diff --git a/CMakeLists.txt b/CMakeLists.txt index e1ccf1389..0d5ff94de 100644 --- a/CMakeLists.txt +++ b/CMakeLists.txt @@ -604,26 +604,37 @@ set (wsjt_FSRCS lib/fsk4hf/encode204.f90 lib/fsk4hf/decode174_74.f90 lib/fsk4hf/decode240_101.f90 + lib/fsk4hf/decode280_101.f90 lib/fsk4hf/ldpcsim174_91.f90 lib/fsk4hf/ldpcsim174_74.f90 lib/fsk4hf/ldpcsim240_101.f90 + lib/fsk4hf/ldpcsim280_101.f90 lib/fsk4hf/get_crc24.f90 lib/fsk4hf/encode174_74.f90 lib/fsk4hf/encode240_101.f90 + lib/fsk4hf/encode280_101.f90 lib/fsk4hf/bpdecode174_74.f90 lib/fsk4hf/bpdecode240_101.f90 + lib/fsk4hf/bpdecode280_101.f90 lib/fsk4hf/osd174_74.f90 lib/fsk4hf/osd240_101.f90 + lib/fsk4hf/osd280_101.f90 lib/fsk4hf/wspr4sim.f90 lib/fsk4hf/genwspr4.f90 lib/fsk4hf/gen_wspr4wave.f90 lib/fsk4hf/wspr4d.f90 lib/fsk4hf/get_wspr4_bitmetrics.f90 + lib/fsk4hf/get_ft280_bitmetrics.f90 lib/fsk4hf/ft4slowsim.f90 + lib/fsk4hf/ft280sim.f90 lib/fsk4hf/genft4slow.f90 + lib/fsk4hf/genft280.f90 lib/fsk4hf/decode240_101.f90 + lib/fsk4hf/decode280_101.f90 lib/fsk4hf/ft4sd.f90 + lib/fsk4hf/ft280d.f90 lib/fsk4hf/get_ft4s_bitmetrics.f90 + lib/fsk4hf/get_ft280_bitmetrics.f90 ) # temporary workaround for a gfortran v7.3 ICE on Fedora 27 64-bit @@ -1373,6 +1384,9 @@ target_link_libraries (ldpcsim174_74 wsjt_fort wsjt_cxx) add_executable (ldpcsim240_101 lib/fsk4hf/ldpcsim240_101.f90 wsjtx.rc) target_link_libraries (ldpcsim240_101 wsjt_fort wsjt_cxx) +add_executable (ldpcsim280_101 lib/fsk4hf/ldpcsim280_101.f90 wsjtx.rc) +target_link_libraries (ldpcsim280_101 wsjt_fort wsjt_cxx) + add_executable (wspr4sim lib/fsk4hf/wspr4sim.f90 wsjtx.rc) target_link_libraries (wspr4sim wsjt_fort wsjt_cxx) @@ -1382,9 +1396,15 @@ target_link_libraries (wspr4d wsjt_fort wsjt_cxx) add_executable (ft4slowsim lib/fsk4hf/ft4slowsim.f90 wsjtx.rc) target_link_libraries (ft4slowsim wsjt_fort wsjt_cxx) +add_executable (ft280sim lib/fsk4hf/ft280sim.f90 wsjtx.rc) +target_link_libraries (ft280sim wsjt_fort wsjt_cxx) + add_executable (ft4sd lib/fsk4hf/ft4sd.f90 wsjtx.rc) target_link_libraries (ft4sd wsjt_fort wsjt_cxx) +add_executable (ft280d lib/fsk4hf/ft280d.f90 wsjtx.rc) +target_link_libraries (ft280d wsjt_fort wsjt_cxx) + endif(WSJT_BUILD_UTILS) # build the main application diff --git a/lib/fsk4hf/bpdecode280_101.f90 b/lib/fsk4hf/bpdecode280_101.f90 new file mode 100644 index 000000000..a817a3d5c --- /dev/null +++ b/lib/fsk4hf/bpdecode280_101.f90 @@ -0,0 +1,111 @@ +subroutine bpdecode280_101(llr,apmask,maxiterations,message101,cw,nharderror,iter,ncheck) +! +! A log-domain belief propagation decoder for the (280,101) code. +! + integer, parameter:: N=280, K=101, M=N-K + integer*1 cw(N),apmask(N) + integer*1 decoded(K) + integer*1 message101(101) + integer nrw(M),ncw + integer Nm(6,M) + integer Mn(3,N) ! 3 checks per bit + integer synd(M) + real tov(3,N) + real toc(6,M) + real tanhtoc(6,M) + real zn(N) + real llr(N) + real Tmn + + include "ldpc_280_101_parity.f90" + + decoded=0 + toc=0 + tov=0 + tanhtoc=0 +! initialize messages to checks + do j=1,M + do i=1,nrw(j) + toc(i,j)=llr((Nm(i,j))) + enddo + enddo + + ncnt=0 + nclast=0 + do iter=0,maxiterations +! Update bit log likelihood ratios (tov=0 in iteration 0). + do i=1,N + if( apmask(i) .ne. 1 ) then + zn(i)=llr(i)+sum(tov(1:ncw,i)) + else + zn(i)=llr(i) + endif + enddo + +! Check to see if we have a codeword (check before we do any iteration). + cw=0 + where( zn .gt. 0. ) cw=1 + ncheck=0 + do i=1,M + synd(i)=sum(cw(Nm(1:nrw(i),i))) + if( mod(synd(i),2) .ne. 0 ) ncheck=ncheck+1 +! if( mod(synd(i),2) .ne. 0 ) write(*,*) 'check ',i,' unsatisfied' + enddo + if( ncheck .eq. 0 ) then ! we have a codeword - if crc is good, return it + decoded=cw(1:101) + call get_crc24(decoded,101,nbadcrc) + nharderror=count( (2*cw-1)*llr .lt. 0.0 ) + if(nbadcrc.eq.0) then + message101=decoded(1:101) + return + endif + endif + + if( iter.gt.0 ) then ! this code block implements an early stopping criterion +! if( iter.gt.10000 ) then ! this code block implements an early stopping criterion + nd=ncheck-nclast + if( nd .lt. 0 ) then ! # of unsatisfied parity checks decreased + ncnt=0 ! reset counter + else + ncnt=ncnt+1 + endif +! write(*,*) iter,ncheck,nd,ncnt + if( ncnt .ge. 5 .and. iter .ge. 10 .and. ncheck .gt. 15) then + nharderror=-1 + return + endif + endif + nclast=ncheck + +! Send messages from bits to check nodes + do j=1,M + do i=1,nrw(j) + ibj=Nm(i,j) + toc(i,j)=zn(ibj) + do kk=1,ncw ! subtract off what the bit had received from the check + if( Mn(kk,ibj) .eq. j ) then + toc(i,j)=toc(i,j)-tov(kk,ibj) + endif + enddo + enddo + enddo + +! send messages from check nodes to variable nodes + do i=1,M + tanhtoc(1:6,i)=tanh(-toc(1:6,i)/2) + enddo + + do j=1,N + do i=1,ncw + ichk=Mn(i,j) ! Mn(:,j) are the checks that include bit j + Tmn=product(tanhtoc(1:nrw(ichk),ichk),mask=Nm(1:nrw(ichk),ichk).ne.j) + call platanh(-Tmn,y) +! y=atanh(-Tmn) + tov(i,j)=2*y + enddo + enddo + + enddo + nharderror=-1 + return +end subroutine bpdecode280_101 diff --git a/lib/fsk4hf/decode280_101.f90 b/lib/fsk4hf/decode280_101.f90 new file mode 100644 index 000000000..31bde307d --- /dev/null +++ b/lib/fsk4hf/decode280_101.f90 @@ -0,0 +1,133 @@ +subroutine decode280_101(llr,Keff,ndeep,apmask,maxsuper,message101,cw,nharderror,iter,ncheck,dmin,isuper) +! +! A hybrid bp/osd decoder for the (280,101) code. +! + integer, parameter:: N=280, K=101, M=N-K + integer*1 cw(N),apmask(N) + integer*1 decoded(K) + integer*1 nxor(N),hdec(N) + integer*1 message101(101) + integer nrw(M),ncw + integer Nm(6,M) + integer Mn(3,N) ! 3 checks per bit + integer synd(M) + real tov(3,N) + real toc(6,M) + real tanhtoc(6,M) + real zn(N),zsum(N) + real llr(N) + real Tmn + + include "ldpc_280_101_parity.f90" + + decoded=0 + toc=0 + tov=0 + tanhtoc=0 +! initialize messages to checks + do j=1,M + do i=1,nrw(j) + toc(i,j)=llr((Nm(i,j))) + enddo + enddo + + ncnt=0 + nclast=0 + + maxiterations=1 + + zsum=0.0 + do isuper=1,maxsuper + + do iter=0,maxiterations +! Update bit log likelihood ratios (tov=0 in iteration 0). + do i=1,N + if( apmask(i) .ne. 1 ) then + zn(i)=llr(i)+sum(tov(1:ncw,i)) + else + zn(i)=llr(i) + endif + enddo + zsum=zsum+zn +! Check to see if we have a codeword (check before we do any iteration). + cw=0 + where( zn .gt. 0. ) cw=1 + ncheck=0 + do i=1,M + synd(i)=sum(cw(Nm(1:nrw(i),i))) + if( mod(synd(i),2) .ne. 0 ) ncheck=ncheck+1 +! if( mod(synd(i),2) .ne. 0 ) write(*,*) 'check ',i,' unsatisfied' + enddo +! write(*,*) 'number of unsatisfied parity checks ',ncheck + if( ncheck .eq. 0 ) then ! we have a codeword - if crc is good, return it + decoded=cw(1:K) + call get_crc24(decoded,74,nbadcrc) + nharderror=count( (2*cw-1)*llr .lt. 0.0 ) + if(nbadcrc.eq.0) then + message101=decoded(1:101) + dmin=0.0 + return + endif + endif + +! if( iter.gt.0 ) then ! this code block implements an early stopping criterion + if( iter.gt.10000 ) then ! this code block implements an early stopping criterion + nd=ncheck-nclast + if( nd .lt. 0 ) then ! # of unsatisfied parity checks decreased + ncnt=0 ! reset counter + else + ncnt=ncnt+1 + endif +! write(*,*) iter,ncheck,nd,ncnt + if( ncnt .ge. 5 .and. iter .ge. 10 .and. ncheck .gt. 15) then + nharderror=-1 + + return + endif + endif + nclast=ncheck + +! Send messages from bits to check nodes + do j=1,M + do i=1,nrw(j) + ibj=Nm(i,j) + toc(i,j)=zn(ibj) + do kk=1,ncw ! subtract off what the bit had received from the check + if( Mn(kk,ibj) .eq. j ) then + toc(i,j)=toc(i,j)-tov(kk,ibj) + endif + enddo + enddo + enddo + +! send messages from check nodes to variable nodes + do i=1,M + tanhtoc(1:6,i)=tanh(-toc(1:6,i)/2) + enddo + + do j=1,N + do i=1,ncw + ichk=Mn(i,j) ! Mn(:,j) are the checks that include bit j + Tmn=product(tanhtoc(1:nrw(ichk),ichk),mask=Nm(1:nrw(ichk),ichk).ne.j) + call platanh(-Tmn,y) +! y=atanh(-Tmn) + tov(i,j)=2*y + enddo + enddo + + enddo ! bp iterations + + call osd280_101(zsum,Keff,apmask,ndeep,message101,cw,nharderror,dminosd) + if(nharderror.gt.0) then + hdec=0 + where(llr .ge. 0) hdec=1 + nxor=ieor(hdec,cw) + dmin=sum(nxor*abs(llr)) + return + endif + enddo ! super iterations + + nharderror=-1 + + return +end subroutine decode280_101 diff --git a/lib/fsk4hf/encode280_101.f90 b/lib/fsk4hf/encode280_101.f90 new file mode 100644 index 000000000..704816355 --- /dev/null +++ b/lib/fsk4hf/encode280_101.f90 @@ -0,0 +1,46 @@ +subroutine encode280_101(message,codeword) + use, intrinsic :: iso_c_binding + use iso_c_binding, only: c_loc,c_size_t + use crc + + integer, parameter:: N=280, K=101, M=N-K + character*24 c24 + integer*1 codeword(N) + integer*1 gen(M,K) + integer*1 message(K) + integer*1 pchecks(M) + integer*4 ncrc24 + include "ldpc_280_101_generator.f90" + logical first + data first/.true./ + save first,gen + + if( first ) then ! fill the generator matrix + gen=0 + do i=1,M + do j=1,26 + read(g(i)(j:j),"(Z1)") istr + ibmax=4 + if(j.eq.26) ibmax=1 + do jj=1, ibmax + icol=(j-1)*4+jj + if( btest(istr,4-jj) ) gen(i,icol)=1 + enddo + enddo + enddo + first=.false. + endif + + do i=1,M + nsum=0 + do j=1,K + nsum=nsum+message(j)*gen(i,j) + enddo + pchecks(i)=mod(nsum,2) + enddo + + codeword(1:K)=message + codeword(K+1:N)=pchecks + + return +end subroutine encode280_101 diff --git a/lib/fsk4hf/ft280d.f90 b/lib/fsk4hf/ft280d.f90 new file mode 100644 index 000000000..b03f22fae --- /dev/null +++ b/lib/fsk4hf/ft280d.f90 @@ -0,0 +1,427 @@ +program ft280d + +! Decode ft280 data read from *.c2 or *.wav files. + + use packjt77 + include 'ft4s280_params.f90' + parameter (NSPS2=NSPS/NDOWN) + character arg*8,cbits*50,infile*80,fname*16,datetime*11 + character ch1*1,ch4*4,cseq*31 + character*22 decodes(100) + character*37 msg + character*120 data_dir + character*77 c77 + complex c2(0:NMAX/NDOWN-1) !Complex waveform + complex cframe(0:164*NSPS2-1) !Complex waveform + complex cd(0:164*20-1) !Complex waveform + real*8 fMHz + real llr(280),llra(280),llrb(280),llrc(280),llrd(280) + real candidates(100,2) + real bitmetrics(328,4) + integer ihdr(11) + integer*2 iwave(NMAX) !Generated full-length waveform + integer*1 apmask(280),cw(280) + integer*1 hbits(328) + integer*1 message101(101) + logical badsync,unpk77_success + + fs=12000.0/NDOWN !Sample rate + dt=1.0/fs !Sample interval (s) + tt=NSPS*dt !Duration of "itone" symbols (s) + txt=NZ*dt !Transmission length (s) + hmod=1.0 + Keff=91 + + nargs=iargc() + if(nargs.lt.1) then + print*,'Usage: ft280d [-a ] [-f fMHz] [-h hmod] [-k Keff] file1 [file2 ...]' + go to 999 + endif + iarg=1 + data_dir="." + call getarg(iarg,arg) + if(arg(1:2).eq.'-a') then + call getarg(iarg+1,data_dir) + iarg=iarg+2 + call getarg(iarg,arg) + endif + if(arg(1:2).eq.'-f') then + call getarg(iarg+1,arg) + read(arg,*) fMHz + iarg=iarg+2 + call getarg(iarg,arg) + endif + if(arg(1:2).eq.'-h') then + call getarg(iarg+1,arg) + read(arg,*) hmod + iarg=iarg+2 + call getarg(iarg,arg) + endif + if(arg(1:2).eq.'-k') then + call getarg(iarg+1,arg) + read(arg,*) Keff + iarg=iarg+2 + call getarg(iarg,arg) + endif + if(arg(1:2).eq.'-d') then + call getarg(iarg+1,arg) + read(arg,*) ndeep + iarg=iarg+2 + endif + + ngood=0 + ngoodsync=0 + do ifile=iarg,nargs + call getarg(ifile,infile) + open(10,file=infile,status='old',access='stream') + j1=index(infile,'.c2') + j2=index(infile,'.wav') + if(j1.gt.0) then + read(10,end=999) fname,ntrmin,fMHz,c2 + read(fname(8:11),*) nutc + write(datetime,'(i11)') nutc + else if(j2.gt.0) then + read(10,end=999) ihdr,iwave + read(infile(j2-4:j2-1),*) nutc + datetime=infile(j2-11:j2-1) + call ft280_downsample(iwave,c2) + else + print*,'Wrong file format?' + go to 999 + endif + close(10) + + fa=-100.0 + fb=100.0 + fs=12000.0/32.0 + npts=120*12000.0/32.0 + + call getcandidate_ft280(c2,npts,hmod,fs,fa,fb,ncand,candidates) !First approx for freq + + del=1.5*hmod*fs/300.0 + ndecodes=0 + do icand=1,ncand +! do icand=1,1 + fc0=candidates(icand,1) + xsnr=candidates(icand,2) +!write(*,*) 'candidates ',icand,fc0,xsnr + do isync=0,1 + + if(isync.eq.0) then + fc1=fc0-del + is0=375 + ishw=350 + isst=30 + ifhw=10 + df=.1 + else if(isync.eq.1) then + fc1=fc2 + is0=isbest + ishw=100 + isst=10 + ifhw=10 + df=.02 + endif + smax=0.0 + do if=-ifhw,ifhw + fc=fc1+df*if + do istart=max(1,is0-ishw),is0+ishw,isst + call coherent_sync_ft280(c2,istart,hmod,fc,1,sync) + if(sync.gt.smax) then + fc2=fc + isbest=istart + smax=sync + endif + enddo + enddo +! write(*,*) ifile,icand,isync,fc1+del,fc2+del,isbest,smax + enddo + +if(abs((isbest-429)/429.0) .lt. 0.07 .and. abs(fc2+del).lt.0.2) ngoodsync=ngoodsync+1 +!cycle +! if(smax .lt. 100.0 ) cycle +!isbest=429 +!fc2=-del + do ijitter=0,2 + if(ijitter.eq.0) ioffset=0 + if(ijitter.eq.1) ioffset=45 + if(ijitter.eq.2) ioffset=-45 + is0=isbest+ioffset + if(is0.lt.0) cycle + cframe=c2(is0:is0+164*300-1) + call downsample_ft280(cframe,fc2+del,hmod,cd) + s2=sum(cd*conjg(cd))/(20*144) + cd=cd/sqrt(s2) + call get_ft280_bitmetrics(cd,hmod,bitmetrics,badsync) + + hbits=0 + where(bitmetrics(:,1).ge.0) hbits=1 + ns1=count(hbits( 1: 8).eq.(/0,0,0,1,1,0,1,1/)) + ns2=count(hbits( 9: 16).eq.(/0,1,0,0,1,1,1,0/)) + ns3=count(hbits(157:164).eq.(/0,0,0,1,1,0,1,1/)) + ns4=count(hbits(165:172).eq.(/0,1,0,0,1,1,1,0/)) + ns5=count(hbits(313:320).eq.(/0,0,0,1,1,0,1,1/)) + ns6=count(hbits(321:328).eq.(/0,1,0,0,1,1,1,0/)) + nsync_qual=ns1+ns2+ns3+ns4+ns5+ns6 +! if(nsync_qual.lt. 20) cycle + + scalefac=2.83 + llra( 1:140)=bitmetrics( 17:156, 1) + llra(141:280)=bitmetrics(173:312, 1) + llra=scalefac*llra + llrb( 1:140)=bitmetrics( 17:156, 2) + llrb(141:280)=bitmetrics(173:312, 2) + llrb=scalefac*llrb + llrc( 1:140)=bitmetrics( 17:156, 3) + llrc(141:280)=bitmetrics(173:312, 3) + llrc=scalefac*llrc + llrd( 1:140)=bitmetrics( 17:156, 4) + llrd(141:280)=bitmetrics(173:312, 4) + llrd=scalefac*llrd + apmask=0 + max_iterations=40 + + do itry=4,1,-1 + if(itry.eq.1) llr=llra + if(itry.eq.2) llr=llrb + if(itry.eq.3) llr=llrc + if(itry.eq.4) llr=llrd + nhardbp=0 + nhardosd=0 + dmin=0.0 + call bpdecode280_101(llr,apmask,max_iterations,message101,cw,nhardbp,niterations,nchecks) +! if(nhardbp.lt.0) call osd280_101(llr,Keff,apmask,5,message101,cw,nhardosd,dmin) + maxsuperits=2 + if(nhardbp.lt.0) then +! call osd280_101(llr,Keff,apmask,ndeep,message101,cw,nhardosd,dmin) + call decode280_101(llr,Keff,ndeep,apmask,maxsuperits,message101,cw,nhardosd,iter,ncheck,dmin,isuper) + endif + if(nhardbp.ge.0 .or. nhardosd.ge.0) then + write(c77,'(77i1)') message101(1:77) + call unpack77(c77,0,msg,unpk77_success) + if(unpk77_success .and. index(msg,'K9AN').gt.0) then + ngood=ngood+1 + write(*,1100) ifile-2,icand,xsnr,isbest/375.0-1.0,1500.0+fc2+del,msg(1:20),itry,nhardbp,nhardosd,dmin,ijitter +1100 format(i5,2x,i5,2x,f6.1,2x,f6.2,2x,f8.2,2x,a20,i4,i4,i4,f7.2,i6) + goto 2002 + else + cycle + endif + endif + enddo ! metrics + enddo ! istart jitter + enddo !candidate list +2002 continue + enddo !files + nfiles=nargs-iarg+1 + write(*,*) 'nfiles: ',nfiles,' ngood: ',ngood,' ngoodsync: ',ngoodsync + write(*,1120) +1120 format("") + +999 end program ft280d + +subroutine coherent_sync_ft280(cd0,i0,hmod,f0,itwk,sync) + +! Compute sync power for a complex, downsampled FT4s signal. + + include 'ft4s280_params.f90' + parameter(NP=NMAX/NDOWN,NSS=NSPS/NDOWN) + complex cd0(0:NP-1) + complex csynca(8*NSS) + complex csync2(8*NSS) + complex ctwk(8*NSS) + complex z1,z2,z3,z4,z5,z6 + logical first + integer icos4(0:7) + data icos4/0,1,3,2,1,0,2,3/ + data first/.true./ + save first,twopi,csynca,fac + + p(z1)=(real(z1*fac)**2 + aimag(z1*fac)**2)**0.5 !Statement function for power + + if( first ) then + twopi=8.0*atan(1.0) + k=1 + phia=0.0 + do i=0,7 + dphia=twopi*hmod*icos4(i)/real(NSS) + do j=1,NSS + csynca(k)=cmplx(cos(phia),sin(phia)) + phia=mod(phia+dphia,twopi) + k=k+1 + enddo + enddo + first=.false. + fac=1.0/(8.0*NSS) + endif + + i1=i0 !four Costas arrays + i2=i0+78*NSS + i3=i0+156*NSS + + z1=0. + z2=0. + z3=0. + + if(itwk.eq.1) then + dt=1/(12000.0/32.0) + dphi=twopi*f0*dt + phi=0.0 + do i=1,8*NSS + ctwk(i)=cmplx(cos(phi),sin(phi)) + phi=mod(phi+dphi,twopi) + enddo + endif + + if(itwk.eq.1) csync2=ctwk*csynca !Tweak the frequency + if(i1.ge.0 .and. i1+8*NSS-1.le.NP-1) then + z1=sum(cd0(i1:i1+8*NSS-1)*conjg(csync2)) +! z1=abs(sum(cd0(i1:i1+4*NSS-1)*conjg(csync2(1:4*NSS))))**2 +! z1=z1+abs(sum(cd0(i1+4*NSS:i1+8*NSS-1)*conjg(csync2(4*NSS+1:8*NSS))))**2 + elseif( i1.lt.0 ) then + npts=(i1+8*NSS-1)/2 + if(npts.le.40) then + z1=0. + else + z1=sum(cd0(0:i1+8*NSS-1)*conjg(csync2(8*NSS-npts:))) + endif + endif + + if(i2.ge.0 .and. i2+8*NSS-1.le.NP-1) then + z2=sum(cd0(i2:i2+8*NSS-1)*conjg(csync2)) +! z2=abs(sum(cd0(i2:i2+4*NSS-1)*conjg(csync2(1:4*NSS))))**2 +! z2=z2+abs(sum(cd0(i2+4*NSS:i2+8*NSS-1)*conjg(csync2(4*NSS+1:8*NSS))))**2 + endif + + if(i3.ge.0 .and. i3+8*NSS-1.le.NP-1) then + z3=sum(cd0(i3:i3+8*NSS-1)*conjg(csync2)) +! z3=abs(sum(cd0(i3:i3+4*NSS-1)*conjg(csync2(1:4*NSS))))**2 +! z3=z3+abs(sum(cd0(i3+4*NSS:i3+8*NSS-1)*conjg(csync2(4*NSS+1:8*NSS))))**2 + elseif( i3+8*NSS-1.gt.NP-1 ) then + npts=(NP-1-i3+1) + if(npts.le.40) then + z3=0. + else + z3=sum(cd0(i3:i3+npts-1)*conjg(csync2(1:npts))) + endif + endif + + sync = p(z1) + p(z2) + p(z3) +!sync=z1+z2+z3 + return +end subroutine coherent_sync_ft280 + +subroutine downsample_ft280(ci,f0,hmod,co) + parameter(NI=164*300,NH=NI/2,NO=NI/15) ! downsample from 315 samples per symbol to 20 + complex ci(0:NI-1),ct(0:NI-1) + complex co(0:NO-1) + fs=12000.0/28.0 + df=fs/NI + ct=ci + call four2a(ct,NI,1,-1,1) !c2c FFT to freq domain + i0=nint(f0/df) + ct=cshift(ct,i0) + co=0.0 + co(0)=ct(0) +! b=16.0*hmod + b=10.0*hmod + icutoff=nint(24.0/df) + do i=1,NO/2 +! arg=(i*df/b)**2 +! filt=exp(-arg) + filt=0 + if(i.le.icutoff) filt=1 + co(i)=ct(i)*filt + co(NO-i)=ct(NI-i)*filt + enddo + co=co/NO + call four2a(co,NO,1,1,1) !c2c FFT back to time domain + return +end subroutine downsample_ft280 + +subroutine getcandidate_ft280(c,npts,hmod,fs,fa,fb,ncand,candidates) + parameter(NFFT1=120*12000/28,NH1=NFFT1/2,NFFT2=120*12000/300,NH2=NFFT2/2) + complex c(0:npts-1) !Complex waveform + complex cc(0:NFFT1-1) + complex csfil(0:NFFT2-1) + complex cwork(0:NFFT2-1) + real bigspec(0:NFFT2-1) + complex c2(0:NFFT1-1) !Short spectra + real s(-NH1+1:NH1) !Coarse spectrum + real ss(-NH1+1:NH1) !Smoothed coarse spectrum + real candidates(100,2) + integer indx(NFFT2-1) + logical first + data first/.true./ + save first,w,df,csfil + + if(first) then + df=10*fs/NFFT1 + csfil=cmplx(0.0,0.0) + do i=0,NFFT2-1 +! csfil(i)=exp(-((i-NH2)/32.0)**2) ! revisit this + csfil(i)=exp(-((i-NH2)/(hmod*28.0))**2) ! revisit this + enddo + csfil=cshift(csfil,NH2) + call four2a(csfil,NFFT2,1,-1,1) + first=.false. + endif + + cc=cmplx(0.0,0.0) + cc(0:npts-1)=c; + call four2a(cc,NFFT1,1,-1,1) + cc=abs(cc)**2 + call four2a(cc,NFFT1,1,-1,1) + cwork(0:NH2)=cc(0:NH2)*conjg(csfil(0:NH2)) + cwork(NH2+1:NFFT2-1)=cc(NFFT1-NH2+1:NFFT1-1)*conjg(csfil(NH2+1:NFFT2-1)) + + call four2a(cwork,NFFT2,1,+1,1) + bigspec=cshift(real(cwork),-NH2) + il=NH2+fa/df + ih=NH2+fb/df + nnl=ih-il+1 + call indexx(bigspec(il:il+nnl-1),nnl,indx) + xn=bigspec(il-1+indx(nint(0.3*nnl))) + bigspec=bigspec/xn + ncand=0 + do i=il,ih + if((bigspec(i).gt.bigspec(i-1)).and. & + (bigspec(i).gt.bigspec(i+1)).and. & + (bigspec(i).gt.1.15).and.ncand.lt.100) then + ncand=ncand+1 + candidates(ncand,1)=df*(i-NH2) + candidates(ncand,2)=10*log10(bigspec(i)-1)-26.5 + endif + enddo + return +end subroutine getcandidate_ft280 + +subroutine ft280_downsample(iwave,c) + +! Input: i*2 data in iwave() at sample rate 12000 Hz +! Output: Complex data in c(), sampled at 375 Hz + + include 'ft4s280_params.f90' + parameter (NFFT2=NMAX/28) + integer*2 iwave(NMAX) + complex c(0:NMAX/28-1) + complex c1(0:NFFT2-1) + complex cx(0:NMAX/2) + real x(NMAX) + equivalence (x,cx) + + df=12000.0/NMAX + x=iwave + call four2a(x,NMAX,1,-1,0) !r2c FFT to freq domain + i0=nint(1500.0/df) + c1(0)=cx(i0) + do i=1,NFFT2/2 + c1(i)=cx(i0+i) + c1(NFFT2-i)=cx(i0-i) + enddo + c1=c1/NFFT2 + call four2a(c1,NFFT2,1,1,1) !c2c FFT back to time domain + c=c1(0:NMAX/28-1) + return +end subroutine ft280_downsample + diff --git a/lib/fsk4hf/ft280sim.f90 b/lib/fsk4hf/ft280sim.f90 new file mode 100644 index 000000000..96a7251d0 --- /dev/null +++ b/lib/fsk4hf/ft280sim.f90 @@ -0,0 +1,113 @@ +program ft280sim + +! Generate simulated signals for experimental slow FT4 mode + + use wavhdr + use packjt77 + include 'ft4s280_params.f90' !Set various constants + type(hdr) h !Header for .wav file + character arg*12,fname*17 + character msg37*37,msgsent37*37 + character c77*77 + complex c0(0:NMAX-1) + complex c(0:NMAX-1) + real wave(NMAX) + integer itone(NN) + integer*1 msgbits(101) + integer*2 iwave(NMAX) !Generated full-length waveform + +! Get command-line argument(s) + nargs=iargc() + if(nargs.ne.8) then + print*,'Usage: ft280sim "message" f0 DT h fdop del nfiles snr' + print*,'Examples: ft280sim "K1JT K9AN EN50" 1500 0.0 1.0 0.1 1.0 10 -15' + go to 999 + endif + call getarg(1,msg37) !Message to be transmitted + call getarg(2,arg) + read(arg,*) f0 !Frequency (only used for single-signal) + call getarg(3,arg) + read(arg,*) xdt !Time offset from nominal (s) + call getarg(4,arg) + read(arg,*) hmod !Modulation index, h + call getarg(5,arg) + read(arg,*) fspread !Watterson frequency spread (Hz) + call getarg(6,arg) + read(arg,*) delay !Watterson delay (ms) + call getarg(7,arg) + read(arg,*) nfiles !Number of files + call getarg(8,arg) + read(arg,*) snrdb !SNR_2500 + + nfiles=abs(nfiles) + twopi=8.0*atan(1.0) + fs=12000.0 !Sample rate (Hz) + dt=1.0/fs !Sample interval (s) + tt=NSPS*dt !Duration of symbols (s) + baud=1.0/tt !Keying rate (baud) + txt=NZ2*dt !Transmission length (s) + + bandwidth_ratio=2500.0/(fs/2.0) + sig=sqrt(2*bandwidth_ratio) * 10.0**(0.05*snrdb) + if(snrdb.gt.90.0) sig=1.0 + + call genft280(msg37,0,msgsent37,msgbits,itone) + write(*,*) + write(*,'(a9,a37,3x,a7,i1,a1,i1)') 'Message: ',msgsent37,'i3.n3: ',i3,'.',n3 + write(*,1000) f0,xdt,hmod,txt,snrdb +1000 format('f0:',f9.3,' DT:',f6.2,' hmod:',f6.3,' TxT:',f6.1,' SNR:',f6.1) + write(*,*) + if(i3.eq.1) then + write(*,*) ' mycall hiscall hisgrid' + write(*,'(28i1,1x,i1,1x,28i1,1x,i1,1x,i1,1x,15i1,1x,3i1)') msgbits(1:77) + else + write(*,'(a14)') 'Message bits: ' + write(*,'(50i1,1x,24i1)') msgbits + endif + write(*,*) + write(*,'(a17)') 'Channel symbols: ' + write(*,'(10i1)') itone + write(*,*) + + call sgran() + + fsample=12000.0 + icmplx=1 + call gen_wspr4wave(itone,NN,NSPS,fsample,hmod,f0,c0,wave,icmplx,NMAX) + k=nint((xdt+1.0)/dt)-NSPS + c0=cshift(c0,-k) + if(k.gt.0) c0(0:k-1)=0.0 + if(k.lt.0) c0(NMAX+k:NMAX-1)=0.0 + + do ifile=1,nfiles + c=c0 + if(fspread.ne.0.0 .or. delay.ne.0.0) call watterson(c,NMAX,NZ,fs,delay,fspread) + c=sig*c + wave=real(c) + if(snrdb.lt.90) then + do i=1,NMAX !Add gaussian noise at specified SNR + xnoise=gran() + wave(i)=wave(i) + xnoise + enddo + endif + gain=100.0 + if(snrdb.lt.90.0) then + wave=gain*wave + else + datpk=maxval(abs(wave)) + fac=32766.9/datpk + wave=fac*wave + endif + if(any(abs(wave).gt.32767.0)) print*,"Warning - data will be clipped." + iwave=nint(wave) + h=default_header(12000,NMAX) + write(fname,1102) ifile +1102 format('000000_',i6.6,'.wav') + open(10,file=fname,status='unknown',access='stream') + write(10) h,iwave !Save to *.wav file + close(10) + write(*,1110) ifile,xdt,f0,snrdb,fname +1110 format(i4,f7.2,f8.2,f7.1,2x,a17) + enddo + +999 end program ft280sim diff --git a/lib/fsk4hf/ft4s280_params.f90 b/lib/fsk4hf/ft4s280_params.f90 new file mode 100644 index 000000000..29483e48a --- /dev/null +++ b/lib/fsk4hf/ft4s280_params.f90 @@ -0,0 +1,16 @@ +! FT4S280 +! LDPC(280,101)/CRC24 code, six 4x4 Costas arrays for sync, ramp-up and ramp-down symbols + +parameter (KK=77) !Information bits (77 + CRC24) +parameter (ND=140) !Data symbols +parameter (NS=24) !Sync symbols +parameter (NN=NS+ND) !Sync and data symbols (164) +parameter (NN2=NS+ND+2) !Total channel symbols (166) +parameter (NSPS=8400) !Samples per symbol at 12000 S/s +parameter (NZ=NSPS*NN) !Sync and Data samples (1,377,600) +parameter (NZ2=NSPS*NN2) !Total samples in shaped waveform (1,394,400) +parameter (NMAX=408*3456) !Samples in iwave (1,410,048) +parameter (NFFT1=4*NSPS, NH1=NFFT1/2) !Length of FFTs for symbol spectra +parameter (NSTEP=NSPS) !Coarse time-sync step size +parameter (NHSYM=(NMAX-NFFT1)/NSTEP) !Number of symbol spectra (1/4-sym steps) +parameter (NDOWN=28) !Downsample factor diff --git a/lib/fsk4hf/ft4sd.f90 b/lib/fsk4hf/ft4sd.f90 index 17f664d11..b74f397d6 100644 --- a/lib/fsk4hf/ft4sd.f90 +++ b/lib/fsk4hf/ft4sd.f90 @@ -30,10 +30,11 @@ program ft4sd tt=NSPS*dt !Duration of "itone" symbols (s) txt=NZ*dt !Transmission length (s) hmod=1.0 + Keff=91 nargs=iargc() if(nargs.lt.1) then - print*,'Usage: ft4sd [-a ] [-f fMHz] file1 [file2 ...]' + print*,'Usage: ft4sd [-a ] [-f fMHz] [-h hmod] [-k Keff] file1 [file2 ...]' go to 999 endif iarg=1 @@ -42,17 +43,24 @@ program ft4sd if(arg(1:2).eq.'-a') then call getarg(iarg+1,data_dir) iarg=iarg+2 + call getarg(iarg,arg) endif - call getarg(iarg,arg) if(arg(1:2).eq.'-f') then call getarg(iarg+1,arg) read(arg,*) fMHz iarg=iarg+2 + call getarg(iarg,arg) endif if(arg(1:2).eq.'-h') then call getarg(iarg+1,arg) read(arg,*) hmod iarg=iarg+2 + call getarg(iarg,arg) + endif + if(arg(1:2).eq.'-k') then + call getarg(iarg+1,arg) + read(arg,*) Keff + iarg=iarg+2 endif ngood=0 @@ -86,7 +94,6 @@ program ft4sd del=1.5*hmod*fs/300.0 ndecodes=0 do icand=1,ncand -! do icand=1,1 fc0=candidates(icand,1) xsnr=candidates(icand,2) !write(*,*) 'candidates ',icand,fc0,xsnr @@ -124,7 +131,7 @@ program ft4sd ! if(smax .lt. 100.0 ) cycle !isbest=375 -!fc2=0 +!fc2=-del do ijitter=0,2 if(ijitter.eq.0) ioffset=0 if(ijitter.eq.1) ioffset=45 @@ -185,10 +192,10 @@ program ft4sd nhardosd=0 dmin=0.0 call bpdecode240_101(llr,apmask,max_iterations,message101,cw,nhardbp,niterations,nchecks) - Keff=91 ! if(nhardbp.lt.0) call osd240_101(llr,Keff,apmask,5,message101,cw,nhardosd,dmin) maxsuperits=2 ndeep=3 ! use ndeep=3 with Keff=91 + if(Keff.eq.77) ndeep=4 if(nhardbp.lt.0) then ! call osd240_101(llr,Keff,apmask,ndeep,message101,cw,nhardosd,dmin) call decode240_101(llr,Keff,ndeep,apmask,maxsuperits,message101,cw,nhardosd,iter,ncheck,dmin,isuper) diff --git a/lib/fsk4hf/genft280.f90 b/lib/fsk4hf/genft280.f90 new file mode 100644 index 000000000..bc8de4b18 --- /dev/null +++ b/lib/fsk4hf/genft280.f90 @@ -0,0 +1,95 @@ +subroutine genft280(msg0,ichk,msgsent,msgbits,i4tone) + +! Encode an FT4 message +! Input: +! - msg0 requested message to be transmitted +! - ichk if ichk=1, return only msgsent +! - msgsent message as it will be decoded +! - i4tone array of audio tone values, {0,1,2,3} + +! Frame structure: +! s4s4 d70 s4s4 d70 s4s4 + +! Message duration: TxT = 144*9600/12000 = 115.2 s + + use packjt77 + include 'ft4s280_params.f90' + character*37 msg0 + character*37 message !Message to be generated + character*37 msgsent !Message as it will be received + character*77 c77 + character*24 c24 + integer*4 i4tone(NN),itmp(ND) + integer*1 codeword(2*ND) + integer*1 msgbits(101),rvec(77) + integer icos4a(4),icos4b(4),icos4c(4),icos4d(4),icos4e(4),icos4f(4) + integer ncrc24 + logical unpk77_success + data icos4a/0,1,3,2/ + data icos4b/1,0,2,3/ + data icos4c/2,3,1,0/ + data icos4d/3,2,0,1/ + data icos4e/0,2,3,1/ + data icos4f/1,2,0,3/ + data rvec/0,1,0,0,1,0,1,0,0,1,0,1,1,1,1,0,1,0,0,0,1,0,0,1,1,0,1,1,0, & + 1,0,0,1,0,1,1,0,0,0,0,1,0,0,0,1,0,1,0,0,1,1,1,1,0,0,1,0,1, & + 0,1,0,1,0,1,1,0,1,1,1,1,1,0,0,0,1,0,1/ + message=msg0 + + do i=1, 37 + if(ichar(message(i:i)).eq.0) then + message(i:37)=' ' + exit + endif + enddo + do i=1,37 !Strip leading blanks + if(message(1:1).ne.' ') exit + message=message(i+1:) + enddo + + i3=-1 + n3=-1 + call pack77(message,i3,n3,c77) + call unpack77(c77,0,msgsent,unpk77_success) !Unpack to get msgsent + msgbits=0 + read(c77,'(77i1)') msgbits(1:77) + call get_crc24(msgbits,101,ncrc24) + write(c24,'(b24.24)') ncrc24 + read(c24,'(24i1)') msgbits(78:101) + + if(ichk.eq.1) go to 999 + if(unpk77_success) go to 2 +1 msgbits=0 + itone=0 + msgsent='*** bad message *** ' + go to 999 + +entry get_ft4s280_tones_from_101bits(msgbits,i4tone) + +2 call encode280_101(msgbits,codeword) + +! Grayscale mapping: +! bits tone +! 00 0 +! 01 1 +! 11 2 +! 10 3 + + do i=1,ND + is=codeword(2*i)+2*codeword(2*i-1) + if(is.le.1) itmp(i)=is + if(is.eq.2) itmp(i)=3 + if(is.eq.3) itmp(i)=2 + enddo + + i4tone(1:4)=icos4a + i4tone(5:8)=icos4b + i4tone(9:78)=itmp(1:70) + i4tone(79:82)=icos4a + i4tone(83:86)=icos4b + i4tone(87:156)=itmp(71:140) + i4tone(157:160)=icos4a + i4tone(161:164)=icos4b + +999 return +end subroutine genft280 diff --git a/lib/fsk4hf/get_ft280_bitmetrics.f90 b/lib/fsk4hf/get_ft280_bitmetrics.f90 new file mode 100644 index 000000000..761577aa7 --- /dev/null +++ b/lib/fsk4hf/get_ft280_bitmetrics.f90 @@ -0,0 +1,117 @@ +subroutine get_ft280_bitmetrics(cd,hmod,bitmetrics,badsync) + + include 'ft4s280_params.f90' + parameter (NSS=20) + complex cd(0:NN*NSS-1) + complex cs(0:3,NN) + complex csymb(NSS) + complex c1(NSS,0:3) ! ideal waveforms, 20 samples per symbol, 4 tones + complex ccor(0:3,NN) ! correlations with each ideal waveform, for each symbol + complex cp(0:3) ! accumulated phase shift over symbol types 0:3 + complex csum,cterm + integer icos8(0:7) + integer graymap(0:3) + integer ip(1) + logical one(0:65535,0:15) ! 65536 8-symbol sequences, 16 bits + logical first + logical badsync + real bitmetrics(2*NN,4) + real s2(0:65535) + real s4(0:3,NN) + data icos8/0,1,3,2,1,0,2,3/ + data graymap/0,1,3,2/ + data first/.true./ + save first,one,c1,cp + + if(first) then + one=.false. + do i=0,65535 + do j=0,15 + if(iand(i,2**j).ne.0) one(i,j)=.true. + enddo + enddo + twopi=8.0*atan(1.0) + dphi=twopi*hmod/NSS + do itone=0,3 + dp=(itone-1.5)*dphi + phi=0.0 + do j=1,NSS + c1(j,itone)=cmplx(cos(phi),sin(phi)) + phi=mod(phi+dp,twopi) + enddo + cp(itone)=cmplx(cos(phi),sin(phi)) + enddo + first=.false. + endif + + do k=1,NN + i1=(k-1)*NSS + csymb=cd(i1:i1+NSS-1) + do itone=0,3 + cs(itone,k)=sum(csymb*conjg(c1(:,itone))) + enddo + s4(0:3,k)=abs(cs(0:3,k)) + enddo + +! Sync quality check + is1=0 + is2=0 + is3=0 + badsync=.false. + ibmax=0 + + do k=1,8 + ip=maxloc(s4(:,k)) + if(icos8(k-1).eq.(ip(1)-1)) is1=is1+1 + ip=maxloc(s4(:,k+78)) + if(icos8(k-1).eq.(ip(1)-1)) is2=is2+1 + ip=maxloc(s4(:,k+156)) + if(icos8(k-1).eq.(ip(1)-1)) is3=is3+1 + enddo + nsync=is1+is2+is3 !Number of correct hard sync symbols, 0-24 + + badsync=.false. +! if(nsync .lt. 8) then +! badsync=.true. +! return +! endif + + do nseq=4,1,-1 !Try coherent sequences of 1, 2, and 4 symbols + if(nseq.eq.1) nsym=1 + if(nseq.eq.2) nsym=2 + if(nseq.eq.3) nsym=4 + if(nseq.eq.4) nsym=8 + nt=4**nsym + do ks=1,NN-nsym+1,nsym + s2=0 + do i=0,nt-1 + csum=0 + cterm=1 + do j=0,nsym-1 + ntone=mod(i/4**(nsym-1-j),4) + csum=csum+cs(graymap(ntone),ks+j)*cterm + cterm=cterm*conjg(cp(graymap(ntone))) + enddo + s2(i)=abs(csum) + enddo + ipt=1+(ks-1)*2 + if(nsym.eq.1) ibmax=1 + if(nsym.eq.2) ibmax=3 + if(nsym.eq.4) ibmax=7 + if(nsym.eq.8) ibmax=15 + do ib=0,ibmax + bm=maxval(s2(0:nt-1),one(0:nt-1,ibmax-ib)) - & + maxval(s2(0:nt-1),.not.one(0:nt-1,ibmax-ib)) + if(ipt+ib.gt.2*NN) cycle + bitmetrics(ipt+ib,nseq)=bm + enddo + enddo + enddo + + call normalizebmet(bitmetrics(:,1),2*NN) + call normalizebmet(bitmetrics(:,2),2*NN) + call normalizebmet(bitmetrics(:,3),2*NN) + call normalizebmet(bitmetrics(:,4),2*NN) + return + +end subroutine get_ft280_bitmetrics diff --git a/lib/fsk4hf/ldpc_280_101_generator.f90 b/lib/fsk4hf/ldpc_280_101_generator.f90 new file mode 100644 index 000000000..521e80026 --- /dev/null +++ b/lib/fsk4hf/ldpc_280_101_generator.f90 @@ -0,0 +1,182 @@ +character*26 g(179) + +data g/ & + "c919bcbfe4091279702a761e98", & + "51b952dddd36200cf73cc1ed30", & + "15871d32e8e888439180cf6fd8", & + "581f858f6c89ee5ccb91664358", & + "3515e85cedf905eda366a8fc20", & + "e9fcaa6aaa9bab21bc91174e80", & + "0ac73221d424e8747628b13968", & + "4999f7116446f1a7a7a1453a30", & + "0e92773bff2a6d4f09caa48898", & + "7dfaec97c17679f6c3b6a425f0", & + "00707d76a2a7d90297ee39f660", & + "8048cc93fc4ad84ccfc021e6e0", & + "0c13df64062fed419c9bf43400", & + "5523d84459c826b7bc3335d508", & + "828ee2552144d041ed44ada8e0", & + "3f1b89fbd93f674df4813f0898", & + "4e13df64062fed419c9bf43400", & + "5d8645307d3d442991d6efafd0", & + "e5cd9b98d73aab17ce04c4df10", & + "06d26e11e2d02e9cb4f191c2b0", & + "5630cebc5b3a09f7d4fe58fab0", & + "bbfa9591589229738ecbc19288", & + "c98654d1f1f16d507e9bb77cf0", & + "c2af2107bb2bdff49d909dc730", & + "51da7da0c9b1bd18a15f580068", & + "5bdfd83e7ca3097146a5359428", & + "34fc4d397d97ca3ceb272f49a0", & + "6716a6d027ade94010e9aa90b0", & + "62ac7bb089d1a13f6e89f92348", & + "737c3ab63210e195e92e8ad478", & + "db2da5b8a21d22a7122ad80e60", & + "1226525dba4221d4768a495878", & + "a99deb4c9b7d316917b1ece958", & + "8123fb46556f22a0b57bdc7eb0", & + "cc6a80e87a7a9bf8addb17a6a8", & + "3d42bb6ca1c8d30e6cee77aa10", & + "ad15a0c2f36d4409a458cc83c0", & + "766a04039736bd8be23513ae58", & + "257a3da77558d7c707170c30c8", & + "8e54a55fd9f00eb669ab787678", & + "4ef1a73cc9da8670d83bebc588", & + "be8bb82558d44fea1ab27376a0", & + "ea9db4f88c60edf410cb0128d8", & + "a84e19a5261818262ee7247278", & + "51f99e4ea17cf84038d4e00bd0", & + "610560db4095fc44d2465308a0", & + "7688745b59c3d6baa6950c4f50", & + "4b8794914d365b6802bd62a9c8", & + "f62c211d05ed28802b9d278298", & + "b9cd45b2ffa8c0dd688f8d2bc0", & + "68555e81f4227a48e76878bc98", & + "7ab58f11d41a2d38b80d2a7558", & + "aba2d33e69077b6acad393af68", & + "81e5f58fa3ab563e73706201a8", & + "7586aea816750c41671eaa7db8", & + "af37b0a97ba5334a3dd01948e8", & + "4fdc03c263a0c42dcc265f7dc8", & + "b23f2d7f28748944cdfffd5af0", & + "5c1e6f37dfba8feacaafdb0f78", & + "3a85b051f4f1c930d921f60828", & + "72319352bd8022ce2cae2e7858", & + "78b79f633ac6879e3ac3a005a0", & + "9f0c470609669953b23328de60", & + "86d3745d50142c82a066ab9490", & + "743e7bf411490f36a9799e37e8", & + "9b8378677870933ef360d7e418", & + "5f7adbf515b663a1434b0d47d8", & + "13249a96b14c6cdcfae5009eb0", & + "da9570e0a52125d0dc4dec4430", & + "ada13ce2dbcb57e2f5b31172f0", & + "84f5485886d4157e9d37efb4d0", & + "23f58c3200bab4ae5dee54edd0", & + "d4377aadf8acb19d4369613ac8", & + "17cefcf65c87885fb6c4d537a0", & + "59d70b8536488298930aaea7f8", & + "49e8dbb08c2ecdaa84bb6a5378", & + "e1694479ecc1f87e503f959e50", & + "dbb3fc94f0f70d4bd4dcf302d8", & + "4ccb3a56f80c236424683b1588", & + "f4f123c72596a00397d56fcdf8", & + "13f9cf266a6957b87cd2b576f0", & + "0904d341bc0878460cd8361ac0", & + "69fd534caf2cccf9c90659a038", & + "757d3d95089a5bc20a7b77c618", & + "30df1d7b8124415c73190b08d8", & + "d39319584987dce0c44176d5d8", & + "1a81df299eb7434a5b6b9322a0", & + "fe4acfab1c22c7bea222f1a6b0", & + "2f2fde37fa8f87a318f7bcda10", & + "fae712210c23665aa7a3f10620", & + "977b8407c7fd22d7715077ee78", & + "2ab2b355b3477df0b738c49d48", & + "93a2468cfd11a522b310069d88", & + "0e5ae6e789ded3c0d436359318", & + "9ece0b13a3c06d560a15d3c448", & + "838e8bbf5e671503ea72ba3118", & + "7c827de9a87d740763c69c6778", & + "1fe395e4e2e6d1373602243488", & + "f2c4efee3d0ce2e22749be9e20", & + "46405cca0e40f36ab83de4a998", & + "8b6e931355a79630ef2dbdbdb8", & + "10df1d3b8124415c72190b08d8", & + "cdff258b07a4f7cfe5c2210ba8", & + "1515e85cedf904eda366a8fc20", & + "a38276f2d077abc1da5e177868", & + "67a7b5ab66f21f391d306c3330", & + "29492cc630f9bad1fdedf0c990", & + "490a6dd38170eab178f7cebf78", & + "ca9db4e88c60edf410cf0128d8", & + "e3f1c23fa8531fb1e4c7768d88", & + "39d7d8fbbb689b2a9bedfd4dd0", & + "d1b952dd5d36200cf734c1ed30", & + "0820a5ccb970d1ab109d84d700", & + "58bc3c509fcd7874e9b1533ba8", & + "08ed7724ac66b7974499b12f40", & + "4738529b2fd04afd89184b64b8", & + "7155b496e3b9f687135b4c55b8", & + "b5d1d3cf38b1765dd730d8b960", & + "296de2c373773a869b9cf804c8", & + "1cdf18b99bcc47ae72bf59df68", & + "ad0888db89dd794be0b2660e98", & + "1f2a8db9db19cd4d69a735d930", & + "44b720007480382206fdbfbb18", & + "c63817aad3801fb993ea9032c0", & + "d44707db5a0b489fd48748cca8", & + "49f98a67c6e128a5300f7ccc50", & + "04849fa9da91d4514355406388", & + "dfad3a11788cf6f6517f987de8", & + "47078a19e38a0763cabd7c8d70", & + "aafa7f864f0da5bc78f8e57ba8", & + "8acb5a34e18e111023b3e7b1f8", & + "5acc41263d6aa1767e5e6acdc8", & + "27623a9f6c1174e35394191820", & + "1f2bde9c006b3b687964b1c5e0", & + "b01c6e357bce202244b4a88d08", & + "61c85d74d7e97576507c9b0e88", & + "bcad5a44d75ae40bc43559d268", & + "10584eaf319552194418563de0", & + "b29b011d717d10a22de0983980", & + "2f9b42d7d2299449491c612b20", & + "389ba33f5fec3bfb3a0ef86b50", & + "3df89f78c19fb27ae7ff19d360", & + "65ff6ba4e107aa919a6afb4ff0", & + "39b607c3f09679a62e134cd390", & + "94ad06f7b7414727d92f998930", & + "169200459898ae0bc7f06714a0", & + "c7a5a945adebb554cb4d86a830", & + "f37c3ab63230e195e92e8ad478", & + "559a51262e91aa9ba0fa96af48", & + "fb2998ca916a557463d00fb160", & + "aa32462ada57a76ae132fc8de8", & + "e6df6b19f58bfee0b96b731b90", & + "e984335d40a54fe914a6249110", & + "ea73d8f3f14bd9fe2374e39120", & + "3adab8e51c36f53584e3669c88", & + "74ef69f64dc4fef86c3b1fe640", & + "d01c6bc112d7ae3e4ba4820a78", & + "62923979fd3c3d1153bcaaf338", & + "038f72995b5072df8fe5f4dfa0", & + "9f07e7cea2f1476fb035978790", & + "2a5aad6a75d5c86cab38fd0070", & + "a254a09cc3180854688d2aa9c8", & + "0495639712a04820f7038ae7c0", & + "d99fc716ca825ad45cca8f4518", & + "01b8d558073c0377ce67344a50", & + "2fbd0f86a17c3f93713fbd09a0", & + "c29dc84bec7b4cd00dd1c17380", & + "5e6238b823f530ae017a03f0e0", & + "51203d329c68b061977d78d4c0", & + "1186729e08cf1dfbec30237968", & + "40363018b431224a1f559d2908", & + "e334e78442b614a0c9a377e1b8", & + "ff2eda86339f589f96382f52e0", & + "58a30e07fc7a37a4f858623778", & + "f5067fe407a4c3b94ce7b63e48", & + "1d09ced788a3642bc0ec640ec8", & + "17734ca67d53cd9d8595970668", & + "47953c2105bd94bff079672740", & + "3444682d1dc0ab486036c1b0d0"/ diff --git a/lib/fsk4hf/ldpc_280_101_parity.f90 b/lib/fsk4hf/ldpc_280_101_parity.f90 new file mode 100644 index 000000000..b1cabb7d1 --- /dev/null +++ b/lib/fsk4hf/ldpc_280_101_parity.f90 @@ -0,0 +1,476 @@ +data Mn/ & + 150, 151, 161, & + 6, 164, 172, & + 92, 128, 158, & + 2, 63, 135, & + 3, 14, 22, & + 4, 18, 29, & + 5, 17, 164, & + 7, 99, 179, & + 8, 88, 115, & + 9, 62, 110, & + 10, 107, 154, & + 11, 50, 140, & + 12, 28, 33, & + 13, 31, 170, & + 15, 69, 175, & + 16, 77, 178, & + 19, 70, 91, & + 20, 95, 177, & + 21, 96, 106, & + 23, 129, 168, & + 24, 49, 169, & + 25, 65, 102, & + 26, 82, 171, & + 27, 45, 137, & + 30, 89, 119, & + 32, 148, 158, & + 34, 94, 152, & + 35, 44, 92, & + 36, 39, 138, & + 37, 55, 58, & + 38, 121, 165, & + 40, 81, 162, & + 41, 139, 150, & + 42, 43, 83, & + 46, 80, 114, & + 47, 52, 54, & + 48, 166, 173, & + 38, 53, 87, & + 56, 64, 126, & + 57, 67, 127, & + 59, 156, 159, & + 60, 97, 133, & + 61, 118, 161, & + 66, 100, 123, & + 68, 124, 131, & + 71, 101, 155, & + 72, 74, 144, & + 73, 112, 141, & + 75, 136, 149, & + 59, 78, 117, & + 79, 130, 163, & + 84, 93, 113, & + 86, 108, 163, & + 103, 146, 157, & + 70, 104, 145, & + 105, 128, 142, & + 74, 109, 122, & + 54, 111, 153, & + 116, 154, 176, & + 120, 132, 167, & + 21, 125, 147, & + 134, 143, 166, & + 7, 81, 160, & + 32, 99, 174, & + 1, 93, 104, & + 2, 69, 98, & + 3, 33, 152, & + 4, 46, 159, & + 5, 126, 178, & + 6, 127, 147, & + 8, 101, 110, & + 9, 73, 158, & + 10, 120, 123, & + 11, 122, 125, & + 12, 58, 170, & + 13, 88, 105, & + 14, 133, 150, & + 15, 92, 100, & + 16, 90, 108, & + 17, 44, 106, & + 18, 35, 175, & + 19, 94, 179, & + 20, 97, 153, & + 22, 109, 130, & + 23, 63, 140, & + 24, 37, 146, & + 25, 141, 168, & + 26, 95, 115, & + 27, 107, 149, & + 28, 91, 168, & + 29, 134, 144, & + 30, 31, 169, & + 34, 40, 96, & + 36, 156, 172, & + 39, 61, 135, & + 41, 42, 121, & + 43, 57, 117, & + 45, 62, 72, & + 47, 137, 167, & + 48, 83, 116, & + 49, 65, 173, & + 1, 50, 141, & + 2, 8, 150, & + 3, 62, 140, & + 4, 104, 124, & + 5, 128, 139, & + 6, 64, 159, & + 7, 103, 176, & + 2, 11, 104, & + 9, 71, 85, & + 10, 80, 131, & + 11, 17, 130, & + 12, 148, 156, & + 13, 39, 164, & + 14, 15, 167, & + 14, 32, 89, & + 16, 114, 135, & + 8, 164, 169, & + 18, 107, 129, & + 19, 53, 102, & + 20, 134, 170, & + 21, 43, 145, & + 22, 24, 76, & + 23, 44, 146, & + 19, 22, 101, & + 25, 41, 48, & + 26, 46, 58, & + 27, 82, 87, & + 28, 78, 179, & + 29, 73, 81, & + 30, 116, 161, & + 31, 96, 157, & + 15, 58, 172, & + 10, 33, 160, & + 34, 110, 118, & + 33, 35, 113, & + 36, 166, 175, & + 32, 37, 152, & + 38, 57, 74, & + 13, 82, 176, & + 40, 42, 45, & + 25, 57, 177, & + 40, 120, 136, & + 21, 92, 121, & + 23, 34, 147, & + 12, 45, 54, & + 3, 46, 48, & + 47, 91, 169, & + 26, 61, 132, & + 49, 123, 147, & + 1, 79, 88, & + 51, 97, 101, & + 52, 155, 177, & + 24, 72, 105, & + 54, 84, 106, & + 55, 63, 126, & + 56, 72, 163, & + 38, 63, 170, & + 37, 71, 178, & + 20, 49, 59, & + 30, 60, 117, & + 61, 65, 137, & + 41, 98, 119, & + 47, 51, 62, & + 6, 76, 131, & + 55, 70, 81, & + 66, 111, 119, & + 60, 67, 94, & + 68, 112, 132, & + 9, 69, 157, & + 70, 75, 89, & + 69, 108, 153, & + 44, 53, 77, & + 29, 130, 149, & + 65, 103, 125, & + 74, 85, 156, & + 56, 67, 68, & + 77, 138, 144, & + 28, 95, 138, & + 79, 133, 142, & + 35, 50, 86, & + 73, 78, 137, & + 27, 126, 175, & + 83, 100, 143, & + 42, 142, 168, & + 40, 48, 158, & + 86, 95, 174, & + 39, 109, 129, & + 59, 88, 125, & + 6, 89, 155, & + 36, 90, 102, & + 75, 97, 141, & + 43, 146, 148, & + 93, 149, 168, & + 52, 83, 94, & + 80, 87, 106, & + 91, 96, 143, & + 3, 43, 126, & + 98, 154, 162, & + 99, 115, 173, & + 5, 84, 100, & + 64, 133, 154, & + 90, 117, 158, & + 7, 108, 151, & + 4, 128, 167, & + 105, 127, 136, & + 1, 83, 114, & + 107, 127, 134, & + 4, 108, 170, & + 92, 109, 171, & + 110, 113, 122, & + 111, 124, 166, & + 12, 112, 150, & + 2, 95, 105, & + 17, 114, 118, & + 99, 139, 144, & + 116, 165, 178, & + 5, 22, 73, & + 16, 115, 162, & + 13, 34, 41, & + 120, 122, 151, & + 121, 160, 172, & + 8, 37, 102, & + 123, 140, 165, & + 7, 53, 93, & + 9, 10, 130, & + 11, 30, 58, & + 31, 66, 179, & + 14, 31, 45, & + 15, 88, 129, & + 18, 101, 148, & + 16, 62, 127, & + 17, 20, 68, & + 19, 86, 98, & + 25, 106, 163, & + 135, 152, 163, & + 23, 124, 137, & + 21, 28, 71, & + 24, 26, 153, & + 29, 90, 123, & + 32, 113, 134, & + 35, 57, 169, & + 27, 50, 139, & + 33, 60, 65, & + 38, 61, 142, & + 145, 153, 154, & + 39, 67, 81, & + 36, 84, 133, & + 18, 161, 173, & + 93, 155, 171, & + 42, 99, 131, & + 49, 87, 162, & + 51, 56, 168, & + 47, 125, 144, & + 44, 143, 159, & + 46, 75, 138, & + 52, 78, 107, & + 54, 109, 174, & + 64, 110, 179, & + 159, 165, 174, & + 66, 135, 171, & + 63, 76, 117, & + 59, 111, 120, & + 72, 160, 166, & + 70, 118, 156, & + 55, 157, 173, & + 74, 100, 176, & + 77, 112, 145, & + 69, 141, 147, & + 94, 140, 151, & + 51, 82, 104, & + 85, 98, 167, & + 80, 119, 146, & + 97, 122, 172, & + 90, 96, 132, & + 79, 91, 178, & + 103, 136, 152, & + 1, 76, 85, & + 115, 121, 149, & + 116, 175, 177/ + +data Nm/ & + 65, 102, 151, 207, 278, 0, & + 4, 66, 103, 109, 214, 0, & + 5, 67, 104, 147, 198, 0, & + 6, 68, 105, 205, 209, 0, & + 7, 69, 106, 201, 218, 0, & + 2, 70, 107, 165, 190, 0, & + 8, 63, 108, 204, 225, 0, & + 9, 71, 103, 118, 223, 0, & + 10, 72, 110, 170, 226, 0, & + 11, 73, 111, 134, 226, 0, & + 12, 74, 109, 112, 227, 0, & + 13, 75, 113, 146, 213, 0, & + 14, 76, 114, 140, 220, 0, & + 5, 77, 115, 116, 229, 0, & + 15, 78, 115, 133, 230, 0, & + 16, 79, 117, 219, 232, 0, & + 7, 80, 112, 215, 233, 0, & + 6, 81, 119, 231, 249, 0, & + 17, 82, 120, 125, 234, 0, & + 18, 83, 121, 160, 233, 0, & + 19, 61, 122, 144, 238, 0, & + 5, 84, 123, 125, 218, 0, & + 20, 85, 124, 145, 237, 0, & + 21, 86, 123, 154, 239, 0, & + 22, 87, 126, 142, 235, 0, & + 23, 88, 127, 149, 239, 0, & + 24, 89, 128, 183, 243, 0, & + 13, 90, 129, 179, 238, 0, & + 6, 91, 130, 174, 240, 0, & + 25, 92, 131, 161, 227, 0, & + 14, 92, 132, 228, 229, 0, & + 26, 64, 116, 138, 241, 0, & + 13, 67, 134, 136, 244, 0, & + 27, 93, 135, 145, 220, 0, & + 28, 81, 136, 181, 242, 0, & + 29, 94, 137, 191, 248, 0, & + 30, 86, 138, 159, 223, 0, & + 31, 38, 139, 158, 245, 0, & + 29, 95, 114, 188, 247, 0, & + 32, 93, 141, 143, 186, 0, & + 33, 96, 126, 163, 220, 0, & + 34, 96, 141, 185, 251, 0, & + 34, 97, 122, 193, 198, 0, & + 28, 80, 124, 173, 255, 0, & + 24, 98, 141, 146, 229, 0, & + 35, 68, 127, 147, 256, 0, & + 36, 99, 148, 164, 254, 0, & + 37, 100, 126, 147, 186, 0, & + 21, 101, 150, 160, 252, 0, & + 12, 102, 181, 243, 0, 0, & + 152, 164, 253, 271, 0, 0, & + 36, 153, 195, 257, 0, 0, & + 38, 120, 173, 225, 0, 0, & + 36, 58, 146, 155, 258, 0, & + 30, 156, 166, 266, 0, 0, & + 39, 157, 177, 253, 0, 0, & + 40, 97, 139, 142, 242, 0, & + 30, 75, 127, 133, 227, 0, & + 41, 50, 160, 189, 263, 0, & + 42, 161, 168, 244, 0, 0, & + 43, 95, 149, 162, 245, 0, & + 10, 98, 104, 164, 232, 0, & + 4, 85, 156, 158, 262, 0, & + 39, 107, 202, 259, 0, 0, & + 22, 101, 162, 175, 244, 0, & + 44, 167, 228, 261, 0, 0, & + 40, 168, 177, 247, 0, 0, & + 45, 169, 177, 233, 0, 0, & + 15, 66, 170, 172, 269, 0, & + 17, 55, 166, 171, 265, 0, & + 46, 110, 159, 238, 0, 0, & + 47, 98, 154, 157, 264, 0, & + 48, 72, 130, 182, 218, 0, & + 47, 57, 139, 176, 267, 0, & + 49, 171, 192, 256, 0, 0, & + 123, 165, 262, 278, 0, 0, & + 16, 173, 178, 268, 0, 0, & + 50, 129, 182, 257, 0, 0, & + 51, 151, 180, 276, 0, 0, & + 35, 111, 196, 273, 0, 0, & + 32, 63, 130, 166, 247, 0, & + 23, 128, 140, 271, 0, 0, & + 34, 100, 184, 195, 207, 0, & + 52, 155, 201, 248, 0, 0, & + 110, 176, 272, 278, 0, 0, & + 53, 181, 187, 234, 0, 0, & + 38, 128, 196, 252, 0, 0, & + 9, 76, 151, 189, 230, 0, & + 25, 116, 171, 190, 0, 0, & + 79, 191, 203, 240, 275, 0, & + 17, 90, 148, 197, 276, 0, & + 3, 28, 78, 144, 210, 0, & + 52, 65, 194, 225, 250, 0, & + 27, 82, 168, 195, 270, 0, & + 18, 88, 179, 187, 214, 0, & + 19, 93, 132, 197, 275, 0, & + 42, 83, 152, 192, 274, 0, & + 66, 163, 199, 234, 272, 0, & + 8, 64, 200, 216, 251, 0, & + 44, 78, 184, 201, 267, 0, & + 46, 71, 125, 152, 231, 0, & + 22, 120, 191, 223, 0, 0, & + 54, 108, 175, 277, 0, 0, & + 55, 65, 105, 109, 271, 0, & + 56, 76, 154, 206, 214, 0, & + 19, 80, 155, 196, 235, 0, & + 11, 89, 119, 208, 257, 0, & + 53, 79, 172, 204, 209, 0, & + 57, 84, 188, 210, 258, 0, & + 10, 71, 135, 211, 259, 0, & + 58, 167, 212, 263, 0, 0, & + 48, 169, 213, 268, 0, 0, & + 52, 136, 211, 241, 0, 0, & + 35, 117, 207, 215, 0, 0, & + 9, 88, 200, 219, 279, 0, & + 59, 100, 131, 217, 280, 0, & + 50, 97, 161, 203, 262, 0, & + 43, 135, 215, 265, 0, 0, & + 25, 163, 167, 273, 0, 0, & + 60, 73, 143, 221, 263, 0, & + 31, 96, 144, 222, 279, 0, & + 57, 74, 211, 221, 274, 0, & + 44, 73, 150, 224, 240, 0, & + 45, 105, 212, 237, 0, 0, & + 61, 74, 175, 189, 254, 0, & + 39, 69, 156, 183, 198, 0, & + 40, 70, 206, 208, 232, 0, & + 3, 56, 106, 205, 0, 0, & + 20, 119, 188, 230, 0, 0, & + 51, 84, 112, 174, 226, 0, & + 45, 111, 165, 251, 0, 0, & + 60, 149, 169, 275, 0, 0, & + 42, 77, 180, 202, 248, 0, & + 62, 91, 121, 208, 241, 0, & + 4, 95, 117, 236, 261, 0, & + 49, 143, 206, 277, 0, 0, & + 24, 99, 162, 182, 237, 0, & + 29, 178, 179, 256, 0, 0, & + 33, 106, 216, 243, 0, 0, & + 12, 85, 104, 224, 270, 0, & + 48, 87, 102, 192, 269, 0, & + 56, 180, 185, 245, 0, 0, & + 62, 184, 197, 255, 0, 0, & + 47, 91, 178, 216, 254, 0, & + 55, 122, 246, 268, 0, 0, & + 54, 86, 124, 193, 273, 0, & + 61, 70, 145, 150, 269, 0, & + 26, 113, 193, 231, 0, 0, & + 49, 89, 174, 194, 279, 0, & + 1, 33, 77, 103, 213, 0, & + 1, 204, 221, 270, 0, 0, & + 27, 67, 138, 236, 277, 0, & + 58, 83, 172, 239, 246, 0, & + 11, 59, 199, 202, 246, 0, & + 46, 153, 190, 250, 0, 0, & + 41, 94, 113, 176, 265, 0, & + 54, 132, 170, 266, 0, 0, & + 3, 26, 72, 186, 203, 0, & + 41, 68, 107, 255, 260, 0, & + 63, 134, 222, 264, 0, 0, & + 1, 43, 131, 249, 0, 0, & + 32, 199, 219, 252, 0, 0, & + 51, 53, 157, 235, 236, 0, & + 2, 7, 114, 118, 0, 0, & + 31, 217, 224, 260, 0, 0, & + 37, 62, 137, 212, 264, 0, & + 60, 99, 115, 205, 272, 0, & + 20, 87, 90, 185, 194, 253, & + 21, 92, 118, 148, 242, 0, & + 14, 75, 121, 158, 209, 0, & + 23, 210, 250, 261, 0, 0, & + 2, 94, 133, 222, 274, 0, & + 37, 101, 200, 249, 266, 0, & + 64, 187, 258, 260, 0, 0, & + 15, 81, 137, 183, 280, 0, & + 59, 108, 140, 267, 0, 0, & + 18, 142, 153, 280, 0, 0, & + 16, 69, 159, 217, 276, 0, & + 8, 82, 129, 228, 259, 0/ + +data nrw/ & +5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5, & +5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5, & +5,5,5,5,5,5,5,5,5,4,4,4,4,5,4,4,5,5,5,4, & +5,5,5,4,5,4,4,4,5,5,4,5,5,5,4,4,4,4,4,4, & +5,4,5,4,4,4,4,5,4,5,5,5,5,5,5,5,5,5,5,5, & +5,4,4,5,5,5,5,5,5,5,4,4,4,4,5,5,5,4,4,5, & +5,5,5,4,5,5,5,4,4,5,4,4,5,5,5,4,5,4,4,5, & +5,4,4,5,4,5,5,4,5,5,4,5,5,5,4,5,4,5,5,4, & +4,4,5,4,4,5,5,6,5,5,4,5,5,4,5,4,4,5,5/ + +ncw=3 + diff --git a/lib/fsk4hf/ldpcsim280_101.f90 b/lib/fsk4hf/ldpcsim280_101.f90 new file mode 100644 index 000000000..060e32c80 --- /dev/null +++ b/lib/fsk4hf/ldpcsim280_101.f90 @@ -0,0 +1,144 @@ +program ldpcsim280_101 + +! End-to-end test of the (280,101)/crc24 encoder and decoders. + + use packjt77 + + parameter(N=280, K=101, M=N-K) + character*8 arg + character*37 msg0,msg + character*77 c77 + character*24 c24 + integer*1 msgbits(101) + integer*1 apmask(280) + integer*1 cw(280) + integer*1 codeword(N),message101(101) + integer ncrc24 + real rxdata(N),llr(N) + real llrd(280) + logical first,unpk77_success + data first/.true./ + + nargs=iargc() + if(nargs.ne.5 .and. nargs.ne.6) then + print*,'Usage: ldpcsim niter ndeep #trials s K [msg]' + print*,'e.g. ldpcsim280_101 20 5 1000 0.85 91 "K9AN K1JT FN20"' + print*,'s : if negative, then value is ignored and sigma is calculated from SNR.' + print*,'niter: is the number of BP iterations.' + print*,'ndeep: -1 is BP only, ndeep>=0 is OSD order' + print*,'K :is the number of message+CRC bits and must be in the range [77,101]' + print*,'WSPR-format message is optional' + return + endif + call getarg(1,arg) + read(arg,*) max_iterations + call getarg(2,arg) + read(arg,*) ndeep + call getarg(3,arg) + read(arg,*) ntrials + call getarg(4,arg) + read(arg,*) s + call getarg(5,arg) + read(arg,*) Keff + msg0='K9AN K1JT FN20 ' + if(nargs.eq.6) call getarg(6,msg0) + call pack77(msg0,i3,n3,c77) + + rate=real(Keff)/real(N) + + write(*,*) "code rate: ",rate + write(*,*) "niter : ",max_iterations + write(*,*) "ndeep : ",ndeep + write(*,*) "s : ",s + write(*,*) "K : ",Keff + + msgbits=0 + read(c77,'(77i1)') msgbits(1:77) + write(*,*) 'message' + write(*,'(77i1)') msgbits(1:77) + + call get_crc24(msgbits,101,ncrc24) + write(c24,'(b24.24)') ncrc24 + read(c24,'(24i1)') msgbits(78:101) +write(*,'(24i1)') msgbits(78:101) + write(*,*) 'message with crc24' + write(*,'(101i1)') msgbits(1:101) + call encode280_101(msgbits,codeword) + call init_random_seed() + call sgran() + + write(*,*) 'codeword' + write(*,'(77i1,1x,24i1,1x,73i1)') codeword + + write(*,*) "Eb/N0 Es/N0 ngood nundetected sigma symbol error rate" + do idb = 8,-3,-1 + db=idb/2.0-1.0 + sigma=1/sqrt( 2*rate*(10**(db/10.0)) ) ! to make db represent Eb/No +! sigma=1/sqrt( 2*(10**(db/10.0)) ) ! db represents Es/No + ngood=0 + nue=0 + nberr=0 + do itrial=1, ntrials +! Create a realization of a noisy received word + do i=1,N + rxdata(i) = 2.0*codeword(i)-1.0 + sigma*gran() + enddo + nerr=0 + do i=1,N + if( rxdata(i)*(2*codeword(i)-1.0) .lt. 0 ) nerr=nerr+1 + enddo + nberr=nberr+nerr + + rxav=sum(rxdata)/N + rx2av=sum(rxdata*rxdata)/N + rxsig=sqrt(rx2av-rxav*rxav) + rxdata=rxdata/rxsig + if( s .lt. 0 ) then + ss=sigma + else + ss=s + endif + + llr=2.0*rxdata/(ss*ss) + apmask=0 +! max_iterations is max number of belief propagation iterations + call bpdecode280_101(llr,apmask,max_iterations,message101,cw,nharderror,niterations,nchecks) + dmin=0.0 + if( (nharderror .lt. 0) .and. (ndeep .ge. 0) ) then +! call osd280_101(llr, Keff, apmask, ndeep, message101, cw, nharderror, dmin) + maxsuper=2 + call decode280_101(llr, Keff, ndeep, apmask, maxsuper, message101, cw, nharderror, iterations, ncheck, dmin, isuper) + endif + + if(nharderror.ge.0) then + n2err=0 + do i=1,N + if( cw(i)*(2*codeword(i)-1.0) .lt. 0 ) n2err=n2err+1 + enddo + if(n2err.eq.0) then + ngood=ngood+1 + else + nue=nue+1 + endif + endif + enddo +! snr2500=db+10*log10(200.0/116.0/2500.0) + esn0=db+10*log10(rate) + pberr=real(nberr)/(real(ntrials*N)) + write(*,"(f4.1,4x,f5.1,1x,i8,1x,i8,8x,f5.2,8x,e10.3)") db,esn0,ngood,nue,ss,pberr + + if(first) then + write(c77,'(77i1)') message101(1:77) +write(*,'(101i1)') message101 + call unpack77(c77,0,msg,unpk77_success) + if(unpk77_success) then + write(*,1100) msg(1:37) +1100 format('Decoded message: ',a37) + else + print*,'Error unpacking message' + endif + first=.false. + endif + enddo + +end program ldpcsim280_101 diff --git a/lib/fsk4hf/osd280_101.f90 b/lib/fsk4hf/osd280_101.f90 new file mode 100644 index 000000000..acea3f664 --- /dev/null +++ b/lib/fsk4hf/osd280_101.f90 @@ -0,0 +1,403 @@ +subroutine osd280_101(llr,k,apmask,ndeep,message101,cw,nhardmin,dmin) +! +! An ordered-statistics decoder for the (280,101) code. +! Message payload is 77 bits. Any or all of a 24-bit CRC can be +! used for detecting incorrect codewords. The remaining CRC bits are +! cascaded with the LDPC code for the purpose of improving the +! distance spectrum of the code. +! +! If p1 (0.le.p1.le.24) is the number of CRC24 bits that are +! to be used for bad codeword detection, then the argument k should +! be set to 77+p1. +! +! Valid values for k are in the range [77,101]. +! + character*24 c24 + integer, parameter:: N=280 + integer*1 apmask(N),apmaskr(N) + integer*1, allocatable, save :: gen(:,:) + integer*1, allocatable :: genmrb(:,:),g2(:,:) + integer*1, allocatable :: temp(:),m0(:),me(:),mi(:),misub(:),e2sub(:),e2(:),ui(:) + integer*1, allocatable :: r2pat(:) + integer indices(N),nxor(N) + integer*1 cw(N),ce(N),c0(N),hdec(N) + integer*1, allocatable :: decoded(:) + integer*1 message101(101) + integer indx(N) + real llr(N),rx(N),absrx(N) + + logical first,reset + data first/.true./ + save first + + allocate( genmrb(k,N), g2(N,k) ) + allocate( temp(k), m0(k), me(k), mi(k), misub(k), e2sub(N-k), e2(N-k), ui(N-k) ) + allocate( r2pat(N-k), decoded(k) ) + + if( first ) then ! fill the generator matrix +! +! Create generator matrix for partial CRC cascaded with LDPC code. +! +! Let p2=101-k and p1+p2=24. +! +! The last p2 bits of the CRC24 are cascaded with the LDPC code. +! +! The first p1=k-77 CRC24 bits will be used for error detection. +! + allocate( gen(k,N) ) + gen=0 + do i=1,k + message101=0 + message101(i)=1 + if(i.le.77) then + call get_crc24(message101,101,ncrc24) + write(c24,'(b24.24)') ncrc24 + read(c24,'(24i1)') message101(78:101) + message101(78:k)=0 + endif + call encode280_101(message101,cw) + gen(i,:)=cw + enddo + + first=.false. + endif + + rx=llr + apmaskr=apmask + +! Hard decisions on the received word. + hdec=0 + where(rx .ge. 0) hdec=1 + +! Use magnitude of received symbols as a measure of reliability. + absrx=abs(rx) + call indexx(absrx,N,indx) + +! Re-order the columns of the generator matrix in order of decreasing reliability. + do i=1,N + genmrb(1:k,i)=gen(1:k,indx(N+1-i)) + indices(i)=indx(N+1-i) + enddo + +! Do gaussian elimination to create a generator matrix with the most reliable +! received bits in positions 1:k in order of decreasing reliability (more or less). + do id=1,k ! diagonal element indices + do icol=id,k+20 ! The 20 is ad hoc - beware + iflag=0 + if( genmrb(id,icol) .eq. 1 ) then + iflag=1 + if( icol .ne. id ) then ! reorder column + temp(1:k)=genmrb(1:k,id) + genmrb(1:k,id)=genmrb(1:k,icol) + genmrb(1:k,icol)=temp(1:k) + itmp=indices(id) + indices(id)=indices(icol) + indices(icol)=itmp + endif + do ii=1,k + if( ii .ne. id .and. genmrb(ii,id) .eq. 1 ) then + genmrb(ii,1:N)=ieor(genmrb(ii,1:N),genmrb(id,1:N)) + endif + enddo + exit + endif + enddo + enddo + + g2=transpose(genmrb) + +! The hard decisions for the k MRB bits define the order 0 message, m0. +! Encode m0 using the modified generator matrix to find the "order 0" codeword. +! Flip various combinations of bits in m0 and re-encode to generate a list of +! codewords. Return the member of the list that has the smallest Euclidean +! distance to the received word. + + hdec=hdec(indices) ! hard decisions from received symbols + m0=hdec(1:k) ! zero'th order message + absrx=absrx(indices) + rx=rx(indices) + apmaskr=apmaskr(indices) + + call mrbencode101(m0,c0,g2,N,k) + nxor=ieor(c0,hdec) + nhardmin=sum(nxor) + dmin=sum(nxor*absrx) + + cw=c0 + ntotal=0 + nrejected=0 + npre1=0 + npre2=0 + + if(ndeep.eq.0) goto 998 ! norder=0 + if(ndeep.gt.6) ndeep=6 + if( ndeep.eq. 1) then + nord=1 + npre1=0 + npre2=0 + nt=40 + ntheta=12 + elseif(ndeep.eq.2) then + nord=1 + npre1=1 + npre2=0 + nt=40 + ntheta=12 + elseif(ndeep.eq.3) then + nord=1 + npre1=1 + npre2=1 + nt=40 + ntheta=12 + ntau=14 + elseif(ndeep.eq.4) then + nord=2 + npre1=1 + npre2=1 + nt=40 + ntheta=12 + ntau=17 + elseif(ndeep.eq.5) then + nord=3 + npre1=1 + npre2=1 + nt=40 + ntheta=12 + ntau=15 + elseif(ndeep.eq.6) then + nord=4 + npre1=1 + npre2=1 + nt=95 + ntheta=12 + ntau=15 + endif + + do iorder=1,nord + misub(1:k-iorder)=0 + misub(k-iorder+1:k)=1 + iflag=k-iorder+1 + do while(iflag .ge.0) + if(iorder.eq.nord .and. npre1.eq.0) then + iend=iflag + else + iend=1 + endif + d1=0. + do n1=iflag,iend,-1 + mi=misub + mi(n1)=1 + if(any(iand(apmaskr(1:k),mi).eq.1)) cycle + ntotal=ntotal+1 + me=ieor(m0,mi) + if(n1.eq.iflag) then + call mrbencode101(me,ce,g2,N,k) + e2sub=ieor(ce(k+1:N),hdec(k+1:N)) + e2=e2sub + nd1kpt=sum(e2sub(1:nt))+1 + d1=sum(ieor(me(1:k),hdec(1:k))*absrx(1:k)) + else + e2=ieor(e2sub,g2(k+1:N,n1)) + nd1kpt=sum(e2(1:nt))+2 + endif + if(nd1kpt .le. ntheta) then + call mrbencode101(me,ce,g2,N,k) + nxor=ieor(ce,hdec) + if(n1.eq.iflag) then + dd=d1+sum(e2sub*absrx(k+1:N)) + else + dd=d1+ieor(ce(n1),hdec(n1))*absrx(n1)+sum(e2*absrx(k+1:N)) + endif + if( dd .lt. dmin ) then + dmin=dd + cw=ce + nhardmin=sum(nxor) + nd1kptbest=nd1kpt + endif + else + nrejected=nrejected+1 + endif + enddo +! Get the next test error pattern, iflag will go negative +! when the last pattern with weight iorder has been generated. + call nextpat101(misub,k,iorder,iflag) + enddo + enddo + + if(npre2.eq.1) then + reset=.true. + ntotal=0 + do i1=k,1,-1 + do i2=i1-1,1,-1 + ntotal=ntotal+1 + mi(1:ntau)=ieor(g2(k+1:k+ntau,i1),g2(k+1:k+ntau,i2)) + call boxit101(reset,mi(1:ntau),ntau,ntotal,i1,i2) + enddo + enddo + + ncount2=0 + ntotal2=0 + reset=.true. +! Now run through again and do the second pre-processing rule + misub(1:k-nord)=0 + misub(k-nord+1:k)=1 + iflag=k-nord+1 + do while(iflag .ge.0) + me=ieor(m0,misub) + call mrbencode101(me,ce,g2,N,k) + e2sub=ieor(ce(k+1:N),hdec(k+1:N)) + do i2=0,ntau + ntotal2=ntotal2+1 + ui=0 + if(i2.gt.0) ui(i2)=1 + r2pat=ieor(e2sub,ui) +778 continue + call fetchit101(reset,r2pat(1:ntau),ntau,in1,in2) + if(in1.gt.0.and.in2.gt.0) then + ncount2=ncount2+1 + mi=misub + mi(in1)=1 + mi(in2)=1 + if(sum(mi).lt.nord+npre1+npre2.or.any(iand(apmaskr(1:k),mi).eq.1)) cycle + me=ieor(m0,mi) + call mrbencode101(me,ce,g2,N,k) + nxor=ieor(ce,hdec) + dd=sum(nxor*absrx) + if( dd .lt. dmin ) then + dmin=dd + cw=ce + nhardmin=sum(nxor) + endif + goto 778 + endif + enddo + call nextpat101(misub,k,nord,iflag) + enddo + endif + +998 continue +! Re-order the codeword to [message bits][parity bits] format. + cw(indices)=cw + hdec(indices)=hdec + message101=cw(1:101) + call get_crc24(message101,101,nbadcrc) + if(nbadcrc.ne.0) nhardmin=-nhardmin + + return +end subroutine osd280_101 + +subroutine mrbencode101(me,codeword,g2,N,K) + integer*1 me(K),codeword(N),g2(N,K) +! fast encoding for low-weight test patterns + codeword=0 + do i=1,K + if( me(i) .eq. 1 ) then + codeword=ieor(codeword,g2(1:N,i)) + endif + enddo + return +end subroutine mrbencode101 + +subroutine nextpat101(mi,k,iorder,iflag) + integer*1 mi(k),ms(k) +! generate the next test error pattern + ind=-1 + do i=1,k-1 + if( mi(i).eq.0 .and. mi(i+1).eq.1) ind=i + enddo + if( ind .lt. 0 ) then ! no more patterns of this order + iflag=ind + return + endif + ms=0 + ms(1:ind-1)=mi(1:ind-1) + ms(ind)=1 + ms(ind+1)=0 + if( ind+1 .lt. k ) then + nz=iorder-sum(ms) + ms(k-nz+1:k)=1 + endif + mi=ms + do i=1,k ! iflag will point to the lowest-index 1 in mi + if(mi(i).eq.1) then + iflag=i + exit + endif + enddo + return +end subroutine nextpat101 + +subroutine boxit101(reset,e2,ntau,npindex,i1,i2) + integer*1 e2(1:ntau) + integer indexes(5000,2),fp(0:525000),np(5000) + logical reset + common/boxes/indexes,fp,np + + if(reset) then + patterns=-1 + fp=-1 + np=-1 + sc=-1 + indexes=-1 + reset=.false. + endif + + indexes(npindex,1)=i1 + indexes(npindex,2)=i2 + ipat=0 + do i=1,ntau + if(e2(i).eq.1) then + ipat=ipat+ishft(1,ntau-i) + endif + enddo + + ip=fp(ipat) ! see what's currently stored in fp(ipat) + if(ip.eq.-1) then + fp(ipat)=npindex + else + do while (np(ip).ne.-1) + ip=np(ip) + enddo + np(ip)=npindex + endif + return +end subroutine boxit101 + +subroutine fetchit101(reset,e2,ntau,i1,i2) + integer indexes(5000,2),fp(0:525000),np(5000) + integer lastpat + integer*1 e2(ntau) + logical reset + common/boxes/indexes,fp,np + save lastpat,inext + + if(reset) then + lastpat=-1 + reset=.false. + endif + + ipat=0 + do i=1,ntau + if(e2(i).eq.1) then + ipat=ipat+ishft(1,ntau-i) + endif + enddo + index=fp(ipat) + + if(lastpat.ne.ipat .and. index.gt.0) then ! return first set of indices + i1=indexes(index,1) + i2=indexes(index,2) + inext=np(index) + elseif(lastpat.eq.ipat .and. inext.gt.0) then + i1=indexes(inext,1) + i2=indexes(inext,2) + inext=np(inext) + else + i1=-1 + i2=-1 + inext=-1 + endif + lastpat=ipat + return +end subroutine fetchit101 +