1347, 2048 }, { 5, 1348, 2048 }, { 6, 1349, 2048 }, { 6, 1350, 2048 }, { 7, 1351, 2048 }, - { 5, 1352, 2048 }, { 6, 1353, 2048 }, { 6, 1354, 2048 }, { 7, 1355, 2048 }, { 6, 1356, 2048 }, { 7, 1357, 2048 }, { 7, 1358, 2048 }, { 8, 1359, 2048 }, - { 5, 1360, 2048 }, { 6, 1361, 2048 }, { 6, 1362, 2048 }, { 7, 1363, 2048 }, { 6, 1364, 2048 }, { 7, 1365, 2048 }, { 7, 1366, 2048 }, { 8, 1367, 2048 }, - { 6, 1368, 2048 }, { 7, 1369, 2048 }, { 7, 1370, 2048 }, { 8, 1371, 2048 }, { 7, 1372, 2048 }, { 8, 1373, 2048 }, { 8, 1374, 2048 }, { 9, 1375, 2048 }, - { 5, 1376, 2048 }, { 6, 1377, 2048 }, { 6, 1378, 2048 }, { 7, 1379, 2048 }, { 6, 1380, 2048 }, { 7, 1381, 2048 }, { 7, 1382, 2048 }, { 8, 1383, 2048 }, - { 6, 1384, 2048 }, { 7, 1385, 2048 }, { 7, 1386, 2048 }, { 8, 1387, 2048 }, { 7, 1388, 2048 }, { 8, 1389, 2048 }, { 8, 1390, 2048 }, { 9, 1391, 2048 }, - { 6, 1392, 2048 }, { 7, 1393, 2048 }, { 7, 1394, 2048 }, { 8, 1395, 2048 }, { 7, 1396, 2048 }, { 8, 1397, 2048 }, { 8, 1398, 2048 }, { 9, 1399, 2048 }, - { 7, 1400, 2048 }, { 8, 1401, 2048 }, { 8, 1402, 2048 }, { 9, 1403, 2048 }, { 8, 1404, 2048 }, { 9, 1405, 2048 }, { 9, 1406, 2048 }, { 10, 1407, 2048 }, - { 4, 1408, 2048 }, { 5, 1409, 2048 }, { 5, 1410, 2048 }, { 6, 1411, 2048 }, { 5, 1412, 2048 }, { 6, 1413, 2048 }, { 6, 1414, 2048 }, { 7, 1415, 2048 }, - { 5, 1416, 2048 }, { 6, 1417, 2048 }, { 6, 1418, 2048 }, { 7, 1419, 2048 }, { 6, 1420, 2048 }, { 7, 1421, 2048 }, { 7, 1422, 2048 }, { 8, 1423, 2048 }, - { 5, 1424, 2048 }, { 6, 1425, 2048 }, { 6, 1426, 2048 }, { 7, 1427, 2048 }, { 6, 1428, 2048 }, { 7, 1429, 2048 }, { 7, 1430, 2048 }, { 8, 1431, 2048 }, - { 6, 1432, 2048 }, { 7, 1433, 2048 }, { 7, 1434, 2048 }, { 8, 1435, 2048 }, { 7, 1436, 2048 }, { 8, 1437, 2048 }, { 8, 1438, 2048 }, { 9, 1439, 2048 }, - { 5, 1440, 2048 }, { 6, 1441, 2048 }, { 6, 1442, 2048 }, { 7, 1443, 2048 }, { 6, 1444, 2048 }, { 7, 1445, 2048 }, { 7, 1446, 2048 }, { 8, 1447, 2048 }, - { 6, 1448, 2048 }, { 7, 1449, 2048 }, { 7, 1450, 2048 }, { 8, 1451, 2048 }, { 7, 1452, 2048 }, { 8, 1453, 2048 }, { 8, 1454, 2048 }, { 9, 1455, 2048 }, - { 6, 1456, 2048 }, { 7, 1457, 2048 }, { 7, 1458, 2048 }, { 8, 1459, 2048 }, { 7, 1460, 2048 }, { 8, 1461, 2048 }, { 8, 1462, 2048 }, { 9, 1463, 2048 }, - { 7, 1464, 2048 }, { 8, 1465, 2048 }, { 8, 1466, 2048 }, { 9, 1467, 2048 }, { 8, 1468, 2048 }, { 9, 1469, 2048 }, { 9, 1470, 2048 }, { 10, 1471, 2048 }, - { 5, 1472, 2048 }, { 6, 1473, 2048 }, { 6, 1474, 2048 }, { 7, 1475, 2048 }, { 6, 1476, 2048 }, { 7, 1477, 2048 }, { 7, 1478, 2048 }, { 8, 1479, 2048 }, - { 6, 1480, 2048 }, { 7, 1481, 2048 }, { 7, 1482, 2048 }, { 8, 1483, 2048 }, { 7, 1484, 2048 }, { 8, 1485, 2048 }, { 8, 1486, 2048 }, { 9, 1487, 2048 }, - { 6, 1488, 2048 }, { 7, 1489, 2048 }, { 7, 1490, 2048 }, { 8, 1491, 2048 }, { 7, 1492, 2048 }, { 8, 1493, 2048 }, { 8, 1494, 2048 }, { 9, 1495, 2048 }, - { 7, 1496, 2048 }, { 8, 1497, 2048 }, { 8, 1498, 2048 }, { 9, 1499, 2048 }, { 8, 1500, 2048 }, { 9, 1501, 2048 }, { 9, 1502, 2048 }, { 10, 1503, 2048 }, - { 6, 1504, 2048 }, { 7, 1505, 2048 }, { 7, 1506, 2048 }, { 8, 1507, 2048 }, { 7, 1508, 2048 }, { 8, 1509, 2048 }, { 8, 1510, 2048 }, { 9, 1511, 2048 }, - { 7, 1512, 2048 }, { 8, 1513, 2048 }, { 8, 1514, 2048 }, { 9, 1515, 2048 }, { 8, 1516, 2048 }, { 9, 1517, 2048 }, { 9, 1518, 2048 }, { 10, 1519, 2048 }, - { 7, 1520, 2048 }, { 8, 1521, 2048 }, { 8, 1522, 2048 }, { 9, 1523, 2048 }, { 8, 1524, 2048 }, { 9, 1525, 2048 }, { 9, 1526, 2048 }, { 10, 1527, 2048 }, - { 8, 1528, 2048 }, { 9, 1529, 2048 }, { 9, 1530, 2048 }, { 10, 1531, 2048 }, { 9, 1532, 2048 }, { 10, 1533, 2048 }, { 10, 1534, 2048 }, { 11, 1535, 2048 }, - { 3, 1536, 2048 }, { 4, 1537, 2048 }, { 4, 1538, 2048 }, { 5, 1539, 2048 }, { 4, 1540, 2048 }, { 5, 1541, 2048 }, { 5, 1542, 2048 }, { 6, 1543, 2048 }, - { 4, 1544, 2048 }, { 5, 1545, 2048 }, { 5, 1546, 2048 }, { 6, 1547, 2048 }, { 5, 1548, 2048 }, { 6, 1549, 2048 }, { 6, 1550, 2048 }, { 7, 1551, 2048 }, - { 4, 1552, 2048 }, { 5, 1553, 2048 }, { 5, 1554, 2048 }, { 6, 1555, 2048 }, { 5, 1556, 2048 }, { 6, 1557, 2048 }, { 6, 1558, 2048 }, { 7, 1559, 2048 }, - { 5, 1560, 2048 }, { 6, 1561, 2048 }, { 6, 1562, 2048 }, { 7, 1563, 2048 }, { 6, 1564, 2048 }, { 7, 1565, 2048 }, { 7, 1566, 2048 }, { 8, 1567, 2048 }, - { 4, 1568, 2048 }, { 5, 1569, 2048 }, { 5, 1570, 2048 }, { 6, 1571, 2048 }, { 5, 1572, 2048 }, { 6, 1573, 2048 }, { 6, 1574, 2048 }, { 7, 1575, 2048 }, - { 5, 1576, 2048 }, { 6, 1577, 2048 }, { 6, 1578, 2048 }, { 7, 1579, 2048 }, { 6, 1580, 2048 }, { 7, 1581, 2048 }, { 7, 1582, 2048 }, { 8, 1583, 2048 }, - { 5, 1584, 2048 }, { 6, 1585, 2048 }, { 6, 1586, 2048 }, { 7, 1587, 2048 }, { 6, 1588, 2048 }, { 7, 1589, 2048 }, { 7, 1590, 2048 }, { 8, 1591, 2048 }, - { 6, 1592, 2048 }, { 7, 1593, 2048 }, { 7, 1594, 2048 }, { 8, 1595, 2048 }, { 7, 1596, 2048 }, { 8, 1597, 2048 }, { 8, 1598, 2048 }, { 9, 1599, 2048 }, - { 4, 1600, 2048 }, { 5, 1601, 2048 }, { 5, 1602, 2048 }, { 6, 1603, 2048 }, { 5, 1604, 2048 }, { 6, 1605, 2048 }, { 6, 1606, 2048 }, { 7, 1607, 2048 }, - { 5, 1608, 2048 }, { 6, 1609, 2048 }, { 6, 1610, 2048 }, { 7, 1611, 2048 }, { 6, 1612, 2048 }, { 7, 1613, 2048 }, { 7, 1614, 2048 }, { 8, 1615, 2048 }, - { 5, 1616, 2048 }, { 6, 1617, 2048 }, { 6, 1618, 2048 }, { 7, 1619, 2048 }, { 6, 1620, 2048 }, { 7, 1621, 2048 }, { 7, 1622, 2048 }, { 8, 1623, 2048 }, - { 6, 1624, 2048 }, { 7, 1625, 2048 }, { 7, 1626, 2048 }, { 8, 1627, 2048 }, { 7, 1628, 2048 }, { 8, 1629, 2048 }, { 8, 1630, 2048 }, { 9, 1631, 2048 }, - { 5, 1632, 2048 }, { 6, 1633, 2048 }, { 6, 1634, 2048 }, { 7, 1635, 2048 }, { 6, 1636, 2048 }, { 7, 1637, 2048 }, { 7, 1638, 2048 }, { 8, 1639, 2048 }, - { 6, 1640, 2048 }, { 7, 1641, 2048 }, { 7, 1642, 2048 }, { 8, 1643, 2048 }, { 7, 1644, 2048 }, { 8, 1645, 2048 }, { 8, 1646, 2048 }, { 9, 1647, 2048 }, - { 6, 1648, 2048 }, { 7, 1649, 2048 }, { 7, 1650, 2048 }, { 8, 1651, 2048 }, { 7, 1652, 2048 }, { 8, 1653, 2048 }, { 8, 1654, 2048 }, { 9, 1655, 2048 }, - { 7, 1656, 2048 }, { 8, 1657, 2048 }, { 8, 1658, 2048 }, { 9, 1659, 2048 }, { 8, 1660, 2048 }, { 9, 1661, 2048 }, { 9, 1662, 2048 }, { 10, 1663, 2048 }, - { 4, 1664, 2048 }, { 5, 1665, 2048 }, { 5, 1666, 2048 }, { 6, 1667, 2048 }, { 5, 1668, 2048 }, { 6, 1669, 2048 }, { 6, 1670, 2048 }, { 7, 1671, 2048 }, - { 5, 1672, 2048 }, { 6, 1673, 2048 }, { 6, 1674, 2048 }, { 7, 1675, 2048 }, { 6, 1676, 2048 }, { 7, 1677, 2048 }, { 7, 1678, 2048 }, { 8, 1679, 2048 }, - { 5, 1680, 2048 }, { 6, 1681, 2048 }, { 6, 1682, 2048 }, { 7, 1683, 2048 }, { 6, 1684, 2048 }, { 7, 1685, 2048 }, { 7, 1686, 2048 }, { 8, 1687, 2048 }, - { 6, 1688, 2048 }, { 7, 1689, 2048 }, { 7, 1690, 2048 }, { 8, 1691, 2048 }, { 7, 1692, 2048 }, { 8, 1693, 2048 }, { 8, 1694, 2048 }, { 9, 1695, 2048 }, - { 5, 1696, 2048 }, { 6, 1697, 2048 }, { 6, 1698, 2048 }, { 7, 1699, 2048 }, { 6, 1700, 2048 }, { 7, 1701, 2048 }, { 7, 1702, 2048 }, { 8, 1703, 2048 }, - { 6, 1704, 2048 }, { 7, 1705, 2048 }, { 7, 1706, 2048 }, { 8, 1707, 2048 }, { 7, 1708, 2048 }, { 8, 1709, 2048 }, { 8, 1710, 2048 }, { 9, 1711, 2048 }, - { 6, 1712, 2048 }, { 7, 1713, 2048 }, { 7, 1714, 2048 }, { 8, 1715, 2048 }, { 7, 1716, 2048 }, { 8, 1717, 2048 }, { 8, 1718, 2048 }, { 9, 1719, 2048 }, - { 7, 1720, 2048 }, { 8, 1721, 2048 }, { 8, 1722, 2048 }, { 9, 1723, 2048 }, { 8, 1724, 2048 }, { 9, 1725, 2048 }, { 9, 1726, 2048 }, { 10, 1727, 2048 }, - { 5, 1728, 2048 }, { 6, 1729, 2048 }, { 6, 1730, 2048 }, { 7, 1731, 2048 }, { 6, 1732, 2048 }, { 7, 1733, 2048 }, { 7, 1734, 2048 }, { 8, 1735, 2048 }, - { 6, 1736, 2048 }, { 7, 1737, 2048 }, { 7, 1738, 2048 }, { 8, 1739, 2048 }, { 7, 1740, 2048 }, { 8, 1741, 2048 }, { 8, 1742, 2048 }, { 9, 1743, 2048 }, - { 6, 1744, 2048 }, { 7, 1745, 2048 }, { 7, 1746, 2048 }, { 8, 1747, 2048 }, { 7, 1748, 2048 }, { 8, 1749, 2048 }, { 8, 1750, 2048 }, { 9, 1751, 2048 }, - { 7, 1752, 2048 }, { 8, 1753, 2048 }, { 8, 1754, 2048 }, { 9, 1755, 2048 }, { 8, 1756, 2048 }, { 9, 1757, 2048 }, { 9, 1758, 2048 }, { 10, 1759, 2048 }, - { 6, 1760, 2048 }, { 7, 1761, 2048 }, { 7, 1762, 2048 }, { 8, 1763, 2048 }, { 7, 1764, 2048 }, { 8, 1765, 2048 }, { 8, 1766, 2048 }, { 9, 1767, 2048 }, - { 7, 1768, 2048 }, { 8, 1769, 2048 }, { 8, 1770, 2048 }, { 9, 1771, 2048 }, { 8, 1772, 2048 }, { 9, 1773, 2048 }, { 9, 1774, 2048 }, { 10, 1775, 2048 }, - { 7, 1776, 2048 }, { 8, 1777, 2048 }, { 8, 1778, 2048 }, { 9, 1779, 2048 }, { 8, 1780, 2048 }, { 9, 1781, 2048 }, { 9, 1782, 2048 }, { 10, 1783, 2048 }, - { 8, 1784, 2048 }, { 9, 1785, 2048 }, { 9, 1786, 2048 }, { 10, 1787, 2048 }, { 9, 1788, 2048 }, { 10, 1789, 2048 }, { 10, 1790, 2048 }, { 11, 1791, 2048 }, - { 4, 1792, 2048 }, { 5, 1793, 2048 }, { 5, 1794, 2048 }, { 6, 1795, 2048 }, { 5, 1796, 2048 }, { 6, 1797, 2048 }, { 6, 1798, 2048 }, { 7, 1799, 2048 }, - { 5, 1800, 2048 }, { 6, 1801, 2048 }, { 6, 1802, 2048 }, { 7, 1803, 2048 }, { 6, 1804, 2048 }, { 7, 1805, 2048 }, { 7, 1806, 2048 }, { 8, 1807, 2048 }, - { 5, 1808, 2048 }, { 6, 1809, 2048 }, { 6, 1810, 2048 }, { 7, 1811, 2048 }, { 6, 1812, 2048 }, { 7, 1813, 2048 }, { 7, 1814, 2048 }, { 8, 1815, 2048 }, - { 6, 1816, 2048 }, { 7, 1817, 2048 }, { 7, 1818, 2048 }, { 8, 1819, 2048 }, { 7, 1820, 2048 }, { 8, 1821, 2048 }, { 8, 1822, 2048 }, { 9, 1823, 2048 }, - { 5, 1824, 2048 }, { 6, 1825, 2048 }, { 6, 1826, 2048 }, { 7, 1827, 2048 }, { 6, 1828, 2048 }, { 7, 1829, 2048 }, { 7, 1830, 2048 }, { 8, 1831, 2048 }, - { 6, 1832, 2048 }, { 7, 1833, 2048 }, { 7, 1834, 2048 }, { 8, 1835, 2048 }, { 7, 1836, 2048 }, { 8, 1837, 2048 }, { 8, 1838, 2048 }, { 9, 1839, 2048 }, - { 6, 1840, 2048 }, { 7, 1841, 2048 }, { 7, 1842, 2048 }, { 8, 1843, 2048 }, { 7, 1844, 2048 }, { 8, 1845, 2048 }, { 8, 1846, 2048 }, { 9, 1847, 2048 }, - { 7, 1848, 2048 }, { 8, 1849, 2048 }, { 8, 1850, 2048 }, { 9, 1851, 2048 }, { 8, 1852, 2048 }, { 9, 1853, 2048 }, { 9, 1854, 2048 }, { 10, 1855, 2048 }, - { 5, 1856, 2048 }, { 6, 1857, 2048 }, { 6, 1858, 2048 }, { 7, 1859, 2048 }, { 6, 1860, 2048 }, { 7, 1861, 2048 }, { 7, 1862, 2048 }, { 8, 1863, 2048 }, - { 6, 1864, 2048 }, { 7, 1865, 2048 }, { 7, 1866, 2048 }, { 8, 1867, 2048 }, { 7, 1868, 2048 }, { 8, 1869, 2048 }, { 8, 1870, 2048 }, { 9, 1871, 2048 }, - { 6, 1872, 2048 }, { 7, 1873, 2048 }, { 7, 1874, 2048 }, { 8, 1875, 2048 }, { 7, 1876, 2048 }, { 8, 1877, 2048 }, { 8, 1878, 2048 }, { 9, 1879, 2048 }, - { 7, 1880, 2048 }, { 8, 1881, 2048 }, { 8, 1882, 2048 }, { 9, 1883, 2048 }, { 8, 1884, 2048 }, { 9, 1885, 2048 }, { 9, 1886, 2048 }, { 10, 1887, 2048 }, - { 6, 1888, 2048 }, { 7, 1889, 2048 }, { 7, 1890, 2048 }, { 8, 1891, 2048 }, { 7, 1892, 2048 }, { 8, 1893, 2048 }, { 8, 1894, 2048 }, { 9, 1895, 2048 }, - { 7, 1896, 2048 }, { 8, 1897, 2048 }, { 8, 1898, 2048 }, { 9, 1899, 2048 }, { 8, 1900, 2048 }, { 9, 1901, 2048 }, { 9, 1902, 2048 }, { 10, 1903, 2048 }, - { 7, 1904, 2048 }, { 8, 1905, 2048 }, { 8, 1906, 2048 }, { 9, 1907, 2048 }, { 8, 1908, 2048 }, { 9, 1909, 2048 }, { 9, 1910, 2048 }, { 10, 1911, 2048 }, - { 8, 1912, 2048 }, { 9, 1913, 2048 }, { 9, 1914, 2048 }, { 10, 1915, 2048 }, { 9, 1916, 2048 }, { 10, 1917, 2048 }, { 10, 1918, 2048 }, { 11, 1919, 2048 }, - { 5, 1920, 2048 }, { 6, 1921, 2048 }, { 6, 1922, 2048 }, { 7, 1923, 2048 }, { 6, 1924, 2048 }, { 7, 1925, 2048 }, { 7, 1926, 2048 }, { 8, 1927, 2048 }, - { 6, 1928, 2048 }, { 7, 1929, 2048 }, { 7, 1930, 2048 }, { 8, 1931, 2048 }, { 7, 1932, 2048 }, { 8, 1933, 2048 }, { 8, 1934, 2048 }, { 9, 1935, 2048 }, - { 6, 1936, 2048 }, { 7, 1937, 2048 }, { 7, 1938, 2048 }, { 8, 1939, 2048 }, { 7, 1940, 2048 }, { 8, 1941, 2048 }, { 8, 1942, 2048 }, { 9, 1943, 2048 }, - { 7, 1944, 2048 }, { 8, 1945, 2048 }, { 8, 1946, 2048 }, { 9, 1947, 2048 }, { 8, 1948, 2048 }, { 9, 1949, 2048 }, { 9, 1950, 2048 }, { 10, 1951, 2048 }, - { 6, 1952, 2048 }, { 7, 1953, 2048 }, { 7, 1954, 2048 }, { 8, 1955, 2048 }, { 7, 1956, 2048 }, { 8, 1957, 2048 }, { 8, 1958, 2048 }, { 9, 1959, 2048 }, - { 7, 1960, 2048 }, { 8, 1961, 2048 }, { 8, 1962, 2048 }, { 9, 1963, 2048 }, { 8, 1964, 2048 }, { 9, 1965, 2048 }, { 9, 1966, 2048 }, { 10, 1967, 2048 }, - { 7, 1968, 2048 }, { 8, 1969, 2048 }, { 8, 1970, 2048 }, { 9, 1971, 2048 }, { 8, 1972, 2048 }, { 9, 1973, 2048 }, { 9, 1974, 2048 }, { 10, 1975, 2048 }, - { 8, 1976, 2048 }, { 9, 1977, 2048 }, { 9, 1978, 2048 }, { 10, 1979, 2048 }, { 9, 1980, 2048 }, { 10, 1981, 2048 }, { 10, 1982, 2048 }, { 11, 1983, 2048 }, - { 6, 1984, 2048 }, { 7, 1985, 2048 }, { 7, 1986, 2048 }, { 8, 1987, 2048 }, { 7, 1988, 2048 }, { 8, 1989, 2048 }, { 8, 1990, 2048 }, { 9, 1991, 2048 }, - { 7, 1992, 2048 }, { 8, 1993, 2048 }, { 8, 1994, 2048 }, { 9, 1995, 2048 }, { 8, 1996, 2048 }, { 9, 1997, 2048 }, { 9, 1998, 2048 }, { 10, 1999, 2048 }, - { 7, 2000, 2048 }, { 8, 2001, 2048 }, { 8, 2002, 2048 }, { 9, 2003, 2048 }, { 8, 2004, 2048 }, { 9, 2005, 2048 }, { 9, 2006, 2048 }, { 10, 2007, 2048 }, - { 8, 2008, 2048 }, { 9, 2009, 2048 }, { 9, 2010, 2048 }, { 10, 2011, 2048 }, { 9, 2012, 2048 }, { 10, 2013, 2048 }, { 10, 2014, 2048 }, { 11, 2015, 2048 }, - { 7, 2016, 2048 }, { 8, 2017, 2048 }, { 8, 2018, 2048 }, { 9, 2019, 2048 }, { 8, 2020, 2048 }, { 9, 2021, 2048 }, { 9, 2022, 2048 }, { 10, 2023, 2048 }, - { 8, 2024, 2048 }, { 9, 2025, 2048 }, { 9, 2026, 2048 }, { 10, 2027, 2048 }, { 9, 2028, 2048 }, { 10, 2029, 2048 }, { 10, 2030, 2048 }, { 11, 2031, 2048 }, - { 8, 2032, 2048 }, { 9, 2033, 2048 }, { 9, 2034, 2048 }, { 10, 2035, 2048 }, { 9, 2036, 2048 }, { 10, 2037, 2048 }, { 10, 2038, 2048 }, { 11, 2039, 2048 }, - { 9, 2040, 2048 }, { 10, 2041, 2048 }, { 10, 2042, 2048 }, { 11, 2043, 2048 }, { 10, 2044, 2048 }, { 11, 2045, 2048 }, { 11, 2046, 2048 }, { 12, 2047, 2048 }, + { 1, 0, 0 }, { 2, 1, 2048 }, { 2, 2, 2048 }, { 3, 3, 2048 }, { 2, 4, 2048 }, { 3, 5, 2048 }, { 3, 6, 2048 }, { 4, 7, 2048 }, + { 2, 8, 2048 }, { 3, 9, 2048 }, { 3, 10, 2048 }, { 4, 11, 2048 }, { 3, 12, 2048 }, { 4, 13, 2048 }, { 4, 14, 2048 }, { 5, 15, 2048 }, + { 2, 16, 2048 }, { 3, 17, 2048 }, { 3, 18, 2048 }, { 4, 19, 2048 }, { 3, 20, 2048 }, { 4, 21, 2048 }, { 4, 22, 2048 }, { 5, 23, 2048 }, + { 3, 24, 2048 }, { 4, 25, 2048 }, { 4, 26, 2048 }, { 5, 27, 2048 }, { 4, 28, 2048 }, { 5, 29, 2048 }, { 5, 30, 2048 }, { 6, 31, 2048 }, + { 2, 32, 2048 }, { 3, 33, 2048 }, { 3, 34, 2048 }, { 4, 35, 2048 }, { 3, 36, 2048 }, { 4, 37, 2048 }, { 4, 38, 2048 }, { 5, 39, 2048 }, + { 3, 40, 2048 }, { 4, 41, 2048 }, { 4, 42, 2048 }, { 5, 43, 2048 }, { 4, 44, 2048 }, { 5, 45, 2048 }, { 5, 46, 2048 }, { 6, 47, 2048 }, + { 3, 48, 2048 }, { 4, 49, 2048 }, { 4, 50, 2048 }, { 5, 51, 2048 }, { 4, 52, 2048 }, { 5, 53, 2048 }, { 5, 54, 2048 }, { 6, 55, 2048 }, + { 4, 56, 2048 }, { 5, 57, 2048 }, { 5, 58, 2048 }, { 6, 59, 2048 }, { 5, 60, 2048 }, { 6, 61, 2048 }, { 6, 62, 2048 }, { 7, 63, 2048 }, + { 2, 64, 2048 }, { 3, 65, 2048 }, { 3, 66, 2048 }, { 4, 67, 2048 }, { 3, 68, 2048 }, { 4, 69, 2048 }, { 4, 70, 2048 }, { 5, 71, 2048 }, + { 3, 72, 2048 }, { 4, 73, 2048 }, { 4, 74, 2048 }, { 5, 75, 2048 }, { 4, 76, 2048 }, { 5, 77, 2048 }, { 5, 78, 2048 }, { 6, 79, 2048 }, + { 3, 80, 2048 }, { 4, 81, 2048 }, { 4, 82, 2048 }, { 5, 83, 2048 }, { 4, 84, 2048 }, { 5, 85, 2048 }, { 5, 86, 2048 }, { 6, 87, 2048 }, + { 4, 88, 2048 }, { 5, 89, 2048 }, { 5, 90, 2048 }, { 6, 91, 2048 }, { 5, 92, 2048 }, { 6, 93, 2048 }, { 6, 94, 2048 }, { 7, 95, 2048 }, + { 3, 96, 2048 }, { 4, 97, 2048 }, { 4, 98, 2048 }, { 5, 99, 2048 }, { 4, 100, 2048 }, { 5, 101, 2048 }, { 5, 102, 2048 }, { 6, 103, 2048 }, + { 4, 104, 2048 }, { 5, 105, 2048 }, { 5, 106, 2048 }, { 6, 107, 2048 }, { 5, 108, 2048 }, { 6, 109, 2048 }, { 6, 110, 2048 }, { 7, 111, 2048 }, + { 4, 112, 2048 }, { 5, 113, 2048 }, { 5, 114, 2048 }, { 6, 115, 2048 }, { 5, 116, 2048 }, { 6, 117, 2048 }, { 6, 118, 2048 }, { 7, 119, 2048 }, + { 5, 120, 2048 }, { 6, 121, 2048 }, { 6, 122, 2048 }, { 7, 123, 2048 }, { 6, 124, 2048 }, { 7, 125, 2048 }, { 7, 126, 2048 }, { 8, 127, 2048 }, + { 2, 128, 2048 }, { 3, 129, 2048 }, { 3, 130, 2048 }, { 4, 131, 2048 }, { 3, 132, 2048 }, { 4, 133, 2048 }, { 4, 134, 2048 }, { 5, 135, 2048 }, + { 3, 136, 2048 }, { 4, 137, 2048 }, { 4, 138, 2048 }, { 5, 139, 2048 }, { 4, 140, 2048 }, { 5, 141, 2048 }, { 5, 142, 2048 }, { 6, 143, 2048 }, + { 3, 144, 2048 }, { 4, 145, 2048 }, { 4, 146, 2048 }, { 5, 147, 2048 }, { 4, 148, 2048 }, { 5, 149, 2048 }, { 5, 150, 2048 }, { 6, 151, 2048 }, + { 4, 152, 2048 }, { 5, 153, 2048 }, { 5, 154, 2048 }, { 6, 155, 2048 }, { 5, 156, 2048 }, { 6, 157, 2048 }, { 6, 158, 2048 }, { 7, 159, 2048 }, + { 3, 160, 2048 }, { 4, 161, 2048 }, { 4, 162, 2048 }, { 5, 163, 2048 }, { 4, 164, 2048 }, { 5, 165, 2048 }, { 5, 166, 2048 }, { 6, 167, 2048 }, + { 4, 168, 2048 }, { 5, 169, 2048 }, { 5, 170, 2048 }, { 6, 171, 2048 }, { 5, 172, 2048 }, { 6, 173, 2048 }, { 6, 174, 2048 }, { 7, 175, 2048 }, + { 4, 176, 2048 }, { 5, 177, 2048 }, { 5, 178, 2048 }, { 6, 179, 2048 }, { 5, 180, 2048 }, { 6, 181, 2048 }, { 6, 182, 2048 }, { 7, 183, 2048 }, + { 5, 184, 2048 }, { 6, 185, 2048 }, { 6, 186, 2048 }, { 7, 187, 2048 }, { 6, 188, 2048 }, { 7, 189, 2048 }, { 7, 190, 2048 }, { 8, 191, 2048 }, + { 3, 192, 2048 }, { 4, 193, 2048 }, { 4, 194, 2048 }, { 5, 195, 2048 }, { 4, 196, 2048 }, { 5, 197, 2048 }, { 5, 198, 2048 }, { 6, 199, 2048 }, + { 4, 200, 2048 }, { 5, 201, 2048 }, { 5, 202, 2048 }, { 6, 203, 2048 }, { 5, 204, 2048 }, { 6, 205, 2048 }, { 6, 206, 2048 }, { 7, 207, 2048 }, + { 4, 208, 2048 }, { 5, 209, 2048 }, { 5, 210, 2048 }, { 6, 211, 2048 }, { 5, 212, 2048 }, { 6, 213, 2048 }, { 6, 214, 2048 }, { 7, 215, 2048 }, + { 5, 216, 2048 }, { 6, 217, 2048 }, { 6, 218, 2048 }, { 7, 219, 2048 }, { 6, 220, 2048 }, { 7, 221, 2048 }, { 7, 222, 2048 }, { 8, 223, 2048 }, + { 4, 224, 2048 }, { 5, 225, 2048 }, { 5, 226, 2048 }, { 6, 227, 2048 }, { 5, 228, 2048 }, { 6, 229, 2048 }, { 6, 230, 2048 }, { 7, 231, 2048 }, + { 5, 232, 2048 }, { 6, 233, 2048 }, { 6, 234, 2048 }, { 7, 235, 2048 }, { 6, 236, 2048 }, { 7, 237, 2048 }, { 7, 238, 2048 }, { 8, 239, 2048 }, + { 5, 240, 2048 }, { 6, 241, 2048 }, { 6, 242, 2048 }, { 7, 243, 2048 }, { 6, 244, 2048 }, { 7, 245, 2048 }, { 7, 246, 2048 }, { 8, 247, 2048 }, + { 6, 248, 2048 }, { 7, 249, 2048 }, { 7, 250, 2048 }, { 8, 251, 2048 }, { 7, 252, 2048 }, { 8, 253, 2048 }, { 8, 254, 2048 }, { 9, 255, 2048 }, + { 2, 256, 2048 }, { 3, 257, 2048 }, { 3, 258, 2048 }, { 4, 259, 2048 }, { 3, 260, 2048 }, { 4, 261, 2048 }, { 4, 262, 2048 }, { 5, 263, 2048 }, + { 3, 264, 2048 }, { 4, 265, 2048 }, { 4, 266, 2048 }, { 5, 267, 2048 }, { 4, 268, 2048 }, { 5, 269, 2048 }, { 5, 270, 2048 }, { 6, 271, 2048 }, + { 3, 272, 2048 }, { 4, 273, 2048 }, { 4, 274, 2048 }, { 5, 275, 2048 }, { 4, 276, 2048 }, { 5, 277, 2048 }, { 5, 278, 2048 }, { 6, 279, 2048 }, + { 4, 280, 2048 }, { 5, 281, 2048 }, { 5, 282, 2048 }, { 6, 283, 2048 }, { 5, 284, 2048 }, { 6, 285, 2048 }, { 6, 286, 2048 }, { 7, 287, 2048 }, + { 3, 288, 2048 }, { 4, 289, 2048 }, { 4, 290, 2048 }, { 5, 291, 2048 }, { 4, 292, 2048 }, { 5, 293, 2048 }, { 5, 294, 2048 }, { 6, 295, 2048 }, + { 4, 296, 2048 }, { 5, 297, 2048 }, { 5, 298, 2048 }, { 6, 299, 2048 }, { 5, 300, 2048 }, { 6, 301, 2048 }, { 6, 302, 2048 }, { 7, 303, 2048 }, + { 4, 304, 2048 }, { 5, 305, 2048 }, { 5, 306, 2048 }, { 6, 307, 2048 }, { 5, 308, 2048 }, { 6, 309, 2048 }, { 6, 310, 2048 }, { 7, 311, 2048 }, + { 5, 312, 2048 }, { 6, 313, 2048 }, { 6, 314, 2048 }, { 7, 315, 2048 }, { 6, 316, 2048 }, { 7, 317, 2048 }, { 7, 318, 2048 }, { 8, 319, 2048 }, + { 3, 320, 2048 }, { 4, 321, 2048 }, { 4, 322, 2048 }, { 5, 323, 2048 }, { 4, 324, 2048 }, { 5, 325, 2048 }, { 5, 326, 2048 }, { 6, 327, 2048 }, + { 4, 328, 2048 }, { 5, 329, 2048 }, { 5, 330, 2048 }, { 6, 331, 2048 }, { 5, 332, 2048 }, { 6, 333, 2048 }, { 6, 334, 2048 }, { 7, 335, 2048 }, + { 4, 336, 2048 }, { 5, 337, 2048 }, { 5, 338, 2048 }, { 6, 339, 2048 }, { 5, 340, 2048 }, { 6, 341, 2048 }, { 6, 342, 2048 }, { 7, 343, 2048 }, + { 5, 344, 2048 }, { 6, 345, 2048 }, { 6, 346, 2048 }, { 7, 347, 2048 }, { 6, 348, 2048 }, { 7, 349, 2048 }, { 7, 350, 2048 }, { 8, 351, 2048 }, + { 4, 352, 2048 }, { 5, 353, 2048 }, { 5, 354, 2048 }, { 6, 355, 2048 }, { 5, 356, 2048 }, { 6, 357, 2048 }, { 6, 358, 2048 }, { 7, 359, 2048 }, + { 5, 360, 2048 }, { 6, 361, 2048 }, { 6, 362, 2048 }, { 7, 363, 2048 }, { 6, 364, 2048 }, { 7, 365, 2048 }, { 7, 366, 2048 }, { 8, 367, 2048 }, + { 5, 368, 2048 }, { 6, 369, 2048 }, { 6, 370, 2048 }, { 7, 371, 2048 }, { 6, 372, 2048 }, { 7, 373, 2048 }, { 7, 374, 2048 }, { 8, 375, 2048 }, + { 6, 376, 2048 }, { 7, 377, 2048 }, { 7, 378, 2048 }, { 8, 379, 2048 }, { 7, 380, 2048 }, { 8, 381, 2048 }, { 8, 382, 2048 }, { 9, 383, 2048 }, + { 3, 384, 2048 }, { 4, 385, 2048 }, { 4, 386, 2048 }, { 5, 387, 2048 }, { 4, 388, 2048 }, { 5, 389, 2048 }, { 5, 390, 2048 }, { 6, 391, 2048 }, + { 4, 392, 2048 }, { 5, 393, 2048 }, { 5, 394, 2048 }, { 6, 395, 2048 }, { 5, 396, 2048 }, { 6, 397, 2048 }, { 6, 398, 2048 }, { 7, 399, 2048 }, + { 4, 400, 2048 }, { 5, 401, 2048 }, { 5, 402, 2048 }, { 6, 403, 2048 }, { 5, 404, 2048 }, { 6, 405, 2048 }, { 6, 406, 2048 }, { 7, 407, 2048 }, + { 5, 408, 2048 }, { 6, 409, 2048 }, { 6, 410, 2048 }, { 7, 411, 2048 }, { 6, 412, 2048 }, { 7, 413, 2048 }, { 7, 414, 2048 }, { 8, 415, 2048 }, + { 4, 416, 2048 }, { 5, 417, 2048 }, { 5, 418, 2048 }, { 6, 419, 2048 }, { 5, 420, 2048 }, { 6, 421, 2048 }, { 6, 422, 2048 }, { 7, 423, 2048 }, + { 5, 424, 2048 }, { 6, 425, 2048 }, { 6, 426, 2048 }, { 7, 427, 2048 }, { 6, 428, 2048 }, { 7, 429, 2048 }, { 7, 430, 2048 }, { 8, 431, 2048 }, + { 5, 432, 2048 }, { 6, 433, 2048 }, { 6, 434, 2048 }, { 7, 435, 2048 }, { 6, 436, 2048 }, { 7, 437, 2048 }, { 7, 438, 2048 }, { 8, 439, 2048 }, + { 6, 440, 2048 }, { 7, 441, 2048 }, { 7, 442, 2048 }, { 8, 443, 2048 }, { 7, 444, 2048 }, { 8, 445, 2048 }, { 8, 446, 2048 }, { 9, 447, 2048 }, + { 4, 448, 2048 }, { 5, 449, 2048 }, { 5, 450, 2048 }, { 6, 451, 2048 }, { 5, 452, 2048 }, { 6, 453, 2048 }, { 6, 454, 2048 }, { 7, 455, 2048 }, + { 5, 456, 2048 }, { 6, 457, 2048 }, { 6, 458, 2048 }, { 7, 459, 2048 }, { 6, 460, 2048 }, { 7, 461, 2048 }, { 7, 462, 2048 }, { 8, 463, 2048 }, + { 5, 464, 2048 }, { 6, 465, 2048 }, { 6, 466, 2048 }, { 7, 467, 2048 }, { 6, 468, 2048 }, { 7, 469, 2048 }, { 7, 470, 2048 }, { 8, 471, 2048 }, + { 6, 472, 2048 }, { 7, 473, 2048 }, { 7, 474, 2048 }, { 8, 475, 2048 }, { 7, 476, 2048 }, { 8, 477, 2048 }, { 8, 478, 2048 }, { 9, 479, 2048 }, + { 5, 480, 2048 }, { 6, 481, 2048 }, { 6, 482, 2048 }, { 7, 483, 2048 }, { 6, 484, 2048 }, { 7, 485, 2048 }, { 7, 486, 2048 }, { 8, 487, 2048 }, + { 6, 488, 2048 }, { 7, 489, 2048 }, { 7, 490, 2048 }, { 8, 491, 2048 }, { 7, 492, 2048 }, { 8, 493, 2048 }, { 8, 494, 2048 }, { 9, 495, 2048 }, + { 6, 496, 2048 }, { 7, 497, 2048 }, { 7, 498, 2048 }, { 8, 499, 2048 }, { 7, 500, 2048 }, { 8, 501, 2048 }, { 8, 502, 2048 }, { 9, 503, 2048 }, + { 7, 504, 2048 }, { 8, 505, 2048 }, { 8, 506, 2048 }, { 9, 507, 2048 }, { 8, 508, 2048 }, { 9, 509, 2048 }, { 9, 510, 2048 }, { 10, 511, 2048 }, + { 2, 512, 2048 }, { 3, 513, 2048 }, { 3, 514, 2048 }, { 4, 515, 2048 }, { 3, 516, 2048 }, { 4, 517, 2048 }, { 4, 518, 2048 }, { 5, 519, 2048 }, + { 3, 520, 2048 }, { 4, 521, 2048 }, { 4, 522, 2048 }, { 5, 523, 2048 }, { 4, 524, 2048 }, { 5, 525, 2048 }, { 5, 526, 2048 }, { 6, 527, 2048 }, + { 3, 528, 2048 }, { 4, 529, 2048 }, { 4, 530, 2048 }, { 5, 531, 2048 }, { 4, 532, 2048 }, { 5, 533, 2048 }, { 5, 534, 2048 }, { 6, 535, 2048 }, + { 4, 536, 2048 }, { 5, 537, 2048 }, { 5, 538, 2048 }, { 6, 539, 2048 }, { 5, 540, 2048 }, { 6, 541, 2048 }, { 6, 542, 2048 }, { 7, 543, 2048 }, + { 3, 544, 2048 }, { 4, 545, 2048 }, { 4, 546, 2048 }, { 5, 547, 2048 }, { 4, 548, 2048 }, { 5, 549, 2048 }, { 5, 550, 2048 }, { 6, 551, 2048 }, + { 4, 552, 2048 }, { 5, 553, 2048 }, { 5, 554, 2048 }, { 6, 555, 2048 }, { 5, 556, 2048 }, { 6, 557, 2048 }, { 6, 558, 2048 }, { 7, 559, 2048 }, + { 4, 560, 2048 }, { 5, 561, 2048 }, { 5, 562, 2048 }, { 6, 563, 2048 }, { 5, 564, 2048 }, { 6, 565, 2048 }, { 6, 566, 2048 }, { 7, 567, 2048 }, + { 5, 568, 2048 }, { 6, 569, 2048 }, { 6, 570, 2048 }, { 7, 571, 2048 }, { 6, 572, 2048 }, { 7, 573, 2048 }, { 7, 574, 2048 }, { 8, 575, 2048 }, + { 3, 576, 2048 }, { 4, 577, 2048 }, { 4, 578, 2048 }, { 5, 579, 2048 }, { 4, 580, 2048 }, { 5, 581, 2048 }, { 5, 582, 2048 }, { 6, 583, 2048 }, + { 4, 584, 2048 }, { 5, 585, 2048 }, { 5, 586, 2048 }, { 6, 587, 2048 }, { 5, 588, 2048 }, { 6, 589, 2048 }, { 6, 590, 2048 }, { 7, 591, 2048 }, + { 4, 592, 2048 }, { 5, 593, 2048 }, { 5, 594, 2048 }, { 6, 595, 2048 }, { 5, 596, 2048 }, { 6, 597, 2048 }, { 6, 598, 2048 }, { 7, 599, 2048 }, + { 5, 600, 2048 }, { 6, 601, 2048 }, { 6, 602, 2048 }, { 7, 603, 2048 }, { 6, 604, 2048 }, { 7, 605, 2048 }, { 7, 606, 2048 }, { 8, 607, 2048 }, + { 4, 608, 2048 }, { 5, 609, 2048 }, { 5, 610, 2048 }, { 6, 611, 2048 }, { 5, 612, 2048 }, { 6, 613, 2048 }, { 6, 614, 2048 }, { 7, 615, 2048 }, + { 5, 616, 2048 }, { 6, 617, 2048 }, { 6, 618, 2048 }, { 7, 619, 2048 }, { 6, 620, 2048 }, { 7, 621, 2048 }, { 7, 622, 2048 }, { 8, 623, 2048 }, + { 5, 624, 2048 }, { 6, 625, 2048 }, { 6, 626, 2048 }, { 7, 627, 2048 }, { 6, 628, 2048 }, { 7, 629, 2048 }, { 7, 630, 2048 }, { 8, 631, 2048 }, + { 6, 632, 2048 }, { 7, 633, 2048 }, { 7, 634, 2048 }, { 8, 635, 2048 }, { 7, 636, 2048 }, { 8, 637, 2048 }, { 8, 638, 2048 }, { 9, 639, 2048 }, + { 3, 640, 2048 }, { 4, 641, 2048 }, { 4, 642, 2048 }, { 5, 643, 2048 }, { 4, 644, 2048 }, { 5, 645, 2048 }, { 5, 646, 2048 }, { 6, 647, 2048 }, + { 4, 648, 2048 }, { 5, 649, 2048 }, { 5, 650, 2048 }, { 6, 651, 2048 }, { 5, 652, 2048 }, { 6, 653, 2048 }, { 6, 654, 2048 }, { 7, 655, 2048 }, + { 4, 656, 2048 }, { 5, 657, 2048 }, { 5, 658, 2048 }, { 6, 659, 2048 }, { 5, 660, 2048 }, { 6, 661, 2048 }, { 6, 662, 2048 }, { 7, 663, 2048 }, + { 5, 664, 2048 }, { 6, 665, 2048 }, { 6, 666, 2048 }, { 7, 667, 2048 }, { 6, 668, 2048 }, { 7, 669, 2048 }, { 7, 670, 2048 }, { 8, 671, 2048 }, + { 4, 672, 2048 }, { 5, 673, 2048 }, { 5, 674, 2048 }, { 6, 675, 2048 }, { 5, 676, 2048 }, { 6, 677, 2048 }, { 6, 678, 2048 }, { 7, 679, 2048 }, + { 5, 680, 2048 }, { 6, 681, 2048 }, { 6, 682, 2048 }, { 7, 683, 2048 }, { 6, 684, 2048 }, { 7, 685, 2048 }, { 7, 686, 2048 }, { 8, 687, 2048 }, + { 5, 688, 2048 }, { 6, 689, 2048 }, { 6, 690, 2048 }, { 7, 691, 2048 }, { 6, 692, 2048 }, { 7, 693, 2048 }, { 7, 694, 2048 }, { 8, 695, 2048 }, + { 6, 696, 2048 }, { 7, 697, 2048 }, { 7, 698, 2048 }, { 8, 699, 2048 }, { 7, 700, 2048 }, { 8, 701, 2048 }, { 8, 702, 2048 }, { 9, 703, 2048 }, + { 4, 704, 2048 }, { 5, 705, 2048 }, { 5, 706, 2048 }, { 6, 707, 2048 }, { 5, 708, 2048 }, { 6, 709, 2048 }, { 6, 710, 2048 }, { 7, 711, 2048 }, + { 5, 712, 2048 }, { 6, 713, 2048 }, { 6, 714, 2048 }, { 7, 715, 2048 }, { 6, 716, 2048 }, { 7, 717, 2048 }, { 7, 718, 2048 }, { 8, 719, 2048 }, + { 5, 720, 2048 }, { 6, 721, 2048 }, { 6, 722, 2048 }, { 7, 723, 2048 }, { 6, 724, 2048 }, { 7, 725, 2048 }, { 7, 726, 2048 }, { 8, 727, 2048 }, + { 6, 728, 2048 }, { 7, 729, 2048 }, { 7, 730, 2048 }, { 8, 731, 2048 }, { 7, 732, 2048 }, { 8, 733, 2048 }, { 8, 734, 2048 }, { 9, 735, 2048 }, + { 5, 736, 2048 }, { 6, 737, 2048 }, { 6, 738, 2048 }, { 7, 739, 2048 }, { 6, 740, 2048 }, { 7, 741, 2048 }, { 7, 742, 2048 }, { 8, 743, 2048 }, + { 6, 744, 2048 }, { 7, 745, 2048 }, { 7, 746, 2048 }, { 8, 747, 2048 }, { 7, 748, 2048 }, { 8, 749, 2048 }, { 8, 750, 2048 }, { 9, 751, 2048 }, + { 6, 752, 2048 }, { 7, 753, 2048 }, { 7, 754, 2048 }, { 8, 755, 2048 }, { 7, 756, 2048 }, { 8, 757, 2048 }, { 8, 758, 2048 }, { 9, 759, 2048 }, + { 7, 760, 2048 }, { 8, 761, 2048 }, { 8, 762, 2048 }, { 9, 763, 2048 }, { 8, 764, 2048 }, { 9, 765, 2048 }, { 9, 766, 2048 }, { 10, 767, 2048 }, + { 3, 768, 2048 }, { 4, 769, 2048 }, { 4, 770, 2048 }, { 5, 771, 2048 }, { 4, 772, 2048 }, { 5, 773, 2048 }, { 5, 774, 2048 }, { 6, 775, 2048 }, + { 4, 776, 2048 }, { 5, 777, 2048 }, { 5, 778, 2048 }, { 6, 779, 2048 }, { 5, 780, 2048 }, { 6, 781, 2048 }, { 6, 782, 2048 }, { 7, 783, 2048 }, + { 4, 784, 2048 }, { 5, 785, 2048 }, { 5, 786, 2048 }, { 6, 787, 2048 }, { 5, 788, 2048 }, { 6, 789, 2048 }, { 6, 790, 2048 }, { 7, 791, 2048 }, + { 5, 792, 2048 }, { 6, 793, 2048 }, { 6, 794, 2048 }, { 7, 795, 2048 }, { 6, 796, 2048 }, { 7, 797, 2048 }, { 7, 798, 2048 }, { 8, 799, 2048 }, + { 4, 800, 2048 }, { 5, 801, 2048 }, { 5, 802, 2048 }, { 6, 803, 2048 }, { 5, 804, 2048 }, { 6, 805, 2048 }, { 6, 806, 2048 }, { 7, 807, 2048 }, + { 5, 808, 2048 }, { 6, 809, 2048 }, { 6, 810, 2048 }, { 7, 811, 2048 }, { 6, 812, 2048 }, { 7, 813, 2048 }, { 7, 814, 2048 }, { 8, 815, 2048 }, + { 5, 816, 2048 }, { 6, 817, 2048 }, { 6, 818, 2048 }, { 7, 819, 2048 }, { 6, 820, 2048 }, { 7, 821, 2048 }, { 7, 822, 2048 }, { 8, 823, 2048 }, + { 6, 824, 2048 }, { 7, 825, 2048 }, { 7, 826, 2048 }, { 8, 827, 2048 }, { 7, 828, 2048 }, { 8, 829, 2048 }, { 8, 830, 2048 }, { 9, 831, 2048 }, + { 4, 832, 2048 }, { 5, 833, 2048 }, { 5, 834, 2048 }, { 6, 835, 2048 }, { 5, 836, 2048 }, { 6, 837, 2048 }, { 6, 838, 2048 }, { 7, 839, 2048 }, + { 5, 840, 2048 }, { 6, 841, 2048 }, { 6, 842, 2048 }, { 7, 843, 2048 }, { 6, 844, 2048 }, { 7, 845, 2048 }, { 7, 846, 2048 }, { 8, 847, 2048 }, + { 5, 848, 2048 }, { 6, 849, 2048 }, { 6, 850, 2048 }, { 7, 851, 2048 }, { 6, 852, 2048 }, { 7, 853, 2048 }, { 7, 854, 2048 }, { 8, 855, 2048 }, + { 6, 856, 2048 }, { 7, 857, 2048 }, { 7, 858, 2048 }, { 8, 859, 2048 }, { 7, 860, 2048 }, { 8, 861, 2048 }, { 8, 862, 2048 }, { 9, 863, 2048 }, + { 5, 864, 2048 }, { 6, 865, 2048 }, { 6, 866, 2048 }, { 7, 867, 2048 }, { 6, 868, 2048 }, { 7, 869, 2048 }, { 7, 870, 2048 }, { 8, 871, 2048 }, + { 6, 872, 2048 }, { 7, 873, 2048 }, { 7, 874, 2048 }, { 8, 875, 2048 }, { 7, 876, 2048 }, { 8, 877, 2048 }, { 8, 878, 2048 }, { 9, 879, 2048 }, + { 6, 880, 2048 }, { 7, 881, 2048 }, { 7, 882, 2048 }, { 8, 883, 2048 }, { 7, 884, 2048 }, { 8, 885, 2048 }, { 8, 886, 2048 }, { 9, 887, 2048 }, + { 7, 888, 2048 }, { 8, 889, 2048 }, { 8, 890, 2048 }, { 9, 891, 2048 }, { 8, 892, 2048 }, { 9, 893, 2048 }, { 9, 894, 2048 }, { 10, 895, 2048 }, + { 4, 896, 2048 }, { 5, 897, 2048 }, { 5, 898, 2048 }, { 6, 899, 2048 }, { 5, 900, 2048 }, { 6, 901, 2048 }, { 6, 902, 2048 }, { 7, 903, 2048 }, + { 5, 904, 2048 }, { 6, 905, 2048 }, { 6, 906, 2048 }, { 7, 907, 2048 }, { 6, 908, 2048 }, { 7, 909, 2048 }, { 7, 910, 2048 }, { 8, 911, 2048 }, + { 5, 912, 2048 }, { 6, 913, 2048 }, { 6, 914, 2048 }, { 7, 915, 2048 }, { 6, 916, 2048 }, { 7, 917, 2048 }, { 7, 918, 2048 }, { 8, 919, 2048 }, + { 6, 920, 2048 }, { 7, 921, 2048 }, { 7, 922, 2048 }, { 8, 923, 2048 }, { 7, 924, 2048 }, { 8, 925, 2048 }, { 8, 926, 2048 }, { 9, 927, 2048 }, + { 5, 928, 2048 }, { 6, 929, 2048 }, { 6, 930, 2048 }, { 7, 931, 2048 }, { 6, 932, 2048 }, { 7, 933, 2048 }, { 7, 934, 2048 }, { 8, 935, 2048 }, + { 6, 936, 2048 }, { 7, 937, 2048 }, { 7, 938, 2048 }, { 8, 939, 2048 }, { 7, 940, 2048 }, { 8, 941, 2048 }, { 8, 942, 2048 }, { 9, 943, 2048 }, + { 6, 944, 2048 }, { 7, 945, 2048 }, { 7, 946, 2048 }, { 8, 947, 2048 }, { 7, 948, 2048 }, { 8, 949, 2048 }, { 8, 950, 2048 }, { 9, 951, 2048 }, + { 7, 952, 2048 }, { 8, 953, 2048 }, { 8, 954, 2048 }, { 9, 955, 2048 }, { 8, 956, 2048 }, { 9, 957, 2048 }, { 9, 958, 2048 }, { 10, 959, 2048 }, + { 5, 960, 2048 }, { 6, 961, 2048 }, { 6, 962, 2048 }, { 7, 963, 2048 }, { 6, 964, 2048 }, { 7, 965, 2048 }, { 7, 966, 2048 }, { 8, 967, 2048 }, + { 6, 968, 2048 }, { 7, 969, 2048 }, { 7, 970, 2048 }, { 8, 971, 2048 }, { 7, 972, 2048 }, { 8, 973, 2048 }, { 8, 974, 2048 }, { 9, 975, 2048 }, + { 6, 976, 2048 }, { 7, 977, 2048 }, { 7, 978, 2048 }, { 8, 979, 2048 }, { 7, 980, 2048 }, { 8, 981, 2048 }, { 8, 982, 2048 }, { 9, 983, 2048 }, + { 7, 984, 2048 }, { 8, 985, 2048 }, { 8, 986, 2048 }, { 9, 987, 2048 }, { 8, 988, 2048 }, { 9, 989, 2048 }, { 9, 990, 2048 }, { 10, 991, 2048 }, + { 6, 992, 2048 }, { 7, 993, 2048 }, { 7, 994, 2048 }, { 8, 995, 2048 }, { 7, 996, 2048 }, { 8, 997, 2048 }, { 8, 998, 2048 }, { 9, 999, 2048 }, + { 7, 1000, 2048 }, { 8, 1001, 2048 }, { 8, 1002, 2048 }, { 9, 1003, 2048 }, { 8, 1004, 2048 }, { 9, 1005, 2048 }, { 9, 1006, 2048 }, { 10, 1007, 2048 }, + { 7, 1008, 2048 }, { 8, 1009, 2048 }, { 8, 1010, 2048 }, { 9, 1011, 2048 }, { 8, 1012, 2048 }, { 9, 1013, 2048 }, { 9, 1014, 2048 }, { 10, 1015, 2048 }, + { 8, 1016, 2048 }, { 9, 1017, 2048 }, { 9, 1018, 2048 }, { 10, 1019, 2048 }, { 9, 1020, 2048 }, { 10, 1021, 2048 }, { 10, 1022, 2048 }, { 11, 1023, 2048 }, + { 2, 1024, 2048 }, { 3, 1025, 2048 }, { 3, 1026, 2048 }, { 4, 1027, 2048 }, { 3, 1028, 2048 }, { 4, 1029, 2048 }, { 4, 1030, 2048 }, { 5, 1031, 2048 }, + { 3, 1032, 2048 }, { 4, 1033, 2048 }, { 4, 1034, 2048 }, { 5, 1035, 2048 }, { 4, 1036, 2048 }, { 5, 1037, 2048 }, { 5, 1038, 2048 }, { 6, 1039, 2048 }, + { 3, 1040, 2048 }, { 4, 1041, 2048 }, { 4, 1042, 2048 }, { 5, 1043, 2048 }, { 4, 1044, 2048 }, { 5, 1045, 2048 }, { 5, 1046, 2048 }, { 6, 1047, 2048 }, + { 4, 1048, 2048 }, { 5, 1049, 2048 }, { 5, 1050, 2048 }, { 6, 1051, 2048 }, { 5, 1052, 2048 }, { 6, 1053, 2048 }, { 6, 1054, 2048 }, { 7, 1055, 2048 }, + { 3, 1056, 2048 }, { 4, 1057, 2048 }, { 4, 1058, 2048 }, { 5, 1059, 2048 }, { 4, 1060, 2048 }, { 5, 1061, 2048 }, { 5, 1062, 2048 }, { 6, 1063, 2048 }, + { 4, 1064, 2048 }, { 5, 1065, 2048 }, { 5, 1066, 2048 }, { 6, 1067, 2048 }, { 5, 1068, 2048 }, { 6, 1069, 2048 }, { 6, 1070, 2048 }, { 7, 1071, 2048 }, + { 4, 1072, 2048 }, { 5, 1073, 2048 }, { 5, 1074, 2048 }, { 6, 1075, 2048 }, { 5, 1076, 2048 }, { 6, 1077, 2048 }, { 6, 1078, 2048 }, { 7, 1079, 2048 }, + { 5, 1080, 2048 }, { 6, 1081, 2048 }, { 6, 1082, 2048 }, { 7, 1083, 2048 }, { 6, 1084, 2048 }, { 7, 1085, 2048 }, { 7, 1086, 2048 }, { 8, 1087, 2048 }, + { 3, 1088, 2048 }, { 4, 1089, 2048 }, { 4, 1090, 2048 }, { 5, 1091, 2048 }, { 4, 1092, 2048 }, { 5, 1093, 2048 }, { 5, 1094, 2048 }, { 6, 1095, 2048 }, + { 4, 1096, 2048 }, { 5, 1097, 2048 }, { 5, 1098, 2048 }, { 6, 1099, 2048 }, { 5, 1100, 2048 }, { 6, 1101, 2048 }, { 6, 1102, 2048 }, { 7, 1103, 2048 }, + { 4, 1104, 2048 }, { 5, 1105, 2048 }, { 5, 1106, 2048 }, { 6, 1107, 2048 }, { 5, 1108, 2048 }, { 6, 1109, 2048 }, { 6, 1110, 2048 }, { 7, 1111, 2048 }, + { 5, 1112, 2048 }, { 6, 1113, 2048 }, { 6, 1114, 2048 }, { 7, 1115, 2048 }, { 6, 1116, 2048 }, { 7, 1117, 2048 }, { 7, 1118, 2048 }, { 8, 1119, 2048 }, + { 4, 1120, 2048 }, { 5, 1121, 2048 }, { 5, 1122, 2048 }, { 6, 1123, 2048 }, { 5, 1124, 2048 }, { 6, 1125, 2048 }, { 6, 1126, 2048 }, { 7, 1127, 2048 }, + { 5, 1128, 2048 }, { 6, 1129, 2048 }, { 6, 1130, 2048 }, { 7, 1131, 2048 }, { 6, 1132, 2048 }, { 7, 1133, 2048 }, { 7, 1134, 2048 }, { 8, 1135, 2048 }, + { 5, 1136, 2048 }, { 6, 1137, 2048 }, { 6, 1138, 2048 }, { 7, 1139, 2048 }, { 6, 1140, 2048 }, { 7, 1141, 2048 }, { 7, 1142, 2048 }, { 8, 1143, 2048 }, + { 6, 1144, 2048 }, { 7, 1145, 2048 }, { 7, 1146, 2048 }, { 8, 1147, 2048 }, { 7, 1148, 2048 }, { 8, 1149, 2048 }, { 8, 1150, 2048 }, { 9, 1151, 2048 }, + { 3, 1152, 2048 }, { 4, 1153, 2048 }, { 4, 1154, 2048 }, { 5, 1155, 2048 }, { 4, 1156, 2048 }, { 5, 1157, 2048 }, { 5, 1158, 2048 }, { 6, 1159, 2048 }, + { 4, 1160, 2048 }, { 5, 1161, 2048 }, { 5, 1162, 2048 }, { 6, 1163, 2048 }, { 5, 1164, 2048 }, { 6, 1165, 2048 }, { 6, 1166, 2048 }, { 7, 1167, 2048 }, + { 4, 1168, 2048 }, { 5, 1169, 2048 }, { 5, 1170, 2048 }, { 6, 1171, 2048 }, { 5, 1172, 2048 }, { 6, 1173, 2048 }, { 6, 1174, 2048 }, { 7, 1175, 2048 }, + { 5, 1176, 2048 }, { 6, 1177, 2048 }, { 6, 1178, 2048 }, { 7, 1179, 2048 }, { 6, 1180, 2048 }, { 7, 1181, 2048 }, { 7, 1182, 2048 }, { 8, 1183, 2048 }, + { 4, 1184, 2048 }, { 5, 1185, 2048 }, { 5, 1186, 2048 }, { 6, 1187, 2048 }, { 5, 1188, 2048 }, { 6, 1189, 2048 }, { 6, 1190, 2048 }, { 7, 1191, 2048 }, + { 5, 1192, 2048 }, { 6, 1193, 2048 }, { 6, 1194, 2048 }, { 7, 1195, 2048 }, { 6, 1196, 2048 }, { 7, 1197, 2048 }, { 7, 1198, 2048 }, { 8, 1199, 2048 }, + { 5, 1200, 2048 }, { 6, 1201, 2048 }, { 6, 1202, 2048 }, { 7, 1203, 2048 }, { 6, 1204, 2048 }, { 7, 1205, 2048 }, { 7, 1206, 2048 }, { 8, 1207, 2048 }, + { 6, 1208, 2048 }, { 7, 1209, 2048 }, { 7, 1210, 2048 }, { 8, 1211, 2048 }, { 7, 1212, 2048 }, { 8, 1213, 2048 }, { 8, 1214, 2048 }, { 9, 1215, 2048 }, + { 4, 1216, 2048 }, { 5, 1217, 2048 }, { 5, 1218, 2048 }, { 6, 1219, 2048 }, { 5, 1220, 2048 }, { 6, 1221, 2048 }, { 6, 1222, 2048 }, { 7, 1223, 2048 }, + { 5, 1224, 2048 }, { 6, 1225, 2048 }, { 6, 1226, 2048 }, { 7, 1227, 2048 }, { 6, 1228, 2048 }, { 7, 1229, 2048 }, { 7, 1230, 2048 }, { 8, 1231, 2048 }, + { 5, 1232, 2048 }, { 6, 1233, 2048 }, { 6, 1234, 2048 }, { 7, 1235, 2048 }, { 6, 1236, 2048 }, { 7, 1237, 2048 }, { 7, 1238, 2048 }, { 8, 1239, 2048 }, + { 6, 1240, 2048 }, { 7, 1241, 2048 }, { 7, 1242, 2048 }, { 8, 1243, 2048 }, { 7, 1244, 2048 }, { 8, 1245, 2048 }, { 8, 1246, 2048 }, { 9, 1247, 2048 }, + { 5, 1248, 2048 }, { 6, 1249, 2048 }, { 6, 1250, 2048 }, { 7, 1251, 2048 }, { 6, 1252, 2048 }, { 7, 1253, 2048 }, { 7, 1254, 2048 }, { 8, 1255, 2048 }, + { 6, 1256, 2048 }, { 7, 1257, 2048 }, { 7, 1258, 2048 }, { 8, 1259, 2048 }, { 7, 1260, 2048 }, { 8, 1261, 2048 }, { 8, 1262, 2048 }, { 9, 1263, 2048 }, + { 6, 1264, 2048 }, { 7, 1265, 2048 }, { 7, 1266, 2048 }, { 8, 1267, 2048 }, { 7, 1268, 2048 }, { 8, 1269, 2048 }, { 8, 1270, 2048 }, { 9, 1271, 2048 }, + { 7, 1272, 2048 }, { 8, 1273, 2048 }, { 8, 1274, 2048 }, { 9, 1275, 2048 }, { 8, 1276, 2048 }, { 9, 1277, 2048 }, { 9, 1278, 2048 }, { 10, 1279, 2048 }, + { 3, 1280, 2048 }, { 4, 1281, 2048 }, { 4, 1282, 2048 }, { 5, 1283, 2048 }, { 4, 1284, 2048 }, { 5, 1285, 2048 }, { 5, 1286, 2048 }, { 6, 1287, 2048 }, + { 4, 1288, 2048 }, { 5, 1289, 2048 }, { 5, 1290, 2048 }, { 6, 1291, 2048 }, { 5, 1292, 2048 }, { 6, 1293, 2048 }, { 6, 1294, 2048 }, { 7, 1295, 2048 }, + { 4, 1296, 2048 }, { 5, 1297, 2048 }, { 5, 1298, 2048 }, { 6, 1299, 2048 }, { 5, 1300, 2048 }, { 6, 1301, 2048 }, { 6, 1302, 2048 }, { 7, 1303, 2048 }, + { 5, 1304, 2048 }, { 6, 1305, 2048 }, { 6, 1306, 2048 }, { 7, 1307, 2048 }, { 6, 1308, 2048 }, { 7, 1309, 2048 }, { 7, 1310, 2048 }, { 8, 1311, 2048 }, + { 4, 1312, 2048 }, { 5, 1313, 2048 }, { 5, 1314, 2048 }, { 6, 1315, 2048 }, { 5, 1316, 2048 }, { 6, 1317, 2048 }, { 6, 1318, 2048 }, { 7, 1319, 2048 }, + { 5, 1320, 2048 }, { 6, 1321, 2048 }, { 6, 1322, 2048 }, { 7, 1323, 2048 }, { 6, 1324, 2048 }, { 7, 1325, 2048 }, { 7, 1326, 2048 }, { 8, 1327, 2048 }, + { 5, 1328, 2048 }, { 6, 1329, 2048 }, { 6, 1330, 2048 }, { 7, 1331, 2048 }, { 6, 1332, 2048 }, { 7, 1333, 2048 }, { 7, 1334, 2048 }, { 8, 1335, 2048 }, + { 6, 1336, 2048 }, { 7, 1337, 2048 }, { 7, 1338, 2048 }, { 8, 1339, 2048 }, { 7, 1340, 2048 }, { 8, 1341, 2048 }, { 8, 1342, 2048 }, { 9, 1343, 2048 }, + { 4, 1344, 2048 }, { 5, 1345, 2048 }, { 5, 1346, 2048 }, { 6, 1347, 2048 }, { 5, 1348, 2048 }, { 6, 1349, 2048 }, { 6, 1350, 2048 }, { 7, 1351, 2048 }, + { 5, 1352, 2048 }, { 6, 1353, 2048 }, { 6, 1354, 2048 }, { 7, 1355, 2048 }, { 6, 1356, 2048 }, { 7, 1357, 2048 }, { 7, 1358, 2048 }, { 8, 1359, 2048 }, + { 5, 1360, 2048 }, { 6, 1361, 2048 }, { 6, 1362, 2048 }, { 7, 1363, 2048 }, { 6, 1364, 2048 }, { 7, 1365, 2048 }, { 7, 1366, 2048 }, { 8, 1367, 2048 }, + { 6, 1368, 2048 }, { 7, 1369, 2048 }, { 7, 1370, 2048 }, { 8, 1371, 2048 }, { 7, 1372, 2048 }, { 8, 1373, 2048 }, { 8, 1374, 2048 }, { 9, 1375, 2048 }, + { 5, 1376, 2048 }, { 6, 1377, 2048 }, { 6, 1378, 2048 }, { 7, 1379, 2048 }, { 6, 1380, 2048 }, { 7, 1381, 2048 }, { 7, 1382, 2048 }, { 8, 1383, 2048 }, + { 6, 1384, 2048 }, { 7, 1385, 2048 }, { 7, 1386, 2048 }, { 8, 1387, 2048 }, { 7, 1388, 2048 }, { 8, 1389, 2048 }, { 8, 1390, 2048 }, { 9, 1391, 2048 }, + { 6, 1392, 2048 }, { 7, 1393, 2048 }, { 7, 1394, 2048 }, { 8, 1395, 2048 }, { 7, 1396, 2048 }, { 8, 1397, 2048 }, { 8, 1398, 2048 }, { 9, 1399, 2048 }, + { 7, 1400, 2048 }, { 8, 1401, 2048 }, { 8, 1402, 2048 }, { 9, 1403, 2048 }, { 8, 1404, 2048 }, { 9, 1405, 2048 }, { 9, 1406, 2048 }, { 10, 1407, 2048 }, + { 4, 1408, 2048 }, { 5, 1409, 2048 }, { 5, 1410, 2048 }, { 6, 1411, 2048 }, { 5, 1412, 2048 }, { 6, 1413, 2048 }, { 6, 1414, 2048 }, { 7, 1415, 2048 }, + { 5, 1416, 2048 }, { 6, 1417, 2048 }, { 6, 1418, 2048 }, { 7, 1419, 2048 }, { 6, 1420, 2048 }, { 7, 1421, 2048 }, { 7, 1422, 2048 }, { 8, 1423, 2048 }, + { 5, 1424, 2048 }, { 6, 1425, 2048 }, { 6, 1426, 2048 }, { 7, 1427, 2048 }, { 6, 1428, 2048 }, { 7, 1429, 2048 }, { 7, 1430, 2048 }, { 8, 1431, 2048 }, + { 6, 1432, 2048 }, { 7, 1433, 2048 }, { 7, 1434, 2048 }, { 8, 1435, 2048 }, { 7, 1436, 2048 }, { 8, 1437, 2048 }, { 8, 1438, 2048 }, { 9, 1439, 2048 }, + { 5, 1440, 2048 }, { 6, 1441, 2048 }, { 6, 1442, 2048 }, { 7, 1443, 2048 }, { 6, 1444, 2048 }, { 7, 1445, 2048 }, { 7, 1446, 2048 }, { 8, 1447, 2048 }, + { 6, 1448, 2048 }, { 7, 1449, 2048 }, { 7, 1450, 2048 }, { 8, 1451, 2048 }, { 7, 1452, 2048 }, { 8, 1453, 2048 }, { 8, 1454, 2048 }, { 9, 1455, 2048 }, + { 6, 1456, 2048 }, { 7, 1457, 2048 }, { 7, 1458, 2048 }, { 8, 1459, 2048 }, { 7, 1460, 2048 }, { 8, 1461, 2048 }, { 8, 1462, 2048 }, { 9, 1463, 2048 }, + { 7, 1464, 2048 }, { 8, 1465, 2048 }, { 8, 1466, 2048 }, { 9, 1467, 2048 }, { 8, 1468, 2048 }, { 9, 1469, 2048 }, { 9, 1470, 2048 }, { 10, 1471, 2048 }, + { 5, 1472, 2048 }, { 6, 1473, 2048 }, { 6, 1474, 2048 }, { 7, 1475, 2048 }, { 6, 1476, 2048 }, { 7, 1477, 2048 }, { 7, 1478, 2048 }, { 8, 1479, 2048 }, + { 6, 1480, 2048 }, { 7, 1481, 2048 }, { 7, 1482, 2048 }, { 8, 1483, 2048 }, { 7, 1484, 2048 }, { 8, 1485, 2048 }, { 8, 1486, 2048 }, { 9, 1487, 2048 }, + { 6, 1488, 2048 }, { 7, 1489, 2048 }, { 7, 1490, 2048 }, { 8, 1491, 2048 }, { 7, 1492, 2048 }, { 8, 1493, 2048 }, { 8, 1494, 2048 }, { 9, 1495, 2048 }, + { 7, 1496, 2048 }, { 8, 1497, 2048 }, { 8, 1498, 2048 }, { 9, 1499, 2048 }, { 8, 1500, 2048 }, { 9, 1501, 2048 }, { 9, 1502, 2048 }, { 10, 1503, 2048 }, + { 6, 1504, 2048 }, { 7, 1505, 2048 }, { 7, 1506, 2048 }, { 8, 1507, 2048 }, { 7, 1508, 2048 }, { 8, 1509, 2048 }, { 8, 1510, 2048 }, { 9, 1511, 2048 }, + { 7, 1512, 2048 }, { 8, 1513, 2048 }, { 8, 1514, 2048 }, { 9, 1515, 2048 }, { 8, 1516, 2048 }, { 9, 1517, 2048 }, { 9, 1518, 2048 }, { 10, 1519, 2048 }, + { 7, 1520, 2048 }, { 8, 1521, 2048 }, { 8, 1522, 2048 }, { 9, 1523, 2048 }, { 8, 1524, 2048 }, { 9, 1525, 2048 }, { 9, 1526, 2048 }, { 10, 1527, 2048 }, + { 8, 1528, 2048 }, { 9, 1529, 2048 }, { 9, 1530, 2048 }, { 10, 1531, 2048 }, { 9, 1532, 2048 }, { 10, 1533, 2048 }, { 10, 1534, 2048 }, { 11, 1535, 2048 }, + { 3, 1536, 2048 }, { 4, 1537, 2048 }, { 4, 1538, 2048 }, { 5, 1539, 2048 }, { 4, 1540, 2048 }, { 5, 1541, 2048 }, { 5, 1542, 2048 }, { 6, 1543, 2048 }, + { 4, 1544, 2048 }, { 5, 1545, 2048 }, { 5, 1546, 2048 }, { 6, 1547, 2048 }, { 5, 1548, 2048 }, { 6, 1549, 2048 }, { 6, 1550, 2048 }, { 7, 1551, 2048 }, + { 4, 1552, 2048 }, { 5, 1553, 2048 }, { 5, 1554, 2048 }, { 6, 1555, 2048 }, { 5, 1556, 2048 }, { 6, 1557, 2048 }, { 6, 1558, 2048 }, { 7, 1559, 2048 }, + { 5, 1560, 2048 }, { 6, 1561, 2048 }, { 6, 1562, 2048 }, { 7, 1563, 2048 }, { 6, 1564, 2048 }, { 7, 1565, 2048 }, { 7, 1566, 2048 }, { 8, 1567, 2048 }, + { 4, 1568, 2048 }, { 5, 1569, 2048 }, { 5, 1570, 2048 }, { 6, 1571, 2048 }, { 5, 1572, 2048 }, { 6, 1573, 2048 }, { 6, 1574, 2048 }, { 7, 1575, 2048 }, + { 5, 1576, 2048 }, { 6, 1577, 2048 }, { 6, 1578, 2048 }, { 7, 1579, 2048 }, { 6, 1580, 2048 }, { 7, 1581, 2048 }, { 7, 1582, 2048 }, { 8, 1583, 2048 }, + { 5, 1584, 2048 }, { 6, 1585, 2048 }, { 6, 1586, 2048 }, { 7, 1587, 2048 }, { 6, 1588, 2048 }, { 7, 1589, 2048 }, { 7, 1590, 2048 }, { 8, 1591, 2048 }, + { 6, 1592, 2048 }, { 7, 1593, 2048 }, { 7, 1594, 2048 }, { 8, 1595, 2048 }, { 7, 1596, 2048 }, { 8, 1597, 2048 }, { 8, 1598, 2048 }, { 9, 1599, 2048 }, + { 4, 1600, 2048 }, { 5, 1601, 2048 }, { 5, 1602, 2048 }, { 6, 1603, 2048 }, { 5, 1604, 2048 }, { 6, 1605, 2048 }, { 6, 1606, 2048 }, { 7, 1607, 2048 }, + { 5, 1608, 2048 }, { 6, 1609, 2048 }, { 6, 1610, 2048 }, { 7, 1611, 2048 }, { 6, 1612, 2048 }, { 7, 1613, 2048 }, { 7, 1614, 2048 }, { 8, 1615, 2048 }, + { 5, 1616, 2048 }, { 6, 1617, 2048 }, { 6, 1618, 2048 }, { 7, 1619, 2048 }, { 6, 1620, 2048 }, { 7, 1621, 2048 }, { 7, 1622, 2048 }, { 8, 1623, 2048 }, + { 6, 1624, 2048 }, { 7, 1625, 2048 }, { 7, 1626, 2048 }, { 8, 1627, 2048 }, { 7, 1628, 2048 }, { 8, 1629, 2048 }, { 8, 1630, 2048 }, { 9, 1631, 2048 }, + { 5, 1632, 2048 }, { 6, 1633, 2048 }, { 6, 1634, 2048 }, { 7, 1635, 2048 }, { 6, 1636, 2048 }, { 7, 1637, 2048 }, { 7, 1638, 2048 }, { 8, 1639, 2048 }, + { 6, 1640, 2048 }, { 7, 1641, 2048 }, { 7, 1642, 2048 }, { 8, 1643, 2048 }, { 7, 1644, 2048 }, { 8, 1645, 2048 }, { 8, 1646, 2048 }, { 9, 1647, 2048 }, + { 6, 1648, 2048 }, { 7, 1649, 2048 }, { 7, 1650, 2048 }, { 8, 1651, 2048 }, { 7, 1652, 2048 }, { 8, 1653, 2048 }, { 8, 1654, 2048 }, { 9, 1655, 2048 }, + { 7, 1656, 2048 }, { 8, 1657, 2048 }, { 8, 1658, 2048 }, { 9, 1659, 2048 }, { 8, 1660, 2048 }, { 9, 1661, 2048 }, { 9, 1662, 2048 }, { 10, 1663, 2048 }, + { 4, 1664, 2048 }, { 5, 1665, 2048 }, { 5, 1666, 2048 }, { 6, 1667, 2048 }, { 5, 1668, 2048 }, { 6, 1669, 2048 }, { 6, 1670, 2048 }, { 7, 1671, 2048 }, + { 5, 1672, 2048 }, { 6, 1673, 2048 }, { 6, 1674, 2048 }, { 7, 1675, 2048 }, { 6, 1676, 2048 }, { 7, 1677, 2048 }, { 7, 1678, 2048 }, { 8, 1679, 2048 }, + { 5, 1680, 2048 }, { 6, 1681, 2048 }, { 6, 1682, 2048 }, { 7, 1683, 2048 }, { 6, 1684, 2048 }, { 7, 1685, 2048 }, { 7, 1686, 2048 }, { 8, 1687, 2048 }, + { 6, 1688, 2048 }, { 7, 1689, 2048 }, { 7, 1690, 2048 }, { 8, 1691, 2048 }, { 7, 1692, 2048 }, { 8, 1693, 2048 }, { 8, 1694, 2048 }, { 9, 1695, 2048 }, + { 5, 1696, 2048 }, { 6, 1697, 2048 }, { 6, 1698, 2048 }, { 7, 1699, 2048 }, { 6, 1700, 2048 }, { 7, 1701, 2048 }, { 7, 1702, 2048 }, { 8, 1703, 2048 }, + { 6, 1704, 2048 }, { 7, 1705, 2048 }, { 7, 1706, 2048 }, { 8, 1707, 2048 }, { 7, 1708, 2048 }, { 8, 1709, 2048 }, { 8, 1710, 2048 }, { 9, 1711, 2048 }, + { 6, 1712, 2048 }, { 7, 1713, 2048 }, { 7, 1714, 2048 }, { 8, 1715, 2048 }, { 7, 1716, 2048 }, { 8, 1717, 2048 }, { 8, 1718, 2048 }, { 9, 1719, 2048 }, + { 7, 1720, 2048 }, { 8, 1721, 2048 }, { 8, 1722, 2048 }, { 9, 1723, 2048 }, { 8, 1724, 2048 }, { 9, 1725, 2048 }, { 9, 1726, 2048 }, { 10, 1727, 2048 }, + { 5, 1728, 2048 }, { 6, 1729, 2048 }, { 6, 1730, 2048 }, { 7, 1731, 2048 }, { 6, 1732, 2048 }, { 7, 1733, 2048 }, { 7, 1734, 2048 }, { 8, 1735, 2048 }, + { 6, 1736, 2048 }, { 7, 1737, 2048 }, { 7, 1738, 2048 }, { 8, 1739, 2048 }, { 7, 1740, 2048 }, { 8, 1741, 2048 }, { 8, 1742, 2048 }, { 9, 1743, 2048 }, + { 6, 1744, 2048 }, { 7, 1745, 2048 }, { 7, 1746, 2048 }, { 8, 1747, 2048 }, { 7, 1748, 2048 }, { 8, 1749, 2048 }, { 8, 1750, 2048 }, { 9, 1751, 2048 }, + { 7, 1752, 2048 }, { 8, 1753, 2048 }, { 8, 1754, 2048 }, { 9, 1755, 2048 }, { 8, 1756, 2048 }, { 9, 1757, 2048 }, { 9, 1758, 2048 }, { 10, 1759, 2048 }, + { 6, 1760, 2048 }, { 7, 1761, 2048 }, { 7, 1762, 2048 }, { 8, 1763, 2048 }, { 7, 1764, 2048 }, { 8, 1765, 2048 }, { 8, 1766, 2048 }, { 9, 1767, 2048 }, + { 7, 1768, 2048 }, { 8, 1769, 2048 }, { 8, 1770, 2048 }, { 9, 1771, 2048 }, { 8, 1772, 2048 }, { 9, 1773, 2048 }, { 9, 1774, 2048 }, { 10, 1775, 2048 }, + { 7, 1776, 2048 }, { 8, 1777, 2048 }, { 8, 1778, 2048 }, { 9, 1779, 2048 }, { 8, 1780, 2048 }, { 9, 1781, 2048 }, { 9, 1782, 2048 }, { 10, 1783, 2048 }, + { 8, 1784, 2048 }, { 9, 1785, 2048 }, { 9, 1786, 2048 }, { 10, 1787, 2048 }, { 9, 1788, 2048 }, { 10, 1789, 2048 }, { 10, 1790, 2048 }, { 11, 1791, 2048 }, + { 4, 1792, 2048 }, { 5, 1793, 2048 }, { 5, 1794, 2048 }, { 6, 1795, 2048 }, { 5, 1796, 2048 }, { 6, 1797, 2048 }, { 6, 1798, 2048 }, { 7, 1799, 2048 }, + { 5, 1800, 2048 }, { 6, 1801, 2048 }, { 6, 1802, 2048 }, { 7, 1803, 2048 }, { 6, 1804, 2048 }, { 7, 1805, 2048 }, { 7, 1806, 2048 }, { 8, 1807, 2048 }, + { 5, 1808, 2048 }, { 6, 1809, 2048 }, { 6, 1810, 2048 }, { 7, 1811, 2048 }, { 6, 1812, 2048 }, { 7, 1813, 2048 }, { 7, 1814, 2048 }, { 8, 1815, 2048 }, + { 6, 1816, 2048 }, { 7, 1817, 2048 }, { 7, 1818, 2048 }, { 8, 1819, 2048 }, { 7, 1820, 2048 }, { 8, 1821, 2048 }, { 8, 1822, 2048 }, { 9, 1823, 2048 }, + { 5, 1824, 2048 }, { 6, 1825, 2048 }, { 6, 1826, 2048 }, { 7, 1827, 2048 }, { 6, 1828, 2048 }, { 7, 1829, 2048 }, { 7, 1830, 2048 }, { 8, 1831, 2048 }, + { 6, 1832, 2048 }, { 7, 1833, 2048 }, { 7, 1834, 2048 }, { 8, 1835, 2048 }, { 7, 1836, 2048 }, { 8, 1837, 2048 }, { 8, 1838, 2048 }, { 9, 1839, 2048 }, + { 6, 1840, 2048 }, { 7, 1841, 2048 }, { 7, 1842, 2048 }, { 8, 1843, 2048 }, { 7, 1844, 2048 }, { 8, 1845, 2048 }, { 8, 1846, 2048 }, { 9, 1847, 2048 }, + { 7, 1848, 2048 }, { 8, 1849, 2048 }, { 8, 1850, 2048 }, { 9, 1851, 2048 }, { 8, 1852, 2048 }, { 9, 1853, 2048 }, { 9, 1854, 2048 }, { 10, 1855, 2048 }, + { 5, 1856, 2048 }, { 6, 1857, 2048 }, { 6, 1858, 2048 }, { 7, 1859, 2048 }, { 6, 1860, 2048 }, { 7, 1861, 2048 }, { 7, 1862, 2048 }, { 8, 1863, 2048 }, + { 6, 1864, 2048 }, { 7, 1865, 2048 }, { 7, 1866, 2048 }, { 8, 1867, 2048 }, { 7, 1868, 2048 }, { 8, 1869, 2048 }, { 8, 1870, 2048 }, { 9, 1871, 2048 }, + { 6, 1872, 2048 }, { 7, 1873, 2048 }, { 7, 1874, 2048 }, { 8, 1875, 2048 }, { 7, 1876, 2048 }, { 8, 1877, 2048 }, { 8, 1878, 2048 }, { 9, 1879, 2048 }, + { 7, 1880, 2048 }, { 8, 1881, 2048 }, { 8, 1882, 2048 }, { 9, 1883, 2048 }, { 8, 1884, 2048 }, { 9, 1885, 2048 }, { 9, 1886, 2048 }, { 10, 1887, 2048 }, + { 6, 1888, 2048 }, { 7, 1889, 2048 }, { 7, 1890, 2048 }, { 8, 1891, 2048 }, { 7, 1892, 2048 }, { 8, 1893, 2048 }, { 8, 1894, 2048 }, { 9, 1895, 2048 }, + { 7, 1896, 2048 }, { 8, 1897, 2048 }, { 8, 1898, 2048 }, { 9, 1899, 2048 }, { 8, 1900, 2048 }, { 9, 1901, 2048 }, { 9, 1902, 2048 }, { 10, 1903, 2048 }, + { 7, 1904, 2048 }, { 8, 1905, 2048 }, { 8, 1906, 2048 }, { 9, 1907, 2048 }, { 8, 1908, 2048 }, { 9, 1909, 2048 }, { 9, 1910, 2048 }, { 10, 1911, 2048 }, + { 8, 1912, 2048 }, { 9, 1913, 2048 }, { 9, 1914, 2048 }, { 10, 1915, 2048 }, { 9, 1916, 2048 }, { 10, 1917, 2048 }, { 10, 1918, 2048 }, { 11, 1919, 2048 }, + { 5, 1920, 2048 }, { 6, 1921, 2048 }, { 6, 1922, 2048 }, { 7, 1923, 2048 }, { 6, 1924, 2048 }, { 7, 1925, 2048 }, { 7, 1926, 2048 }, { 8, 1927, 2048 }, + { 6, 1928, 2048 }, { 7, 1929, 2048 }, { 7, 1930, 2048 }, { 8, 1931, 2048 }, { 7, 1932, 2048 }, { 8, 1933, 2048 }, { 8, 1934, 2048 }, { 9, 1935, 2048 }, + { 6, 1936, 2048 }, { 7, 1937, 2048 }, { 7, 1938, 2048 }, { 8, 1939, 2048 }, { 7, 1940, 2048 }, { 8, 1941, 2048 }, { 8, 1942, 2048 }, { 9, 1943, 2048 }, + { 7, 1944, 2048 }, { 8, 1945, 2048 }, { 8, 1946, 2048 }, { 9, 1947, 2048 }, { 8, 1948, 2048 }, { 9, 1949, 2048 }, { 9, 1950, 2048 }, { 10, 1951, 2048 }, + { 6, 1952, 2048 }, { 7, 1953, 2048 }, { 7, 1954, 2048 }, { 8, 1955, 2048 }, { 7, 1956, 2048 }, { 8, 1957, 2048 }, { 8, 1958, 2048 }, { 9, 1959, 2048 }, + { 7, 1960, 2048 }, { 8, 1961, 2048 }, { 8, 1962, 2048 }, { 9, 1963, 2048 }, { 8, 1964, 2048 }, { 9, 1965, 2048 }, { 9, 1966, 2048 }, { 10, 1967, 2048 }, + { 7, 1968, 2048 }, { 8, 1969, 2048 }, { 8, 1970, 2048 }, { 9, 1971, 2048 }, { 8, 1972, 2048 }, { 9, 1973, 2048 }, { 9, 1974, 2048 }, { 10, 1975, 2048 }, + { 8, 1976, 2048 }, { 9, 1977, 2048 }, { 9, 1978, 2048 }, { 10, 1979, 2048 }, { 9, 1980, 2048 }, { 10, 1981, 2048 }, { 10, 1982, 2048 }, { 11, 1983, 2048 }, + { 6, 1984, 2048 }, { 7, 1985, 2048 }, { 7, 1986, 2048 }, { 8, 1987, 2048 }, { 7, 1988, 2048 }, { 8, 1989, 2048 }, { 8, 1990, 2048 }, { 9, 1991, 2048 }, + { 7, 1992, 2048 }, { 8, 1993, 2048 }, { 8, 1994, 2048 }, { 9, 1995, 2048 }, { 8, 1996, 2048 }, { 9, 1997, 2048 }, { 9, 1998, 2048 }, { 10, 1999, 2048 }, + { 7, 2000, 2048 }, { 8, 2001, 2048 }, { 8, 2002, 2048 }, { 9, 2003, 2048 }, { 8, 2004, 2048 }, { 9, 2005, 2048 }, { 9, 2006, 2048 }, { 10, 2007, 2048 }, + { 8, 2008, 2048 }, { 9, 2009, 2048 }, { 9, 2010, 2048 }, { 10, 2011, 2048 }, { 9, 2012, 2048 }, { 10, 2013, 2048 }, { 10, 2014, 2048 }, { 11, 2015, 2048 }, + { 7, 2016, 2048 }, { 8, 2017, 2048 }, { 8, 2018, 2048 }, { 9, 2019, 2048 }, { 8, 2020, 2048 }, { 9, 2021, 2048 }, { 9, 2022, 2048 }, { 10, 2023, 2048 }, + { 8, 2024, 2048 }, { 9, 2025, 2048 }, { 9, 2026, 2048 }, { 10, 2027, 2048 }, { 9, 2028, 2048 }, { 10, 2029, 2048 }, { 10, 2030, 2048 }, { 11, 2031, 2048 }, + { 8, 2032, 2048 }, { 9, 2033, 2048 }, { 9, 2034, 2048 }, { 10, 2035, 2048 }, { 9, 2036, 2048 }, { 10, 2037, 2048 }, { 10, 2038, 2048 }, { 11, 2039, 2048 }, + { 9, 2040, 2048 }, { 10, 2041, 2048 }, { 10, 2042, 2048 }, { 11, 2043, 2048 }, { 10, 2044, 2048 }, { 11, 2045, 2048 }, { 11, 2046, 2048 }, { 12, 2047, 2048 }, #endif #endif #endif @@ -614,9 +614,9 @@ static int find_base(ecc_point *g) { int x; for (x = 0; x < FP_ENTRIES; x++) { - if (fp_cache[x].g != NULL && - mp_cmp(fp_cache[x].g->x, g->x) == LTC_MP_EQ && - mp_cmp(fp_cache[x].g->y, g->y) == LTC_MP_EQ && + if (fp_cache[x].g != NULL && + mp_cmp(fp_cache[x].g->x, g->x) == LTC_MP_EQ && + mp_cmp(fp_cache[x].g->y, g->y) == LTC_MP_EQ && mp_cmp(fp_cache[x].g->z, g->z) == LTC_MP_EQ) { break; } @@ -645,7 +645,7 @@ static int add_entry(int idx, ecc_point *g) ltc_ecc_del_point(fp_cache[idx].g); fp_cache[idx].g = NULL; return CRYPT_MEM; - } + } for (x = 0; x < (1U<x, mu, modulus, fp_cache[idx].LUT[1]->x) != CRYPT_OK) || - (mp_mulmod(fp_cache[idx].g->y, mu, modulus, fp_cache[idx].LUT[1]->y) != CRYPT_OK) || + if ((mp_mulmod(fp_cache[idx].g->x, mu, modulus, fp_cache[idx].LUT[1]->x) != CRYPT_OK) || + (mp_mulmod(fp_cache[idx].g->y, mu, modulus, fp_cache[idx].LUT[1]->y) != CRYPT_OK) || (mp_mulmod(fp_cache[idx].g->z, mu, modulus, fp_cache[idx].LUT[1]->z) != CRYPT_OK)) { goto ERR; } - + /* make all single bit entries */ for (x = 1; x < FP_LUT; x++) { - if ((mp_copy(fp_cache[idx].LUT[1<<(x-1)]->x, fp_cache[idx].LUT[1<x) != CRYPT_OK) || - (mp_copy(fp_cache[idx].LUT[1<<(x-1)]->y, fp_cache[idx].LUT[1<y) != CRYPT_OK) || + if ((mp_copy(fp_cache[idx].LUT[1<<(x-1)]->x, fp_cache[idx].LUT[1<x) != CRYPT_OK) || + (mp_copy(fp_cache[idx].LUT[1<<(x-1)]->y, fp_cache[idx].LUT[1<y) != CRYPT_OK) || (mp_copy(fp_cache[idx].LUT[1<<(x-1)]->z, fp_cache[idx].LUT[1<z) != CRYPT_OK)) { goto ERR; } - + /* now double it bitlen/FP_LUT times */ for (y = 0; y < lut_gap; y++) { if ((err = ltc_mp.ecc_ptdbl(fp_cache[idx].LUT[1<z, modulus, mp)) != CRYPT_OK) { goto ERR; } - + /* invert it */ if ((err = mp_invmod(fp_cache[idx].LUT[x]->z, modulus, fp_cache[idx].LUT[x]->z)) != CRYPT_OK) { goto ERR; } /* now square it */ if ((err = mp_sqrmod(fp_cache[idx].LUT[x]->z, modulus, tmp)) != CRYPT_OK) { goto ERR; } - + /* fix x */ if ((err = mp_mulmod(fp_cache[idx].LUT[x]->x, tmp, modulus, fp_cache[idx].LUT[x]->x)) != CRYPT_OK) { goto ERR; } @@ -755,10 +755,10 @@ static int build_lut(int idx, void *modulus, void *mp, void *mu) } mp_clear(tmp); - return CRYPT_OK; + return CRYPT_OK; ERR: err = CRYPT_MEM; -DONE: +DONE: for (y = 0; y < (1U< (sizeof(kb) - 2)) { if (tk != k) { mp_clear(tk); - } + } return CRYPT_BUFFER_OVERFLOW; } - + /* store k */ zeromem(kb, sizeof(kb)); if ((err = mp_to_unsigned_bin(tk, kb)) != CRYPT_OK) { if (tk != k) { mp_clear(tk); - } + } return err; } - + /* let's reverse kb so it's little endian */ x = 0; y = mp_unsigned_bin_size(tk) - 1; if (tk != k) { mp_clear(tk); - } + } while ((unsigned)x < y) { z = kb[x]; kb[x] = kb[y]; kb[y] = z; ++x; --y; - } - + } + /* at this point we can start, yipee */ first = 1; for (x = lut_gap-1; x >= 0; x--) { @@ -867,26 +867,26 @@ static int accel_fp_mul(int idx, void *k, ecc_point *R, void *modulus, void *mp, z |= ((kb[bitpos>>3] >> (bitpos&7)) & 1) << y; bitpos += lut_gap; /* it's y*lut_gap + x, but here we can avoid the mult in each loop */ } - + /* double if not first */ if (!first) { if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { return err; } } - - /* add if not first, otherwise copy */ + + /* add if not first, otherwise copy */ if (!first && z) { if ((err = ltc_mp.ecc_ptadd(R, fp_cache[idx].LUT[z], R, modulus, mp)) != CRYPT_OK) { return err; } } else if (z) { - if ((mp_copy(fp_cache[idx].LUT[z]->x, R->x) != CRYPT_OK) || - (mp_copy(fp_cache[idx].LUT[z]->y, R->y) != CRYPT_OK) || + if ((mp_copy(fp_cache[idx].LUT[z]->x, R->x) != CRYPT_OK) || + (mp_copy(fp_cache[idx].LUT[z]->y, R->y) != CRYPT_OK) || (mp_copy(fp_cache[idx].mu, R->z) != CRYPT_OK)) { return CRYPT_MEM; } - first = 0; + first = 0; } - } + } z = 0; zeromem(kb, sizeof(kb)); /* map R back from projective space */ @@ -900,7 +900,7 @@ static int accel_fp_mul(int idx, void *k, ecc_point *R, void *modulus, void *mp, #ifdef LTC_ECC_SHAMIR /* perform a fixed point ECC mulmod */ -static int accel_fp_mul2add(int idx1, int idx2, +static int accel_fp_mul2add(int idx1, int idx2, void *kA, void *kB, ecc_point *R, void *modulus, void *mp) { @@ -916,13 +916,13 @@ static int accel_fp_mul2add(int idx1, int idx2, for (x = 0; ltc_ecc_sets[x].size; x++) { if (y <= (unsigned)ltc_ecc_sets[x].size) break; } - + /* back off if we are on the 521 bit curve */ if (y == 66) --x; - + if ((err = mp_init(&order)) != CRYPT_OK) { return err; - } + } if ((err = mp_read_radix(order, ltc_ecc_sets[x].order, 16)) != CRYPT_OK) { mp_clear(&order); return err; @@ -945,7 +945,7 @@ static int accel_fp_mul2add(int idx1, int idx2, mp_clear(order); } else { tka = kA; - } + } /* if it's smaller than modulus we fine */ if (mp_unsigned_bin_size(kB) > mp_unsigned_bin_size(modulus)) { @@ -954,13 +954,13 @@ static int accel_fp_mul2add(int idx1, int idx2, for (x = 0; ltc_ecc_sets[x].size; x++) { if (y <= (unsigned)ltc_ecc_sets[x].size) break; } - + /* back off if we are on the 521 bit curve */ if (y == 66) --x; - + if ((err = mp_init(&order)) != CRYPT_OK) { return err; - } + } if ((err = mp_read_radix(order, ltc_ecc_sets[x].order, 16)) != CRYPT_OK) { mp_clear(&order); return err; @@ -983,55 +983,55 @@ static int accel_fp_mul2add(int idx1, int idx2, mp_clear(order); } else { tkb = kB; - } + } /* get bitlen and round up to next multiple of FP_LUT */ bitlen = mp_unsigned_bin_size(modulus) << 3; x = bitlen % FP_LUT; if (x) { bitlen += FP_LUT - x; - } + } lut_gap = bitlen / FP_LUT; - + /* get the k value */ if ((mp_unsigned_bin_size(tka) > (sizeof(kb[0]) - 2)) || (mp_unsigned_bin_size(tkb) > (sizeof(kb[0]) - 2)) ) { if (tka != kA) { mp_clear(tka); - } + } if (tkb != kB) { mp_clear(tkb); - } + } return CRYPT_BUFFER_OVERFLOW; } - + /* store k */ zeromem(kb, sizeof(kb)); if ((err = mp_to_unsigned_bin(tka, kb[0])) != CRYPT_OK) { if (tka != kA) { mp_clear(tka); - } + } if (tkb != kB) { mp_clear(tkb); - } + } return err; } - + /* let's reverse kb so it's little endian */ x = 0; y = mp_unsigned_bin_size(tka) - 1; if (tka != kA) { mp_clear(tka); - } + } while ((unsigned)x < y) { z = kb[0][x]; kb[0][x] = kb[0][y]; kb[0][y] = z; ++x; --y; - } - + } + /* store b */ if ((err = mp_to_unsigned_bin(tkb, kb[1])) != CRYPT_OK) { if (tkb != kB) { mp_clear(tkb); - } + } return err; } @@ -1039,11 +1039,11 @@ static int accel_fp_mul2add(int idx1, int idx2, y = mp_unsigned_bin_size(tkb) - 1; if (tkb != kB) { mp_clear(tkb); - } + } while ((unsigned)x < y) { z = kb[1][x]; kb[1][x] = kb[1][y]; kb[1][y] = z; ++x; --y; - } + } /* at this point we can start, yipee */ first = 1; @@ -1055,15 +1055,15 @@ static int accel_fp_mul2add(int idx1, int idx2, zB |= ((kb[1][bitpos>>3] >> (bitpos&7)) & 1) << y; bitpos += lut_gap; /* it's y*lut_gap + x, but here we can avoid the mult in each loop */ } - + /* double if not first */ if (!first) { if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { return err; } } - - /* add if not first, otherwise copy */ + + /* add if not first, otherwise copy */ if (!first) { if (zA) { if ((err = ltc_mp.ecc_ptadd(R, fp_cache[idx1].LUT[zA], R, modulus, mp)) != CRYPT_OK) { @@ -1077,10 +1077,10 @@ static int accel_fp_mul2add(int idx1, int idx2, } } else { if (zA) { - if ((mp_copy(fp_cache[idx1].LUT[zA]->x, R->x) != CRYPT_OK) || - (mp_copy(fp_cache[idx1].LUT[zA]->y, R->y) != CRYPT_OK) || + if ((mp_copy(fp_cache[idx1].LUT[zA]->x, R->x) != CRYPT_OK) || + (mp_copy(fp_cache[idx1].LUT[zA]->y, R->y) != CRYPT_OK) || (mp_copy(fp_cache[idx1].mu, R->z) != CRYPT_OK)) { return CRYPT_MEM; } - first = 0; + first = 0; } if (zB && first == 0) { if (zB) { @@ -1089,13 +1089,13 @@ static int accel_fp_mul2add(int idx1, int idx2, } } } else if (zB && first == 1) { - if ((mp_copy(fp_cache[idx2].LUT[zB]->x, R->x) != CRYPT_OK) || - (mp_copy(fp_cache[idx2].LUT[zB]->y, R->y) != CRYPT_OK) || + if ((mp_copy(fp_cache[idx2].LUT[zB]->x, R->x) != CRYPT_OK) || + (mp_copy(fp_cache[idx2].LUT[zB]->y, R->y) != CRYPT_OK) || (mp_copy(fp_cache[idx2].mu, R->z) != CRYPT_OK)) { return CRYPT_MEM; } - first = 0; + first = 0; } } - } + } zeromem(kb, sizeof(kb)); return ltc_ecc_map(R, modulus, mp); } @@ -1107,16 +1107,16 @@ static int accel_fp_mul2add(int idx1, int idx2, @param B Second point to multiply @param kB What to multiple B by @param C [out] Destination point (can overlap with A or B) - @param modulus Modulus for curve + @param modulus Modulus for curve @return CRYPT_OK on success -*/ +*/ int ltc_ecc_fp_mul2add(ecc_point *A, void *kA, ecc_point *B, void *kB, ecc_point *C, void *modulus) { int idx1, idx2, err; void *mp, *mu; - + mp = NULL; mu = NULL; LTC_MUTEX_LOCK(<c_ecc_fp_lock); @@ -1165,12 +1165,12 @@ int ltc_ecc_fp_mul2add(ecc_point *A, void *kA, } if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { goto LBL_ERR; - } - + } + /* build the LUT */ if ((err = build_lut(idx1, modulus, mp, mu)) != CRYPT_OK) { goto LBL_ERR;; - } + } } /* if it's 2 build the LUT, if it's higher just use the LUT */ @@ -1185,13 +1185,13 @@ int ltc_ecc_fp_mul2add(ecc_point *A, void *kA, } if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { goto LBL_ERR; - } + } } - + /* build the LUT */ if ((err = build_lut(idx2, modulus, mp, mu)) != CRYPT_OK) { goto LBL_ERR;; - } + } } @@ -1208,10 +1208,10 @@ LBL_ERR: LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); if (mp != NULL) { mp_montgomery_free(mp); - } + } if (mu != NULL) { mp_clear(mu); - } + } return err; } #endif @@ -1223,12 +1223,12 @@ LBL_ERR: @param modulus The modulus for the curve @param map [boolean] If non-zero maps the point back to affine co-ordinates, otherwise it's left in jacobian-montgomery form @return CRYPT_OK if successful -*/ +*/ int ltc_ecc_fp_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map) { int idx, err; void *mp, *mu; - + mp = NULL; mu = NULL; LTC_MUTEX_LOCK(<c_ecc_fp_lock); @@ -1251,7 +1251,7 @@ int ltc_ecc_fp_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int ma ++(fp_cache[idx].lru_count); } - + /* if it's 2 build the LUT, if it's higher just use the LUT */ if (idx >= 0 && fp_cache[idx].lru_count == 2) { /* compute mp */ @@ -1263,12 +1263,12 @@ int ltc_ecc_fp_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int ma } if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { goto LBL_ERR; - } - + } + /* build the LUT */ if ((err = build_lut(idx, modulus, mp, mu)) != CRYPT_OK) { goto LBL_ERR;; - } + } } if (idx >= 0 && fp_cache[idx].lru_count >= 2) { @@ -1284,10 +1284,10 @@ LBL_ERR: LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); if (mp != NULL) { mp_montgomery_free(mp); - } + } if (mu != NULL) { mp_clear(mu); - } + } return err; } @@ -1309,9 +1309,9 @@ static void ltc_ecc_fp_free_cache(void) } fp_cache[x].lru_count = 0; fp_cache[x].lock = 0; - } + } } -} +} /** Free the Fixed Point cache */ void ltc_ecc_fp_free(void) @@ -1323,7 +1323,7 @@ void ltc_ecc_fp_free(void) /** Add a point to the cache and initialize the LUT @param g The point to add - @param modulus Modulus for curve + @param modulus Modulus for curve @param lock Flag to indicate if this entry should be locked into the cache or not @return CRYPT_OK on success */ @@ -1362,26 +1362,26 @@ ltc_ecc_fp_add_point(ecc_point *g, void *modulus, int lock) } if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { goto LBL_ERR; - } - + } + /* build the LUT */ if ((err = build_lut(idx, modulus, mp, mu)) != CRYPT_OK) { goto LBL_ERR; - } + } fp_cache[idx].lru_count = 2; fp_cache[idx].lock = lock; LBL_ERR: LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); if (mp != NULL) { mp_montgomery_free(mp); - } + } if (mu != NULL) { mp_clear(mu); - } + } return err; } -/** Prevent/permit the FP cache from being updated +/** Prevent/permit the FP cache from being updated @param flag If flag is 0, remove cache lock (unlock), otherwise lock it */ void ltc_ecc_fp_tablelock(int lock) @@ -1416,7 +1416,7 @@ int ltc_ecc_fp_save_state(unsigned char **out, unsigned long *outlen) LTC_MUTEX_LOCK(<c_ecc_fp_lock); /* - * build the list; + * build the list; Cache DEFINITIONS ::= BEGIN CacheDump ::= SEQUENCE { @@ -1426,7 +1426,7 @@ int ltc_ecc_fp_save_state(unsigned char **out, unsigned long *outlen) cache SEQUENCE OF INTEGER } END - * + * */ /* * The cache itself is a point (3 INTEGERS), @@ -1492,7 +1492,7 @@ int ltc_ecc_fp_restore_state(unsigned char *in, unsigned long inlen) LTC_ARGCHK(in != NULL); if (inlen == 0) { return CRYPT_INVALID_ARG; - } + } /* zero indecies */ i = 0; @@ -1512,7 +1512,7 @@ int ltc_ecc_fp_restore_state(unsigned char *in, unsigned long inlen) * * use standard decoding for the first part, then flexible for the second */ - if((err = der_decode_sequence_multi(in, inlen, + if((err = der_decode_sequence_multi(in, inlen, LTC_ASN1_SHORT_INTEGER, 1, &num_entries, LTC_ASN1_SHORT_INTEGER, 1, &fp_entries, LTC_ASN1_SHORT_INTEGER, 1, &fp_lut, @@ -1540,7 +1540,7 @@ int ltc_ecc_fp_restore_state(unsigned char *in, unsigned long inlen) LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_INTEGER, fp_cache[i].g->y, 1); LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_INTEGER, fp_cache[i].g->z, 1); for (x = 0; x < (1U< 512) { + if (len < 2 || len > 512) { return CRYPT_INVALID_PRIME_SIZE; } - + /* valid PRNG? Better be! */ if ((err = prng_is_valid(wprng)) != CRYPT_OK) { - return err; + return err; } /* allocate buffer to work with */ @@ -60,7 +60,7 @@ int rand_prime(void *N, long len, prng_state *prng, int wprng) /* munge bits */ buf[0] |= 0x80 | 0x40; buf[len-1] |= 0x01 | ((type & USE_BBS) ? 0x02 : 0x00); - + /* load value */ if ((err = mp_read_unsigned_bin(N, buf, len)) != CRYPT_OK) { XFREE(buf); @@ -81,7 +81,7 @@ int rand_prime(void *N, long len, prng_state *prng, int wprng) XFREE(buf); return CRYPT_OK; } - + #endif /* LTC_NO_MATH */ diff --git a/src/misc/crypt/crypt_find_cipher_any.c b/src/misc/crypt/crypt_find_cipher_any.c index c528e6e..34cd8f0 100644 --- a/src/misc/crypt/crypt_find_cipher_any.c +++ b/src/misc/crypt/crypt_find_cipher_any.c @@ -16,7 +16,7 @@ */ /** - Find a cipher flexibly. First by name then if not present by block and key size + Find a cipher flexibly. First by name then if not present by block and key size @param name The name of the cipher desired @param blocklen The minimum length of the block cipher desired (octets) @param keylen The minimum length of the key size desired (octets) diff --git a/src/misc/crypt/crypt_find_hash_any.c b/src/misc/crypt/crypt_find_hash_any.c index 65ecce7..777ce08 100644 --- a/src/misc/crypt/crypt_find_hash_any.c +++ b/src/misc/crypt/crypt_find_hash_any.c @@ -16,7 +16,7 @@ */ /** - Find a hash flexibly. First by name then if not present by digest size + Find a hash flexibly. First by name then if not present by digest size @param name The name of the hash desired @param digestlen The minimum length of the digest size (octets) @return >= 0 if found, -1 if not present diff --git a/src/misc/crypt/crypt_fsa.c b/src/misc/crypt/crypt_fsa.c index 9960ec9..e177f9a 100644 --- a/src/misc/crypt/crypt_fsa.c +++ b/src/misc/crypt/crypt_fsa.c @@ -14,7 +14,7 @@ /** @file crypt_fsa.c LibTomCrypt FULL SPEED AHEAD!, Tom St Denis -*/ +*/ /* format is ltc_mp, cipher_desc, [cipher_desc], NULL, hash_desc, [hash_desc], NULL, prng_desc, [prng_desc], NULL */ int crypt_fsa(void *mp, ...) @@ -26,7 +26,7 @@ int crypt_fsa(void *mp, ...) if (mp != NULL) { XMEMCPY(<c_mp, mp, sizeof(ltc_mp)); } - + while ((p = va_arg(args, void*)) != NULL) { if (register_cipher(p) == -1) { va_end(args); @@ -49,7 +49,7 @@ int crypt_fsa(void *mp, ...) } va_end(args); - return CRYPT_OK; + return CRYPT_OK; } diff --git a/src/misc/crypt/crypt_hash_descriptor.c b/src/misc/crypt/crypt_hash_descriptor.c index a0c3c1a..4e8bce1 100644 --- a/src/misc/crypt/crypt_hash_descriptor.c +++ b/src/misc/crypt/crypt_hash_descriptor.c @@ -12,7 +12,7 @@ /** @file crypt_hash_descriptor.c - Stores the hash descriptor table, Tom St Denis + Stores the hash descriptor table, Tom St Denis */ struct ltc_hash_descriptor hash_descriptor[TAB_SIZE] = { diff --git a/src/misc/crypt/crypt_hash_is_valid.c b/src/misc/crypt/crypt_hash_is_valid.c index 011f829..dbab714 100644 --- a/src/misc/crypt/crypt_hash_is_valid.c +++ b/src/misc/crypt/crypt_hash_is_valid.c @@ -13,7 +13,7 @@ /** @file crypt_hash_is_valid.c Determine if hash is valid, Tom St Denis -*/ +*/ /* Test if a hash index is valid diff --git a/src/misc/crypt/crypt_prng_descriptor.c b/src/misc/crypt/crypt_prng_descriptor.c index 3af9df5..926f3bb 100644 --- a/src/misc/crypt/crypt_prng_descriptor.c +++ b/src/misc/crypt/crypt_prng_descriptor.c @@ -13,7 +13,7 @@ /** @file crypt_prng_descriptor.c Stores the PRNG descriptors, Tom St Denis -*/ +*/ struct ltc_prng_descriptor prng_descriptor[TAB_SIZE] = { { NULL, 0, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL } }; diff --git a/src/misc/crypt/crypt_register_prng.c b/src/misc/crypt/crypt_register_prng.c index 1724df0..faebb18 100644 --- a/src/misc/crypt/crypt_register_prng.c +++ b/src/misc/crypt/crypt_register_prng.c @@ -14,7 +14,7 @@ @file crypt_register_prng.c Register a PRNG, Tom St Denis */ - + /** Register a PRNG with the descriptor table @param prng The PRNG you wish to register diff --git a/src/misc/error_to_string.c b/src/misc/error_to_string.c index 7ebd898..2ca1492 100644 --- a/src/misc/error_to_string.c +++ b/src/misc/error_to_string.c @@ -68,7 +68,7 @@ const char *error_to_string(int err) return "Invalid error code."; } else { return err_2_str[err]; - } + } } diff --git a/src/modes/cbc/cbc_done.c b/src/modes/cbc/cbc_done.c index 75b9742..4824940 100644 --- a/src/modes/cbc/cbc_done.c +++ b/src/modes/cbc/cbc_done.c @@ -33,7 +33,7 @@ int cbc_done(symmetric_CBC *cbc) return CRYPT_OK; } - + #endif diff --git a/src/modes/cbc/cbc_setiv.c b/src/modes/cbc/cbc_setiv.c index cd2e32e..3d02093 100644 --- a/src/modes/cbc/cbc_setiv.c +++ b/src/modes/cbc/cbc_setiv.c @@ -36,7 +36,7 @@ int cbc_setiv(const unsigned char *IV, unsigned long len, symmetric_CBC *cbc) return CRYPT_OK; } -#endif +#endif /* $Source$ */ diff --git a/src/modes/cbc/cbc_start.c b/src/modes/cbc/cbc_start.c index 832e77a..71b6fa8 100644 --- a/src/modes/cbc/cbc_start.c +++ b/src/modes/cbc/cbc_start.c @@ -21,17 +21,17 @@ Initialize a CBC context @param cipher The index of the cipher desired @param IV The initial vector - @param key The secret key + @param key The secret key @param keylen The length of the secret key (octets) @param num_rounds Number of rounds in the cipher desired (0 for default) @param cbc The CBC state to initialize @return CRYPT_OK if successful */ -int cbc_start(int cipher, const unsigned char *IV, const unsigned char *key, +int cbc_start(int cipher, const unsigned char *IV, const unsigned char *key, int keylen, int num_rounds, symmetric_CBC *cbc) { int x, err; - + LTC_ARGCHK(IV != NULL); LTC_ARGCHK(key != NULL); LTC_ARGCHK(cbc != NULL); diff --git a/src/modes/cfb/cfb_decrypt.c b/src/modes/cfb/cfb_decrypt.c index 13ac5a6..0c08c74 100644 --- a/src/modes/cfb/cfb_decrypt.c +++ b/src/modes/cfb/cfb_decrypt.c @@ -52,7 +52,7 @@ int cfb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s } cfb->pad[cfb->padlen] = *ct; *pt = *ct ^ cfb->IV[cfb->padlen]; - ++pt; + ++pt; ++ct; ++(cfb->padlen); } diff --git a/src/modes/cfb/cfb_done.c b/src/modes/cfb/cfb_done.c index 1ee9a98..bacfa28 100644 --- a/src/modes/cfb/cfb_done.c +++ b/src/modes/cfb/cfb_done.c @@ -33,7 +33,7 @@ int cfb_done(symmetric_CFB *cfb) return CRYPT_OK; } - + #endif diff --git a/src/modes/cfb/cfb_encrypt.c b/src/modes/cfb/cfb_encrypt.c index 8ac5f5c..e762143 100644 --- a/src/modes/cfb/cfb_encrypt.c +++ b/src/modes/cfb/cfb_encrypt.c @@ -51,7 +51,7 @@ int cfb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s cfb->padlen = 0; } cfb->pad[cfb->padlen] = (*ct = *pt ^ cfb->IV[cfb->padlen]); - ++pt; + ++pt; ++ct; ++(cfb->padlen); } diff --git a/src/modes/cfb/cfb_setiv.c b/src/modes/cfb/cfb_setiv.c index 0fc8757..4a22110 100644 --- a/src/modes/cfb/cfb_setiv.c +++ b/src/modes/cfb/cfb_setiv.c @@ -13,7 +13,7 @@ /** @file cfb_setiv.c CFB implementation, set IV, Tom St Denis -*/ +*/ #ifdef LTC_CFB_MODE @@ -27,24 +27,24 @@ int cfb_setiv(const unsigned char *IV, unsigned long len, symmetric_CFB *cfb) { int err; - + LTC_ARGCHK(IV != NULL); LTC_ARGCHK(cfb != NULL); if ((err = cipher_is_valid(cfb->cipher)) != CRYPT_OK) { return err; } - + if (len != (unsigned long)cfb->blocklen) { return CRYPT_INVALID_ARG; } - + /* force next block */ cfb->padlen = 0; return cipher_descriptor[cfb->cipher].ecb_encrypt(IV, cfb->IV, &cfb->key); } -#endif +#endif /* $Source$ */ diff --git a/src/modes/cfb/cfb_start.c b/src/modes/cfb/cfb_start.c index a8e5b8b..b42c97f 100644 --- a/src/modes/cfb/cfb_start.c +++ b/src/modes/cfb/cfb_start.c @@ -22,13 +22,13 @@ Initialize a CFB context @param cipher The index of the cipher desired @param IV The initial vector - @param key The secret key + @param key The secret key @param keylen The length of the secret key (octets) @param num_rounds Number of rounds in the cipher desired (0 for default) @param cfb The CFB state to initialize @return CRYPT_OK if successful */ -int cfb_start(int cipher, const unsigned char *IV, const unsigned char *key, +int cfb_start(int cipher, const unsigned char *IV, const unsigned char *key, int keylen, int num_rounds, symmetric_CFB *cfb) { int x, err; @@ -40,7 +40,7 @@ int cfb_start(int cipher, const unsigned char *IV, const unsigned char *key, if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { return err; } - + /* copy data */ cfb->cipher = cipher; diff --git a/src/modes/ctr/ctr_done.c b/src/modes/ctr/ctr_done.c index 26391fd..77d888b 100644 --- a/src/modes/ctr/ctr_done.c +++ b/src/modes/ctr/ctr_done.c @@ -33,7 +33,7 @@ int ctr_done(symmetric_CTR *ctr) return CRYPT_OK; } - + #endif diff --git a/src/modes/ctr/ctr_setiv.c b/src/modes/ctr/ctr_setiv.c index 56a3c97..50c6539 100644 --- a/src/modes/ctr/ctr_setiv.c +++ b/src/modes/ctr/ctr_setiv.c @@ -14,7 +14,7 @@ @file ctr_setiv.c CTR implementation, set IV, Tom St Denis */ - + #ifdef LTC_CTR_MODE /** @@ -27,7 +27,7 @@ int ctr_setiv(const unsigned char *IV, unsigned long len, symmetric_CTR *ctr) { int err; - + LTC_ARGCHK(IV != NULL); LTC_ARGCHK(ctr != NULL); @@ -35,20 +35,20 @@ int ctr_setiv(const unsigned char *IV, unsigned long len, symmetric_CTR *ctr) if ((err = cipher_is_valid(ctr->cipher)) != CRYPT_OK) { return err; } - + if (len != (unsigned long)ctr->blocklen) { return CRYPT_INVALID_ARG; } /* set IV */ XMEMCPY(ctr->ctr, IV, len); - + /* force next block */ ctr->padlen = 0; return cipher_descriptor[ctr->cipher].ecb_encrypt(IV, ctr->pad, &ctr->key); } -#endif +#endif /* $Source$ */ diff --git a/src/modes/ctr/ctr_start.c b/src/modes/ctr/ctr_start.c index b27bed0..8544636 100644 --- a/src/modes/ctr/ctr_start.c +++ b/src/modes/ctr/ctr_start.c @@ -22,16 +22,16 @@ Initialize a CTR context @param cipher The index of the cipher desired @param IV The initial vector - @param key The secret key + @param key The secret key @param keylen The length of the secret key (octets) @param num_rounds Number of rounds in the cipher desired (0 for default) @param ctr_mode The counter mode (CTR_COUNTER_LITTLE_ENDIAN or CTR_COUNTER_BIG_ENDIAN) @param ctr The CTR state to initialize @return CRYPT_OK if successful */ -int ctr_start( int cipher, - const unsigned char *IV, - const unsigned char *key, int keylen, +int ctr_start( int cipher, + const unsigned char *IV, + const unsigned char *key, int keylen, int num_rounds, int ctr_mode, symmetric_CTR *ctr) { @@ -91,7 +91,7 @@ int ctr_start( int cipher, } } - return cipher_descriptor[ctr->cipher].ecb_encrypt(ctr->ctr, ctr->pad, &ctr->key); + return cipher_descriptor[ctr->cipher].ecb_encrypt(ctr->ctr, ctr->pad, &ctr->key); } #endif diff --git a/src/modes/ctr/ctr_test.c b/src/modes/ctr/ctr_test.c index 9962afd..6c97174 100644 --- a/src/modes/ctr/ctr_test.c +++ b/src/modes/ctr/ctr_test.c @@ -52,7 +52,7 @@ int ctr_test(void) unsigned char buf[64]; symmetric_CTR ctr; - /* AES can be under rijndael or aes... try to find it */ + /* AES can be under rijndael or aes... try to find it */ if ((idx = find_cipher("aes")) == -1) { if ((idx = find_cipher("rijndael")) == -1) { return CRYPT_NOP; diff --git a/src/modes/ecb/ecb_done.c b/src/modes/ecb/ecb_done.c index 961ec97..9199eae 100644 --- a/src/modes/ecb/ecb_done.c +++ b/src/modes/ecb/ecb_done.c @@ -33,7 +33,7 @@ int ecb_done(symmetric_ECB *ecb) return CRYPT_OK; } - + #endif diff --git a/src/modes/ecb/ecb_start.c b/src/modes/ecb/ecb_start.c index cec583a..67061ca 100644 --- a/src/modes/ecb/ecb_start.c +++ b/src/modes/ecb/ecb_start.c @@ -21,7 +21,7 @@ /** Initialize a ECB context @param cipher The index of the cipher desired - @param key The secret key + @param key The secret key @param keylen The length of the secret key (octets) @param num_rounds Number of rounds in the cipher desired (0 for default) @param ecb The ECB state to initialize diff --git a/src/modes/f8/f8_decrypt.c b/src/modes/f8/f8_decrypt.c index 9c4525d..6279eee 100644 --- a/src/modes/f8/f8_decrypt.c +++ b/src/modes/f8/f8_decrypt.c @@ -36,7 +36,7 @@ int f8_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, sy #endif - + /* $Source$ */ /* $Revision$ */ diff --git a/src/modes/f8/f8_done.c b/src/modes/f8/f8_done.c index 867d603..6173a0a 100644 --- a/src/modes/f8/f8_done.c +++ b/src/modes/f8/f8_done.c @@ -33,7 +33,7 @@ int f8_done(symmetric_F8 *f8) return CRYPT_OK; } - + #endif diff --git a/src/modes/f8/f8_setiv.c b/src/modes/f8/f8_setiv.c index d1cafcf..5d2cb88 100644 --- a/src/modes/f8/f8_setiv.c +++ b/src/modes/f8/f8_setiv.c @@ -44,7 +44,7 @@ int f8_setiv(const unsigned char *IV, unsigned long len, symmetric_F8 *f8) return cipher_descriptor[f8->cipher].ecb_encrypt(IV, f8->IV, &f8->key); } -#endif +#endif /* $Source$ */ diff --git a/src/modes/f8/f8_start.c b/src/modes/f8/f8_start.c index 4cd58de..f454367 100644 --- a/src/modes/f8/f8_start.c +++ b/src/modes/f8/f8_start.c @@ -22,7 +22,7 @@ Initialize an F8 context @param cipher The index of the cipher desired @param IV The initial vector - @param key The secret key + @param key The secret key @param keylen The length of the secret key (octets) @param salt_key The salting key for the IV @param skeylen The length of the salting key (octets) @@ -30,8 +30,8 @@ @param f8 The F8 state to initialize @return CRYPT_OK if successful */ -int f8_start( int cipher, const unsigned char *IV, - const unsigned char *key, int keylen, +int f8_start( int cipher, const unsigned char *IV, + const unsigned char *key, int keylen, const unsigned char *salt_key, int skeylen, int num_rounds, symmetric_F8 *f8) { @@ -58,7 +58,7 @@ int f8_start( int cipher, const unsigned char *IV, f8->cipher = cipher; f8->blocklen = cipher_descriptor[cipher].block_length; f8->padlen = f8->blocklen; - + /* now get key ^ salt_key [extend salt_ket with 0x55 as required to match length] */ zeromem(tkey, sizeof(tkey)); for (x = 0; x < keylen && x < (int)sizeof(tkey); x++) { @@ -66,16 +66,16 @@ int f8_start( int cipher, const unsigned char *IV, } for (x = 0; x < skeylen && x < (int)sizeof(tkey); x++) { tkey[x] ^= salt_key[x]; - } + } for (; x < keylen && x < (int)sizeof(tkey); x++) { tkey[x] ^= 0x55; } - + /* now encrypt with tkey[0..keylen-1] the IV and use that as the IV */ if ((err = cipher_descriptor[cipher].setup(tkey, keylen, num_rounds, &f8->key)) != CRYPT_OK) { return err; } - + /* encrypt IV */ if ((err = cipher_descriptor[f8->cipher].ecb_encrypt(IV, f8->MIV, &f8->key)) != CRYPT_OK) { cipher_descriptor[f8->cipher].done(&f8->key); @@ -83,10 +83,10 @@ int f8_start( int cipher, const unsigned char *IV, } zeromem(tkey, sizeof(tkey)); zeromem(f8->IV, sizeof(f8->IV)); - + /* terminate this cipher */ cipher_descriptor[f8->cipher].done(&f8->key); - + /* init the cipher */ return cipher_descriptor[cipher].setup(key, keylen, num_rounds, &f8->key); } diff --git a/src/modes/f8/f8_test_mode.c b/src/modes/f8/f8_test_mode.c index 5cc391b..39f5496 100644 --- a/src/modes/f8/f8_test_mode.c +++ b/src/modes/f8/f8_test_mode.c @@ -23,36 +23,36 @@ int f8_test_mode(void) #ifndef LTC_TEST return CRYPT_NOP; #else - static const unsigned char key[16] = { 0x23, 0x48, 0x29, 0x00, 0x84, 0x67, 0xbe, 0x18, + static const unsigned char key[16] = { 0x23, 0x48, 0x29, 0x00, 0x84, 0x67, 0xbe, 0x18, 0x6c, 0x3d, 0xe1, 0x4a, 0xae, 0x72, 0xd6, 0x2c }; static const unsigned char salt[4] = { 0x32, 0xf2, 0x87, 0x0d }; - static const unsigned char IV[16] = { 0x00, 0x6e, 0x5c, 0xba, 0x50, 0x68, 0x1d, 0xe5, + static const unsigned char IV[16] = { 0x00, 0x6e, 0x5c, 0xba, 0x50, 0x68, 0x1d, 0xe5, 0x5c, 0x62, 0x15, 0x99, 0xd4, 0x62, 0x56, 0x4a }; - static const unsigned char pt[39] = { 0x70, 0x73, 0x65, 0x75, 0x64, 0x6f, 0x72, 0x61, + static const unsigned char pt[39] = { 0x70, 0x73, 0x65, 0x75, 0x64, 0x6f, 0x72, 0x61, 0x6e, 0x64, 0x6f, 0x6d, 0x6e, 0x65, 0x73, 0x73, - 0x20, 0x69, 0x73, 0x20, 0x74, 0x68, 0x65, 0x20, + 0x20, 0x69, 0x73, 0x20, 0x74, 0x68, 0x65, 0x20, 0x6e, 0x65, 0x78, 0x74, 0x20, 0x62, 0x65, 0x73, 0x74, 0x20, 0x74, 0x68, 0x69, 0x6e, 0x67 }; - static const unsigned char ct[39] = { 0x01, 0x9c, 0xe7, 0xa2, 0x6e, 0x78, 0x54, 0x01, + static const unsigned char ct[39] = { 0x01, 0x9c, 0xe7, 0xa2, 0x6e, 0x78, 0x54, 0x01, 0x4a, 0x63, 0x66, 0xaa, 0x95, 0xd4, 0xee, 0xfd, - 0x1a, 0xd4, 0x17, 0x2a, 0x14, 0xf9, 0xfa, 0xf4, + 0x1a, 0xd4, 0x17, 0x2a, 0x14, 0xf9, 0xfa, 0xf4, 0x55, 0xb7, 0xf1, 0xd4, 0xb6, 0x2b, 0xd0, 0x8f, 0x56, 0x2c, 0x0e, 0xef, 0x7c, 0x48, 0x02 }; unsigned char buf[39]; symmetric_F8 f8; int err, idx; - + idx = find_cipher("aes"); if (idx == -1) { idx = find_cipher("rijndael"); if (idx == -1) return CRYPT_NOP; - } - + } + /* initialize the context */ if ((err = f8_start(idx, IV, key, sizeof(key), salt, sizeof(salt), 0, &f8)) != CRYPT_OK) { return err; } - + /* encrypt block */ if ((err = f8_encrypt(pt, buf, sizeof(pt), &f8)) != CRYPT_OK) { f8_done(&f8); @@ -63,11 +63,11 @@ int f8_test_mode(void) /* compare */ if (XMEMCMP(buf, ct, sizeof(ct))) { return CRYPT_FAIL_TESTVECTOR; - } - + } + return CRYPT_OK; -#endif -} +#endif +} #endif diff --git a/src/modes/lrw/lrw_done.c b/src/modes/lrw/lrw_done.c index e123d28..ce51f63 100644 --- a/src/modes/lrw/lrw_done.c +++ b/src/modes/lrw/lrw_done.c @@ -22,12 +22,12 @@ @param lrw The state to terminate @return CRYPT_OK if successful */ -int lrw_done(symmetric_LRW *lrw) +int lrw_done(symmetric_LRW *lrw) { int err; LTC_ARGCHK(lrw != NULL); - + if ((err = cipher_is_valid(lrw->cipher)) != CRYPT_OK) { return err; } diff --git a/src/modes/lrw/lrw_encrypt.c b/src/modes/lrw/lrw_encrypt.c index d84cbdd..1683330 100644 --- a/src/modes/lrw/lrw_encrypt.c +++ b/src/modes/lrw/lrw_encrypt.c @@ -16,7 +16,7 @@ */ #ifdef LTC_LRW_MODE - + /** LRW encrypt blocks @param pt The plaintext diff --git a/src/modes/lrw/lrw_start.c b/src/modes/lrw/lrw_start.c index 64014d2..fc052db 100644 --- a/src/modes/lrw/lrw_start.c +++ b/src/modes/lrw/lrw_start.c @@ -19,9 +19,9 @@ /** Initialize the LRW context - @param cipher The cipher desired, must be a 128-bit block cipher + @param cipher The cipher desired, must be a 128-bit block cipher @param IV The index value, must be 128-bits - @param key The cipher key + @param key The cipher key @param keylen The length of the cipher key in octets @param tweak The tweak value (second key), must be 128-bits @param num_rounds The number of rounds for the cipher (0 == default) @@ -32,7 +32,7 @@ int lrw_start( int cipher, const unsigned char *IV, const unsigned char *key, int keylen, const unsigned char *tweak, - int num_rounds, + int num_rounds, symmetric_LRW *lrw) { int err; diff --git a/src/modes/lrw/lrw_test.c b/src/modes/lrw/lrw_test.c index 2c9e076..0abde98 100644 --- a/src/modes/lrw/lrw_test.c +++ b/src/modes/lrw/lrw_test.c @@ -105,7 +105,7 @@ int lrw_test(void) } /* process block */ - if ((err = lrw_setiv(tests[x].IV, 16, &lrw)) != CRYPT_OK) { + if ((err = lrw_setiv(tests[x].IV, 16, &lrw)) != CRYPT_OK) { lrw_done(&lrw); return err; } diff --git a/src/modes/ofb/ofb_decrypt.c b/src/modes/ofb/ofb_decrypt.c index 2c8780e..b741887 100644 --- a/src/modes/ofb/ofb_decrypt.c +++ b/src/modes/ofb/ofb_decrypt.c @@ -36,7 +36,7 @@ int ofb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s #endif - + /* $Source$ */ /* $Revision$ */ diff --git a/src/modes/ofb/ofb_done.c b/src/modes/ofb/ofb_done.c index 10506b3..412b4d1 100644 --- a/src/modes/ofb/ofb_done.c +++ b/src/modes/ofb/ofb_done.c @@ -33,7 +33,7 @@ int ofb_done(symmetric_OFB *ofb) return CRYPT_OK; } - + #endif diff --git a/src/modes/ofb/ofb_encrypt.c b/src/modes/ofb/ofb_encrypt.c index 8c97a4d..f32fd39 100644 --- a/src/modes/ofb/ofb_encrypt.c +++ b/src/modes/ofb/ofb_encrypt.c @@ -34,13 +34,13 @@ int ofb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s if ((err = cipher_is_valid(ofb->cipher)) != CRYPT_OK) { return err; } - + /* is blocklen/padlen valid? */ if (ofb->blocklen < 0 || ofb->blocklen > (int)sizeof(ofb->IV) || ofb->padlen < 0 || ofb->padlen > (int)sizeof(ofb->IV)) { return CRYPT_INVALID_ARG; } - + while (len-- > 0) { if (ofb->padlen == ofb->blocklen) { if ((err = cipher_descriptor[ofb->cipher].ecb_encrypt(ofb->IV, ofb->IV, &ofb->key)) != CRYPT_OK) { diff --git a/src/modes/ofb/ofb_setiv.c b/src/modes/ofb/ofb_setiv.c index 826caa9..77a96ad 100644 --- a/src/modes/ofb/ofb_setiv.c +++ b/src/modes/ofb/ofb_setiv.c @@ -44,7 +44,7 @@ int ofb_setiv(const unsigned char *IV, unsigned long len, symmetric_OFB *ofb) return cipher_descriptor[ofb->cipher].ecb_encrypt(IV, ofb->IV, &ofb->key); } -#endif +#endif /* $Source$ */ diff --git a/src/modes/ofb/ofb_start.c b/src/modes/ofb/ofb_start.c index cf87545..f701d69 100644 --- a/src/modes/ofb/ofb_start.c +++ b/src/modes/ofb/ofb_start.c @@ -22,13 +22,13 @@ Initialize a OFB context @param cipher The index of the cipher desired @param IV The initial vector - @param key The secret key + @param key The secret key @param keylen The length of the secret key (octets) @param num_rounds Number of rounds in the cipher desired (0 for default) @param ofb The OFB state to initialize @return CRYPT_OK if successful */ -int ofb_start(int cipher, const unsigned char *IV, const unsigned char *key, +int ofb_start(int cipher, const unsigned char *IV, const unsigned char *key, int keylen, int num_rounds, symmetric_OFB *ofb) { int x, err; diff --git a/src/pk/asn1/der/bit/der_decode_bit_string.c b/src/pk/asn1/der/bit/der_decode_bit_string.c index d27af9f..05d19cb 100644 --- a/src/pk/asn1/der/bit/der_decode_bit_string.c +++ b/src/pk/asn1/der/bit/der_decode_bit_string.c @@ -67,7 +67,7 @@ int der_decode_bit_string(const unsigned char *in, unsigned long inlen, /* short format */ dlen = in[x++] & 0x7F; } - + /* is the data len too long or too short? */ if ((dlen == 0) || (dlen + x > inlen)) { return CRYPT_INVALID_PACKET; diff --git a/src/pk/asn1/der/bit/der_length_bit_string.c b/src/pk/asn1/der/bit/der_length_bit_string.c index 3ec5f58..45472e9 100644 --- a/src/pk/asn1/der/bit/der_length_bit_string.c +++ b/src/pk/asn1/der/bit/der_length_bit_string.c @@ -17,7 +17,7 @@ #ifdef LTC_DER /** - Gets length of DER encoding of BIT STRING + Gets length of DER encoding of BIT STRING @param nbits The number of bits in the string to encode @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful @@ -29,7 +29,7 @@ int der_length_bit_string(unsigned long nbits, unsigned long *outlen) /* get the number of the bytes */ nbytes = (nbits >> 3) + ((nbits & 7) ? 1 : 0) + 1; - + if (nbytes < 128) { /* 03 LL PP DD DD DD ... */ *outlen = 2 + nbytes; diff --git a/src/pk/asn1/der/boolean/der_decode_boolean.c b/src/pk/asn1/der/boolean/der_decode_boolean.c index 874622f..4e25012 100644 --- a/src/pk/asn1/der/boolean/der_decode_boolean.c +++ b/src/pk/asn1/der/boolean/der_decode_boolean.c @@ -30,13 +30,13 @@ int der_decode_boolean(const unsigned char *in, unsigned long inlen, { LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); - + if (inlen < 3 || in[0] != 0x01 || in[1] != 0x01 || (in[2] != 0x00 && in[2] != 0xFF)) { return CRYPT_INVALID_ARG; } - + *out = (in[2]==0xFF) ? 1 : 0; - + return CRYPT_OK; } diff --git a/src/pk/asn1/der/boolean/der_encode_boolean.c b/src/pk/asn1/der/boolean/der_encode_boolean.c index b40fae6..48e9090 100644 --- a/src/pk/asn1/der/boolean/der_encode_boolean.c +++ b/src/pk/asn1/der/boolean/der_encode_boolean.c @@ -25,22 +25,22 @@ @param outlen [in/out] The max size and resulting size of the DER BOOLEAN @return CRYPT_OK if successful */ -int der_encode_boolean(int in, +int der_encode_boolean(int in, unsigned char *out, unsigned long *outlen) { LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(out != NULL); - + if (*outlen < 3) { *outlen = 3; return CRYPT_BUFFER_OVERFLOW; } - + *outlen = 3; out[0] = 0x01; out[1] = 0x01; out[2] = in ? 0xFF : 0x00; - + return CRYPT_OK; } diff --git a/src/pk/asn1/der/boolean/der_length_boolean.c b/src/pk/asn1/der/boolean/der_length_boolean.c index 5437031..fa19064 100644 --- a/src/pk/asn1/der/boolean/der_length_boolean.c +++ b/src/pk/asn1/der/boolean/der_length_boolean.c @@ -17,7 +17,7 @@ #ifdef LTC_DER /** - Gets length of DER encoding of a BOOLEAN + Gets length of DER encoding of a BOOLEAN @param outlen [out] The length of the DER encoding @return CRYPT_OK if successful */ diff --git a/src/pk/asn1/der/ia5/der_decode_ia5_string.c b/src/pk/asn1/der/ia5/der_decode_ia5_string.c index 1880ada..4699e31 100644 --- a/src/pk/asn1/der/ia5/der_decode_ia5_string.c +++ b/src/pk/asn1/der/ia5/der_decode_ia5_string.c @@ -88,7 +88,7 @@ int der_decode_ia5_string(const unsigned char *in, unsigned long inlen, return CRYPT_OK; } - + #endif /* $Source$ */ diff --git a/src/pk/asn1/der/ia5/der_encode_ia5_string.c b/src/pk/asn1/der/ia5/der_encode_ia5_string.c index 6009dbc..42b3f58 100644 --- a/src/pk/asn1/der/ia5/der_encode_ia5_string.c +++ b/src/pk/asn1/der/ia5/der_encode_ia5_string.c @@ -37,7 +37,7 @@ int der_encode_ia5_string(const unsigned char *in, unsigned long inlen, /* get the size */ if ((err = der_length_ia5_string(in, inlen, &len)) != CRYPT_OK) { - return err; + return err; } /* too big? */ diff --git a/src/pk/asn1/der/ia5/der_length_ia5_string.c b/src/pk/asn1/der/ia5/der_length_ia5_string.c index f10c1b8..04debaf 100644 --- a/src/pk/asn1/der/ia5/der_length_ia5_string.c +++ b/src/pk/asn1/der/ia5/der_length_ia5_string.c @@ -21,106 +21,106 @@ static const struct { int code, value; } ia5_table[] = { { '\0', 0 }, -{ '\a', 7 }, -{ '\b', 8 }, -{ '\t', 9 }, -{ '\n', 10 }, -{ '\f', 12 }, -{ '\r', 13 }, -{ ' ', 32 }, -{ '!', 33 }, -{ '"', 34 }, -{ '#', 35 }, -{ '$', 36 }, -{ '%', 37 }, -{ '&', 38 }, -{ '\'', 39 }, -{ '(', 40 }, -{ ')', 41 }, -{ '*', 42 }, -{ '+', 43 }, -{ ',', 44 }, -{ '-', 45 }, -{ '.', 46 }, -{ '/', 47 }, -{ '0', 48 }, -{ '1', 49 }, -{ '2', 50 }, -{ '3', 51 }, -{ '4', 52 }, -{ '5', 53 }, -{ '6', 54 }, -{ '7', 55 }, -{ '8', 56 }, -{ '9', 57 }, -{ ':', 58 }, -{ ';', 59 }, -{ '<', 60 }, -{ '=', 61 }, -{ '>', 62 }, -{ '?', 63 }, -{ '@', 64 }, -{ 'A', 65 }, -{ 'B', 66 }, -{ 'C', 67 }, -{ 'D', 68 }, -{ 'E', 69 }, -{ 'F', 70 }, -{ 'G', 71 }, -{ 'H', 72 }, -{ 'I', 73 }, -{ 'J', 74 }, -{ 'K', 75 }, -{ 'L', 76 }, -{ 'M', 77 }, -{ 'N', 78 }, -{ 'O', 79 }, -{ 'P', 80 }, -{ 'Q', 81 }, -{ 'R', 82 }, -{ 'S', 83 }, -{ 'T', 84 }, -{ 'U', 85 }, -{ 'V', 86 }, -{ 'W', 87 }, -{ 'X', 88 }, -{ 'Y', 89 }, -{ 'Z', 90 }, -{ '[', 91 }, -{ '\\', 92 }, -{ ']', 93 }, -{ '^', 94 }, -{ '_', 95 }, -{ '`', 96 }, -{ 'a', 97 }, -{ 'b', 98 }, -{ 'c', 99 }, -{ 'd', 100 }, -{ 'e', 101 }, -{ 'f', 102 }, -{ 'g', 103 }, -{ 'h', 104 }, -{ 'i', 105 }, -{ 'j', 106 }, -{ 'k', 107 }, -{ 'l', 108 }, -{ 'm', 109 }, -{ 'n', 110 }, -{ 'o', 111 }, -{ 'p', 112 }, -{ 'q', 113 }, -{ 'r', 114 }, -{ 's', 115 }, -{ 't', 116 }, -{ 'u', 117 }, -{ 'v', 118 }, -{ 'w', 119 }, -{ 'x', 120 }, -{ 'y', 121 }, -{ 'z', 122 }, -{ '{', 123 }, -{ '|', 124 }, -{ '}', 125 }, +{ '\a', 7 }, +{ '\b', 8 }, +{ '\t', 9 }, +{ '\n', 10 }, +{ '\f', 12 }, +{ '\r', 13 }, +{ ' ', 32 }, +{ '!', 33 }, +{ '"', 34 }, +{ '#', 35 }, +{ '$', 36 }, +{ '%', 37 }, +{ '&', 38 }, +{ '\'', 39 }, +{ '(', 40 }, +{ ')', 41 }, +{ '*', 42 }, +{ '+', 43 }, +{ ',', 44 }, +{ '-', 45 }, +{ '.', 46 }, +{ '/', 47 }, +{ '0', 48 }, +{ '1', 49 }, +{ '2', 50 }, +{ '3', 51 }, +{ '4', 52 }, +{ '5', 53 }, +{ '6', 54 }, +{ '7', 55 }, +{ '8', 56 }, +{ '9', 57 }, +{ ':', 58 }, +{ ';', 59 }, +{ '<', 60 }, +{ '=', 61 }, +{ '>', 62 }, +{ '?', 63 }, +{ '@', 64 }, +{ 'A', 65 }, +{ 'B', 66 }, +{ 'C', 67 }, +{ 'D', 68 }, +{ 'E', 69 }, +{ 'F', 70 }, +{ 'G', 71 }, +{ 'H', 72 }, +{ 'I', 73 }, +{ 'J', 74 }, +{ 'K', 75 }, +{ 'L', 76 }, +{ 'M', 77 }, +{ 'N', 78 }, +{ 'O', 79 }, +{ 'P', 80 }, +{ 'Q', 81 }, +{ 'R', 82 }, +{ 'S', 83 }, +{ 'T', 84 }, +{ 'U', 85 }, +{ 'V', 86 }, +{ 'W', 87 }, +{ 'X', 88 }, +{ 'Y', 89 }, +{ 'Z', 90 }, +{ '[', 91 }, +{ '\\', 92 }, +{ ']', 93 }, +{ '^', 94 }, +{ '_', 95 }, +{ '`', 96 }, +{ 'a', 97 }, +{ 'b', 98 }, +{ 'c', 99 }, +{ 'd', 100 }, +{ 'e', 101 }, +{ 'f', 102 }, +{ 'g', 103 }, +{ 'h', 104 }, +{ 'i', 105 }, +{ 'j', 106 }, +{ 'k', 107 }, +{ 'l', 108 }, +{ 'm', 109 }, +{ 'n', 110 }, +{ 'o', 111 }, +{ 'p', 112 }, +{ 'q', 113 }, +{ 'r', 114 }, +{ 's', 115 }, +{ 't', 116 }, +{ 'u', 117 }, +{ 'v', 118 }, +{ 'w', 119 }, +{ 'x', 120 }, +{ 'y', 121 }, +{ 'z', 122 }, +{ '{', 123 }, +{ '|', 124 }, +{ '}', 125 }, { '~', 126 } }; @@ -145,10 +145,10 @@ int der_ia5_value_decode(int v) } return -1; } - + /** - Gets length of DER encoding of IA5 STRING - @param octets The values you want to encode + Gets length of DER encoding of IA5 STRING + @param octets The values you want to encode @param noctets The number of octets in the string to encode @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful diff --git a/src/pk/asn1/der/integer/der_decode_integer.c b/src/pk/asn1/der/integer/der_decode_integer.c index 0ed8ad7..768e28a 100644 --- a/src/pk/asn1/der/integer/der_decode_integer.c +++ b/src/pk/asn1/der/integer/der_decode_integer.c @@ -54,7 +54,7 @@ int der_decode_integer(const unsigned char *in, unsigned long inlen, void *num) if (x + z > inlen) { return CRYPT_INVALID_PACKET; } - + /* no so read it */ if ((err = mp_read_unsigned_bin(num, (unsigned char *)in + x, z)) != CRYPT_OK) { return err; @@ -62,7 +62,7 @@ int der_decode_integer(const unsigned char *in, unsigned long inlen, void *num) } else { /* long form */ z &= 0x7F; - + /* will number of length bytes overflow? (or > 4) */ if (((x + z) > inlen) || (z > 4) || (z == 0)) { return CRYPT_INVALID_PACKET; @@ -97,7 +97,7 @@ int der_decode_integer(const unsigned char *in, unsigned long inlen, void *num) return CRYPT_MEM; } mp_clear(tmp); - } + } return CRYPT_OK; diff --git a/src/pk/asn1/der/integer/der_encode_integer.c b/src/pk/asn1/der/integer/der_encode_integer.c index e80bb3c..544bfb0 100644 --- a/src/pk/asn1/der/integer/der_encode_integer.c +++ b/src/pk/asn1/der/integer/der_encode_integer.c @@ -27,7 +27,7 @@ @return CRYPT_OK if successful */ int der_encode_integer(void *num, unsigned char *out, unsigned long *outlen) -{ +{ unsigned long tmplen, y; int err, leading_zero; @@ -97,7 +97,7 @@ int der_encode_integer(void *num, unsigned char *out, unsigned long *outlen) } } else if (mp_iszero(num) != LTC_MP_YES) { void *tmp; - + /* negative */ if (mp_init(&tmp) != CRYPT_OK) { return CRYPT_MEM; @@ -119,7 +119,7 @@ int der_encode_integer(void *num, unsigned char *out, unsigned long *outlen) } /* we good */ - *outlen = tmplen; + *outlen = tmplen; return CRYPT_OK; } diff --git a/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c b/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c index b110908..47547f0 100644 --- a/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c +++ b/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c @@ -48,10 +48,10 @@ int der_decode_object_identifier(const unsigned char *in, unsigned long inle if ((in[x++] & 0x1F) != 0x06) { return CRYPT_INVALID_PACKET; } - + /* get the length */ if (in[x] < 128) { - len = in[x++]; + len = in[x++]; } else { if (in[x] < 0x81 || in[x] > 0x82) { return CRYPT_INVALID_PACKET; @@ -87,7 +87,7 @@ int der_decode_object_identifier(const unsigned char *in, unsigned long inle t = 0; } } - + *outlen = y; return CRYPT_OK; } diff --git a/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c b/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c index d9ebf8e..ccecd98 100644 --- a/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c +++ b/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c @@ -55,7 +55,7 @@ int der_encode_object_identifier(unsigned long *words, unsigned long nwords, } /* store header + length */ - x = 0; + x = 0; out[x++] = 0x06; if (z < 128) { out[x++] = (unsigned char)z; @@ -71,7 +71,7 @@ int der_encode_object_identifier(unsigned long *words, unsigned long nwords, } /* store first byte */ - wordbuf = words[0] * 40 + words[1]; + wordbuf = words[0] * 40 + words[1]; for (i = 1; i < nwords; i++) { /* store 7 bit words in little endian */ t = wordbuf & 0xFFFFFFFF; @@ -87,14 +87,14 @@ int der_encode_object_identifier(unsigned long *words, unsigned long nwords, z = x - 1; while (y < z) { t = out[y]; out[y] = out[z]; out[z] = (unsigned char)t; - ++y; + ++y; --z; } } else { /* zero word */ out[x++] = 0x00; } - + if (i < nwords - 1) { wordbuf = words[i + 1]; } diff --git a/src/pk/asn1/der/object_identifier/der_length_object_identifier.c b/src/pk/asn1/der/object_identifier/der_length_object_identifier.c index ccb1e6d..3b6826a 100644 --- a/src/pk/asn1/der/object_identifier/der_length_object_identifier.c +++ b/src/pk/asn1/der/object_identifier/der_length_object_identifier.c @@ -32,14 +32,14 @@ unsigned long der_object_identifier_bits(unsigned long x) /** Gets length of DER encoding of Object Identifier - @param nwords The number of OID words + @param nwords The number of OID words @param words The actual OID words to get the size of @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful */ int der_length_object_identifier(unsigned long *words, unsigned long nwords, unsigned long *outlen) { - unsigned long y, z, t, wordbuf; + unsigned long y, z, t, wordbuf; LTC_ARGCHK(words != NULL); LTC_ARGCHK(outlen != NULL); diff --git a/src/pk/asn1/der/octet/der_decode_octet_string.c b/src/pk/asn1/der/octet/der_decode_octet_string.c index 952d739..a656b25 100644 --- a/src/pk/asn1/der/octet/der_decode_octet_string.c +++ b/src/pk/asn1/der/octet/der_decode_octet_string.c @@ -83,7 +83,7 @@ int der_decode_octet_string(const unsigned char *in, unsigned long inlen, return CRYPT_OK; } - + #endif /* $Source$ */ diff --git a/src/pk/asn1/der/octet/der_encode_octet_string.c b/src/pk/asn1/der/octet/der_encode_octet_string.c index 9a16c3b..23d337d 100644 --- a/src/pk/asn1/der/octet/der_encode_octet_string.c +++ b/src/pk/asn1/der/octet/der_encode_octet_string.c @@ -38,7 +38,7 @@ int der_encode_octet_string(const unsigned char *in, unsigned long inlen, /* get the size */ if ((err = der_length_octet_string(inlen, &len)) != CRYPT_OK) { - return err; + return err; } /* too big? */ diff --git a/src/pk/asn1/der/octet/der_length_octet_string.c b/src/pk/asn1/der/octet/der_length_octet_string.c index 07da058..6e37ca7 100644 --- a/src/pk/asn1/der/octet/der_length_octet_string.c +++ b/src/pk/asn1/der/octet/der_length_octet_string.c @@ -17,7 +17,7 @@ #ifdef LTC_DER /** - Gets length of DER encoding of OCTET STRING + Gets length of DER encoding of OCTET STRING @param noctets The number of octets in the string to encode @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful diff --git a/src/pk/asn1/der/printable_string/der_decode_printable_string.c b/src/pk/asn1/der/printable_string/der_decode_printable_string.c index 56bf376..726387d 100644 --- a/src/pk/asn1/der/printable_string/der_decode_printable_string.c +++ b/src/pk/asn1/der/printable_string/der_decode_printable_string.c @@ -88,7 +88,7 @@ int der_decode_printable_string(const unsigned char *in, unsigned long inlen, return CRYPT_OK; } - + #endif /* $Source$ */ diff --git a/src/pk/asn1/der/printable_string/der_encode_printable_string.c b/src/pk/asn1/der/printable_string/der_encode_printable_string.c index 7d7cfd2..21fa511 100644 --- a/src/pk/asn1/der/printable_string/der_encode_printable_string.c +++ b/src/pk/asn1/der/printable_string/der_encode_printable_string.c @@ -37,7 +37,7 @@ int der_encode_printable_string(const unsigned char *in, unsigned long inlen, /* get the size */ if ((err = der_length_printable_string(in, inlen, &len)) != CRYPT_OK) { - return err; + return err; } /* too big? */ diff --git a/src/pk/asn1/der/printable_string/der_length_printable_string.c b/src/pk/asn1/der/printable_string/der_length_printable_string.c index 9f78f20..64d9608 100644 --- a/src/pk/asn1/der/printable_string/der_length_printable_string.c +++ b/src/pk/asn1/der/printable_string/der_length_printable_string.c @@ -20,80 +20,80 @@ static const struct { int code, value; } printable_table[] = { -{ ' ', 32 }, -{ '\'', 39 }, -{ '(', 40 }, -{ ')', 41 }, -{ '+', 43 }, -{ ',', 44 }, -{ '-', 45 }, -{ '.', 46 }, -{ '/', 47 }, -{ '0', 48 }, -{ '1', 49 }, -{ '2', 50 }, -{ '3', 51 }, -{ '4', 52 }, -{ '5', 53 }, -{ '6', 54 }, -{ '7', 55 }, -{ '8', 56 }, -{ '9', 57 }, -{ ':', 58 }, -{ '=', 61 }, -{ '?', 63 }, -{ 'A', 65 }, -{ 'B', 66 }, -{ 'C', 67 }, -{ 'D', 68 }, -{ 'E', 69 }, -{ 'F', 70 }, -{ 'G', 71 }, -{ 'H', 72 }, -{ 'I', 73 }, -{ 'J', 74 }, -{ 'K', 75 }, -{ 'L', 76 }, -{ 'M', 77 }, -{ 'N', 78 }, -{ 'O', 79 }, -{ 'P', 80 }, -{ 'Q', 81 }, -{ 'R', 82 }, -{ 'S', 83 }, -{ 'T', 84 }, -{ 'U', 85 }, -{ 'V', 86 }, -{ 'W', 87 }, -{ 'X', 88 }, -{ 'Y', 89 }, -{ 'Z', 90 }, -{ 'a', 97 }, -{ 'b', 98 }, -{ 'c', 99 }, -{ 'd', 100 }, -{ 'e', 101 }, -{ 'f', 102 }, -{ 'g', 103 }, -{ 'h', 104 }, -{ 'i', 105 }, -{ 'j', 106 }, -{ 'k', 107 }, -{ 'l', 108 }, -{ 'm', 109 }, -{ 'n', 110 }, -{ 'o', 111 }, -{ 'p', 112 }, -{ 'q', 113 }, -{ 'r', 114 }, -{ 's', 115 }, -{ 't', 116 }, -{ 'u', 117 }, -{ 'v', 118 }, -{ 'w', 119 }, -{ 'x', 120 }, -{ 'y', 121 }, -{ 'z', 122 }, +{ ' ', 32 }, +{ '\'', 39 }, +{ '(', 40 }, +{ ')', 41 }, +{ '+', 43 }, +{ ',', 44 }, +{ '-', 45 }, +{ '.', 46 }, +{ '/', 47 }, +{ '0', 48 }, +{ '1', 49 }, +{ '2', 50 }, +{ '3', 51 }, +{ '4', 52 }, +{ '5', 53 }, +{ '6', 54 }, +{ '7', 55 }, +{ '8', 56 }, +{ '9', 57 }, +{ ':', 58 }, +{ '=', 61 }, +{ '?', 63 }, +{ 'A', 65 }, +{ 'B', 66 }, +{ 'C', 67 }, +{ 'D', 68 }, +{ 'E', 69 }, +{ 'F', 70 }, +{ 'G', 71 }, +{ 'H', 72 }, +{ 'I', 73 }, +{ 'J', 74 }, +{ 'K', 75 }, +{ 'L', 76 }, +{ 'M', 77 }, +{ 'N', 78 }, +{ 'O', 79 }, +{ 'P', 80 }, +{ 'Q', 81 }, +{ 'R', 82 }, +{ 'S', 83 }, +{ 'T', 84 }, +{ 'U', 85 }, +{ 'V', 86 }, +{ 'W', 87 }, +{ 'X', 88 }, +{ 'Y', 89 }, +{ 'Z', 90 }, +{ 'a', 97 }, +{ 'b', 98 }, +{ 'c', 99 }, +{ 'd', 100 }, +{ 'e', 101 }, +{ 'f', 102 }, +{ 'g', 103 }, +{ 'h', 104 }, +{ 'i', 105 }, +{ 'j', 106 }, +{ 'k', 107 }, +{ 'l', 108 }, +{ 'm', 109 }, +{ 'n', 110 }, +{ 'o', 111 }, +{ 'p', 112 }, +{ 'q', 113 }, +{ 'r', 114 }, +{ 's', 115 }, +{ 't', 116 }, +{ 'u', 117 }, +{ 'v', 118 }, +{ 'w', 119 }, +{ 'x', 120 }, +{ 'y', 121 }, +{ 'z', 122 }, }; int der_printable_char_encode(int c) @@ -117,10 +117,10 @@ int der_printable_value_decode(int v) } return -1; } - + /** - Gets length of DER encoding of Printable STRING - @param octets The values you want to encode + Gets length of DER encoding of Printable STRING + @param octets The values you want to encode @param noctets The number of octets in the string to encode @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful diff --git a/src/pk/asn1/der/sequence/der_sequence_free.c b/src/pk/asn1/der/sequence/der_sequence_free.c index 77e263a..e849483 100644 --- a/src/pk/asn1/der/sequence/der_sequence_free.c +++ b/src/pk/asn1/der/sequence/der_sequence_free.c @@ -20,13 +20,13 @@ /** Free memory allocated by der_decode_sequence_flexi() @param in The list to free -*/ +*/ void der_sequence_free(ltc_asn1_list *in) { ltc_asn1_list *l; if (!in) return; - + /* walk to the start of the chain */ while (in->prev != NULL || in->parent != NULL) { if (in->parent != NULL) { @@ -35,7 +35,7 @@ void der_sequence_free(ltc_asn1_list *in) in = in->prev; } } - + /* now walk the list and free stuff */ while (in != NULL) { /* is there a child? */ @@ -44,20 +44,20 @@ void der_sequence_free(ltc_asn1_list *in) in->child->parent = NULL; der_sequence_free(in->child); } - - switch (in->type) { + + switch (in->type) { case LTC_ASN1_SET: case LTC_ASN1_SETOF: case LTC_ASN1_SEQUENCE: break; case LTC_ASN1_INTEGER : if (in->data != NULL) { mp_clear(in->data); } break; default : if (in->data != NULL) { XFREE(in->data); } } - + /* move to next and free current */ l = in->next; XFREE(in); in = l; - } + } } #endif diff --git a/src/pk/asn1/der/short_integer/der_encode_short_integer.c b/src/pk/asn1/der/short_integer/der_encode_short_integer.c index 903ceb4..7b4f527 100644 --- a/src/pk/asn1/der/short_integer/der_encode_short_integer.c +++ b/src/pk/asn1/der/short_integer/der_encode_short_integer.c @@ -26,10 +26,10 @@ @return CRYPT_OK if successful */ int der_encode_short_integer(unsigned long num, unsigned char *out, unsigned long *outlen) -{ +{ unsigned long len, x, y, z; int err; - + LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); @@ -86,7 +86,7 @@ int der_encode_short_integer(unsigned long num, unsigned char *out, unsigned lon /* we good */ *outlen = x; - + return CRYPT_OK; } diff --git a/src/pk/asn1/der/short_integer/der_length_short_integer.c b/src/pk/asn1/der/short_integer/der_length_short_integer.c index 0b8fdcf..f248e64 100644 --- a/src/pk/asn1/der/short_integer/der_length_short_integer.c +++ b/src/pk/asn1/der/short_integer/der_length_short_integer.c @@ -18,8 +18,8 @@ #ifdef LTC_DER /** - Gets length of DER encoding of num - @param num The integer to get the size of + Gets length of DER encoding of num + @param num The integer to get the size of @param outlen [out] The length of the DER encoding for the given integer @return CRYPT_OK if successful */ @@ -39,7 +39,7 @@ int der_length_short_integer(unsigned long num, unsigned long *outlen) ++z; y >>= 8; } - + /* handle zero */ if (z == 0) { z = 1; @@ -58,8 +58,8 @@ int der_length_short_integer(unsigned long num, unsigned long *outlen) len += (num&(1UL<<((z<<3) - 1))) ? 1 : 0; /* return length */ - *outlen = len; - + *outlen = len; + return CRYPT_OK; } diff --git a/src/pk/asn1/der/teletex_string/der_length_teletex_string.c b/src/pk/asn1/der/teletex_string/der_length_teletex_string.c index 85cd1a4..b5ae8b4 100644 --- a/src/pk/asn1/der/teletex_string/der_length_teletex_string.c +++ b/src/pk/asn1/der/teletex_string/der_length_teletex_string.c @@ -28,116 +28,116 @@ static const struct { { '\v', 11 }, { '\f', 12 }, { '\r', 13 }, -{ ' ', 32 }, -{ '!', 33 }, -{ '"', 34 }, -{ '%', 37 }, -{ '&', 38 }, -{ '\'', 39 }, -{ '(', 40 }, -{ ')', 41 }, -{ '+', 43 }, -{ ',', 44 }, -{ '-', 45 }, -{ '.', 46 }, -{ '/', 47 }, -{ '0', 48 }, -{ '1', 49 }, -{ '2', 50 }, -{ '3', 51 }, -{ '4', 52 }, -{ '5', 53 }, -{ '6', 54 }, -{ '7', 55 }, -{ '8', 56 }, -{ '9', 57 }, -{ ':', 58 }, -{ ';', 59 }, -{ '<', 60 }, -{ '=', 61 }, -{ '>', 62 }, -{ '?', 63 }, -{ '@', 64 }, -{ 'A', 65 }, -{ 'B', 66 }, -{ 'C', 67 }, -{ 'D', 68 }, -{ 'E', 69 }, -{ 'F', 70 }, -{ 'G', 71 }, -{ 'H', 72 }, -{ 'I', 73 }, -{ 'J', 74 }, -{ 'K', 75 }, -{ 'L', 76 }, -{ 'M', 77 }, -{ 'N', 78 }, -{ 'O', 79 }, -{ 'P', 80 }, -{ 'Q', 81 }, -{ 'R', 82 }, -{ 'S', 83 }, -{ 'T', 84 }, -{ 'U', 85 }, -{ 'V', 86 }, -{ 'W', 87 }, -{ 'X', 88 }, -{ 'Y', 89 }, -{ 'Z', 90 }, -{ '[', 91 }, -{ ']', 93 }, -{ '_', 95 }, -{ 'a', 97 }, -{ 'b', 98 }, -{ 'c', 99 }, -{ 'd', 100 }, -{ 'e', 101 }, -{ 'f', 102 }, -{ 'g', 103 }, -{ 'h', 104 }, -{ 'i', 105 }, -{ 'j', 106 }, -{ 'k', 107 }, -{ 'l', 108 }, -{ 'm', 109 }, -{ 'n', 110 }, -{ 'o', 111 }, -{ 'p', 112 }, -{ 'q', 113 }, -{ 'r', 114 }, -{ 's', 115 }, -{ 't', 116 }, -{ 'u', 117 }, -{ 'v', 118 }, -{ 'w', 119 }, -{ 'x', 120 }, -{ 'y', 121 }, -{ 'z', 122 }, -{ '|', 124 }, -{ ' ', 160 }, -{ 0xa1, 161 }, -{ 0xa2, 162 }, -{ 0xa3, 163 }, -{ '$', 164 }, -{ 0xa5, 165 }, -{ '#', 166 }, -{ 0xa7, 167 }, -{ 0xa4, 168 }, -{ 0xab, 171 }, -{ 0xb0, 176 }, -{ 0xb1, 177 }, -{ 0xb2, 178 }, -{ 0xb3, 179 }, -{ 0xd7, 180 }, -{ 0xb5, 181 }, -{ 0xb6, 182 }, -{ 0xb7, 183 }, -{ 0xf7, 184 }, -{ 0xbb, 187 }, -{ 0xbc, 188 }, -{ 0xbd, 189 }, -{ 0xbe, 190 }, -{ 0xbf, 191 }, +{ ' ', 32 }, +{ '!', 33 }, +{ '"', 34 }, +{ '%', 37 }, +{ '&', 38 }, +{ '\'', 39 }, +{ '(', 40 }, +{ ')', 41 }, +{ '+', 43 }, +{ ',', 44 }, +{ '-', 45 }, +{ '.', 46 }, +{ '/', 47 }, +{ '0', 48 }, +{ '1', 49 }, +{ '2', 50 }, +{ '3', 51 }, +{ '4', 52 }, +{ '5', 53 }, +{ '6', 54 }, +{ '7', 55 }, +{ '8', 56 }, +{ '9', 57 }, +{ ':', 58 }, +{ ';', 59 }, +{ '<', 60 }, +{ '=', 61 }, +{ '>', 62 }, +{ '?', 63 }, +{ '@', 64 }, +{ 'A', 65 }, +{ 'B', 66 }, +{ 'C', 67 }, +{ 'D', 68 }, +{ 'E', 69 }, +{ 'F', 70 }, +{ 'G', 71 }, +{ 'H', 72 }, +{ 'I', 73 }, +{ 'J', 74 }, +{ 'K', 75 }, +{ 'L', 76 }, +{ 'M', 77 }, +{ 'N', 78 }, +{ 'O', 79 }, +{ 'P', 80 }, +{ 'Q', 81 }, +{ 'R', 82 }, +{ 'S', 83 }, +{ 'T', 84 }, +{ 'U', 85 }, +{ 'V', 86 }, +{ 'W', 87 }, +{ 'X', 88 }, +{ 'Y', 89 }, +{ 'Z', 90 }, +{ '[', 91 }, +{ ']', 93 }, +{ '_', 95 }, +{ 'a', 97 }, +{ 'b', 98 }, +{ 'c', 99 }, +{ 'd', 100 }, +{ 'e', 101 }, +{ 'f', 102 }, +{ 'g', 103 }, +{ 'h', 104 }, +{ 'i', 105 }, +{ 'j', 106 }, +{ 'k', 107 }, +{ 'l', 108 }, +{ 'm', 109 }, +{ 'n', 110 }, +{ 'o', 111 }, +{ 'p', 112 }, +{ 'q', 113 }, +{ 'r', 114 }, +{ 's', 115 }, +{ 't', 116 }, +{ 'u', 117 }, +{ 'v', 118 }, +{ 'w', 119 }, +{ 'x', 120 }, +{ 'y', 121 }, +{ 'z', 122 }, +{ '|', 124 }, +{ ' ', 160 }, +{ 0xa1, 161 }, +{ 0xa2, 162 }, +{ 0xa3, 163 }, +{ '$', 164 }, +{ 0xa5, 165 }, +{ '#', 166 }, +{ 0xa7, 167 }, +{ 0xa4, 168 }, +{ 0xab, 171 }, +{ 0xb0, 176 }, +{ 0xb1, 177 }, +{ 0xb2, 178 }, +{ 0xb3, 179 }, +{ 0xd7, 180 }, +{ 0xb5, 181 }, +{ 0xb6, 182 }, +{ 0xb7, 183 }, +{ 0xf7, 184 }, +{ 0xbb, 187 }, +{ 0xbc, 188 }, +{ 0xbd, 189 }, +{ 0xbe, 190 }, +{ 0xbf, 191 }, }; int der_teletex_char_encode(int c) @@ -161,10 +161,10 @@ int der_teletex_value_decode(int v) } return -1; } - + /** - Gets length of DER encoding of teletex STRING - @param octets The values you want to encode + Gets length of DER encoding of teletex STRING + @param octets The values you want to encode @param noctets The number of octets in the string to encode @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful diff --git a/src/pk/asn1/der/utctime/der_decode_utctime.c b/src/pk/asn1/der/utctime/der_decode_utctime.c index c86bc75..ca12799 100644 --- a/src/pk/asn1/der/utctime/der_decode_utctime.c +++ b/src/pk/asn1/der/utctime/der_decode_utctime.c @@ -73,7 +73,7 @@ int der_decode_utctime(const unsigned char *in, unsigned long *inlen, *inlen = 2 + x; - /* possible encodings are + /* possible encodings are YYMMDDhhmmZ YYMMDDhhmm+hh'mm' YYMMDDhhmm-hh'mm' @@ -81,7 +81,7 @@ YYMMDDhhmmssZ YYMMDDhhmmss+hh'mm' YYMMDDhhmmss-hh'mm' - So let's do a trivial decode upto [including] mm + So let's do a trivial decode upto [including] mm */ x = 0; diff --git a/src/pk/asn1/der/utctime/der_encode_utctime.c b/src/pk/asn1/der/utctime/der_encode_utctime.c index 0dcac8a..92fffe5 100644 --- a/src/pk/asn1/der/utctime/der_encode_utctime.c +++ b/src/pk/asn1/der/utctime/der_encode_utctime.c @@ -30,12 +30,12 @@ static const char * const baseten = "0123456789"; @param outlen [in/out] The length of the DER encoding @return CRYPT_OK if successful */ -int der_encode_utctime(ltc_utctime *utctime, +int der_encode_utctime(ltc_utctime *utctime, unsigned char *out, unsigned long *outlen) { unsigned long x, tmplen; int err; - + LTC_ARGCHK(utctime != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); @@ -47,7 +47,7 @@ int der_encode_utctime(ltc_utctime *utctime, *outlen = tmplen; return CRYPT_BUFFER_OVERFLOW; } - + /* store header */ out[0] = 0x17; @@ -70,7 +70,7 @@ int der_encode_utctime(ltc_utctime *utctime, /* store length */ out[1] = (unsigned char)(x - 2); - + /* all good let's return */ *outlen = x; return CRYPT_OK; diff --git a/src/pk/asn1/der/utf8/der_decode_utf8_string.c b/src/pk/asn1/der/utf8/der_decode_utf8_string.c index d9cbdaf..d67362a 100644 --- a/src/pk/asn1/der/utf8/der_decode_utf8_string.c +++ b/src/pk/asn1/der/utf8/der_decode_utf8_string.c @@ -73,10 +73,10 @@ int der_decode_utf8_string(const unsigned char *in, unsigned long inlen, for (y = 0; x < inlen; ) { /* get first byte */ tmp = in[x++]; - + /* count number of bytes */ for (z = 0; (tmp & 0x80) && (z <= 4); z++, tmp = (tmp << 1) & 0xFF); - + if (z > 4 || (x + (z - 1) > inlen)) { return CRYPT_INVALID_PACKET; } @@ -103,7 +103,7 @@ int der_decode_utf8_string(const unsigned char *in, unsigned long inlen, return CRYPT_OK; } - + #endif /* $Source$ */ diff --git a/src/pk/asn1/der/utf8/der_length_utf8_string.c b/src/pk/asn1/der/utf8/der_length_utf8_string.c index 3321f94..2ce2ca4 100644 --- a/src/pk/asn1/der/utf8/der_length_utf8_string.c +++ b/src/pk/asn1/der/utf8/der_length_utf8_string.c @@ -35,7 +35,7 @@ unsigned long der_utf8_charsize(const wchar_t c) } /** - Gets length of DER encoding of UTF8 STRING + Gets length of DER encoding of UTF8 STRING @param in The characters to measure the length of @param noctets The number of octets in the string to encode @param outlen [out] The length of the DER encoding for the given string diff --git a/src/pk/dsa/dsa_decrypt_key.c b/src/pk/dsa/dsa_decrypt_key.c index c622c78..f971e6e 100644 --- a/src/pk/dsa/dsa_decrypt_key.c +++ b/src/pk/dsa/dsa_decrypt_key.c @@ -13,7 +13,7 @@ /** @file dsa_decrypt_key.c DSA Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MDSA @@ -27,7 +27,7 @@ @return CRYPT_OK if successful */ int dsa_decrypt_key(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen, + unsigned char *out, unsigned long *outlen, dsa_key *key) { unsigned char *skey, *expt; @@ -45,21 +45,21 @@ int dsa_decrypt_key(const unsigned char *in, unsigned long inlen, if (key->type != PK_PRIVATE) { return CRYPT_PK_NOT_PRIVATE; } - + /* decode to find out hash */ LTC_SET_ASN1(decode, 0, LTC_ASN1_OBJECT_IDENTIFIER, hashOID, sizeof(hashOID)/sizeof(hashOID[0])); - + if ((err = der_decode_sequence(in, inlen, decode, 1)) != CRYPT_OK) { return err; } - hash = find_hash_oid(hashOID, decode[0].size); + hash = find_hash_oid(hashOID, decode[0].size); if (hash_is_valid(hash) != CRYPT_OK) { return CRYPT_INVALID_PACKET; } /* we now have the hash! */ - + if ((err = mp_init(&g_pub)) != CRYPT_OK) { return err; } @@ -77,7 +77,7 @@ int dsa_decrypt_key(const unsigned char *in, unsigned long inlen, mp_clear(g_pub); return CRYPT_MEM; } - + LTC_SET_ASN1(decode, 1, LTC_ASN1_INTEGER, g_pub, 1UL); LTC_SET_ASN1(decode, 2, LTC_ASN1_OCTET_STRING, skey, MAXBLOCKSIZE); @@ -125,7 +125,7 @@ LBL_ERR: XFREE(expt); XFREE(skey); - + mp_clear(g_pub); return err; diff --git a/src/pk/dsa/dsa_encrypt_key.c b/src/pk/dsa/dsa_encrypt_key.c index 92be479..a7e9ed2 100644 --- a/src/pk/dsa/dsa_encrypt_key.c +++ b/src/pk/dsa/dsa_encrypt_key.c @@ -13,7 +13,7 @@ /** @file dsa_encrypt_key.c DSA Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MDSA @@ -24,14 +24,14 @@ @param out [out] The destination for the ciphertext @param outlen [in/out] The max size and resulting size of the ciphertext @param prng An active PRNG state - @param wprng The index of the PRNG you wish to use - @param hash The index of the hash you want to use + @param wprng The index of the PRNG you wish to use + @param hash The index of the hash you want to use @param key The DSA key you want to encrypt to @return CRYPT_OK if successful */ int dsa_encrypt_key(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen, - prng_state *prng, int wprng, int hash, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, int hash, dsa_key *key) { unsigned char *expt, *skey; @@ -61,7 +61,7 @@ int dsa_encrypt_key(const unsigned char *in, unsigned long inlen, if ((err = mp_init_multi(&g_pub, &g_priv, NULL)) != CRYPT_OK) { return err; } - + expt = XMALLOC(mp_unsigned_bin_size(key->p) + 1); skey = XMALLOC(MAXBLOCKSIZE); if (expt == NULL || skey == NULL) { @@ -74,7 +74,7 @@ int dsa_encrypt_key(const unsigned char *in, unsigned long inlen, mp_clear_multi(g_pub, g_priv, NULL); return CRYPT_MEM; } - + /* make a random g_priv, g_pub = g^x pair */ qbits = mp_count_bits(key->q); do { @@ -88,7 +88,7 @@ int dsa_encrypt_key(const unsigned char *in, unsigned long inlen, if ((err = mp_exptmod(key->g, g_priv, key->p, g_pub)) != CRYPT_OK) { goto LBL_ERR; } - + /* make random key */ x = mp_unsigned_bin_size(key->p) + 1; if ((err = dsa_shared_secret(g_priv, key->y, key, expt, &x)) != CRYPT_OK) { @@ -99,7 +99,7 @@ int dsa_encrypt_key(const unsigned char *in, unsigned long inlen, if ((err = hash_memory(hash, expt, x, skey, &y)) != CRYPT_OK) { goto LBL_ERR; } - + /* Encrypt key */ for (x = 0; x < inlen; x++) { skey[x] ^= in[x]; @@ -120,7 +120,7 @@ LBL_ERR: XFREE(skey); XFREE(expt); - + mp_clear_multi(g_pub, g_priv, NULL); return err; } diff --git a/src/pk/dsa/dsa_shared_secret.c b/src/pk/dsa/dsa_shared_secret.c index 5adaa5f..8ae9d4d 100644 --- a/src/pk/dsa/dsa_shared_secret.c +++ b/src/pk/dsa/dsa_shared_secret.c @@ -13,14 +13,14 @@ /** @file dsa_shared_secret.c DSA Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MDSA /** Create a DSA shared secret between two keys @param private_key The private DSA key (the exponent) - @param base The base of the exponentiation (allows this to be used for both encrypt and decrypt) + @param base The base of the exponentiation (allows this to be used for both encrypt and decrypt) @param public_key The public key @param out [out] Destination of the shared secret @param outlen [in/out] The max size and resulting size of the shared secret @@ -48,7 +48,7 @@ int dsa_shared_secret(void *private_key, void *base, mp_clear(res); return err; } - + x = (unsigned long)mp_unsigned_bin_size(res); if (*outlen < x) { *outlen = x; diff --git a/src/pk/dsa/dsa_sign_hash.c b/src/pk/dsa/dsa_sign_hash.c index 4d131b4..c9da8cf 100644 --- a/src/pk/dsa/dsa_sign_hash.c +++ b/src/pk/dsa/dsa_sign_hash.c @@ -96,7 +96,7 @@ retry: if (mp_iszero(s) == LTC_MP_YES) { goto retry; } err = CRYPT_OK; -error: +error: mp_clear_multi(k, kinv, tmp, NULL); ERRBUF: #ifdef LTC_CLEAN_STACK @@ -137,9 +137,9 @@ int dsa_sign_hash(const unsigned char *in, unsigned long inlen, goto error; } - err = der_encode_sequence_multi(out, outlen, - LTC_ASN1_INTEGER, 1UL, r, - LTC_ASN1_INTEGER, 1UL, s, + err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_INTEGER, 1UL, r, + LTC_ASN1_INTEGER, 1UL, s, LTC_ASN1_EOL, 0UL, NULL); error: diff --git a/src/pk/dsa/dsa_verify_hash.c b/src/pk/dsa/dsa_verify_hash.c index 6188164..d247391 100644 --- a/src/pk/dsa/dsa_verify_hash.c +++ b/src/pk/dsa/dsa_verify_hash.c @@ -29,7 +29,7 @@ @return CRYPT_OK if successful (even if the signature is invalid) */ int dsa_verify_hash_raw( void *r, void *s, - const unsigned char *hash, unsigned long hashlen, + const unsigned char *hash, unsigned long hashlen, int *stat, dsa_key *key) { void *w, *v, *u1, *u2; @@ -53,7 +53,7 @@ int dsa_verify_hash_raw( void *r, void *s, err = CRYPT_INVALID_PACKET; goto error; } - + /* FIPS 186-4 4.7: use leftmost min(bitlen(q), bitlen(hash)) bits of 'hash' */ hashlen = MIN(hashlen, (unsigned long)(key->qord)); @@ -65,7 +65,7 @@ int dsa_verify_hash_raw( void *r, void *s, if ((err = mp_mulmod(u1, w, key->q, u1)) != CRYPT_OK) { goto error; } /* u2 = r*w mod q */ - if ((err = mp_mulmod(r, w, key->q, u2)) != CRYPT_OK) { goto error; } + if ((err = mp_mulmod(r, w, key->q, u2)) != CRYPT_OK) { goto error; } /* v = g^u1 * y^u2 mod p mod q */ if ((err = mp_exptmod(key->g, u1, key->p, u1)) != CRYPT_OK) { goto error; } @@ -95,7 +95,7 @@ error: @return CRYPT_OK if successful (even if the signature is invalid) */ int dsa_verify_hash(const unsigned char *sig, unsigned long siglen, - const unsigned char *hash, unsigned long hashlen, + const unsigned char *hash, unsigned long hashlen, int *stat, dsa_key *key) { int err; @@ -107,8 +107,8 @@ int dsa_verify_hash(const unsigned char *sig, unsigned long siglen, /* decode the sequence */ if ((err = der_decode_sequence_multi(sig, siglen, - LTC_ASN1_INTEGER, 1UL, r, - LTC_ASN1_INTEGER, 1UL, s, + LTC_ASN1_INTEGER, 1UL, r, + LTC_ASN1_INTEGER, 1UL, s, LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { goto LBL_ERR; } diff --git a/src/pk/dsa/dsa_verify_key.c b/src/pk/dsa/dsa_verify_key.c index fa839ef..5afdb3b 100644 --- a/src/pk/dsa/dsa_verify_key.c +++ b/src/pk/dsa/dsa_verify_key.c @@ -89,7 +89,7 @@ int dsa_verify_key(dsa_key *key, int *stat) /* at this point we are out of tests ;-( */ err = CRYPT_OK; *stat = 1; -error: +error: mp_clear_multi(tmp, tmp2, NULL); return err; } diff --git a/src/pk/ecc/ecc_ansi_x963_import.c b/src/pk/ecc/ecc_ansi_x963_import.c index ec34245..3c70dc8 100644 --- a/src/pk/ecc/ecc_ansi_x963_import.c +++ b/src/pk/ecc/ecc_ansi_x963_import.c @@ -19,11 +19,11 @@ /** @file ecc_ansi_x963_import.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC -/** Import an ANSI X9.63 format public key +/** Import an ANSI X9.63 format public key @param in The input data to read @param inlen The length of the input data @param key [out] destination to store imported key \ @@ -36,10 +36,10 @@ int ecc_ansi_x963_import(const unsigned char *in, unsigned long inlen, ecc_key * int ecc_ansi_x963_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, ltc_ecc_set_type *dp) { int x, err; - + LTC_ARGCHK(in != NULL); LTC_ARGCHK(key != NULL); - + /* must be odd */ if ((inlen & 1) == 0) { return CRYPT_INVALID_ARG; diff --git a/src/pk/ecc/ecc_decrypt_key.c b/src/pk/ecc/ecc_decrypt_key.c index 6e09e61..1d29291 100644 --- a/src/pk/ecc/ecc_decrypt_key.c +++ b/src/pk/ecc/ecc_decrypt_key.c @@ -19,7 +19,7 @@ /** @file ecc_decrypt_key.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC @@ -33,7 +33,7 @@ @return CRYPT_OK if successful */ int ecc_decrypt_key(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen, + unsigned char *out, unsigned long *outlen, ecc_key *key) { unsigned char *ecc_shared, *skey, *pub_expt; @@ -51,15 +51,15 @@ int ecc_decrypt_key(const unsigned char *in, unsigned long inlen, if (key->type != PK_PRIVATE) { return CRYPT_PK_NOT_PRIVATE; } - + /* decode to find out hash */ LTC_SET_ASN1(decode, 0, LTC_ASN1_OBJECT_IDENTIFIER, hashOID, sizeof(hashOID)/sizeof(hashOID[0])); - + if ((err = der_decode_sequence(in, inlen, decode, 1)) != CRYPT_OK) { return err; } - hash = find_hash_oid(hashOID, decode[0].size); + hash = find_hash_oid(hashOID, decode[0].size); if (hash_is_valid(hash) != CRYPT_OK) { return CRYPT_INVALID_PACKET; } diff --git a/src/pk/ecc/ecc_encrypt_key.c b/src/pk/ecc/ecc_encrypt_key.c index a74d50f..b46986b 100644 --- a/src/pk/ecc/ecc_encrypt_key.c +++ b/src/pk/ecc/ecc_encrypt_key.c @@ -19,25 +19,25 @@ /** @file ecc_encrypt_key.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC /** - Encrypt a symmetric key with ECC + Encrypt a symmetric key with ECC @param in The symmetric key you want to encrypt @param inlen The length of the key to encrypt (octets) @param out [out] The destination for the ciphertext @param outlen [in/out] The max size and resulting size of the ciphertext @param prng An active PRNG state - @param wprng The index of the PRNG you wish to use - @param hash The index of the hash you want to use + @param wprng The index of the PRNG you wish to use + @param hash The index of the hash you want to use @param key The ECC key you want to encrypt to @return CRYPT_OK if successful */ int ecc_encrypt_key(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen, - prng_state *prng, int wprng, int hash, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, int hash, ecc_key *key) { unsigned char *pub_expt, *ecc_shared, *skey; @@ -90,7 +90,7 @@ int ecc_encrypt_key(const unsigned char *in, unsigned long inlen, ecc_free(&pubkey); goto LBL_ERR; } - + /* make random key */ x = ECC_BUF_SIZE; if ((err = ecc_shared_secret(&pubkey, key, ecc_shared, &x)) != CRYPT_OK) { @@ -102,7 +102,7 @@ int ecc_encrypt_key(const unsigned char *in, unsigned long inlen, if ((err = hash_memory(hash, ecc_shared, x, skey, &y)) != CRYPT_OK) { goto LBL_ERR; } - + /* Encrypt key */ for (x = 0; x < inlen; x++) { skey[x] ^= in[x]; diff --git a/src/pk/ecc/ecc_export.c b/src/pk/ecc/ecc_export.c index b6c3485..51c9bf2 100644 --- a/src/pk/ecc/ecc_export.c +++ b/src/pk/ecc/ecc_export.c @@ -19,7 +19,7 @@ /** @file ecc_export.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC @@ -40,7 +40,7 @@ int ecc_export(unsigned char *out, unsigned long *outlen, int type, ecc_key *key LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(key != NULL); - + /* type valid? */ if (key->type != PK_PRIVATE && type == PK_PRIVATE) { return CRYPT_PK_TYPE_MISMATCH; diff --git a/src/pk/ecc/ecc_free.c b/src/pk/ecc/ecc_free.c index c9e5d6c..8e8455b 100644 --- a/src/pk/ecc/ecc_free.c +++ b/src/pk/ecc/ecc_free.c @@ -19,7 +19,7 @@ /** @file ecc_free.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC diff --git a/src/pk/ecc/ecc_get_size.c b/src/pk/ecc/ecc_get_size.c index a824aa4..b01b813 100644 --- a/src/pk/ecc/ecc_get_size.c +++ b/src/pk/ecc/ecc_get_size.c @@ -19,13 +19,13 @@ /** @file ecc_get_size.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC /** Get the size of an ECC key - @param key The key to get the size of + @param key The key to get the size of @return The size (octets) of the key or INT_MAX on error */ int ecc_get_size(ecc_key *key) diff --git a/src/pk/ecc/ecc_import.c b/src/pk/ecc/ecc_import.c index efb1d70..9ee97a1 100644 --- a/src/pk/ecc/ecc_import.c +++ b/src/pk/ecc/ecc_import.c @@ -19,7 +19,7 @@ /** @file ecc_import.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC @@ -27,26 +27,26 @@ static int is_point(ecc_key *key) { void *prime, *b, *t1, *t2; int err; - + if ((err = mp_init_multi(&prime, &b, &t1, &t2, NULL)) != CRYPT_OK) { return err; } - + /* load prime and b */ if ((err = mp_read_radix(prime, key->dp->prime, 16)) != CRYPT_OK) { goto error; } if ((err = mp_read_radix(b, key->dp->B, 16)) != CRYPT_OK) { goto error; } - + /* compute y^2 */ if ((err = mp_sqr(key->pubkey.y, t1)) != CRYPT_OK) { goto error; } - + /* compute x^3 */ if ((err = mp_sqr(key->pubkey.x, t2)) != CRYPT_OK) { goto error; } if ((err = mp_mod(t2, prime, t2)) != CRYPT_OK) { goto error; } if ((err = mp_mul(key->pubkey.x, t2, t2)) != CRYPT_OK) { goto error; } - + /* compute y^2 - x^3 */ if ((err = mp_sub(t1, t2, t1)) != CRYPT_OK) { goto error; } - + /* compute y^2 - x^3 + 3x */ if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } @@ -58,14 +58,14 @@ static int is_point(ecc_key *key) while (mp_cmp(t1, prime) != LTC_MP_LT) { if ((err = mp_sub(t1, prime, t1)) != CRYPT_OK) { goto error; } } - + /* compare to b */ if (mp_cmp(t1, b) != LTC_MP_EQ) { err = CRYPT_INVALID_PACKET; } else { err = CRYPT_OK; } - + error: mp_clear_multi(prime, b, t1, t2, NULL); return err; @@ -153,7 +153,7 @@ int ecc_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, co } /* set z */ if ((err = mp_set(key->pubkey.z, 1)) != CRYPT_OK) { goto done; } - + /* is it a point on the curve? */ if ((err = is_point(key)) != CRYPT_OK) { goto done; diff --git a/src/pk/ecc/ecc_make_key.c b/src/pk/ecc/ecc_make_key.c index 9bbeb44..7dc44f9 100644 --- a/src/pk/ecc/ecc_make_key.c +++ b/src/pk/ecc/ecc_make_key.c @@ -19,12 +19,12 @@ /** @file ecc_make_key.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC /** - Make a new ECC key + Make a new ECC key @param prng An active PRNG state @param wprng The index of the PRNG you wish to use @param keysize The keysize for the new key (in octets from 20 to 65 bytes) diff --git a/src/pk/ecc/ecc_shared_secret.c b/src/pk/ecc/ecc_shared_secret.c index 5aece5e..5215fc9 100644 --- a/src/pk/ecc/ecc_shared_secret.c +++ b/src/pk/ecc/ecc_shared_secret.c @@ -19,7 +19,7 @@ /** @file ecc_shared_secret.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC diff --git a/src/pk/ecc/ecc_sign_hash.c b/src/pk/ecc/ecc_sign_hash.c index 5975781..4b8d4b2 100644 --- a/src/pk/ecc/ecc_sign_hash.c +++ b/src/pk/ecc/ecc_sign_hash.c @@ -19,7 +19,7 @@ /** @file ecc_sign_hash.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC @@ -51,12 +51,12 @@ int ecc_sign_hash_raw(const unsigned char *in, unsigned long inlen, if (key->type != PK_PRIVATE) { return CRYPT_PK_NOT_PRIVATE; } - + /* is the IDX valid ? */ if (ltc_ecc_is_valid_idx(key->idx) != 1) { return CRYPT_PK_INVALID_TYPE; } - + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { return err; } @@ -80,7 +80,7 @@ int ecc_sign_hash_raw(const unsigned char *in, unsigned long inlen, if (mp_iszero(r) == LTC_MP_YES) { ecc_free(&pubkey); - } else { + } else { /* find s = (e + xr)/k */ if ((err = mp_invmod(pubkey.k, p, pubkey.k)) != CRYPT_OK) { goto error; } /* k = 1/k */ if ((err = mp_mulmod(key->k, r, p, s)) != CRYPT_OK) { goto error; } /* s = xr */ @@ -143,7 +143,7 @@ int ecc_sign_hash(const unsigned char *in, unsigned long inlen, error: mp_clear_multi(r, s, NULL); - return err; + return err; } #endif diff --git a/src/pk/ecc/ecc_sizes.c b/src/pk/ecc/ecc_sizes.c index b02a9f9..eb3a377 100644 --- a/src/pk/ecc/ecc_sizes.c +++ b/src/pk/ecc/ecc_sizes.c @@ -19,7 +19,7 @@ /** @file ecc_sizes.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC diff --git a/src/pk/ecc/ecc_verify_hash.c b/src/pk/ecc/ecc_verify_hash.c index afa7f39..cd9f65a 100644 --- a/src/pk/ecc/ecc_verify_hash.c +++ b/src/pk/ecc/ecc_verify_hash.c @@ -19,14 +19,14 @@ /** @file ecc_verify_hash.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC -/* verify +/* verify * * w = s^-1 mod n - * u1 = xw + * u1 = xw * u2 = rw * X = u1*G + u2*Q * v = X_x1 mod n @@ -117,13 +117,13 @@ int ecc_verify_hash_raw( void *r, void *s, if (ltc_mp.ecc_mul2add == NULL) { if ((err = ltc_mp.ecc_ptmul(u1, mG, mG, m, 0)) != CRYPT_OK) { goto error; } if ((err = ltc_mp.ecc_ptmul(u2, mQ, mQ, m, 0)) != CRYPT_OK) { goto error; } - + /* find the montgomery mp */ if ((err = mp_montgomery_setup(m, &mp)) != CRYPT_OK) { goto error; } /* add them */ if ((err = ltc_mp.ecc_ptadd(mQ, mG, mG, m, mp)) != CRYPT_OK) { goto error; } - + /* reduce */ if ((err = ltc_mp.ecc_map(mG, m, mp)) != CRYPT_OK) { goto error; } } else { @@ -145,7 +145,7 @@ error: ltc_ecc_del_point(mG); ltc_ecc_del_point(mQ); mp_clear_multi(v, w, u1, u2, p, e, m, NULL); - if (mp != NULL) { + if (mp != NULL) { mp_montgomery_free(mp); } return err; diff --git a/src/pk/ecc/ltc_ecc_is_valid_idx.c b/src/pk/ecc/ltc_ecc_is_valid_idx.c index 4a02068..2e9d8f2 100644 --- a/src/pk/ecc/ltc_ecc_is_valid_idx.c +++ b/src/pk/ecc/ltc_ecc_is_valid_idx.c @@ -19,14 +19,14 @@ /** @file ltc_ecc_is_valid_idx.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC /** Returns whether an ECC idx is valid or not @param n The idx number to check @return 1 if valid, 0 if not -*/ +*/ int ltc_ecc_is_valid_idx(int n) { int x; diff --git a/src/pk/ecc/ltc_ecc_map.c b/src/pk/ecc/ltc_ecc_map.c index 4f3ec09..c6ec9b5 100644 --- a/src/pk/ecc/ltc_ecc_map.c +++ b/src/pk/ecc/ltc_ecc_map.c @@ -19,7 +19,7 @@ /** @file ltc_ecc_map.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC @@ -48,7 +48,7 @@ int ltc_ecc_map(ecc_point *P, void *modulus, void *mp) /* get 1/z */ if ((err = mp_invmod(P->z, modulus, t1)) != CRYPT_OK) { goto done; } - + /* get 1/z^2 and 1/z^3 */ if ((err = mp_sqr(t1, t2)) != CRYPT_OK) { goto done; } if ((err = mp_mod(t2, modulus, t2)) != CRYPT_OK) { goto done; } diff --git a/src/pk/ecc/ltc_ecc_mul2add.c b/src/pk/ecc/ltc_ecc_mul2add.c index 8b59320..73e8217 100644 --- a/src/pk/ecc/ltc_ecc_mul2add.c +++ b/src/pk/ecc/ltc_ecc_mul2add.c @@ -19,7 +19,7 @@ /** @file ltc_ecc_mul2add.c ECC Crypto, Shamir's Trick, Tom St Denis -*/ +*/ #ifdef LTC_MECC @@ -31,9 +31,9 @@ @param B Second point to multiply @param kB What to multiple B by @param C [out] Destination point (can overlap with A or B - @param modulus Modulus for curve + @param modulus Modulus for curve @return CRYPT_OK on success -*/ +*/ int ltc_ecc_mul2add(ecc_point *A, void *kA, ecc_point *B, void *kB, ecc_point *C, @@ -44,7 +44,7 @@ int ltc_ecc_mul2add(ecc_point *A, void *kA, unsigned char *tA, *tB; int err, first; void *mp, *mu; - + /* argchks */ LTC_ARGCHK(A != NULL); LTC_ARGCHK(B != NULL); @@ -126,7 +126,7 @@ int ltc_ecc_mul2add(ecc_point *A, void *kA, for (y = 1; y < 4; y++) { if ((err = ltc_mp.ecc_ptadd(precomp[x], precomp[(y<<2)], precomp[x+(y<<2)], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } } - } + } nibble = 3; first = 1; @@ -147,8 +147,8 @@ int ltc_ecc_mul2add(ecc_point *A, void *kA, /* extract two bits from both, shift/update */ nA = (bitbufA >> 6) & 0x03; nB = (bitbufB >> 6) & 0x03; - bitbufA = (bitbufA << 2) & 0xFF; - bitbufB = (bitbufB << 2) & 0xFF; + bitbufA = (bitbufA << 2) & 0xFF; + bitbufB = (bitbufB << 2) & 0xFF; /* if both zero, if first, continue */ if ((nA == 0) && (nB == 0) && (first == 1)) { diff --git a/src/pk/ecc/ltc_ecc_points.c b/src/pk/ecc/ltc_ecc_points.c index 9be9eff..df38c19 100644 --- a/src/pk/ecc/ltc_ecc_points.c +++ b/src/pk/ecc/ltc_ecc_points.c @@ -19,13 +19,13 @@ /** @file ltc_ecc_points.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC /** Allocate a new ECC point - @return A newly allocated point or NULL on error + @return A newly allocated point or NULL on error */ ecc_point *ltc_ecc_new_point(void) { diff --git a/src/pk/katja/katja_free.c b/src/pk/katja/katja_free.c index 767486a..4f0b698 100644 --- a/src/pk/katja/katja_free.c +++ b/src/pk/katja/katja_free.c @@ -13,7 +13,7 @@ /** @file katja_free.c Free an Katja key, Tom St Denis -*/ +*/ #ifdef LTC_MKAT diff --git a/src/pk/katja/katja_make_key.c b/src/pk/katja/katja_make_key.c index 86b4c1a..d592eac 100644 --- a/src/pk/katja/katja_make_key.c +++ b/src/pk/katja/katja_make_key.c @@ -13,11 +13,11 @@ /** @file katja_make_key.c Katja key generation, Tom St Denis -*/ +*/ #ifdef LTC_MKAT -/** +/** Create a Katja key @param prng An active PRNG state @param wprng The index of the PRNG desired @@ -29,7 +29,7 @@ int katja_make_key(prng_state *prng, int wprng, int size, katja_key *key) { void *p, *q, *tmp1, *tmp2; int err; - + LTC_ARGCHK(key != NULL); LTC_ARGCHK(ltc_mp.name != NULL); @@ -68,7 +68,7 @@ int katja_make_key(prng_state *prng, int wprng, int size, katja_key *key) if ((err = mp_copy( p, key->p)) != CRYPT_OK) { goto error2; } if ((err = mp_copy( q, key->q)) != CRYPT_OK) { goto error2; } if ((err = mp_mul(key->p, key->q, key->pq)) != CRYPT_OK) { goto error2; } /* tmp1 = pq */ - if ((err = mp_mul(key->pq, key->p, key->N)) != CRYPT_OK) { goto error2; } /* N = p^2q */ + if ((err = mp_mul(key->pq, key->p, key->N)) != CRYPT_OK) { goto error2; } /* N = p^2q */ if ((err = mp_sub_d( p, 1, tmp1)) != CRYPT_OK) { goto error2; } /* tmp1 = q-1 */ if ((err = mp_sub_d( q, 1, tmp2)) != CRYPT_OK) { goto error2; } /* tmp2 = p-1 */ if ((err = mp_lcm(tmp1, tmp2, key->d)) != CRYPT_OK) { goto error2; } /* tmp1 = lcd(p-1,q-1) */ diff --git a/src/pk/pkcs1/pkcs_1_os2ip.c b/src/pk/pkcs1/pkcs_1_os2ip.c index 2df7574..5fe97ea 100644 --- a/src/pk/pkcs1/pkcs_1_os2ip.c +++ b/src/pk/pkcs1/pkcs_1_os2ip.c @@ -10,9 +10,9 @@ */ #include "tomcrypt.h" -/** +/** @file pkcs_1_os2ip.c - Octet to Integer OS2IP, Tom St Denis + Octet to Integer OS2IP, Tom St Denis */ #ifdef LTC_PKCS_1 diff --git a/src/pk/rsa/rsa_free.c b/src/pk/rsa/rsa_free.c index bb6daef..702116a 100644 --- a/src/pk/rsa/rsa_free.c +++ b/src/pk/rsa/rsa_free.c @@ -13,7 +13,7 @@ /** @file rsa_free.c Free an RSA key, Tom St Denis -*/ +*/ #ifdef LTC_MRSA diff --git a/src/pk/rsa/rsa_sign_hash.c b/src/pk/rsa/rsa_sign_hash.c index f66b9f4..46d5c9f 100644 --- a/src/pk/rsa/rsa_sign_hash.c +++ b/src/pk/rsa/rsa_sign_hash.c @@ -88,12 +88,12 @@ int rsa_sign_hash_ex(const unsigned char *in, unsigned long inlen, return CRYPT_INVALID_ARG; } - /* construct the SEQUENCE + /* construct the SEQUENCE SEQUENCE { SEQUENCE {hashoid OID blah NULL } - hash OCTET STRING + hash OCTET STRING } */ LTC_SET_ASN1(digestinfo, 0, LTC_ASN1_OBJECT_IDENTIFIER, hash_descriptor[hash_idx].OID, hash_descriptor[hash_idx].OIDlen); diff --git a/src/prngs/fortuna.c b/src/prngs/fortuna.c index 51a1c7d..173deea 100644 --- a/src/prngs/fortuna.c +++ b/src/prngs/fortuna.c @@ -14,14 +14,14 @@ @file fortuna.c Fortuna PRNG, Tom St Denis */ - -/* Implementation of Fortuna by Tom St Denis + +/* Implementation of Fortuna by Tom St Denis We deviate slightly here for reasons of simplicity [and to fit in the API]. First all "sources" -in the AddEntropy function are fixed to 0. Second since no reliable timer is provided +in the AddEntropy function are fixed to 0. Second since no reliable timer is provided we reseed automatically when len(pool0) >= 64 or every LTC_FORTUNA_WD calls to the read function */ -#ifdef LTC_FORTUNA +#ifdef LTC_FORTUNA /* requries LTC_SHA256 and AES */ #if !(defined(LTC_RIJNDAEL) && defined(LTC_SHA256)) @@ -79,11 +79,11 @@ static int fortuna_reseed(prng_state *prng) } for (x = 0; x < LTC_FORTUNA_POOLS; x++) { - if (x == 0 || ((prng->fortuna.reset_cnt >> (x-1)) & 1) == 0) { + if (x == 0 || ((prng->fortuna.reset_cnt >> (x-1)) & 1) == 0) { /* terminate this hash */ if ((err = sha256_done(&prng->fortuna.pool[x], tmp)) != CRYPT_OK) { sha256_done(&md, tmp); - return err; + return err; } /* add it to the string */ if ((err = sha256_process(&md, tmp, 32)) != CRYPT_OK) { @@ -102,7 +102,7 @@ static int fortuna_reseed(prng_state *prng) /* finish key */ if ((err = sha256_done(&md, prng->fortuna.K)) != CRYPT_OK) { - return err; + return err; } if ((err = rijndael_setup(prng->fortuna.K, 32, 0, &prng->fortuna.skey)) != CRYPT_OK) { return err; @@ -126,14 +126,14 @@ static int fortuna_reseed(prng_state *prng) Start the PRNG @param prng [out] The PRNG state to initialize @return CRYPT_OK if successful -*/ +*/ int fortuna_start(prng_state *prng) { int err, x, y; unsigned char tmp[MAXBLOCKSIZE]; LTC_ARGCHK(prng != NULL); - + /* initialize the pools */ for (x = 0; x < LTC_FORTUNA_POOLS; x++) { if ((err = sha256_init(&prng->fortuna.pool[x])) != CRYPT_OK) { @@ -155,9 +155,9 @@ int fortuna_start(prng_state *prng) return err; } zeromem(prng->fortuna.IV, 16); - + LTC_MUTEX_INIT(&prng->fortuna.prng_lock) - + return CRYPT_OK; } @@ -167,7 +167,7 @@ int fortuna_start(prng_state *prng) @param inlen Length of the data to add @param prng PRNG state to update @return CRYPT_OK if successful -*/ +*/ int fortuna_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) { unsigned char tmp[2]; @@ -210,7 +210,7 @@ int fortuna_add_entropy(const unsigned char *in, unsigned long inlen, prng_state Make the PRNG ready to read from @param prng The PRNG to make active @return CRYPT_OK if successful -*/ +*/ int fortuna_ready(prng_state *prng) { return fortuna_reseed(prng); @@ -222,7 +222,7 @@ int fortuna_ready(prng_state *prng) @param outlen Length of output @param prng The active PRNG to read from @return Number of octets read -*/ +*/ unsigned long fortuna_read(unsigned char *out, unsigned long outlen, prng_state *prng) { unsigned char tmp[16]; @@ -259,14 +259,14 @@ unsigned long fortuna_read(unsigned char *out, unsigned long outlen, prng_state XMEMCPY(out, tmp, outlen); fortuna_update_iv(prng); } - + /* generate new key */ - rijndael_ecb_encrypt(prng->fortuna.IV, prng->fortuna.K , &prng->fortuna.skey); + rijndael_ecb_encrypt(prng->fortuna.IV, prng->fortuna.K , &prng->fortuna.skey); fortuna_update_iv(prng); - - rijndael_ecb_encrypt(prng->fortuna.IV, prng->fortuna.K+16, &prng->fortuna.skey); + + rijndael_ecb_encrypt(prng->fortuna.IV, prng->fortuna.K+16, &prng->fortuna.skey); fortuna_update_iv(prng); - + if (rijndael_setup(prng->fortuna.K, 32, 0, &prng->fortuna.skey) != CRYPT_OK) { LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); return 0; @@ -277,13 +277,13 @@ unsigned long fortuna_read(unsigned char *out, unsigned long outlen, prng_state #endif LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); return tlen; -} +} /** Terminate the PRNG @param prng The PRNG to terminate @return CRYPT_OK if successful -*/ +*/ int fortuna_done(prng_state *prng) { int err, x; @@ -296,7 +296,7 @@ int fortuna_done(prng_state *prng) for (x = 0; x < LTC_FORTUNA_POOLS; x++) { if ((err = sha256_done(&(prng->fortuna.pool[x]), tmp)) != CRYPT_OK) { LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); - return err; + return err; } } /* call cipher done when we invent one ;-) */ @@ -315,7 +315,7 @@ int fortuna_done(prng_state *prng) @param outlen [in/out] Max size and resulting size of the state @param prng The PRNG to export @return CRYPT_OK if successful -*/ +*/ int fortuna_export(unsigned char *out, unsigned long *outlen, prng_state *prng) { int x, err; @@ -340,9 +340,9 @@ int fortuna_export(unsigned char *out, unsigned long *outlen, prng_state *prng) return CRYPT_MEM; } - /* to emit the state we copy each pool, terminate it then hash it again so - * an attacker who sees the state can't determine the current state of the PRNG - */ + /* to emit the state we copy each pool, terminate it then hash it again so + * an attacker who sees the state can't determine the current state of the PRNG + */ for (x = 0; x < LTC_FORTUNA_POOLS; x++) { /* copy the PRNG */ XMEMCPY(md, &(prng->fortuna.pool[x]), sizeof(*md)); @@ -374,14 +374,14 @@ LBL_ERR: LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); return err; } - + /** Import a PRNG state @param in The PRNG state @param inlen Size of the state @param prng The PRNG to import @return CRYPT_OK if successful -*/ +*/ int fortuna_import(const unsigned char *in, unsigned long inlen, prng_state *prng) { int err, x; @@ -407,7 +407,7 @@ int fortuna_import(const unsigned char *in, unsigned long inlen, prng_state *prn /** PRNG self-test @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled -*/ +*/ int fortuna_test(void) { #ifndef LTC_TEST diff --git a/src/prngs/rc4.c b/src/prngs/rc4.c index 15c74e3..2583451 100644 --- a/src/prngs/rc4.c +++ b/src/prngs/rc4.c @@ -13,11 +13,11 @@ /** @file rc4.c LTC_RC4 PRNG, Tom St Denis -*/ +*/ #ifdef LTC_RC4 -const struct ltc_prng_descriptor rc4_desc = +const struct ltc_prng_descriptor rc4_desc = { "rc4", 32, &rc4_start, @@ -34,14 +34,14 @@ const struct ltc_prng_descriptor rc4_desc = Start the PRNG @param prng [out] The PRNG state to initialize @return CRYPT_OK if successful -*/ +*/ int rc4_start(prng_state *prng) { LTC_ARGCHK(prng != NULL); /* set keysize to zero */ prng->rc4.x = 0; - + return CRYPT_OK; } @@ -51,12 +51,12 @@ int rc4_start(prng_state *prng) @param inlen Length of the data to add @param prng PRNG state to update @return CRYPT_OK if successful -*/ +*/ int rc4_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) { LTC_ARGCHK(in != NULL); LTC_ARGCHK(prng != NULL); - + /* trim as required */ if (prng->rc4.x + inlen > 256) { if (prng->rc4.x == 256) { @@ -65,7 +65,7 @@ int rc4_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *pr } else { /* only accept part of it */ inlen = 256 - prng->rc4.x; - } + } } while (inlen--) { @@ -73,14 +73,14 @@ int rc4_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *pr } return CRYPT_OK; - + } /** Make the PRNG ready to read from @param prng The PRNG to make active @return CRYPT_OK if successful -*/ +*/ int rc4_ready(prng_state *prng) { unsigned char key[256], tmp, *s; @@ -101,7 +101,7 @@ int rc4_ready(prng_state *prng) for (j = x = y = 0; x < 256; x++) { y = (y + prng->rc4.buf[x] + key[j++]) & 255; if (j == keylen) { - j = 0; + j = 0; } tmp = s[x]; s[x] = s[y]; s[y] = tmp; } @@ -121,7 +121,7 @@ int rc4_ready(prng_state *prng) @param outlen Length of output @param prng The active PRNG to read from @return Number of octets read -*/ +*/ unsigned long rc4_read(unsigned char *out, unsigned long outlen, prng_state *prng) { unsigned char x, y, *s, tmp; @@ -154,7 +154,7 @@ unsigned long rc4_read(unsigned char *out, unsigned long outlen, prng_state *prn Terminate the PRNG @param prng The PRNG to terminate @return CRYPT_OK if successful -*/ +*/ int rc4_done(prng_state *prng) { LTC_ARGCHK(prng != NULL); @@ -167,7 +167,7 @@ int rc4_done(prng_state *prng) @param outlen [in/out] Max size and resulting size of the state @param prng The PRNG to export @return CRYPT_OK if successful -*/ +*/ int rc4_export(unsigned char *out, unsigned long *outlen, prng_state *prng) { LTC_ARGCHK(outlen != NULL); @@ -186,14 +186,14 @@ int rc4_export(unsigned char *out, unsigned long *outlen, prng_state *prng) return CRYPT_OK; } - + /** Import a PRNG state @param in The PRNG state @param inlen Size of the state @param prng The PRNG to import @return CRYPT_OK if successful -*/ +*/ int rc4_import(const unsigned char *in, unsigned long inlen, prng_state *prng) { int err; @@ -203,7 +203,7 @@ int rc4_import(const unsigned char *in, unsigned long inlen, prng_state *prng) if (inlen != 32) { return CRYPT_INVALID_ARG; } - + if ((err = rc4_start(prng)) != CRYPT_OK) { return err; } @@ -213,7 +213,7 @@ int rc4_import(const unsigned char *in, unsigned long inlen, prng_state *prng) /** PRNG self-test @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled -*/ +*/ int rc4_test(void) { #if !defined(LTC_TEST) || defined(LTC_VALGRIND) @@ -250,7 +250,7 @@ int rc4_test(void) if (XMEMCMP(dst, tests[x].ct, 8)) { #if 0 int y; - printf("\n\nLTC_RC4 failed, I got:\n"); + printf("\n\nLTC_RC4 failed, I got:\n"); for (y = 0; y < 8; y++) printf("%02x ", dst[y]); printf("\n"); #endif